{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "329e149b-a11f-41d3-8ac8-615c9219296d",
          "code": "19666-30-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=19666-30-9",
          "code_system": "CAS",
          "references": [
            "e668be8f-746b-49c8-a87e-a6ed7105117b",
            "bbfe84c0-7549-4f57-bb8d-16b891783370"
          ]
        },
        {
          "uuid": "0bd6af5d-6fff-4e22-97e3-fe89f217d574",
          "code": "C012466",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67012466",
          "code_system": "MESH",
          "references": [
            "e668be8f-746b-49c8-a87e-a6ed7105117b"
          ]
        },
        {
          "uuid": "cf770be8-aeb0-4226-805e-dc56609b57ce",
          "code": "109001",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3185",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "e668be8f-746b-49c8-a87e-a6ed7105117b"
          ]
        },
        {
          "uuid": "3e25bb6a-8716-45ab-a09c-ab9bb7d6ca46",
          "code": "243-215-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.039.272",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e668be8f-746b-49c8-a87e-a6ed7105117b"
          ]
        },
        {
          "uuid": "4fb3c4c6-a2b8-4a5a-a89d-1f69243f137c",
          "code": "m8276",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8276?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e668be8f-746b-49c8-a87e-a6ed7105117b"
          ]
        },
        {
          "uuid": "f0de87b3-b355-41c3-b999-951c3d88bea9",
          "code": "29732",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/29732",
          "code_system": "PUBCHEM",
          "references": [
            "e668be8f-746b-49c8-a87e-a6ed7105117b"
          ]
        },
        {
          "uuid": "7fdba58a-6c52-25cc-8027-c8840228cfde",
          "code": "6936",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6936",
          "code_system": "HSDB",
          "references": [
            "d84cdb4b-7515-5edd-2d72-17c81575af71"
          ]
        },
        {
          "uuid": "573f9f1c-2514-31e7-09b9-e26ee7ba8556",
          "code": "DTXSID3024239",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3024239",
          "code_system": "EPA CompTox",
          "references": [
            "08f74d04-5cb0-2281-65a1-10c1cbbc20be"
          ]
        },
        {
          "uuid": "445e8fd0-ba46-44aa-950f-d7b091e9c3e2",
          "code": "C6U0E0YTP6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "53c8d2c2-5146-725f-cdba-5884a17c4339",
          "code": "oxadiazon",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/oxadiazon.html",
          "code_system": "ALANWOOD",
          "references": [
            "d376f2b3-768f-fb6e-16f2-3e7d5d770fc8"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2235662a-5bb7-4216-9fe3-fc01f10509b2",
          "name": "3-(2,4-DICHLORO-5-(1-METHYLETHOXY)PHENYL)-5-(1,1-DIMETHYLETHYL)-1,3,4-OXADIAZOL-2(3H)-ONE",
          "stdName": "3-(2,4-DICHLORO-5-(1-METHYLETHOXY)PHENYL)-5-(1,1-DIMETHYLETHYL)-1,3,4-OXADIAZOL-2(3H)-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6e31db3-9395-46f2-90d3-0234d5de6920",
            "7343e919-b0b9-405c-8b68-b6f4b556ca98"
          ],
          "display_name": false
        },
        {
          "uuid": "c2ff9a55-751b-4c14-913c-3781666ead3f",
          "name": "5-TERT-BUTYL-3-(2,4-DICHLORO-5-ISOPROPOXYPHENYL)-1,3,4-OXADIAZOL-2(3H)-ONE",
          "stdName": "5-TERT-BUTYL-3-(2,4-DICHLORO-5-ISOPROPOXYPHENYL)-1,3,4-OXADIAZOL-2(3H)-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "807cb906-b74d-4890-8764-1c07fab64633",
            "7343e919-b0b9-405c-8b68-b6f4b556ca98"
          ],
          "display_name": false
        },
        {
          "uuid": "0d19598d-9bb3-4a23-8478-b8f0b77d03f2",
          "name": "OXADIAZON",
          "stdName": "OXADIAZON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a134f87d-5727-4bbc-87a2-676656377ca5",
            "60774cd2-fe29-40d9-9237-c681a39be025",
            "ecec6aa4-a880-42dd-8cac-78a228496788",
            "b4eee245-7b78-4fee-9ee1-1b44e3f420a5",
            "1afd7dce-61af-4b6a-8032-8d1bf0b76ec3",
            "1baaffe2-170d-4555-bf38-56498760575b",
            "b6e0780a-3b12-4f06-9f7d-1afea94ccee4",
            "ee451f75-da70-4938-8f25-9b4851a11dae"
          ],
          "display_name": true
        },
        {
          "uuid": "4b9b12c6-1f8c-4094-b983-a47caa1e8fee",
          "name": "OXADIAZON [HSDB]",
          "stdName": "OXADIAZON [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ecec6aa4-a880-42dd-8cac-78a228496788",
            "1afd7dce-61af-4b6a-8032-8d1bf0b76ec3"
          ],
          "display_name": false
        },
        {
          "uuid": "0dc8e83c-63d2-44c9-aeec-1552acc9eea5",
          "name": "OXADIAZON [ISO]",
          "stdName": "OXADIAZON [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a134f87d-5727-4bbc-87a2-676656377ca5",
            "ecec6aa4-a880-42dd-8cac-78a228496788"
          ],
          "display_name": false
        },
        {
          "uuid": "017a9e36-1a1f-4f9b-adce-7b0e95ceae41",
          "name": "OXADIAZON [MI]",
          "stdName": "OXADIAZON [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ecec6aa4-a880-42dd-8cac-78a228496788",
            "b6e0780a-3b12-4f06-9f7d-1afea94ccee4"
          ],
          "display_name": false
        },
        {
          "uuid": "e9d3a98f-8200-47bd-b088-e90d0113928b",
          "name": "RONSTAR",
          "stdName": "RONSTAR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ecec6aa4-a880-42dd-8cac-78a228496788",
            "2bfe003f-0fb6-41bd-9e71-986be7ea22cd"
          ],
          "display_name": false
        },
        {
          "uuid": "1141e680-4131-4eba-bbc0-cbe18bda3c5a",
          "name": "RP 17623",
          "stdName": "RP 17623",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ecec6aa4-a880-42dd-8cac-78a228496788",
            "2bfe003f-0fb6-41bd-9e71-986be7ea22cd"
          ],
          "display_name": false
        },
        {
          "uuid": "e732ba20-e687-4189-89da-f9c99b876e77",
          "name": "RP-17623",
          "stdName": "RP-17623",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ecec6aa4-a880-42dd-8cac-78a228496788",
