{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d20a7c23-1821-4a55-9cb7-0e4b9c101f68",
          "code": "436-40-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=436-40-8",
          "code_system": "CAS",
          "references": [
            "509620cc-78ed-4430-ba6f-6455a2ad7248",
            "ced87f7b-d252-4ff1-91dc-a35c3be10a36"
          ]
        },
        {
          "uuid": "d7c86d2e-3459-4b3d-b969-16eddb2a5077",
          "code": "C65919",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C65919",
          "code_system": "NCI_THESAURUS",
          "references": [
            "509620cc-78ed-4430-ba6f-6455a2ad7248"
          ]
        },
        {
          "uuid": "8cd63133-d4e8-4dac-acea-aceab40f74f8",
          "code": "C026480",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67026480",
          "code_system": "MESH",
          "references": [
            "509620cc-78ed-4430-ba6f-6455a2ad7248"
          ]
        },
        {
          "uuid": "5a0229d1-3436-4419-8ec3-74745394ba8d",
          "code": "SUB08193MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "509620cc-78ed-4430-ba6f-6455a2ad7248"
          ]
        },
        {
          "uuid": "d73583be-14d5-4ae3-9a99-fce87af26fa1",
          "code": "829",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=829",
          "code_system": "INN",
          "references": [
            "509620cc-78ed-4430-ba6f-6455a2ad7248"
          ]
        },
        {
          "uuid": "aa63711b-48d2-4970-ad9f-0397ff7340da",
          "code": "CHEMBL462220",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL462220",
          "code_system": "ChEMBL",
          "references": [
            "509620cc-78ed-4430-ba6f-6455a2ad7248"
          ]
        },
        {
          "uuid": "75935af5-f8f9-40b3-8111-040f56bb8fe4",
          "code": "71627",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71627",
          "code_system": "PUBCHEM",
          "references": [
            "509620cc-78ed-4430-ba6f-6455a2ad7248"
          ]
        },
        {
          "uuid": "4b6ca2c7-8db7-d874-d7c9-dbfdbd293e02",
          "code": "DTXSID00195884",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00195884",
          "code_system": "EPA CompTox",
          "references": [
            "8b95c368-5aab-cbeb-4085-6cffce1083f6"
          ]
        },
        {
          "uuid": "02748baf-d085-c3b3-b7f8-db15da0147f6",
          "code": "C274",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C274",
          "code_system": "NCI_THESAURUS",
          "references": [
            "9b61d49b-7ef3-8910-cf9a-4d69ec641e31"
          ]
        },
        {
          "uuid": "09794b36-6e1c-4280-b1a7-8b7d79ccab8d",
          "code": "C6Y700V0M4",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "61a2a63e-2e18-8af0-d761-64db69a834eb",
          "code": "100000083419",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "711c9bb8-c742-8859-9777-87933109dadd"
          ]
        },
        {
          "uuid": "e2c39acc-2d57-9f76-8e57-fa97ba166f1b",
          "code": "17261",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=17261",
          "code_system": "NSC",
          "references": [
            "269d5eaa-ddb9-635c-59e8-71e9f93354c7"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "f7a3de99-736b-4e4e-9ee9-b92c6859b50a",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "30bbfdfa-0585-4977-8e58-ee2e12a0e8a6",
            "refuuid": "d12eb3d4-47e0-446a-ad61-3f2a9ef573d6",
            "name": "INPROQUONE",
            "unii": "C6Y700V0M4",
            "linking_id": "C6Y700V0M4",
            "ref_pname": "INPROQUONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9b3321a1-c3a8-41b7-879e-1e2e6472eb55",
          "name": "2,5-BIS(ETHYLENEIMINO)-3,6-DIPROPOXY-P-BENZOQUINONE",
          "stdName": "2,5-BIS(ETHYLENEIMINO)-3,6-DIPROPOXY-P-BENZOQUINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3be25138-02ba-45fb-b3da-5e02a4823573"
          ],
          "display_name": false
        },
        {
          "uuid": "27911029-57fe-437e-8762-e84d60cfcad2",
          "name": "E-39 (INPROQUONE)",
          "stdName": "E-39 (INPROQUONE)",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e747e548-8c7c-41af-92b3-2de4907b281b"
          ],
          "display_name": false
        },
        {
          "uuid": "b9f00dcd-8d95-494d-bb66-38be4e6a6447",
          "name": "INPROQUONE",
          "stdName": "INPROQUONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f65da1b5-915a-40c7-b51b-390010585dac",
            "eac4f590-af7f-440f-b004-2f3aead187a6",
            "3be25138-02ba-45fb-b3da-5e02a4823573"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "f693ad28-dcc2-4a8b-b64a-fd9679fdf28c",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "c1352316-782a-49ab-b8d8-be5a8c1a3ab3",
          "name": "NSC-17261",
          "stdName": "NSC-17261",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3be25138-02ba-45fb-b3da-5e02a4823573"
          ],
          "display_name": false
        },
        {
          "uuid": "391788ac-e245-4c9e-b9b0-04664d716fb3",
          "name": "RP 6870",
          "stdName": "RP 6870",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3be25138-02ba-45fb-b3da-5e02a4823573"
          ],
          "display_name": false
        },
        {
          "uuid": "6641ecef-18a8-43e6-95be-d2689a6e74f4",
          "name": "RP-6870",
          "stdName": "RP-6870",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e747e548-8c7c-41af-92b3-2de4907b281b"
          ],
          "display_name": false
        },
        {
          "uuid": "7bb15bb6-985f-4521-94e3-132411551b6d",
          "name": "inproquone [INN]",
          "stdName": "INPROQUONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f65da1b5-915a-40c7-b51b-390010585dac"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3be25138-02ba-45fb-b3da-5e02a4823573",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f65da1b5-915a-40c7-b51b-390010585dac",
