{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "89c34994-216a-4136-8d80-41b1544828da",
          "code": "101-05-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=101-05-3",
          "code_system": "CAS",
          "references": [
            "1613aaed-657c-4007-8413-0406530a7ed9",
            "a6845db5-970a-4b37-98eb-d7170bae8a12"
          ]
        },
        {
          "uuid": "f59e994e-a031-40eb-b2f9-988bcd6d0413",
          "code": "C004855",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67004855",
          "code_system": "MESH",
          "references": [
            "1613aaed-657c-4007-8413-0406530a7ed9"
          ]
        },
        {
          "uuid": "8ada85dd-8dd9-4b28-85f6-21c7b4a8e928",
          "code": "ANILAZINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Anilazine",
          "code_system": "WIKIPEDIA",
          "references": [
            "1613aaed-657c-4007-8413-0406530a7ed9"
          ]
        },
        {
          "uuid": "f7a47a70-c859-49af-a0f6-5008e933e6aa",
          "code": "80811",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:141",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "1613aaed-657c-4007-8413-0406530a7ed9"
          ]
        },
        {
          "uuid": "fcd836d6-c7cf-46c7-bae5-33d995af445c",
          "code": "202-910-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.646",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1613aaed-657c-4007-8413-0406530a7ed9"
          ]
        },
        {
          "uuid": "2bda85b4-6fcf-4d35-8c93-1c927eda6967",
          "code": "m1920",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1920?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "1613aaed-657c-4007-8413-0406530a7ed9"
          ]
        },
        {
          "uuid": "60ca0970-f2bc-4066-8893-140c1ad27e37",
          "code": "7541",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7541",
          "code_system": "PUBCHEM",
          "references": [
            "1613aaed-657c-4007-8413-0406530a7ed9"
          ]
        },
        {
          "uuid": "939c5026-5085-5711-8988-5e286614f0a3",
          "code": "1567",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1567",
          "code_system": "HSDB",
          "references": [
            "4d3f63a2-b967-ae90-d4f9-eb256bede2bc"
          ]
        },
        {
          "uuid": "e85c5467-bfe7-4ef7-740c-f3615fe039e5",
          "code": "DTXSID9020089",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9020089",
          "code_system": "EPA CompTox",
          "references": [
            "087eed04-4bdc-0222-c0d0-739e8fa06ea8"
          ]
        },
        {
          "uuid": "9f924bfc-61c3-4ea4-8526-e4d5cf04b0f4",
          "code": "C6E8Y03ZJN",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d8d6e426-1873-e5f6-37f9-f49a95276f2a",
          "code": "82076",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:82076",
          "code_system": "CHEBI",
          "references": [
            "84ee9a09-f46a-0a1a-d36d-ba88ae92716c"
          ]
        },
        {
          "uuid": "9c3c999e-fa9c-99bc-abb7-2ee00518500d",
          "code": "3851",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=3851",
          "code_system": "NSC",
          "references": [
            "54fb5bf9-216b-2302-d607-13c044123fb1"
          ]
        },
        {
          "uuid": "05cd95a3-565b-1791-e17b-5ef7e4b1266a",
          "code": "anilazine",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/anilazine.html",
          "code_system": "ALANWOOD",
          "references": [
            "35e4cb71-2bc2-e984-4d6c-114b94b93946"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "27e8904f-64b3-4e45-a2a0-a0c30bef0142",
          "name": "(O-CHLOROANILINO)DICHLOROTRIAZINE",
          "stdName": "(O-CHLOROANILINO)DICHLOROTRIAZINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f10c4a1b-47ee-4172-a3a9-aab35db8b18e",
            "8af7b3e5-3637-4d73-81b7-9fd75e3f0a76"
          ],
          "display_name": false
        },
        {
          "uuid": "66764423-56be-47c0-8281-c725cd93ab8a",
          "name": "4,6-DICHLORO-N-(2-CHLOROPHENYL)-1,3,5-TRIAZIN-2-AMINE",
          "stdName": "4,6-DICHLORO-N-(2-CHLOROPHENYL)-1,3,5-TRIAZIN-2-AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7853caa5-ce12-4232-823b-62aa7d1be658",
            "cccb813a-973d-43bb-a986-bfd588850c00"
          ],
          "display_name": false
        },
        {
          "uuid": "762e4b98-d755-45aa-aa73-40173a643bb1",
          "name": "ANILAZINE",
          "stdName": "ANILAZINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f49a7ac-64c1-4267-a8c8-573e5bf5aa02",
            "f10c4a1b-47ee-4172-a3a9-aab35db8b18e",
            "bc29b5a9-5ca9-4424-953a-8d648e69dc51",
            "c8d0562c-6020-46d1-9030-b82cba35ba1b",
            "8af7b3e5-3637-4d73-81b7-9fd75e3f0a76",
            "65cfece8-57ce-483d-a3a1-2a329d965cc6",
            "c69019e4-5b49-456a-a01d-8cacb339bdb0",
            "48f1ee00-338d-47f2-91b6-f975d3426ffb"
          ],
          "display_name": true
        },
        {
          "uuid": "6ae47615-ec36-4169-bf00-cd4df2a41911",
          "name": "ANILAZINE [HSDB]",
          "stdName": "ANILAZINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f10c4a1b-47ee-4172-a3a9-aab35db8b18e",
            "65cfece8-57ce-483d-a3a1-2a329d965cc6"
          ],
          "display_name": false
        },
        {
          "uuid": "8c83022c-b602-43c3-b2c0-a94baa32ead8",
          "name": "ANILAZINE [ISO]",
          "stdName": "ANILAZINE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f10c4a1b-47ee-4172-a3a9-aab35db8b18e",
            "48f1ee00-338d-47f2-91b6-f975d3426ffb"
          ],
          "display_name": false
        },
        {
          "uuid": "9b0cd7ec-c7ff-4f1c-a0a9-9e1496884c57",
          "name": "ANILAZINE [MI]",
          "stdName": "ANILAZINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f10c4a1b-47ee-4172-a3a9-aab35db8b18e",
            "c69019e4-5b49-456a-a01d-8cacb339bdb0"
          ],
          "display_name": false
        },
        {
          "uuid": "2dbb68a6-1ed3-44e7-9bdd-3168fd078e23",
          "name": "DYRENE",
          "stdName": "DYRENE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f10c4a1b-47ee-4172-a3a9-aab35db8b18e",
            "8af7b3e5-3637-4d73-81b7-9fd75e3f0a76"
          ],
          "display_name": false
        },
