{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "06013938-08c4-4375-94c3-8fa3230c8c0e",
          "code": "664-95-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=664-95-9",
          "code_system": "CAS",
          "references": [
            "3d848b32-a4eb-4028-9667-bbfe8bbb4909",
            "915aa86b-8185-4429-bc8b-8a1fc519dee4"
          ]
        },
        {
          "uuid": "4fc4ebb1-ef06-4b96-b810-a88f8b174cde",
          "code": "C005008",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67005008",
          "code_system": "MESH",
          "references": [
            "3d848b32-a4eb-4028-9667-bbfe8bbb4909"
          ]
        },
        {
          "uuid": "7196492f-0af0-4bcb-90d1-c6ec4dda1cd3",
          "code": "SUB07952MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "3d848b32-a4eb-4028-9667-bbfe8bbb4909"
          ]
        },
        {
          "uuid": "00967c20-5a8c-40c2-afe9-a866c33eea0c",
          "code": "1317",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1317",
          "code_system": "INN",
          "references": [
            "3d848b32-a4eb-4028-9667-bbfe8bbb4909"
          ]
        },
        {
          "uuid": "21093d99-a9db-4d33-b2d2-ec77b3dbd170",
          "code": "C65809",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C65809",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3d848b32-a4eb-4028-9667-bbfe8bbb4909"
          ]
        },
        {
          "uuid": "cd36fa7e-43c0-44f9-84eb-a32f5b2df177",
          "code": "m10941",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10941?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "3d848b32-a4eb-4028-9667-bbfe8bbb4909"
          ]
        },
        {
          "uuid": "991d89d8-41d6-41f6-8f3c-5c01bd8d58b6",
          "code": "CHEMBL312394",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL312394",
          "code_system": "ChEMBL",
          "references": [
            "3d848b32-a4eb-4028-9667-bbfe8bbb4909"
          ]
        },
        {
          "uuid": "871935fa-a537-45a2-b5fe-30c964994df2",
          "code": "211-557-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.010.508",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3d848b32-a4eb-4028-9667-bbfe8bbb4909"
          ]
        },
        {
          "uuid": "f51e09f5-0fb8-4895-9d23-b0869f12dd34",
          "code": "12628",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/12628",
          "code_system": "PUBCHEM",
          "references": [
            "3d848b32-a4eb-4028-9667-bbfe8bbb4909"
          ]
        },
        {
          "uuid": "ef6aac95-8856-6d48-3f2a-d076a3ae1d31",
          "code": "DTXSID5046273",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5046273",
          "code_system": "EPA CompTox",
          "references": [
            "b2e22e3b-4664-49c8-8e04-8105c646e524"
          ]
        },
        {
          "uuid": "3df64b1e-eaec-f93f-8c8c-95b29c655670",
          "code": "C97936",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Digestive System or Metabolism[C78276]|Anti-diabetic Agent[C29711]|Sulfonylurea Antidiabetic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C97936",
          "code_system": "NCI_THESAURUS",
          "references": [
            "33009de8-0416-9e54-964d-cdd735b093b4"
          ]
        },
        {
          "uuid": "83cb2e13-89f2-4fb5-9af0-d63455a81d96",
          "code": "C40N4EJY68",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d3cd1951-d75e-6a5b-9a2f-90173dc4e976",
          "code": "1324",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1324",
          "code_system": "DRUG CENTRAL",
          "references": [
            "33009de8-0416-9e54-964d-cdd735b093b4"
          ]
        },
        {
          "uuid": "a9997697-4c30-9403-c73b-eb4d436f21a5",
          "code": "142661",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=142661",
          "code_system": "NSC",
          "references": [
            "67a75da1-2f49-0b4f-bb18-43dc26e1ad6d"
          ]
        },
        {
          "uuid": "42d4e053-21f3-017e-edf6-6f48f550af51",
          "code": "100000084233",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "97f8a640-3b69-daf0-7b07-4ec127d91522"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "4d999321-bc07-43ef-9b7c-df17c0f4047e",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ccc083f5-f97d-4ff8-8efc-83edce6be8f7",
            "refuuid": "a0af7470-f531-4c05-b59b-783a9bc96cfc",
            "name": "GLYCYCLAMIDE",
            "unii": "C40N4EJY68",
            "linking_id": "C40N4EJY68",
            "ref_pname": "GLYCYCLAMIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "887d55f8-0af0-4a6b-9c49-76f08e9b972b",
          "name": "1-CYCLOHEXYL-3-P-TOLYLSULFONYLUREA",
