{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "bbdc69c0-59e0-4c88-a559-beadda84aade", "code": "110553-27-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=110553-27-0", "code_system": "CAS", "references": [ "746aa554-16aa-4023-a289-1ee817615c61", "45bd9224-d013-43f1-a640-b00e11d31de3" ] }, { "uuid": "ff266513-4f4e-4332-9325-b2fd35a7f0e9", "code": "113646", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/113646", "code_system": "PUBCHEM", "references": [ "746aa554-16aa-4023-a289-1ee817615c61" ] }, { "uuid": "ae70d52c-e5b8-3911-f774-841b734605db", "code": "DTXSID6044199", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6044199", "code_system": "EPA CompTox", "references": [ "0011d4b6-500f-0ad0-4b0e-5cafbac37146" ] }, { "uuid": "6afb61a6-2583-4eb2-98f1-e0a9628e3ca1", "code": "C73V7OV6Q3", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "fcdc2a33-b7d9-487a-8ae3-efd9def00150", "name": "2,4-BIS(OCTYLTHIOMETHYL)-6-METHYLPHENOL", "stdName": "2,4-BIS(OCTYLTHIOMETHYL)-6-METHYLPHENOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "21e5d406-37bd-453f-9be1-0e425cd2185c", "d6238d3d-1bec-4843-8405-bedff1c0c7b9" ], "display_name": false }, { "uuid": "57d6e4c8-025b-441d-8a4c-1f43456b270c", "name": "2,4-DIOCTYLTHIOMETHYL-6-METHYLPHENOL", "stdName": "2,4-DIOCTYLTHIOMETHYL-6-METHYLPHENOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "21e5d406-37bd-453f-9be1-0e425cd2185c", "d6238d3d-1bec-4843-8405-bedff1c0c7b9" ], "display_name": false }, { "uuid": "56432e65-d6f0-4e08-a1f4-43b198dae3e9", "name": "2-METHYL-4,6-BIS((OCTYLTHIO)METHYL)PHENOL", "stdName": "2-METHYL-4,6-BIS((OCTYLTHIO)METHYL)PHENOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "21e5d406-37bd-453f-9be1-0e425cd2185c" ], "display_name": true }, { "uuid": "169bd9e3-7068-4415-b2bb-e1232ba38d7e", "name": "4,6-BIS(OCTYLTHIOMETHYL)-O-CRESOL", "stdName": "4,6-BIS(OCTYLTHIOMETHYL)-O-CRESOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "21e5d406-37bd-453f-9be1-0e425cd2185c", "d6238d3d-1bec-4843-8405-bedff1c0c7b9" ], "display_name": false }, { "uuid": "25e84df6-8a00-4204-94a0-3e9ee16224aa", "name": "IRGANOX 1520", "stdName": "IRGANOX 1520", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "21e5d406-37bd-453f-9be1-0e425cd2185c", "d6238d3d-1bec-4843-8405-bedff1c0c7b9" ], "display_name": false }, { "uuid": "a179bc61-4aae-4224-a9c0-2ce145faa8e0", "name": "PHENOL, 2-METHYL-4,6-BIS((OCTYLTHIO)METHYL)-", "stdName": "PHENOL, 2-METHYL-4,6-BIS((OCTYLTHIO)METHYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "21e5d406-37bd-453f-9be1-0e425cd2185c", "d6238d3d-1bec-4843-8405-bedff1c0c7b9" ], "display_name": false } ], "references": [ { "uuid": "21e5d406-37bd-453f-9be1-0e425cd2185c", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "d6238d3d-1bec-4843-8405-bedff1c0c7b9", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "746aa554-16aa-4023-a289-1ee817615c61", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391021000, "tags": [ "NOMEN" ] }, { "uuid": "519f3e78-dd8f-4b99-bcde-2b0f9fda3a49", "citation": "SRS import [C73V7OV6Q3]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=C73V7OV6Q3", "doc_type": "SRS", "public_domain": true, "document_date": 1493391021000, "tags": [ "NOMEN" ] }, { "uuid": "f57e4053-b6be-43fb-ba1a-2c52e636e2dc", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0011d4b6-500f-0ad0-4b0e-5cafbac37146", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=110553-27-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "45bd9224-d013-43f1-a640-b00e11d31de3", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "e2403051-a365-44b9-a3a1-a33316986757", "id": "e2403051-a365-44b9-a3a1-a33316986757", "molfile": "\n Marvin 01132111432D \n\n 28 28 0 0 0 0 999 V2000\n -0.6639 -4.2386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1353 -3.8863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8714 -4.2664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6707 -3.9093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3844 -4.3029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2182 -3.9513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9197 -4.3352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7447 -3.9809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4528 -4.3691 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2643 -4.0170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9877 -4.3971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9877 -5.1407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7722 -5.4403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7722 -6.1892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5174 -4.9987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2834 -5.3013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5174 -4.2415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2459 -3.8645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9530 -4.2653 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7713 -3.9280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4787 -4.3137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2991 -3.9705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0118 -4.3756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8173 -4.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5340 -4.4352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3594 -4.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0648 -4.4770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7422 -3.9606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 28 11 2 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 15 17 2 0 0 0 0\n 18 17 1 0 0 0 0\n 17 28 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\nM END", "smiles": "CCCCCCCCSCc1cc(C)c(c(c1)CSCCCCCCCC)O", "formula": "C25H44OS2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "d60bed9b-6dec-42f1-b2ac-e6b27569c0e8" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "424.7494", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "5442a37e-8375-474f-a5f6-d3800ca2a250", "version": "5", "structure": { "id": "193876b9-d359-4daf-9004-0690d6f0745d", "molfile": "\n Marvin 01132101302D \n\n 28 28 0 0 0 0 999 V2000\n 9.2453 -3.8642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5168 -4.2412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5168 -4.9984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2828 -5.3009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7717 -5.4399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9872 -5.1403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9872 -4.3968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7417 -3.9603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2639 -4.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4524 -4.3688 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7444 -3.9806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9194 -4.3349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2180 -3.9510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3842 -4.3026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6706 -3.9090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8713 -4.2661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1353 -3.8860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6639 -4.2383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7717 -6.1888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9523 -4.2650 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7706 -3.9277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4779 -4.3134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2983 -3.9702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0109 -4.3753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8163 -4.0264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5330 -4.4349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3583 -4.0863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0637 -4.4767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 3 2 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 2 8 2 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 5 19 1 0 0 0 0\n 1 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\nM END", "smiles": "CCCCCCCCSCc1cc(C)c(c(c1)CSCCCCCCCC)O", "formula": "C25H44OS2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "424.7494", "optical_activity": "NONE", "references": [ "f57e4053-b6be-43fb-ba1a-2c52e636e2dc", "519f3e78-dd8f-4b99-bcde-2b0f9fda3a49" ], "stereo_centers": 0 }, "unii": "C73V7OV6Q3" } ] }