{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "dd3ea2bb-cab9-4a86-8ad4-d309a4f44087",
          "code": "97780-06-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=97780-06-8",
          "code_system": "CAS",
          "references": [
            "f3d5d8c2-8188-4b64-9e0f-c4c7c0b8dd71",
            "a365cf97-484b-4b20-9486-249d5343e4a5"
          ]
        },
        {
          "uuid": "17c15f08-ce23-4dbb-a32f-8ec8587d7fd9",
          "code": "91756",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91756",
          "code_system": "PUBCHEM",
          "references": [
            "f3d5d8c2-8188-4b64-9e0f-c4c7c0b8dd71"
          ]
        },
        {
          "uuid": "cfd16bf9-67c7-e23b-5442-c764985d1cec",
          "code": "DTXSID9034573",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9034573",
          "code_system": "EPA CompTox",
          "references": [
            "460c7a57-7104-07ea-5d78-c44e40ac2b10"
          ]
        },
        {
          "uuid": "56250f65-0b46-b358-4583-eff8d6b53791",
          "code": "145553",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:145553",
          "code_system": "CHEBI",
          "references": [
            "0e59b6cd-44c5-55b1-a3ae-7debdf196ae2"
          ]
        },
        {
          "uuid": "d6264554-b8e4-4496-bc37-52adfbc75a7d",
          "code": "C54ZP2XRYX",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a4e66050-0d0f-2a20-d826-aa73bfc1879c",
          "code": "ethametsulfuron-methyl",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/ethametsulfuron-methyl.html",
          "code_system": "ALANWOOD",
          "references": [
            "a561035e-e776-b43a-51c7-fbfa15475ee2"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bf0771e3-7560-4901-8e04-85edf50515fb",
          "name": "BENZOIC ACID, 2-(((((4-ETHOXY-6-(METHYLAMINO)-1,3,5-TRIAZIN-2-YL)AMINO)CARBONYL)AMINO)SULFONYL)-, METHYL ESTER",
          "stdName": "BENZOIC ACID, 2-(((((4-ETHOXY-6-(METHYLAMINO)-1,3,5-TRIAZIN-2-YL)AMINO)CARBONYL)AMINO)SULFONYL)-, METHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98f452f3-0b07-4d2d-9c8f-a871c35b2a84",
            "ff0e3ac3-9259-4bd2-b816-8e5f00aeccb9"
          ],
          "display_name": false
        },
        {
          "uuid": "f5c1b360-c9da-4db9-85d8-efd77556eb00",
          "name": "DPX-A 7881",
          "stdName": "DPX-A 7881",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98f452f3-0b07-4d2d-9c8f-a871c35b2a84",
            "ff0e3ac3-9259-4bd2-b816-8e5f00aeccb9"
          ],
          "display_name": false
        },
        {
          "uuid": "2c80292e-591a-4e04-aa76-59bc4a332658",
          "name": "ETHAMETSULFURON METHYL ESTER",
          "stdName": "ETHAMETSULFURON METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98f452f3-0b07-4d2d-9c8f-a871c35b2a84",
            "ff0e3ac3-9259-4bd2-b816-8e5f00aeccb9"
          ],
          "display_name": false
        },
        {
          "uuid": "42a986e4-6dcb-440d-ae6b-564f648464c8",
          "name": "ETHAMETSULFURON-METHYL",
          "stdName": "ETHAMETSULFURON-METHYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b40cc329-bf9a-48fc-a009-9e656db0d014",
            "60fc6bfb-db02-494f-ad91-7d8d16e1c4d1",
            "eff0a6fb-4ed7-4992-97c1-1ad8632388b5",
            "ff0e3ac3-9259-4bd2-b816-8e5f00aeccb9"
          ],
          "display_name": true
        },
        {
          "uuid": "1c4b52d9-1aca-4b31-ade8-902f8aa70340",
          "name": "ETHAMETSULFURON-METHYL [ISO]",
          "stdName": "ETHAMETSULFURON-METHYL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b40cc329-bf9a-48fc-a009-9e656db0d014",
            "ff0e3ac3-9259-4bd2-b816-8e5f00aeccb9"
          ],
          "display_name": false
        },
        {
          "uuid": "b2ef8986-5767-42c6-9a64-299aabb6d1ad",
          "name": "MUSTER",
          "stdName": "MUSTER",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98f452f3-0b07-4d2d-9c8f-a871c35b2a84",
            "ff0e3ac3-9259-4bd2-b816-8e5f00aeccb9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "60fc6bfb-db02-494f-ad91-7d8d16e1c4d1",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b40cc329-bf9a-48fc-a009-9e656db0d014",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff0e3ac3-9259-4bd2-b816-8e5f00aeccb9",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98f452f3-0b07-4d2d-9c8f-a871c35b2a84",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f3d5d8c2-8188-4b64-9e0f-c4c7c0b8dd71",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "374e1d2c-b59c-4b05-82b6-8a013610e4cf",
          "citation": "SRS import [C54ZP2XRYX]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=C54ZP2XRYX",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390960000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c43130af-21df-4ec2-9932-09da19efd4c9",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eff0a6fb-4ed7-4992-97c1-1ad8632388b5",
          "citation": "ETHAMETSULFURON-METHYL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "460c7a57-7104-07ea-5d78-c44e40ac2b10",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=97780-06-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a561035e-e776-b43a-51c7-fbfa15475ee2",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "a365cf97-484b-4b20-9486-249d5343e4a5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0e59b6cd-44c5-55b1-a3ae-7debdf196ae2",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8f7af39c-ecaa-4467-a820-b08a481d7556",
          "id": "8f7af39c-ecaa-4467-a820-b08a481d7556",