        {
          "uuid": "964d0782-b784-41b2-8348-a6d6f337a54a",
          "name": "NSC-3851",
          "stdName": "NSC-3851",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f10c4a1b-47ee-4172-a3a9-aab35db8b18e",
            "c25c7434-b063-47de-adb5-cc9a50567966"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8af7b3e5-3637-4d73-81b7-9fd75e3f0a76",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cccb813a-973d-43bb-a986-bfd588850c00",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7853caa5-ce12-4232-823b-62aa7d1be658",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c69019e4-5b49-456a-a01d-8cacb339bdb0",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f10c4a1b-47ee-4172-a3a9-aab35db8b18e",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "65cfece8-57ce-483d-a3a1-2a329d965cc6",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48f1ee00-338d-47f2-91b6-f975d3426ffb",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c25c7434-b063-47de-adb5-cc9a50567966",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1613aaed-657c-4007-8413-0406530a7ed9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389727000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab93c4f2-6ccc-4df0-91fd-c6592fd201be",
          "citation": "SRS import [C6E8Y03ZJN]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=C6E8Y03ZJN",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389727000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22c42888-41bd-425d-969a-ce478423bb2b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f49a7ac-64c1-4267-a8c8-573e5bf5aa02",
          "citation": "ANILAZINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c8d0562c-6020-46d1-9030-b82cba35ba1b",
          "citation": "ANILAZINE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bc29b5a9-5ca9-4424-953a-8d648e69dc51",
          "citation": "ANILAZINE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4d3f63a2-b967-ae90-d4f9-eb256bede2bc",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+101-05-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "087eed04-4bdc-0222-c0d0-739e8fa06ea8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=101-05-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "35e4cb71-2bc2-e984-4d6c-114b94b93946",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "84ee9a09-f46a-0a1a-d36d-ba88ae92716c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "54fb5bf9-216b-2302-d607-13c044123fb1",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "a6845db5-970a-4b37-98eb-d7170bae8a12",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "51b26282-438f-4cc5-871c-f6a51b839f3a",
          "id": "51b26282-438f-4cc5-871c-f6a51b839f3a",
          "molfile": "\n  Marvin  01132104152D          \n\n 16 17  0  0  0  0            999 V2000\n    0.0619   -3.9114    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.0568   -3.0934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7714   -2.6729    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7663   -1.8550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4784   -1.4371    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.0464   -1.4474    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6579   -1.8602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3751   -1.4525    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0898   -1.8628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0821   -2.6910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7968   -3.1064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5166   -2.6936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5089   -1.8731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8045   -1.4551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8123   -0.6347    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6605   -2.6858    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 16  2  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  7  1  0  0  0  0\n 16  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 14  9  2  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(c(c1)Cl)Nc2nc(Cl)nc(Cl)n2",
          "formula": "C9H5Cl3N4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bde9b96b-6d11-4909-b0f0-6baabb2409b3"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "275.522",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4058d105-6005-4ec0-ac9b-5fd3a6ff76f6",
      "version": "8",
      "structure": {
        "id": "9257919d-5992-4fd6-b173-eeed0e703acf",
        "molfile": "\n  Marvin  01132107352D          \n\n 16 17  0  0  0  0            999 V2000\n   -0.6579   -1.8602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0464   -1.4474    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6605   -2.6858    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7714   -2.6729    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0568   -3.0934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7663   -1.8550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3751   -1.4525    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0898   -1.8628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8045   -1.4551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0619   -3.9114    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.4784   -1.4371    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8123   -0.6347    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0821   -2.6910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5089   -1.8731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7968   -3.1064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5166   -2.6936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  3  2  0  0  0  0\n  6  2  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  5  1  0  0  0  0\n 11  6  1  0  0  0  0\n 12  9  1  0  0  0  0\n 13  8  1  0  0  0  0\n 14  9  1  0  0  0  0\n 15 13  2  0  0  0  0\n 16 15  1  0  0  0  0\n  4  6  2  0  0  0  0\n 14 16  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(c(c1)Cl)Nc2nc(Cl)nc(Cl)n2",
        "formula": "C9H5Cl3N4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "275.522",
        "optical_activity": "NONE",
        "references": [
          "22c42888-41bd-425d-969a-ce478423bb2b",
          "ab93c4f2-6ccc-4df0-91fd-c6592fd201be"
        ],
        "stereo_centers": 0
      },
      "unii": "C6E8Y03ZJN"
    }
  ]
}