{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5e6509d8-73d2-436b-8016-712b5824f2f8",
          "code": "169283-81-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=169283-81-2",
          "code_system": "CAS",
          "references": [
            "62a51dfc-6ef3-4b27-811a-163a1091e4b5",
            "61eff1d0-566a-4dff-9060-8a1eb4c8cded"
          ]
        },
        {
          "uuid": "3293291a-ac82-2e62-43f2-83583e013a21",
          "code": "10220386",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10220386",
          "code_system": "PUBCHEM",
          "references": [
            "d8bd083e-0005-f3f2-3423-7a20334cfb15"
          ]
        },
        {
          "uuid": "2c885995-d3f3-4294-a112-acb7e54f6654",
          "code": "C9XLI5CE7N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "669518ed-9027-98d6-8875-ce777e8ec2d6",
          "code": "DTXSID401021766",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID401021766",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d13dd3cb-6f21-47b4-9356-655dba9ea26b",
          "name": "GLUTAMYLAMIDOETHYL IMIDAZOLE",
          "stdName": "GLUTAMYLAMIDOETHYL IMIDAZOLE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c50471e-67f4-4c3c-b35c-70ad1453a318",
            "b38f5882-ea0b-4c50-8dcb-f94545032d5b",
            "6e91d3e7-b979-425c-992d-6e0bae3e044e"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3c123d56-dcdb-4e1f-8e20-340a8492f68d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "69d6198f-99c0-4c0c-b04c-f04ffe02c7e1",
          "name": "IMUDILIN",
          "stdName": "IMUDILIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c50471e-67f4-4c3c-b35c-70ad1453a318",
            "b38f5882-ea0b-4c50-8dcb-f94545032d5b"
          ],
          "display_name": false
        },
        {
          "uuid": "9b1c4ec8-be63-468f-bc2a-ded23be7d83f",
          "name": "PENTANOIC ACID, 4-AMINO-5-((2-(1H-IMIDAZOL-4-YL)ETHYL)AMINO)-5-OXO-, (4S)-",
          "stdName": "PENTANOIC ACID, 4-AMINO-5-((2-(1H-IMIDAZOL-4-YL)ETHYL)AMINO)-5-OXO-, (4S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "05fe3a7a-b6b5-4b23-8436-5b47b6385065",
            "9c50471e-67f4-4c3c-b35c-70ad1453a318"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b38f5882-ea0b-4c50-8dcb-f94545032d5b",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9c50471e-67f4-4c3c-b35c-70ad1453a318",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05fe3a7a-b6b5-4b23-8436-5b47b6385065",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "62a51dfc-6ef3-4b27-811a-163a1091e4b5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393060000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "40378ccd-6edb-4ebb-a88d-8ceab8f375ea",
          "citation": "SRS import [C9XLI5CE7N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=C9XLI5CE7N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393060000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6e91d3e7-b979-425c-992d-6e0bae3e044e",
          "citation": "GLUTAMYLAMIDOETHYL IMIDAZOLE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d8bd083e-0005-f3f2-3423-7a20334cfb15",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "61eff1d0-566a-4dff-9060-8a1eb4c8cded",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "969b944a-45d6-48b0-93d8-445a403f102b",
          "id": "969b944a-45d6-48b0-93d8-445a403f102b",
          "molfile": "\n  Marvin  01132107492D          \n\n 17 17  0  0  1  0            999 V2000\n   14.2871  -10.4407    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   14.2871   -9.6157    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0015  -10.8532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7161  -10.4407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4305  -10.8532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4305  -11.6783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1450  -10.4407    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5725  -10.8532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5725  -11.6783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8580  -10.4407    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1435  -10.8532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4290  -10.4407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7145  -10.8532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6282  -11.6737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8213  -11.8453    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4088  -11.1307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9608  -10.5176    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  8  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  8  9  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 17  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\nM  END",
          "smiles": "C(CC(=O)O)[C@@H](C(=O)NCCc1c[nH]cn1)N",
          "formula": "C10H16N4O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4f3da57a-1b90-4422-a85e-6082808ddc0d"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "240.2594",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4574d2c2-bebe-4b34-ac8a-318417ca768f",
      "version": "7",
      "structure": {
        "id": "f703c8bd-890a-41d7-9bbc-7f75168bdd84",
        "molfile": "\n  Marvin  01132112482D          \n\n 17 17  0  0  1  0            999 V2000\n   11.4290  -10.4407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7145  -10.8532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9608  -10.5176    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4088  -11.1307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8213  -11.8453    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6282  -11.6737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1435  -10.8532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8580  -10.4407    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5725  -10.8532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5725  -11.6783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2871  -10.4407    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.2871   -9.6157    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0015  -10.8532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7161  -10.4407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4305  -10.8532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4305  -11.6783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1450  -10.4407    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  2  6  2  0  0  0  0\n  1  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  1  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\nM  END",
        "smiles": "C(CC(=O)O)[C@@H](C(=O)NCCc1c[nH]cn1)N",
        "formula": "C10H16N4O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "240.2594",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "05fe3a7a-b6b5-4b23-8436-5b47b6385065",
          "40378ccd-6edb-4ebb-a88d-8ceab8f375ea"
        ],
        "stereo_centers": 1
      },
      "unii": "C9XLI5CE7N"
    }
  ]
}