          "molfile": "\n  Marvin  01132107262D          \n\n 28 29  0  0  0  0            999 V2000\n   11.2407   -6.2835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5238   -5.8687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8117   -6.2835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0948   -5.8687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0948   -5.0437    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3826   -4.6336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3826   -3.8087    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0948   -3.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6658   -5.0437    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6658   -5.8687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9537   -6.2835    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2414   -5.8687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2414   -5.0437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5245   -6.2835    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8077   -5.8687    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3976   -6.5810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2225   -5.1565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0954   -5.4586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3833   -5.8687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6664   -5.4586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6664   -4.6336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3833   -4.2188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0954   -4.6336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8077   -4.2188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5245   -4.6336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8077   -3.3938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0954   -2.9837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3826   -6.2835    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n 28  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  9  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 10 28  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  2  0  0  0  0\n 18 15  1  0  0  0  0\n 18 19  1  0  0  0  0\n 23 18  2  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 24 25  2  0  0  0  0\n 24 26  1  0  0  0  0\n 26 27  1  0  0  0  0\nM  END",
          "smiles": "CCOc1nc(NC)nc(NC(=O)NS(=O)(=O)c2ccccc2C(=O)OC)n1",
          "formula": "C15H18N6O6S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "145b614f-fcb0-4bdf-83a2-1be8f3935218"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "410.4067",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0d8fdc24-ea30-4701-a8b9-c4fa15da449f",
      "version": "5",
      "structure": {
        "id": "cd5d3335-8bcf-436f-8f73-e7f174b311db",
        "molfile": "\n  Marvin  01132110362D          \n\n 28 29  0  0  0  0            999 V2000\n    4.8077   -4.2188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0954   -4.6336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0954   -5.4586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3833   -5.8687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6664   -5.4586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6664   -4.6336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3833   -4.2188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8077   -5.8687    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3976   -6.5810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2225   -5.1565    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5245   -6.2835    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2414   -5.8687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2414   -5.0437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9537   -6.2835    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6658   -5.8687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6658   -5.0437    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3826   -4.6336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0948   -5.0437    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0948   -5.8687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3826   -6.2835    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8117   -6.2835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5238   -5.8687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2407   -6.2835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3826   -3.8087    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0948   -3.3938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5245   -4.6336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8077   -3.3938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0954   -2.9837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  2  7  2  0  0  0  0\n  3  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  2  0  0  0  0\n  8 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 15 20  2  0  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 17 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n  1 26  2  0  0  0  0\n  1 27  1  0  0  0  0\n 27 28  1  0  0  0  0\nM  END",
        "smiles": "CCOc1nc(NC)nc(NC(=O)NS(=O)(=O)c2ccccc2C(=O)OC)n1",
        "formula": "C15H18N6O6S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "410.4067",
        "optical_activity": "NONE",
        "references": [
          "374e1d2c-b59c-4b05-82b6-8a013610e4cf",
          "c43130af-21df-4ec2-9932-09da19efd4c9"
        ],
        "stereo_centers": 0
      },
      "unii": "C54ZP2XRYX"
    }
  ]
}