{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "543b42b2-46b3-4f39-bc47-2f438caf202a",
          "code": "126-15-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=126-15-8",
          "code_system": "CAS",
          "references": [
            "5932c18e-5342-47ca-b753-123e881823bf",
            "de06a5e7-853f-4db2-9ff3-2ff484d26528"
          ]
        },
        {
          "uuid": "89b2fd1c-de74-4f33-88fb-0c097d60a833",
          "code": "43302",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:350",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "5932c18e-5342-47ca-b753-123e881823bf"
          ]
        },
        {
          "uuid": "e87dba83-f65c-4f35-90fa-bd152a1c53b2",
          "code": "204-773-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.340",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "5932c18e-5342-47ca-b753-123e881823bf"
          ]
        },
        {
          "uuid": "213f767c-fa1e-4e87-8dbc-47067bdead6b",
          "code": "m9475",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9475?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "5932c18e-5342-47ca-b753-123e881823bf"
          ]
        },
        {
          "uuid": "6ce0800e-7d5d-44c4-bd0d-a0090adfe8c4",
          "code": "31341",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/31341",
          "code_system": "PUBCHEM",
          "references": [
            "5932c18e-5342-47ca-b753-123e881823bf"
          ]
        },
        {
          "uuid": "3a78d218-9e7e-e552-e718-c12c9adc749a",
          "code": "5609",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5609",
          "code_system": "HSDB",
          "references": [
            "b53490c6-dec0-f732-8bd9-d36b32243d65"
          ]
        },
        {
          "uuid": "534a6118-82da-9cf8-0b26-caf0f1308f9a",
          "code": "DTXSID3041320",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3041320",
          "code_system": "EPA CompTox",
          "references": [
            "a5b954f3-0067-f2a3-44a0-b3cbb3d4a9a8"
          ]
        },
        {
          "uuid": "fe47f9f1-a110-47ea-b60d-019a8c1c9fca",
          "code": "C62PHK07EV",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f944777d-60ea-2050-97f0-8693938df792",
          "code": "52965",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=52965",
          "code_system": "NSC",
          "references": [
            "522b42f1-b29d-115f-f35f-f7e2b201e52a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "91664a36-c630-4eb5-9e45-cee049fc22fa",
          "name": "1,5A,6,9,9A,9B-HEXAHYDRO-4A(4H)-DIBENZOFURANCARBOXALDEHYDE",
          "stdName": "1,5A,6,9,9A,9B-HEXAHYDRO-4A(4H)-DIBENZOFURANCARBOXALDEHYDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3818ae84-bb3d-449d-a215-221490b2dd29",
            "b6233b32-1b77-46e0-a7cb-0a9e3df5b1e2"
          ],
          "display_name": false
        },
        {
          "uuid": "d864397e-bbc8-48dd-8fc4-d162bfed531f",
          "name": "2,3,4,5-BIS(.DELTA.2-BUTENYLENE)TETRAHYDROFURFURA",
          "stdName": "2,3,4,5-BIS(.DELTA.2-BUTENYLENE)TETRAHYDROFURFURA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3818ae84-bb3d-449d-a215-221490b2dd29",
            "b6233b32-1b77-46e0-a7cb-0a9e3df5b1e2"
          ],
          "display_name": false
        },
        {
          "uuid": "f03316bf-26ce-4d8a-8718-027cf76d993b",
          "name": "2,3,4,5-BIS(2-BUTENYLENE)TETRAHYDROFURFURAL",
          "stdName": "2,3,4,5-BIS(2-BUTENYLENE)TETRAHYDROFURFURAL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3818ae84-bb3d-449d-a215-221490b2dd29",
            "b6233b32-1b77-46e0-a7cb-0a9e3df5b1e2"
          ],
          "display_name": false
        },
        {
          "uuid": "ddd09591-17f9-4ae8-8ba1-c1d0a8890ca3",
          "name": "2,3,4,5-BIS(2-BUTYLENE)TETRAHYDRO-2-FURALDEHYDE",
          "stdName": "2,3,4,5-BIS(2-BUTYLENE)TETRAHYDRO-2-FURALDEHYDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3818ae84-bb3d-449d-a215-221490b2dd29",
            "1d1da6fe-8b4d-453a-b216-c5e8ba6a0739"
          ],
          "display_name": true
        },
        {
          "uuid": "14b47183-2c00-4bfb-8400-ea5508ea156e",
          "name": "2,3:4,5-BIS(2-BUTENE-1,4-DIYL)TETRAHYDROFURFURAL",
          "stdName": "2,3:4,5-BIS(2-BUTENE-1,4-DIYL)TETRAHYDROFURFURAL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3818ae84-bb3d-449d-a215-221490b2dd29",
            "b6233b32-1b77-46e0-a7cb-0a9e3df5b1e2"
          ],
          "display_name": false
        },
        {
          "uuid": "f8c92348-3b0a-47bc-aecd-b5a73652f8fd",
          "name": "2,3:4,5-BIS(2-BUTYLENE)TETRAHYDRO-2-FURALDEHYDE",
          "stdName": "2,3:4,5-BIS(2-BUTYLENE)TETRAHYDRO-2-FURALDEHYDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "516ca4a5-7d94-4047-add7-04f8bb31150d",
            "3818ae84-bb3d-449d-a215-221490b2dd29"
          ],
          "display_name": false
        },
        {
          "uuid": "81fbe07c-f200-4e22-8307-db38061d5aed",
          "name": "2,3:4,5-DI(2-BUTENYL)TETRAHYDROFURFURAL [HSDB]",
          "stdName": "2,3:4,5-DI(2-BUTENYL)TETRAHYDROFURFURAL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3818ae84-bb3d-449d-a215-221490b2dd29",
            "da44f10a-6e0b-4c5f-8fd9-5db35d55f8e3"
          ],
          "display_name": false
        },
        {
          "uuid": "494ec151-ff79-4a32-81f3-b35b0d266faf",
          "name": "4A-FORMYL-1,4,4A,5A,6,9,9A,9B-OCTAHYDRODIBENZOFURAN",
          "stdName": "4A-FORMYL-1,4,4A,5A,6,9,9A,9B-OCTAHYDRODIBENZOFURAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3818ae84-bb3d-449d-a215-221490b2dd29",
            "b6233b32-1b77-46e0-a7cb-0a9e3df5b1e2"
          ],
          "display_name": false
        },
        {
          "uuid": "3d397b08-21fd-4c00-9fcc-d5da58ab5248",
          "name": "DIBUTYLENE TETRAFURFURAL",
          "stdName": "DIBUTYLENE TETRAFURFURAL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "bbaf377e-4f25-4fbc-bbda-1d7e97481288",
            "3818ae84-bb3d-449d-a215-221490b2dd29",
            "e6fca540-ead8-490d-82c3-e6d495219195"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ecc4556b-6b41-401e-bb21-b48242568659",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "d2093bd8-0578-4a97-ba2f-4d23d4b773d1",
