{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d7bde844-a7d1-4488-8a9e-272a45d3e3ec",
          "code": "N06BX01",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOANALEPTICS|PSYCHOSTIMULANTS, AGENTS USED FOR ADHD AND NOOTROPICS|Other psychostimulants and nootropics|meclofenoxate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N06BX01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "832ee0c3-1922-4db3-acf9-5a439613385d"
          ]
        },
        {
          "uuid": "c6b231dc-4c39-4f73-8fbe-bf323d5cb883",
          "code": "QN06BX01",
          "comments": "VATC|PSYCHOANALEPTICS|PSYCHOSTIMULANTS, AGENTS USED FOR ADHD AND NOOTROPICS|Other psychostimulants and nootropics|meclofenoxate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN06BX01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "832ee0c3-1922-4db3-acf9-5a439613385d"
          ]
        },
        {
          "uuid": "59444d47-7971-4dfd-809a-1df37cc989f5",
          "code": "51-68-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=51-68-3",
          "code_system": "CAS",
          "references": [
            "832ee0c3-1922-4db3-acf9-5a439613385d",
            "8999e278-92b7-4c15-9e10-81c9c1b60237"
          ]
        },
        {
          "uuid": "0677e52b-96e9-4e67-aafc-9beda483e264",
          "code": "D002504",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68002504",
          "code_system": "MESH",
          "references": [
            "832ee0c3-1922-4db3-acf9-5a439613385d"
          ]
        },
        {
          "uuid": "13034fe4-dd7a-49d7-a3c0-8d08edc2807b",
          "code": "MECLOFENOXATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Meclofenoxate",
          "code_system": "WIKIPEDIA",
          "references": [
            "832ee0c3-1922-4db3-acf9-5a439613385d"
          ]
        },
        {
          "uuid": "94bb6560-6908-4e0e-976f-24d897dfd422",
          "code": "1083",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1083",
          "code_system": "INN",
          "references": [
            "832ee0c3-1922-4db3-acf9-5a439613385d"
          ]
        },
        {
          "uuid": "ff48aeea-6666-4f90-aaa2-4a3eee12eed7",
          "code": "2228",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2228/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "832ee0c3-1922-4db3-acf9-5a439613385d"
          ]
        },
        {
          "uuid": "e23fcb24-94c0-4af2-8b0d-7253f1a3732c",
          "code": "m7121",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7121?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "832ee0c3-1922-4db3-acf9-5a439613385d"
          ]
        },
        {
          "uuid": "52448db7-a042-482b-825d-664d5c4f1aec",
          "code": "SUB08679MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "832ee0c3-1922-4db3-acf9-5a439613385d"
          ]
        },
        {
          "uuid": "f351e9c7-4538-4034-b2cb-dafde59e7390",
          "code": "CHEMBL64545",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL64545",
          "code_system": "ChEMBL",
          "references": [
            "832ee0c3-1922-4db3-acf9-5a439613385d"
          ]
        },
        {
          "uuid": "33706b4b-c4c0-4c88-a12e-95cd61f7a253",
          "code": "200-116-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.107",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "832ee0c3-1922-4db3-acf9-5a439613385d"
          ]
        },
        {
          "uuid": "4ed7a3d7-eb09-4b20-9c32-eb132e045c3e",
          "code": "4039",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4039",
          "code_system": "PUBCHEM",
          "references": [
            "832ee0c3-1922-4db3-acf9-5a439613385d"
          ]
        },
        {
          "uuid": "20caca9c-d287-6fda-c63d-2dd76f4cb77a",
          "code": "DTXSID9046940",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9046940",
          "code_system": "EPA CompTox",
          "references": [
            "2b585b52-584a-a31b-d913-2d1e928ea727"
          ]
        },
        {
          "uuid": "ea0f0d12-4269-4545-9be7-cd2f246d0c79",
          "code": "C76QQ2I0RG",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e5fec5cd-5208-7a36-478a-215e4f6635b3",
          "code": "1889 (Number of products:4)",
          "comments": "Dietary Supplement Label Database|Chemical|Centrophenoxine",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1889&item=Centrophenoxine",
          "code_system": "DSLD",
          "references": [
            "1d8d4642-6f77-4a84-1f88-f407796b7a06"
          ]
        },
        {
          "uuid": "42f2b337-ed2d-1684-a499-88cde142f655",
          "code": "DB13758",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13758",
          "code_system": "DRUG BANK",
          "references": [
            "1d8d4642-6f77-4a84-1f88-f407796b7a06"
          ]
        },
        {
          "uuid": "8dc0f7c0-2e86-0062-ef91-21452a8b790c",
          "code": "1651",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1651",
          "code_system": "DRUG CENTRAL",
          "references": [
            "1d8d4642-6f77-4a84-1f88-f407796b7a06"
          ]
        },
        {
          "uuid": "5179db99-8a06-dd12-1b04-07a16dce9c93",
          "code": "C174654",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C174654",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2460bd2f-a2c7-1da3-ba48-79942578891c"
          ]
        },
        {
          "uuid": "a76850cc-7eac-6858-b31e-30fe970bc9af",
          "code": "100000081777",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "db1368c3-8e8e-0b0e-afc5-36176d3c83dd"
          ]
        },
        {
          "uuid": "34cb31e8-1ecb-409b-5c89-1f2b69a89aef",
          "code": "169411",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=169411",
          "code_system": "NSC",
