{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "968cd001-fe5f-42e6-ac72-cf8975ab1de4",
          "code": "4207-40-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4207-40-3",
          "code_system": "CAS",
          "references": [
            "0776f5c2-72b7-4dcc-88ea-541aef3b9da4",
            "18724014-dfc1-4e79-8773-a4f252e27a0e"
          ]
        },
        {
          "uuid": "3f31b36a-c92a-455d-b0d9-935a2b01e410",
          "code": "224-126-2",
          "type": "PRIMARY",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0776f5c2-72b7-4dcc-88ea-541aef3b9da4"
          ]
        },
        {
          "uuid": "1435b564-bf5c-4089-8978-5cf45594f2f0",
          "code": "18629419",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18629419",
          "code_system": "PUBCHEM",
          "references": [
            "0776f5c2-72b7-4dcc-88ea-541aef3b9da4"
          ]
        },
        {
          "uuid": "dde66c9b-3bba-4b4a-8c92-fe41429e4b31",
          "code": "C554034748",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2eadbc29-12dc-3067-ba14-be5364e94a17",
          "code": "DTXSID80884047",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80884047",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d7ae8e26-91ed-4e9a-b65e-0bf269a67c29",
          "name": "ALLANTOIN ACETYL METHIONINE",
          "stdName": "ALLANTOIN ACETYL METHIONINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48203b16-85c0-4208-824d-9988d90fbefb",
            "5e680f54-8753-4dff-b63c-cf9413bcc6e5",
            "fb7a4875-72ee-4a01-86b5-0bee67f62948"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "e3eb617c-2306-4fb7-841e-8d66610252e0",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "09a02c6f-68c9-4b6e-a6fd-46e9f0a33e52",
          "name": "ALLANTOIN N-ACETYL-DL-METHIONINE",
          "stdName": "ALLANTOIN N-ACETYL-DL-METHIONINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e680f54-8753-4dff-b63c-cf9413bcc6e5",
            "1727284f-2a29-4efc-967f-998186ccb0a6"
          ],
          "display_name": false
        },
        {
          "uuid": "eae2c64c-ae1b-4c20-b92b-9046e4ea4e2a",
          "name": "ALLANTOIN, COMPD. WITH DL-N-ACETYLMETHIONINE (1:1)",
          "stdName": "ALLANTOIN, COMPD. WITH DL-N-ACETYLMETHIONINE (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e680f54-8753-4dff-b63c-cf9413bcc6e5",
            "1727284f-2a29-4efc-967f-998186ccb0a6"
          ],
          "display_name": false
        },
        {
          "uuid": "c0092b60-b7df-4bda-9eeb-01c6a464c39a",
          "name": "ALMETH",
          "stdName": "ALMETH",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e680f54-8753-4dff-b63c-cf9413bcc6e5",
            "1727284f-2a29-4efc-967f-998186ccb0a6"
          ],
          "display_name": false
        },
        {
          "uuid": "49251361-657f-4c18-b8d8-df626fa63f9b",
          "name": "METHIONINE, N-ACETYL-, COMPD. WITH ALLANTOIN",
          "stdName": "METHIONINE, N-ACETYL-, COMPD. WITH ALLANTOIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e680f54-8753-4dff-b63c-cf9413bcc6e5",
            "1727284f-2a29-4efc-967f-998186ccb0a6"
          ],
          "display_name": false
        },
        {
          "uuid": "a898df73-e4cc-404b-8c7e-267ac96309c5",
          "name": "METHIONINE, N-ACETYL-, COMPD. WITH ALLANTOIN (1:1), DL-",
          "stdName": "METHIONINE, N-ACETYL-, COMPD. WITH ALLANTOIN (1:1), DL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e680f54-8753-4dff-b63c-cf9413bcc6e5",
            "1727284f-2a29-4efc-967f-998186ccb0a6"
          ],
          "display_name": false
        },
        {
          "uuid": "4a7be7aa-59e5-4f62-9d86-fc6ff706dd5a",
          "name": "METHIONINE, N-ACETYL-, COMPD. WITH N-(2,5-DIOXO-4-IMIDAZOLIDINYL)UREA (1:1)",
          "stdName": "METHIONINE, N-ACETYL-, COMPD. WITH N-(2,5-DIOXO-4-IMIDAZOLIDINYL)UREA (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e680f54-8753-4dff-b63c-cf9413bcc6e5",
            "1727284f-2a29-4efc-967f-998186ccb0a6"
          ],
          "display_name": false
        },
        {
          "uuid": "7b3b911a-c7fe-42bb-9ce3-e09df16a7367",
          "name": "UREA, (2,5-DIOXO-4-IMIDAZOLIDINYL)-, COMPD. WITH N-ACETYLMETHIONINE (1:1)",
          "stdName": "UREA, (2,5-DIOXO-4-IMIDAZOLIDINYL)-, COMPD. WITH N-ACETYLMETHIONINE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e680f54-8753-4dff-b63c-cf9413bcc6e5",
            "1727284f-2a29-4efc-967f-998186ccb0a6"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "48203b16-85c0-4208-824d-9988d90fbefb",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5e680f54-8753-4dff-b63c-cf9413bcc6e5",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1727284f-2a29-4efc-967f-998186ccb0a6",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0776f5c2-72b7-4dcc-88ea-541aef3b9da4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391912000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9ca2ab70-5364-4a95-9044-861afac77402",
          "citation": "SRS import [C554034748]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=C554034748",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391912000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb7a4875-72ee-4a01-86b5-0bee67f62948",
