{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "37c90df6-9e18-4b88-b6ec-d8e6de5ce498",
          "code": "113376",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/113376",
          "code_system": "PUBCHEM"
        },
        {
          "uuid": "2b9d465f-ac8a-4083-adba-c5ebb6eb8d34",
          "code": "1017018-24-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1017018-24-4",
          "code_system": "CAS",
          "references": [
            "91e69cb0-3952-4993-9cd7-7a0147373e1c"
          ]
        },
        {
          "uuid": "7c944a1a-637f-4cbd-a34b-eeabd69c64a6",
          "code": "50578-85-3",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=50578-85-3",
          "code_system": "CAS",
          "references": [
            "91e69cb0-3952-4993-9cd7-7a0147373e1c"
          ]
        },
        {
          "uuid": "96cb562e-9b20-4d42-9198-40996c600e1e",
          "code": "C6Y6R7H2NQ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "29d0cd96-c753-48e2-a71e-1cecc250fb7c",
          "amount": {
            "uuid": "311e0bca-c0c4-41d7-9e10-574b2dd5447d"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "777a403a-b761-437d-890b-c67d894237ff",
            "refuuid": "2890a69d-7cbb-4802-8d94-8218317b0378",
            "name": "2-((4-(Dimethylamino)phenyl)azo)-1,3-dimethyl-1H-imidazolium trichlorozincate(1-)",
            "unii": "HX42FD5HB9",
            "linking_id": "HX42FD5HB9",
            "ref_pname": "2-((4-(Dimethylamino)phenyl)azo)-1,3-dimethyl-1H-imidazolium trichlorozincate(1-)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c96bb178-1c73-4cf2-9089-a77c250ba79e",
          "amount": {
            "uuid": "edea28ac-9006-4581-8b9d-8dddbc66a93b"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "85bdee57-693e-40b8-b4c2-1f3c3936b331",
            "refuuid": "a2957611-4a12-44c6-a5f2-e479fe11fab8",
            "name": "2-((4-(Dimethylamino)phenyl)azo)-1,3-dimethyl-1H-imidazolium methyl sulfate",
            "unii": "DZ4MZ3V8DK",
            "linking_id": "DZ4MZ3V8DK",
            "ref_pname": "2-((4-(Dimethylamino)phenyl)azo)-1,3-dimethyl-1H-imidazolium methyl sulfate",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e9bac510-314d-4a90-b1c1-b3eb06223254",
          "amount": {
            "uuid": "aae7cf2d-2f19-44f2-8eb8-7bbe608cf37f"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "ed494601-6316-4a74-976b-b4b9e9dd1fe3",
            "refuuid": "8670c263-242c-4d5f-b4d3-4a8ea73cb3e0",
            "name": "2-((4-(Dimethylamino)phenyl)azo)-1,3-dimethyl-1H-imidazolium acetate",
            "unii": "BM9EH9BXQ8",
            "linking_id": "BM9EH9BXQ8",
            "ref_pname": "2-((4-(Dimethylamino)phenyl)azo)-1,3-dimethyl-1H-imidazolium acetate",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e2b3c93b-f247-4660-9ab6-b4d265275388",
          "amount": {
            "uuid": "912803f1-a2fe-4543-a9b4-740848f1538e"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "b7616087-16c2-490a-90b3-71f201fe5014",
            "refuuid": "8b087d15-1087-4664-9ad5-f2bd9f5e3fab",
            "name": "BASIC RED 51",
            "unii": "A7A946JJ6I",
            "linking_id": "A7A946JJ6I",
            "ref_pname": "BASIC RED 51",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1f9895cb-e0cf-41f6-b197-2b2510d730b9",
          "amount": {
            "uuid": "032469be-58a5-44d5-803c-d0334d4ccea9"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "25910ecb-9c16-49fd-bc20-3b84f832911d",
            "refuuid": "1c143357-fda9-455a-ac1e-85d34efb374e",
            "name": "2-[2-[4-(Dimethylamino)phenyl]diazenyl]-1,3-dimethyl-1H-imidazolium tetrachlorozincate",
            "unii": "Q867ME732N",
            "linking_id": "Q867ME732N",
            "ref_pname": "2-[2-[4-(Dimethylamino)phenyl]diazenyl]-1,3-dimethyl-1H-imidazolium tetrachlorozincate",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "14334225-3890-4eb8-97d6-721ec77e50ef",
          "name": "1H-Imidazolium, 2-[(1E)-2-[4-(dimethylamino)phenyl]diazenyl]-1,3-dimethyl-",
          "stdName": "1H-IMIDAZOLIUM, 2-((1E)-2-(4-(DIMETHYLAMINO)PHENYL)DIAZENYL)-1,3-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "91e69cb0-3952-4993-9cd7-7a0147373e1c"
          ],
          "display_name": false
        },
        {
          "uuid": "688e1af5-9ab5-44bb-b6fc-3ec37a687cae",
          "name": "1H-Imidazolium, 2-[2-[4-(dimethylamino)phenyl]diazenyl]-1,3-dimethyl-",
          "stdName": "1H-IMIDAZOLIUM, 2-(2-(4-(DIMETHYLAMINO)PHENYL)DIAZENYL)-1,3-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "91e69cb0-3952-4993-9cd7-7a0147373e1c"
          ],
          "display_name": false
        },
        {
          "uuid": "7fc21dc1-b190-4ea5-b9a0-14cc28d2dd00",
          "name": "1H-Imidazolium, 2-[[4-(dimethylamino)phenyl]azo]-1,3-dimethyl-",
          "stdName": "1H-IMIDAZOLIUM, 2-((4-(DIMETHYLAMINO)PHENYL)AZO)-1,3-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "91e69cb0-3952-4993-9cd7-7a0147373e1c"
          ],
          "display_name": false
        },
        {
          "uuid": "ecaf7a2d-a27e-4612-9337-2d18f392cd03",
          "name": "2-[(1E)-2-[4-(Dimethylamino)phenyl]diazenyl]-1,3-dimethyl-1H-imidazolium",
