{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7046b03d-f681-4812-ac21-c8bbec83b6ff",
          "code": "10504-35-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=10504-35-5",
          "code_system": "CAS",
          "references": [
            "25e578fc-1f4e-4559-aa6f-077b1d5dcd55",
            "6e442e06-0dc6-45d9-9f34-cbfba9844e98"
          ]
        },
        {
          "uuid": "a9851fae-9f61-46ab-b2cb-1bf4ae145657",
          "code": "54690394",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/54690394",
          "code_system": "PUBCHEM",
          "references": [
            "25e578fc-1f4e-4559-aa6f-077b1d5dcd55"
          ]
        },
        {
          "uuid": "018a4970-7ef5-95ae-f92f-0c73b4c3ffad",
          "code": "DTXSID4074982",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4074982",
          "code_system": "EPA CompTox",
          "references": [
            "05bd1a12-945f-4ff1-e656-a94c02ccaad1"
          ]
        },
        {
          "uuid": "50d4b430-eb3a-49b3-a3a3-0b32069aa2ce",
          "code": "C8DQ5M1Y1E",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fe462c05-d82f-e809-5161-7b8fa538c1d9",
          "code": "51384",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:51384",
          "code_system": "CHEBI",
          "references": [
            "1bcd8c12-6f53-51d6-66c7-86acf23fd2da"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "762d33b1-8ccd-4f87-8070-25ef4302a1ce",
          "type": "ENANTIOMER->ENANTIOMER",
          "related_substance": {
            "uuid": "f38cb210-3c8b-43e3-ace4-dd2647fde5e2",
            "refuuid": "57ca4d1b-fb8c-4302-8789-70655308ebc1",
            "name": "ASCORBIC ACID",
            "unii": "PQ6CK8PD0R",
            "linking_id": "PQ6CK8PD0R",
            "ref_pname": "ASCORBIC ACID"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f3e5ebeb-a58c-d48e-a2c7-0c952fd9003b",
          "name": "ASCORBIC ACID, (-)-",
          "stdName": "ASCORBIC ACID, (-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15a09897-08ce-9062-5085-cecf22e37b15"
          ],
          "display_name": true
        },
        {
          "uuid": "65ab7b9f-59b3-485a-a310-1ac4cc83ad7a",
          "name": "ASCORBIC ACID, D-",
          "stdName": "ASCORBIC ACID, D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fc18f361-f53d-4f44-95b8-dea5684872a7"
          ],
          "display_name": false
        },
        {
          "uuid": "e3b99412-1721-4836-a5fe-b315099a0a97",
          "name": "D-ASCORBIC ACID",
          "stdName": "D-ASCORBIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bf913de9-9456-4a1a-aa83-6075210f353a"
          ],
          "display_name": false
        },
        {
          "uuid": "2c710c66-a242-9c50-3b08-299dacd3a625",
          "name": "D-LYXOASCORBIC ACID",
          "stdName": "D-LYXOASCORBIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15a09897-08ce-9062-5085-cecf22e37b15"
          ],
          "display_name": false
        },
        {
          "uuid": "0fcca914-88c8-cf2e-02f1-871f4e9c2cfe",
          "name": "D-THREO-HEX-2-ENONIC ACID, .GAMMA.-LACTONE",
          "stdName": "D-THREO-HEX-2-ENONIC ACID, .GAMMA.-LACTONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15a09897-08ce-9062-5085-cecf22e37b15"
          ],
          "display_name": false
        },
        {
          "uuid": "42cdbe81-f3f1-4d1d-8fc1-6b8e98f13de6",
          "name": "D-XYLOASCORBIC ACID, D-",
          "stdName": "D-XYLOASCORBIC ACID, D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "650b6136-1172-4df7-b28d-dd2e60ddc265"
          ],
          "display_name": false
        },
        {
          "uuid": "ac51f7b7-b0da-4aae-969d-937551cdd62a",
          "name": "LYXOASCORBIC ACID D-",
          "stdName": "LYXOASCORBIC ACID D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "650b6136-1172-4df7-b28d-dd2e60ddc265"
          ],
          "display_name": false
        },
        {
          "uuid": "9fd44db8-0b1e-4a59-815a-36dacafd3c72",
          "name": "THREO-HEX-2-ENONIC ACID, .GAMMA.-LACTONE",
          "stdName": "THREO-HEX-2-ENONIC ACID, .GAMMA.-LACTONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "650b6136-1172-4df7-b28d-dd2e60ddc265"
          ],
          "display_name": false
        },
        {
          "uuid": "c22b4c2c-46f5-4cfa-9b80-26a5b5b25e06",
          "name": "XYLOASCORBIC ACID D-",
          "stdName": "XYLOASCORBIC ACID D-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "650b6136-1172-4df7-b28d-dd2e60ddc265"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "fc18f361-f53d-4f44-95b8-dea5684872a7",
          "citation": "cfsan",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bf913de9-9456-4a1a-aa83-6075210f353a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "650b6136-1172-4df7-b28d-dd2e60ddc265",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25e578fc-1f4e-4559-aa6f-077b1d5dcd55",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393744000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "49fef336-533f-4c99-b2c6-18f41b204f18",
          "citation": "SRS import [C8DQ5M1Y1E]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=C8DQ5M1Y1E",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393744000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05bd1a12-945f-4ff1-e656-a94c02ccaad1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=10504-35-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "15a09897-08ce-9062-5085-cecf22e37b15",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "6e442e06-0dc6-45d9-9f34-cbfba9844e98",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1bcd8c12-6f53-51d6-66c7-86acf23fd2da",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f5b41e07-2910-4ef0-8cbb-483d78882374",
          "id": "f5b41e07-2910-4ef0-8cbb-483d78882374",
          "molfile": "\n  Marvin  01132112442D          \n\n 12 12  0  0  1  0            999 V2000\n    7.9333   -3.0990    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.9333   -2.3359    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5887   -3.4223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2623   -3.1664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1475   -3.3730    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.4920   -2.8970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8185   -3.3730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0328   -3.0990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0699   -4.1588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6031   -4.8367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8917   -4.1588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3944   -4.8367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5 11  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  2  0  0  0  0\nM  END",
          "smiles": "C([C@H]([C@H]1C(=O)C(=C(O)O1)O)O)O",
          "formula": "C6H8O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fcac6af6-fb11-41e2-aeac-d7bb3b2e0683"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "176.1244",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "54d6294e-fb84-4b37-9c19-cfe1d93c1757",
      "version": "8",
      "structure": {
        "id": "d35b5efd-c9c9-46ba-971a-7dd111c624c2",
        "molfile": "\n  Marvin  01132110552D          \n\n 13 13  0  0  1  0            999 V2000\n    6.0709   -4.1595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8928   -4.1595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1487   -3.3735    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.9346   -3.0996    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.9346   -2.3362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5901   -3.4229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2638   -3.1670    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8537   -3.7866    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4930   -2.8975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8195   -3.3735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0336   -3.0996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3956   -4.8374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6040   -4.8374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  6  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  3  8  1  6  0  0  0\n  9  3  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10  1  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12  2  1  0  0  0  0\n 13  1  1  0  0  0  0\nM  END",
        "smiles": "C([C@H]([C@@]1([H])C(=C(C(=O)O1)O)O)O)O",
        "formula": "C6H8O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "176.1244",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "49fef336-533f-4c99-b2c6-18f41b204f18",
          "fc18f361-f53d-4f44-95b8-dea5684872a7"
        ],
        "stereo_centers": 2
      },
      "unii": "C8DQ5M1Y1E"
    }
  ]
}