          "citation": "ALLANTOIN ACETYL METHIONINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "18724014-dfc1-4e79-8773-a4f252e27a0e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6f960454-3cee-4be2-b286-db142911c9a1",
          "id": "6f960454-3cee-4be2-b286-db142911c9a1",
          "molfile": "\n  Marvin  01132105472D          \n\n 11 11  0  0  0  0            999 V2000\n    2.7967   -0.2155    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0046   -1.0084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7794   -1.2265    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4042   -1.6037    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6344   -1.3881    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.3342   -0.5953    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5157   -0.6492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.0257    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2951   -1.4420    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9879   -1.9038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0263   -2.7249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  7  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\nM  END",
          "smiles": "C1(C(=O)NC(=O)N1)NC(=O)N",
          "formula": "C4H6N4O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "27b5c3e8-93ad-435e-a51e-4a518bcaa092"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "158.1156",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        },
        {
          "uuid": "a3a9e0c5-c09b-4d80-939b-42a40d7c89a5",
          "id": "a3a9e0c5-c09b-4d80-939b-42a40d7c89a5",
          "molfile": "\n  Marvin  01132108302D          \n\n 12 11  0  0  0  0            999 V2000\n    5.0401   -0.4146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8353   -0.1642    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4324   -0.7197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2277   -0.4954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8378   -1.0508    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.6448   -1.8799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8548   -2.1041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6828   -2.9046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2369   -1.5488    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6513   -0.8005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8416    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2328   -1.3846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)NC(CCSC)C(=O)O",
          "formula": "C7H13NO3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7ac565ed-2a3f-4d1e-8a27-57b5f58c9076"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "191.2494",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4a9cc91b-086c-48ba-80f4-24c83df07e1d",
      "version": "4",
      "structure": {
        "id": "3aacd8f6-4520-461d-901c-84f06c5ce7c7",
        "molfile": "\n  Marvin  01132103072D          \n\n 23 22  0  0  0  0            999 V2000\n    0.2994   -1.4631    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3537   -0.6040    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5233   -0.6587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6583   -1.4084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0023   -1.9317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4393   -1.6271    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0485   -1.0231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.0261    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0413   -2.7647    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8346   -1.2444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8376   -0.2187    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6378   -0.7992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6328   -1.8770    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8441   -2.1008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8255   -1.0491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8277    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2271   -1.5464    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2183   -1.3824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2164   -0.4947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8262   -0.1640    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6723   -2.9001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4223   -0.7185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0322   -0.4140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 10  7  2  0  0  0  0\n 11  7  1  0  0  0  0\n  4  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  3  2  0  0  0  0\n  9  5  2  0  0  0  0\n 13 15  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 12  1  0  0  0  0\n 16 12  2  0  0  0  0\n 17 14  2  0  0  0  0\n 18 12  1  0  0  0  0\n 19 15  1  0  0  0  0\n 20 22  1  0  0  0  0\n 21 14  1  0  0  0  0\n 22 19  1  0  0  0  0\n 23 20  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)NC(CCSC)C(=O)O.C1(C(=O)NC(=O)N1)NC(=O)N",
        "formula": "C7H13NO3S.C4H6N4O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "349.365",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "9ca2ab70-5364-4a95-9044-861afac77402",
          "1727284f-2a29-4efc-967f-998186ccb0a6"
        ],
        "stereo_centers": 2
      },
      "unii": "C554034748"
    }
  ]
}