{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "1371e2fe-90a9-4c91-81aa-fbb6940b1d16", "code": "78185-80-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=78185-80-5", "code_system": "CAS", "references": [ "f52953b8-3c97-3c91-a2a1-57b4a520ca69" ] }, { "uuid": "825d0939-ef16-f006-eb90-2d12bf6f26a8", "code": "449370", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/449370", "code_system": "PUBCHEM", "references": [ "ee94534b-007b-a6d3-affd-644d7583c59d" ] }, { "uuid": "0eb06bac-017d-4fa3-9175-c87752e0d22c", "code": "C64KRU5QYK", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "9bfb1ec5-1596-73bc-b005-6f7e95ba8d6c", "name": ".ALPHA.-L-3-O-METHYLRHAMNOPYRANOSE", "stdName": ".ALPHA.-L-3-O-METHYLRHAMNOPYRANOSE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2d6cb678-9516-ca9c-bebe-9b61d311b2e8" ], "display_name": false }, { "uuid": "e4c48651-2a78-34c1-836c-961893cfffa5", "name": ".ALPHA.-L-ACOFRIOSE PYRANOSE", "stdName": ".ALPHA.-L-ACOFRIOSE PYRANOSE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2d6cb678-9516-ca9c-bebe-9b61d311b2e8" ], "display_name": true }, { "uuid": "f37c9329-5293-2154-962c-af9abfac79fe", "name": ".ALPHA.-L-MANNOPYRANOSE, 6-DEOXY-3-O-METHYL-", "stdName": ".ALPHA.-L-MANNOPYRANOSE, 6-DEOXY-3-O-METHYL-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f52953b8-3c97-3c91-a2a1-57b4a520ca69" ], "display_name": false }, { "uuid": "9102c304-e8a9-f36c-e037-df660e312603", "name": "6-DEOXY-3-O-METHYL-.ALPHA.-L-MANNOPYRANOSE", "stdName": "6-DEOXY-3-O-METHYL-.ALPHA.-L-MANNOPYRANOSE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f52953b8-3c97-3c91-a2a1-57b4a520ca69" ], "display_name": false } ], "references": [ { "uuid": "2d6cb678-9516-ca9c-bebe-9b61d311b2e8", "citation": "FDA_SRS", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "f52953b8-3c97-3c91-a2a1-57b4a520ca69", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ee94534b-007b-a6d3-affd-644d7583c59d", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "aa6b4951-f90d-9f66-2d3e-4f419ce444c1", "id": "aa6b4951-f90d-9f66-2d3e-4f419ce444c1", "molfile": "\n Marvin 01132108512D \n\n 12 12 0 0 1 0 999 V2000\n 16.3480 -4.4824 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 17.0624 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3480 -3.6574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6335 -3.2450 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 15.6335 -2.4200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9190 -3.6576 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 14.2045 -3.2450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9190 -4.4826 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 14.2045 -4.8950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4901 -4.4826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6335 -4.8950 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 15.6335 -5.7200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 3 1 0 0 0 0\n 11 1 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 6 0 0 0\n 6 4 1 0 0 0 0\n 6 7 1 1 0 0 0\n 8 6 1 0 0 0 0\n 8 9 1 1 0 0 0\n 11 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 12 1 6 0 0 0\nM END", "smiles": "C[C@H]1[C@@H]([C@H]([C@H]([C@H](O)O1)O)OC)O", "formula": "C7H14O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "331425e5-c53a-40b4-844a-848882af908f" }, "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "178.1833", "optical_activity": "UNSPECIFIED", "stereo_centers": 5 } ], "definition_level": "COMPLETE", "uuid": "c9684477-4454-f78c-7ab3-34edb39609ad", "version": "5", "structure": { "id": "72d1ce99-fbd5-c462-e938-7ef4e4c16b7f", "molfile": "L-Mannopyranose, 6-deoxy-3-O-methyl-\n Marvin 01132105572D \n\n 12 12 0 0 1 0 999 V2000\n 14.2045 -4.8950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4901 -4.4826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9190 -4.4826 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 15.6335 -4.8950 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 15.6335 -5.7200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3480 -4.4824 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 17.0624 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3480 -3.6574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6335 -3.2450 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.9190 -3.6576 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.2045 -3.2450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6335 -2.4200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 1 1 1 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 6 0 0 0\n 4 6 1 0 0 0 0\n 6 7 1 1 0 0 0\n 6 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 3 10 1 0 0 0 0\n 10 11 1 1 0 0 0\n 9 12 1 6 0 0 0\nM END", "smiles": "C[C@H]1[C@@H]([C@H]([C@H]([C@H](O)O1)O)OC)O", "formula": "C7H14O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "178.1833", "optical_activity": "UNSPECIFIED", "references": [ "f52953b8-3c97-3c91-a2a1-57b4a520ca69" ], "stereo_centers": 5 }, "unii": "C64KRU5QYK" } ] }