{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "bbddb21b-f203-4fe6-a0ab-3dc718525d86", "code": "96478-09-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=96478-09-0", "code_system": "CAS", "references": [ "adc3c2ca-3ea9-478d-8269-136feaa30fb7", "8a38fc2a-21c5-497a-8c3e-a973506bf9ae" ] }, { "uuid": "57995361-5818-4f17-9c16-a87c4a43959f", "code": "726893", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/726893", "code_system": "PUBCHEM", "references": [ "adc3c2ca-3ea9-478d-8269-136feaa30fb7" ] }, { "uuid": "fd0375ad-b9af-32c0-51bc-c982c069be9a", "code": "DTXSID0072980", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0072980", "code_system": "EPA CompTox", "references": [ "70474cd9-82e1-9e03-6d32-c914833d87b6" ] }, { "uuid": "0b08529e-a0c8-4439-829a-e6ca9c79ebc2", "code": "C7DR7U7VUK", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "e18b0356-966c-4106-951c-a598a8a311c8", "name": "2-(2-Hydroxy-5-methacryloyloxyethylphenyl)-2H-benzotriazole", "stdName": "2-(2-HYDROXY-5-METHACRYLOYLOXYETHYLPHENYL)-2H-BENZOTRIAZOLE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8a38fc2a-21c5-497a-8c3e-a973506bf9ae" ], "display_name": false }, { "uuid": "bcf316be-aab8-4c84-8afc-3568942d0898", "name": "2-Propenoic acid, 2-methyl-, 2-[3-(2H-benzotriazol-2-yl)-4-hydroxyphenyl]ethyl ester", "stdName": "2-PROPENOIC ACID, 2-METHYL-, 2-(3-(2H-BENZOTRIAZOL-2-YL)-4-HYDROXYPHENYL)ETHYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "771d16cf-9c81-4434-a051-4a75648b0446", "72fd0575-7935-45f3-b073-865a99c8abad" ], "display_name": false }, { "uuid": "979f833a-421e-4037-85cb-c12486c5ae6a", "name": "2-[3-(2H-Benzotriazol-2-yl)-4-hydroxyphenyl]ethyl methacrylate", "stdName": "2-(3-(2H-BENZOTRIAZOL-2-YL)-4-HYDROXYPHENYL)ETHYL METHACRYLATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8a38fc2a-21c5-497a-8c3e-a973506bf9ae" ], "display_name": true }, { "uuid": "238562d8-9c22-4382-8558-e961c30fa291", "name": "4-(2-Methacryloyloxyethyl)-2-(2H-benzotriazol-2-yl)phenol", "stdName": "4-(2-METHACRYLOYLOXYETHYL)-2-(2H-BENZOTRIAZOL-2-YL)PHENOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8a38fc2a-21c5-497a-8c3e-a973506bf9ae" ], "display_name": false } ], "references": [ { "uuid": "72fd0575-7935-45f3-b073-865a99c8abad", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "771d16cf-9c81-4434-a051-4a75648b0446", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "adc3c2ca-3ea9-478d-8269-136feaa30fb7", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393315000, "tags": [ "NOMEN" ] }, { "uuid": "c3c14180-9637-4db7-86ef-a40ff9fa83f9", "citation": "CHEMID RECORD 96478-09-0", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "70474cd9-82e1-9e03-6d32-c914833d87b6", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=96478-09-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8a38fc2a-21c5-497a-8c3e-a973506bf9ae", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "6f3630da-636f-4c0c-92ae-7b900d35b9de", "id": "6f3630da-636f-4c0c-92ae-7b900d35b9de", "molfile": "\n Marvin 01132105462D \n\n 24 26 0 0 0 0 999 V2000\n -0.8823 -2.1768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1677 -1.7646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5470 -2.1768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1677 -0.9400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8823 -0.5277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5470 -0.5277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2616 -0.9400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9735 -0.5277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6881 -0.9400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6881 -1.7646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4027 -2.1768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1173 -1.7646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8319 -2.1768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1173 -0.9400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4027 -0.5277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8319 -0.5277 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9172 0.2914 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7252 0.4618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1375 1.1764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9621 1.1764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3743 0.4618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9621 -0.2501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1375 -0.2501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5850 -0.8630 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 2 0 0 0 0\n 2 4 1 0 0 0 0\n 5 4 2 0 0 0 0\n 4 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 9 1 0 0 0 0\n 9 15 2 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 12 14 2 0 0 0 0\n 15 14 1 0 0 0 0\n 14 16 1 0 0 0 0\n 17 16 1 0 0 0 0\n 24 16 1 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 18 23 1 0 0 0 0\n 20 19 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 2 0 0 0 0\nM END", "smiles": "C=C(C)C(=O)OCCc1ccc(c(c1)-n2nc3ccccc3n2)O", "formula": "C18H17N3O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "bfc95b60-eedd-4481-92e8-e5c87d26fa81" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "323.3466", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "25d321c7-f159-4981-a3c0-6319132547b9", "version": "5", "structure": { "id": "20ce6934-2746-44d2-a6c9-7851cd9d1586", "molfile": "\n Marvin 01132101512D \n\n 24 26 0 0 0 0 999 V2000\n 4.8319 -0.5277 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9172 0.2914 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5850 -0.8630 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1173 -0.9400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1375 -0.2501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7252 0.4618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1677 -0.9400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1677 -1.7646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1173 -1.7646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4027 -0.5277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9621 -0.2501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1375 1.1764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8823 -0.5277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9621 1.1764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3743 0.4618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5470 -2.1768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4027 -2.1768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5470 -0.5277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6881 -0.9400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6881 -1.7646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8319 -2.1768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2616 -0.9400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8823 -2.1768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9735 -0.5277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 1 1 0 0 0 0\n 4 1 1 0 0 0 0\n 5 3 2 0 0 0 0\n 6 2 2 0 0 0 0\n 7 18 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 4 1 0 0 0 0\n 10 4 2 0 0 0 0\n 11 5 1 0 0 0 0\n 12 6 1 0 0 0 0\n 13 7 2 0 0 0 0\n 14 12 2 0 0 0 0\n 15 11 2 0 0 0 0\n 16 8 2 0 0 0 0\n 17 9 2 0 0 0 0\n 18 22 1 0 0 0 0\n 19 10 1 0 0 0 0\n 20 17 1 0 0 0 0\n 21 9 1 0 0 0 0\n 22 24 1 0 0 0 0\n 23 8 1 0 0 0 0\n 24 19 1 0 0 0 0\n 6 5 1 0 0 0 0\n 20 19 2 0 0 0 0\n 14 15 1 0 0 0 0\nM END", "smiles": "C=C(C)C(=O)OCCc1ccc(c(c1)-n2nc3ccccc3n2)O", "formula": "C18H17N3O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "323.3466", "optical_activity": "NONE", "references": [ "c3c14180-9637-4db7-86ef-a40ff9fa83f9" ], "stereo_centers": 0 }, "unii": "C7DR7U7VUK" } ] }