          "citation": "INN Proposed List 8",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL08.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e747e548-8c7c-41af-92b3-2de4907b281b",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "509620cc-78ed-4430-ba6f-6455a2ad7248",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390590000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c86f438d-91b2-43f2-8a81-4717866b21e1",
          "citation": "SRS import [C6Y700V0M4]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=C6Y700V0M4",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390590000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eac4f590-af7f-440f-b004-2f3aead187a6",
          "citation": "INPROQUONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8b95c368-5aab-cbeb-4085-6cffce1083f6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=436-40-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9b61d49b-7ef3-8910-cf9a-4d69ec641e31",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ced87f7b-d252-4ff1-91dc-a35c3be10a36",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "269d5eaa-ddb9-635c-59e8-71e9f93354c7",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "711c9bb8-c742-8859-9777-87933109dadd",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7bb8132d-103f-49b3-bb83-84d62337ae82",
          "id": "7bb8132d-103f-49b3-bb83-84d62337ae82",
          "molfile": "\n  Marvin  01132106252D          \n\n 22 24  0  0  0  0            999 V2000\n    4.7642    0.2015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3515   -0.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5267   -0.5219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0965   -1.2024    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3818   -1.6146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3766   -2.4396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0897   -2.8545    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5007   -3.5672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9156   -2.8540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6619   -2.8518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6603   -3.6769    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9524   -2.4391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2377   -2.8512    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1773   -3.5579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0028   -3.5529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4160   -4.2626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9504   -1.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2354   -1.2064    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1773   -0.4955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5890   -1.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6651   -1.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6630   -0.3809    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n 21  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n 10  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 17 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 21 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 18 20  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 22  2  0  0  0  0\nM  END",
          "smiles": "CCCOC1=C(C(=O)C(=C(C1=O)N2CC2)OCCC)N3CC3",
          "formula": "C16H22N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "572ac7b9-024d-4a2e-ae50-e72d3ea6f40d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "306.3575",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d12eb3d4-47e0-446a-ad61-3f2a9ef573d6",
      "version": "8",
      "structure": {
        "id": "1255cef2-db10-44e9-b417-845e35041b57",
        "molfile": "\n  Marvin  01132101102D          \n\n 22 24  0  0  0  0            999 V2000\n    1.6651   -1.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9504   -1.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9524   -2.4391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6619   -2.8518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3766   -2.4396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3818   -1.6146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6630   -0.3809    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6603   -3.6769    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2377   -2.8512    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2354   -1.2064    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0897   -2.8545    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0965   -1.2024    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1773   -0.4955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5890   -1.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5007   -3.5672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9156   -2.8540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5267   -0.5219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3515   -0.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7642    0.2015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1773   -3.5579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0028   -3.5529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4160   -4.2626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  5 11  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6 12  1  0  0  0  0\n 13 10  1  0  0  0  0\n 14 13  1  0  0  0  0\n 10 14  1  0  0  0  0\n  5  6  2  0  0  0  0\n 15 11  1  0  0  0  0\n 16 15  1  0  0  0  0\n 11 16  1  0  0  0  0\n  1  7  2  0  0  0  0\n  1  2  1  0  0  0  0\n  4  8  2  0  0  0  0\n 12 17  1  0  0  0  0\n  1  6  1  0  0  0  0\n 17 18  1  0  0  0  0\n  3  9  1  0  0  0  0\n 18 19  1  0  0  0  0\n  2  3  2  0  0  0  0\n  9 20  1  0  0  0  0\n  2 10  1  0  0  0  0\n 20 21  1  0  0  0  0\n  3  4  1  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
        "smiles": "CCCOC1=C(C(=O)C(=C(C1=O)N2CC2)OCCC)N3CC3",
        "formula": "C16H22N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "306.3575",
        "optical_activity": "NONE",
        "references": [
          "c86f438d-91b2-43f2-8a81-4717866b21e1",
          "3be25138-02ba-45fb-b3da-5e02a4823573",
          "f65da1b5-915a-40c7-b51b-390010585dac"
        ],
        "stereo_centers": 0
      },
      "unii": "C6Y700V0M4"
    }
  ]
}