          "stdName": "1-CYCLOHEXYL-3-P-TOLYLSULFONYLUREA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2aadad1-5fc4-4e3e-b09a-e88a84f5c0e5"
          ],
          "display_name": false
        },
        {
          "uuid": "b80e52fe-97d9-4958-9fec-312de01bddcb",
          "name": "GLYCYCLAMIDE",
          "stdName": "GLYCYCLAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "489c79b9-7d79-4681-bac8-245ac7547430",
            "3b6b03eb-498c-4410-a2a3-13a14e290085",
            "c2aadad1-5fc4-4e3e-b09a-e88a84f5c0e5",
            "c34e55dd-424e-4904-9f35-617da670f70f",
            "eb1f3249-3b89-4047-ad2d-1a3a02bf22fd",
            "f413c08d-ad6b-47e0-b08e-cf5776106d3a",
            "cd276113-db7a-49b8-9f09-72796f447c33",
            "957e5a09-dd02-4d78-bd58-bcaaedaa1acf"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "98de5e4c-79a8-40d3-9ff3-a0512de88896",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "a87113e6-1a59-44b0-9bb1-1c2be3c898ee",
          "name": "GLYCYCLAMIDE [MART.]",
          "stdName": "GLYCYCLAMIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eb1f3249-3b89-4047-ad2d-1a3a02bf22fd"
          ],
          "display_name": false
        },
        {
          "uuid": "699b1f9b-b294-5011-9045-acbc222f7a85",
          "name": "Glycyclamide [WHO-DD]",
          "stdName": "GLYCYCLAMIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dbc88c45-3a49-74c4-7064-9ee71a320877"
          ],
          "display_name": false
        },
        {
          "uuid": "75249755-6c27-49a8-88e7-dc9eb50d7056",
          "name": "K-38",
          "stdName": "K-38",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2aadad1-5fc4-4e3e-b09a-e88a84f5c0e5"
          ],
          "display_name": false
        },
        {
          "uuid": "2e73baaf-45af-4278-a53e-c5d4adfd1c6d",
          "name": "K-386",
          "stdName": "K-386",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2aadad1-5fc4-4e3e-b09a-e88a84f5c0e5"
          ],
          "display_name": false
        },
        {
          "uuid": "d38a7f2c-8741-433c-b96b-ea7cb7b8e7cf",
          "name": "NSC-142661",
          "stdName": "NSC-142661",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acdf27f0-9d56-4ff8-9e36-1d40d3c44268",
            "3b6b03eb-498c-4410-a2a3-13a14e290085"
          ],
          "display_name": false
        },
        {
          "uuid": "54b127c0-ee71-43d6-a9dd-091e46d2ed07",
          "name": "TOLCYCLAMIDE [MI]",
          "stdName": "TOLCYCLAMIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0124030c-b9d9-4dc1-b232-cf9e395811ba",
            "3b6b03eb-498c-4410-a2a3-13a14e290085"
          ],
          "display_name": false
        },
        {
          "uuid": "ea41928a-ef1e-43f1-902c-c0502d2d5c18",
          "name": "glycyclamide [INN]",
          "stdName": "GLYCYCLAMIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f413c08d-ad6b-47e0-b08e-cf5776106d3a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c2aadad1-5fc4-4e3e-b09a-e88a84f5c0e5",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f413c08d-ad6b-47e0-b08e-cf5776106d3a",
          "citation": "INN Proposed List 13",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL13.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "eb1f3249-3b89-4047-ad2d-1a3a02bf22fd",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0124030c-b9d9-4dc1-b232-cf9e395811ba",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b6b03eb-498c-4410-a2a3-13a14e290085",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c34e55dd-424e-4904-9f35-617da670f70f",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "acdf27f0-9d56-4ff8-9e36-1d40d3c44268",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d848b32-a4eb-4028-9667-bbfe8bbb4909",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390551000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8fe0fb3-d088-4b22-8e29-c819ee605df9",
          "citation": "SRS import [C40N4EJY68]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=C40N4EJY68",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390551000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de90f424-3695-4e10-bb8e-68b2b27bd3a6",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd276113-db7a-49b8-9f09-72796f447c33",
          "citation": "GLYCYCLAMIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "489c79b9-7d79-4681-bac8-245ac7547430",
          "citation": "GLYCYCLAMIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "957e5a09-dd02-4d78-bd58-bcaaedaa1acf",