          "references": [
            "6d085af3-9609-d3e9-c669-d8d242f61c1f"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "6e23347f-4296-4eba-be3e-26fd66207601",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ba57cb7a-061d-45d7-813a-6c7a9dc8f6bc",
            "refuuid": "0957ce24-bf10-4955-b3e4-8bae551c74c6",
            "name": "MECLOFENOXATE",
            "unii": "C76QQ2I0RG",
            "linking_id": "C76QQ2I0RG",
            "ref_pname": "MECLOFENOXATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2bcdb1ff-9c9d-4384-9efa-ec7fe326dcd6",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "f376465a-01eb-4835-9299-39328508f6ed",
            "refuuid": "8d1656ed-062d-48fc-bba2-e3a6d735202f",
            "name": "MECLOFENOXATE HYDROCHLORIDE",
            "unii": "5BK3070BDY",
            "linking_id": "5BK3070BDY",
            "ref_pname": "MECLOFENOXATE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a6c4a804-fd9b-4b25-a9d0-3c903183080d",
          "name": "(4-CHLOROPHENOXY)ACETIC ACID 2-(DIMETHYLAMINO)ETHYL ESTER",
          "stdName": "(4-CHLOROPHENOXY)ACETIC ACID 2-(DIMETHYLAMINO)ETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0f1fab0-1843-4863-83e1-12e413951283"
          ],
          "display_name": false
        },
        {
          "uuid": "c7dd9f51-7230-4e4e-9969-e1f8d0a143f6",
          "name": "2-(DIMETHYLAMINO)ETHYL(P-CHLORPHENOXY)ACETATE",
          "stdName": "2-(DIMETHYLAMINO)ETHYL(P-CHLORPHENOXY)ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "974b89ff-6bd2-4bbb-a14c-cc6459e7a21c"
          ],
          "display_name": false
        },
        {
          "uuid": "0311c46d-3569-404a-adf2-e3dede7fbd96",
          "name": "ANALUX",
          "stdName": "ANALUX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0f1fab0-1843-4863-83e1-12e413951283"
          ],
          "display_name": false
        },
        {
          "uuid": "4ec153de-359f-43af-bee3-2312016e51bd",
          "name": "ANP-235",
          "stdName": "ANP-235",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0f1fab0-1843-4863-83e1-12e413951283"
          ],
          "display_name": false
        },
        {
          "uuid": "3e4b62e2-d36f-4f06-8776-da0a67aaacac",
          "name": "CENTROPHENOXINE",
          "stdName": "CENTROPHENOXINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0f1fab0-1843-4863-83e1-12e413951283"
          ],
          "display_name": false
        },
        {
          "uuid": "6424524d-f908-4168-928a-e325f4fda66d",
          "name": "CETREXIN",
          "stdName": "CETREXIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0f1fab0-1843-4863-83e1-12e413951283"
          ],
          "display_name": false
        },
        {
          "uuid": "2d11a0b3-d675-4513-9b03-47b7e1cc09e0",
          "name": "DIMETHYLAMINOETHYL P-CHLOROPHENOXYACETATE",
          "stdName": "DIMETHYLAMINOETHYL P-CHLOROPHENOXYACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0f1fab0-1843-4863-83e1-12e413951283"
          ],
          "display_name": false
        },
        {
          "uuid": "5807751f-67c7-49e3-bfb4-5e1c00e65e58",
          "name": "MECLOFENOXANE",
          "stdName": "MECLOFENOXANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0f1fab0-1843-4863-83e1-12e413951283"
          ],
          "display_name": false
        },
        {
          "uuid": "0be0dfc8-ce16-45d6-a596-f6891ade8175",
          "name": "MECLOFENOXATE",
          "stdName": "MECLOFENOXATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf21e83b-c5a5-4dda-8acb-130dbd3001be",
            "9fed8a1c-157d-45ba-a5dd-9ec362d3095e",
            "59fc1aa0-1e9d-4b4d-b6e6-a5155e9b1f74",
            "87dfd3a6-df89-44b8-8ba9-6d54557991a3",
            "f8bc1132-b866-4032-90e7-3dd92b21af6e",
            "54dc8f20-e919-4944-9421-24be6646b420",
            "fa04d43f-dd99-4f22-9503-ae026678f306"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "cab9434b-8d34-48fe-ac6a-833bf3d9ac8b",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "af7c7811-e445-4f15-9eb9-ed53f5750076",
          "name": "MECLOFENOXATE [MI]",
          "stdName": "MECLOFENOXATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa04d43f-dd99-4f22-9503-ae026678f306"
          ],
          "display_name": false
        },
        {
          "uuid": "46831b21-a279-3707-c939-45a072ad298a",
          "name": "Meclofenoxate [WHO-DD]",
          "stdName": "MECLOFENOXATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "223caa23-00ce-14cd-3d38-e0b41b9dcb2a"
          ],
          "display_name": false
        },
        {
          "uuid": "6fe0b6a7-2bb0-48b8-a025-9f8f02833b5f",
          "name": "NSC-169411",
          "stdName": "NSC-169411",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3001b150-75be-408e-97b5-2acdb5f69251"
          ],
          "display_name": false
        },
        {
          "uuid": "ce48eee9-6b1b-4045-a6fc-7774f81d077d",
          "name": "PROSERYL",
          "stdName": "PROSERYL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0f1fab0-1843-4863-83e1-12e413951283"
          ],
          "display_name": false
        },
        {
          "uuid": "84a060f8-9017-416a-bb4d-8e660fe32b42",
          "name": "meclofenoxate [INN]",
          "stdName": "MECLOFENOXATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59fc1aa0-1e9d-4b4d-b6e6-a5155e9b1f74"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "cf21e83b-c5a5-4dda-8acb-130dbd3001be",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d0f1fab0-1843-4863-83e1-12e413951283",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "974b89ff-6bd2-4bbb-a14c-cc6459e7a21c",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59fc1aa0-1e9d-4b4d-b6e6-a5155e9b1f74",