          "stdName": "2-((1E)-2-(4-(DIMETHYLAMINO)PHENYL)DIAZENYL)-1,3-DIMETHYL-1H-IMIDAZOLIUM",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "91e69cb0-3952-4993-9cd7-7a0147373e1c"
          ],
          "display_name": false
        },
        {
          "uuid": "c9ac200b-a80b-440d-8139-6dfb575da317",
          "name": "2-[2-[4-(Dimethylamino)phenyl]diazenyl]-1,3-dimethyl-1H-imidazolium",
          "stdName": "2-(2-(4-(DIMETHYLAMINO)PHENYL)DIAZENYL)-1,3-DIMETHYL-1H-IMIDAZOLIUM",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "91e69cb0-3952-4993-9cd7-7a0147373e1c"
          ],
          "display_name": true
        },
        {
          "uuid": "e1f23f0b-13be-4135-b335-fc8dc8e736c3",
          "name": "RUBY RED",
          "stdName": "RUBY RED",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1abb31f2-7327-484d-870d-70773f1c43c7"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1abb31f2-7327-484d-870d-70773f1c43c7",
          "citation": "PUBCHEM",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/113376",
          "doc_type": "PUBCHEM",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "91e69cb0-3952-4993-9cd7-7a0147373e1c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3bb96e91-b5f6-40da-a6e4-9909f9940087",
          "id": "3bb96e91-b5f6-40da-a6e4-9909f9940087",
          "molfile": "\n  Marvin  01242316022D          \n\n 18 19  0  0  0  0            999 V2000\n    6.1050   -3.5731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8895   -3.8281    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.3745   -3.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8895   -2.4932    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1050   -2.7482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1444   -1.7086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1444   -4.6128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1995   -3.1607    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6120   -2.4462    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4370   -2.4462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8495   -1.7318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6745   -1.7318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8495   -3.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6745   -3.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0870   -2.4462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9120   -2.4462    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3245   -1.7318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3245   -3.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  5  1  2  0  0  0  0\n  2  3  2  0  0  0  0\n  2  7  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  8  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 13  1  0  0  0  0\n 11 12  1  0  0  0  0\n 15 12  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\nM  CHG  1   2   1\nM  END",
          "smiles": "CN(C)c1ccc(cc1)/N=N/c2n(C)cc[n+]2C",
          "formula": "C13H18N5",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7ec5f599-3fe9-4949-8be7-7d7021d08e7a"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "244.316",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0a7d5597-3ecd-44f9-b30d-c9ed4f44ba2b",
      "version": "8",
      "structure": {
        "id": "0f7f378d-39ae-407e-81e8-25601f3ed8d8",
        "molfile": "\n   JSDraw201242316032D\n\n 18 19  0  0  0  0              0 V2000\n   14.6120   -9.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0955   -9.6826    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   17.0125   -8.4206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0955   -7.1585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6120   -7.6406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5775   -5.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5775  -11.1663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5725   -8.4206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3525   -7.0696    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   20.9125   -7.0696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6925   -5.7186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2525   -5.7186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6925   -8.4206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2525   -8.4206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.0325   -7.0696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.5925   -7.0696    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   26.3725   -5.7186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.3725   -8.4206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  1  2  0  0  0  0\n  4  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 12  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\nM  CHG  1   2   1\nM  END",
        "smiles": "CN(C)c1ccc(cc1)/N=N/c2n(C)cc[n+]2C",
        "formula": "C13H18N5",
        "atropisomerism": "No",
        "charge": 1,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "244.316",
        "optical_activity": "NONE",
        "references": [
          "91e69cb0-3952-4993-9cd7-7a0147373e1c"
        ],
        "stereo_centers": 0
      },
      "unii": "C6Y6R7H2NQ"
    }
  ]
}