          "name": "MGK 11",
          "stdName": "MGK 11",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3818ae84-bb3d-449d-a215-221490b2dd29",
            "1d1da6fe-8b4d-453a-b216-c5e8ba6a0739"
          ],
          "display_name": false
        },
        {
          "uuid": "c29e3917-0c35-4986-959d-8b9fa14029b1",
          "name": "NSC-52965",
          "stdName": "NSC-52965",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3818ae84-bb3d-449d-a215-221490b2dd29",
            "b6233b32-1b77-46e0-a7cb-0a9e3df5b1e2"
          ],
          "display_name": false
        },
        {
          "uuid": "e5eaa374-9e02-477e-8923-e8ac1148d50d",
          "name": "R-11 [MI]",
          "stdName": "R-11 [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3818ae84-bb3d-449d-a215-221490b2dd29",
            "4ed1664b-5195-44ef-8918-f1dad00c8eaa"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1d1da6fe-8b4d-453a-b216-c5e8ba6a0739",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3818ae84-bb3d-449d-a215-221490b2dd29",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4ed1664b-5195-44ef-8918-f1dad00c8eaa",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6233b32-1b77-46e0-a7cb-0a9e3df5b1e2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bbaf377e-4f25-4fbc-bbda-1d7e97481288",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "da44f10a-6e0b-4c5f-8fd9-5db35d55f8e3",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "516ca4a5-7d94-4047-add7-04f8bb31150d",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5932c18e-5342-47ca-b753-123e881823bf",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389676000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6bb1817e-6725-40ed-a752-ed99f103b2f5",
          "citation": "SRS import [C62PHK07EV]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=C62PHK07EV",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389676000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6fca540-ead8-490d-82c3-e6d495219195",
          "citation": "DIBUTYLENE TETRAFURFURAL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b53490c6-dec0-f732-8bd9-d36b32243d65",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+126-15-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a5b954f3-0067-f2a3-44a0-b3cbb3d4a9a8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=126-15-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "de06a5e7-853f-4db2-9ff3-2ff484d26528",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "522b42f1-b29d-115f-f35f-f7e2b201e52a",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0772c976-d69a-40ce-988e-548b828cfae6",
          "id": "0772c976-d69a-40ce-988e-548b828cfae6",
          "molfile": "\n  Marvin  01132100402D          \n\n 15 17  0  0  0  0            999 V2000\n    4.3759   -4.9789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1003   -4.5643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1045   -3.7393    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.2880   -3.9026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7393   -3.2871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0031   -2.5041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8113   -2.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3599   -2.9521    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.1849   -2.9564    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.7334   -2.3449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5374   -2.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7886   -3.3039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2316   -3.9111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4361   -3.7352    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.7703   -4.2251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  8  3  1  0  0  0  0\n 15  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 14  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\nM  END",
          "smiles": "C1=CCC2C(C1)C3CC=CCC3(C=O)O2",
          "formula": "C13H16O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1e707964-3abd-4b05-9780-9de10a79d812"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "204.2654",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "76a1b103-cc38-4dfa-8a14-f2bc145720c7",
      "version": "6",
      "structure": {
        "id": "57dc0e1a-d159-4ae9-bfbd-e89c40b05033",
        "molfile": "\n  Marvin  01132104332D          \n\n 15 17  0  0  0  0            999 V2000\n    5.1045   -3.7393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7703   -4.2251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3599   -2.9521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4361   -3.7352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1849   -2.9564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1003   -4.5643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3759   -4.9789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7393   -3.2871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0031   -2.5041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5374   -2.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7886   -3.3039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2880   -3.9026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8113   -2.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7334   -2.3449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2316   -3.9111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  3  1  0  0  0  0\n  1  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8 12  1  0  0  0  0\n  9 13  1  0  0  0  0\n 10 14  1  0  0  0  0\n 11 15  1  0  0  0  0\n 12  1  1  0  0  0  0\n 13  3  1  0  0  0  0\n 14  5  1  0  0  0  0\n 15  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10 11  2  0  0  0  0\nM  END",
        "smiles": "C1=CCC2C(C1)C3CC=CCC3(C=O)O2",
        "formula": "C13H16O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "204.2654",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b6233b32-1b77-46e0-a7cb-0a9e3df5b1e2",
          "6bb1817e-6725-40ed-a752-ed99f103b2f5"
        ],
        "stereo_centers": 4
      },
      "unii": "C62PHK07EV"
    }
  ]
}