          "citation": "INN Proposed List 15",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL15.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fa04d43f-dd99-4f22-9503-ae026678f306",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8bc1132-b866-4032-90e7-3dd92b21af6e",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3001b150-75be-408e-97b5-2acdb5f69251",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "832ee0c3-1922-4db3-acf9-5a439613385d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389690000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4416e39-64ad-4c54-8572-8cb73f4ca9dc",
          "citation": "SRS import [C76QQ2I0RG]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=C76QQ2I0RG",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389690000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "54dc8f20-e919-4944-9421-24be6646b420",
          "citation": "MECLOFENOXATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "87dfd3a6-df89-44b8-8ba9-6d54557991a3",
          "citation": "MECLOFENOXATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9fed8a1c-157d-45ba-a5dd-9ec362d3095e",
          "citation": "MECLOFENOXATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2b585b52-584a-a31b-d913-2d1e928ea727",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=51-68-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1d8d4642-6f77-4a84-1f88-f407796b7a06",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8999e278-92b7-4c15-9e10-81c9c1b60237",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2460bd2f-a2c7-1da3-ba48-79942578891c",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "6d085af3-9609-d3e9-c669-d8d242f61c1f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "43b3c4a9-c21e-4124-48aa-b87becf0cfed",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "223caa23-00ce-14cd-3d38-e0b41b9dcb2a",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "db1368c3-8e8e-0b0e-afc5-36176d3c83dd",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e82c5693-11ff-478c-9f0e-842c99bef65a",
          "id": "e82c5693-11ff-478c-9f0e-842c99bef65a",
          "molfile": "\n  Marvin  01132112012D          \n\n 17 17  0  0  0  0            999 V2000\n    7.8862   -1.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1690   -1.5690    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1768   -2.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4338   -1.1651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7347   -1.5923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0124   -1.1910    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2978   -1.6078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3133   -2.4337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5962   -1.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8842   -1.6233    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1593   -1.2220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4395   -1.6389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7249   -1.2453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7249   -0.4065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.0078    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.4318    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1515   -0.3910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 17 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 16  2  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "CN(C)CCOC(=O)COc1ccc(cc1)Cl",
          "formula": "C12H16ClNO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2ac480bd-a206-4c56-9646-a7d4f1e8bcf5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "257.7137",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0957ce24-bf10-4955-b3e4-8bae551c74c6",
      "version": "16",
      "structure": {
        "id": "edd920b6-42a3-47e6-a5dd-c5dc751ef735",
        "molfile": "\n  Marvin  01132112182D          \n\n 17 17  0  0  0  0            999 V2000\n    4.2978   -1.6078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3133   -2.4337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8842   -1.6233    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5962   -1.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1593   -1.2220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7249   -0.4065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1690   -1.5690    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0124   -1.1910    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.0078    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.4395   -1.6389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1515   -0.3910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7249   -1.2453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4318    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7347   -1.5923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4338   -1.1651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8862   -1.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1768   -2.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6 13  1  0  0  0  0\n  7 15  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9  6  1  0  0  0  0\n 10  5  2  0  0  0  0\n 11  5  1  0  0  0  0\n 12 10  1  0  0  0  0\n 13 11  2  0  0  0  0\n 14  8  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16  7  1  0  0  0  0\n 17  7  1  0  0  0  0\n  6 12  2  0  0  0  0\nM  END",
        "smiles": "CN(C)CCOC(=O)COc1ccc(cc1)Cl",
        "formula": "C12H16ClNO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "257.7137",
        "optical_activity": "NONE",
        "references": [
          "cf21e83b-c5a5-4dda-8acb-130dbd3001be",
          "b4416e39-64ad-4c54-8572-8cb73f4ca9dc",
          "59fc1aa0-1e9d-4b4d-b6e6-a5155e9b1f74"
        ],
        "stereo_centers": 0
      },
      "unii": "C76QQ2I0RG"
    }
  ]
}