          "citation": "GLYCYCLAMIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b2e22e3b-4664-49c8-8e04-8105c646e524",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=664-95-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "33009de8-0416-9e54-964d-cdd735b093b4",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "915aa86b-8185-4429-bc8b-8a1fc519dee4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "67a75da1-2f49-0b4f-bb18-43dc26e1ad6d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "dbc88c45-3a49-74c4-7064-9ee71a320877",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "97f8a640-3b69-daf0-7b07-4ec127d91522",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7822247c-ef83-4edc-ad93-25b145acb14f",
          "id": "7822247c-ef83-4edc-ad93-25b145acb14f",
          "molfile": "\n  Marvin  01132106142D          \n\n 20 21  0  0  0  0            999 V2000\n    1.6092   -3.2518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2544   -2.7541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0248   -3.0949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6713   -2.5505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5660   -1.7479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8332   -1.4461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1642   -1.9095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1943   -1.2568    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6048   -0.5382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6272   -0.4074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8593   -1.7936    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5780   -1.2773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5741   -0.4428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3178   -1.6877    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0182   -1.2655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0182   -0.4428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7344   -0.0423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4387   -0.4764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4387   -1.2872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7245   -1.7133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  7  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  2  0  0  0  0\n  8 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 20  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccc(cc1)S(=O)(=O)NC(=O)NC2CCCCC2",
          "formula": "C14H20N2O3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c300f473-e9cb-459c-a1a3-3c1410e3b13d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "296.3868",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a0af7470-f531-4c05-b59b-783a9bc96cfc",
      "version": "11",
      "structure": {
        "id": "f0fcbd49-30a5-487e-b806-e4797b7fd7d5",
        "molfile": "\n  Marvin  01132112302D          \n\n 20 21  0  0  0  0            999 V2000\n    4.1943   -1.2568    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5660   -1.7479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8593   -1.7936    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6048   -0.5382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6272   -0.4074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6713   -2.5505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8332   -1.4461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5780   -1.2773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0248   -3.0949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1642   -1.9095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3178   -1.6877    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5741   -0.4428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2544   -2.7541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0182   -1.2655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6092   -3.2518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0182   -0.4428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7245   -1.7133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7344   -0.0423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4387   -1.2872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4387   -0.4764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  2  0  0  0  0\n  1  5  2  0  0  0  0\n  2  6  2  0  0  0  0\n  2  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n  7 10  2  0  0  0  0\n  8 11  1  0  0  0  0\n  8 12  2  0  0  0  0\n  9 13  2  0  0  0  0\n 11 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 10 13  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
        "smiles": "Cc1ccc(cc1)S(=O)(=O)NC(=O)NC2CCCCC2",
        "formula": "C14H20N2O3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "296.3868",
        "optical_activity": "NONE",
        "references": [
          "de90f424-3695-4e10-bb8e-68b2b27bd3a6",
          "c8fe0fb3-d088-4b22-8e29-c819ee605df9",
          "f413c08d-ad6b-47e0-b08e-cf5776106d3a"
        ],
        "stereo_centers": 0
      },
      "unii": "C40N4EJY68"
    }
  ]
}