            "2bfe003f-0fb6-41bd-9e71-986be7ea22cd"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1baaffe2-170d-4555-bf38-56498760575b",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7343e919-b0b9-405c-8b68-b6f4b556ca98",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "807cb906-b74d-4890-8764-1c07fab64633",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6e31db3-9395-46f2-90d3-0234d5de6920",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6e0780a-3b12-4f06-9f7d-1afea94ccee4",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ecec6aa4-a880-42dd-8cac-78a228496788",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2bfe003f-0fb6-41bd-9e71-986be7ea22cd",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1afd7dce-61af-4b6a-8032-8d1bf0b76ec3",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a134f87d-5727-4bbc-87a2-676656377ca5",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e668be8f-746b-49c8-a87e-a6ed7105117b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390947000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad99d070-f668-4d0b-b2f4-97b30b6a459a",
          "citation": "SRS import [C6U0E0YTP6]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=C6U0E0YTP6",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390947000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc9bcfb1-a65a-4c6a-803f-4d5ef78e7e3a",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4eee245-7b78-4fee-9ee1-1b44e3f420a5",
          "citation": "OXADIAZON [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "60774cd2-fe29-40d9-9237-c681a39be025",
          "citation": "OXADIAZON [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ee451f75-da70-4938-8f25-9b4851a11dae",
          "citation": "OXADIAZON [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d84cdb4b-7515-5edd-2d72-17c81575af71",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+19666-30-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "08f74d04-5cb0-2281-65a1-10c1cbbc20be",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=19666-30-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d376f2b3-768f-fb6e-16f2-3e7d5d770fc8",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "bbfe84c0-7549-4f57-bb8d-16b891783370",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4ecffbac-7723-4d75-9e04-70eab04a7f5a",
          "id": "4ecffbac-7723-4d75-9e04-70eab04a7f5a",
          "molfile": "\n  Marvin  01132104072D          \n\n 22 23  0  0  0  0            999 V2000\n   10.5098   -7.0945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7953   -6.6821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0808   -7.0945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7953   -5.8571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0808   -5.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3663   -5.8571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6519   -5.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6519   -4.6196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9376   -4.2071    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.3663   -4.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0808   -4.6196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7953   -4.2071    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.9376   -5.8571    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1838   -5.5216    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6318   -6.1347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0444   -6.8490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8512   -6.6775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4643   -7.2295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8114   -6.0484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5158   -6.8186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9688   -5.2385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0183   -5.8210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 11  2  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n 13  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 17  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 19  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 19 22  1  0  0  0  0\nM  END",
          "smiles": "CC(C)Oc1cc(c(cc1Cl)Cl)-n2c(=O)oc(C(C)(C)C)n2",
          "formula": "C15H18Cl2N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "76146c32-25c8-40b5-ac88-f0fb90a74a14"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "345.2215",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8b2e23cf-e14a-41c1-80c0-f49429ee28be",
      "version": "6",
      "structure": {
        "id": "dd0e7305-e104-431f-a849-5a9b313d790c",
        "molfile": "\n  Marvin  01132111282D          \n\n 22 23  0  0  0  0            999 V2000\n    6.9376   -5.8571    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6519   -5.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3663   -5.8571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0808   -5.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0808   -4.6196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7953   -4.2071    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.3663   -4.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6519   -4.6196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9376   -4.2071    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.7953   -5.8571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7953   -6.6821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5098   -7.0945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0808   -7.0945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1838   -5.5216    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6318   -6.1347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8114   -6.0484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5158   -6.8186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9688   -5.2385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0183   -5.8210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0444   -6.8490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8512   -6.6775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4643   -7.2295    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  2  0  0  0  0\n  8  7  1  0  0  0  0\n  2  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  4 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n  1 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 16 19  1  0  0  0  0\n 15 20  1  0  0  0  0\n 21 20  1  0  0  0  0\n  1 21  1  0  0  0  0\n 21 22  2  0  0  0  0\nM  END",
        "smiles": "CC(C)Oc1cc(c(cc1Cl)Cl)-n2c(=O)oc(C(C)(C)C)n2",
        "formula": "C15H18Cl2N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "345.2215",
        "optical_activity": "NONE",
        "references": [
          "fc9bcfb1-a65a-4c6a-803f-4d5ef78e7e3a",
          "ad99d070-f668-4d0b-b2f4-97b30b6a459a"
        ],
        "stereo_centers": 0
      },
      "unii": "C6U0E0YTP6"
    }
  ]
}