{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a376b938-2427-496c-8c7b-6691c5f0440c",
          "code": "509-60-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=509-60-4",
          "code_system": "CAS",
          "references": [
            "6c0f3a67-c6d1-49b1-ac24-d239744b48bf",
            "ecef02d4-449a-49c9-92ee-a049a38b04da"
          ]
        },
        {
          "uuid": "62b8ab2d-c501-4671-8333-666421c8fb3b",
          "code": "DIHYDROMORPHINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Dihydromorphine",
          "code_system": "WIKIPEDIA",
          "references": [
            "6c0f3a67-c6d1-49b1-ac24-d239744b48bf"
          ]
        },
        {
          "uuid": "4a312c4f-93e6-41f2-b063-52a1a3d5bff3",
          "code": "9145",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I.|Opium derivatives",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "6c0f3a67-c6d1-49b1-ac24-d239744b48bf"
          ]
        },
        {
          "uuid": "e2af8b3f-6143-4dea-b88a-1006246edbb3",
          "code": "208-100-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.365",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "6c0f3a67-c6d1-49b1-ac24-d239744b48bf"
          ]
        },
        {
          "uuid": "592d70e9-9106-4d5a-a0c0-399b9b9ede55",
          "code": "m4464",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4464?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "6c0f3a67-c6d1-49b1-ac24-d239744b48bf"
          ]
        },
        {
          "uuid": "2c148d94-a79b-45f2-a4bf-2189ab2348e7",
          "code": "SUB13595MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "6c0f3a67-c6d1-49b1-ac24-d239744b48bf"
          ]
        },
        {
          "uuid": "e7902b11-acf9-4260-9213-46547edc8094",
          "code": "5359421",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5359421",
          "code_system": "PUBCHEM",
          "references": [
            "6c0f3a67-c6d1-49b1-ac24-d239744b48bf"
          ]
        },
        {
          "uuid": "9d096fd5-09a2-eaa2-a863-e063fe3298fb",
          "code": "DTXSID7048908",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7048908",
          "code_system": "EPA CompTox",
          "references": [
            "d1d703b8-c1f6-897f-d773-d4c56d2be0f9"
          ]
        },
        {
          "uuid": "d654dd64-2890-cb99-aabe-68aa4d0c525d",
          "code": "DB01565",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB01565",
          "code_system": "DRUG BANK",
          "references": [
            "4ce7d596-43e8-bb45-e15e-b9c3a8f0d3cd"
          ]
        },
        {
          "uuid": "c2bde919-87f6-430b-a91b-2d05f29e1960",
          "code": "C3S5FRP6JW",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "506b5fc7-b607-46ba-b027-afc59c6e2df8",
          "code": "117865",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=117865",
          "code_system": "NSC",
          "references": [
            "6ccd4193-c8d1-49d8-b320-c1008a305cf2"
          ]
        },
        {
          "uuid": "6d253eed-7cd6-5a3c-41ba-1e20131b37d1",
          "code": "100000079222",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c65b1fc4-b6e7-7ae3-3125-8bd62c3cba47"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "eca8b2cb-f042-4f67-ad8e-28d1ceb3f873",
          "amount": {
            "uuid": "88c2a102-f430-4089-8443-2e4c566465aa"
          },
          "type": "PARENT->METABOLITE ACTIVE",
          "references": [
            "429be272-96bc-4f86-aef3-3a69a4bbd487"
          ],
          "related_substance": {
            "uuid": "8f21fdac-7737-4ee7-8c8d-2a7b01a3f271",
            "refuuid": "2bc89bfb-9371-4251-b9d5-e212f3f76657",
            "name": "DIHYDROCODEINE",
            "unii": "N9I9HDB855",
            "linking_id": "N9I9HDB855",
            "ref_pname": "DIHYDROCODEINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c65b6494-5a36-45e1-96e3-6f17726d77e4",
          "amount": {
            "uuid": "ca0516af-d01e-4d56-ac4b-edef6b6eaf85",
            "type": "RELATIONSHIP_AMOUNT",
            "average": 89
          },
          "comments": "APPROXIMATE PURE ANHYDROUS DRUG CONTENT (IN PERCENT)",
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "9e729954-e5c9-49aa-86e7-12f71f78925c"
          ],
          "related_substance": {
            "uuid": "316dfbb0-f510-43f3-b15d-3ab2b630c627",
            "refuuid": "7433b71c-c400-4ce6-9164-ca89444341d5",
            "name": "DIHYDROMORPHINE HYDROCHLORIDE",
            "unii": "3T8C8KE0AW",
            "linking_id": "3T8C8KE0AW",
            "ref_pname": "DIHYDROMORPHINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "65e98091-ba07-4dee-b081-534e5edbcb9c",
          "amount": {
            "uuid": "aa9cb1ed-44ab-49f2-9a6a-b092d26b1432",
            "type": "RELATIONSHIP_AMOUNT",
            "average": 56
          },
          "comments": "APPROXIMATE PURE ANHYDROUS DRUG CONTENT (IN PERCENT)",
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "9e729954-e5c9-49aa-86e7-12f71f78925c"
          ],
          "related_substance": {
            "uuid": "a7644343-35eb-4c74-a0c2-53e1034a30d2",
            "refuuid": "fbaa1ea0-00a5-466a-a93c-776be2211c07",
            "name": "DIHYDROMORPHINE PICRATE",
            "unii": "S6V722J7YS",
            "linking_id": "S6V722J7YS",
            "ref_pname": "DIHYDROMORPHINE PICRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "91d6fa32-c2f3-4bba-ba59-5e94f6d140b4",
          "comments": "DIHYDROMORPHINE (derivative of morphine) as per INCB",
          "type": "PARENT->DERIVATIVE",
          "references": [
            "9e729954-e5c9-49aa-86e7-12f71f78925c"
          ],
          "related_substance": {
            "uuid": "18fcac96-c4c4-42a3-a752-cf03676351ad",
            "refuuid": "7433b71c-c400-4ce6-9164-ca89444341d5",
            "name": "DIHYDROMORPHINE HYDROCHLORIDE",
            "unii": "3T8C8KE0AW",
            "linking_id": "3T8C8KE0AW",
            "ref_pname": "DIHYDROMORPHINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2d863a4d-c143-42b9-823d-c657460c2c30",
          "amount": {
            "uuid": "d04b365d-21e8-4a98-9eb4-ced36866d105",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.5
          },
          "qualification": "USP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "c93eec36-b42e-0b07-92c0-854b0b183777"
          ],
          "related_substance": {
            "uuid": "824a0cdb-8d44-4533-8228-f55dfee53a75",
            "refuuid": "ee6bb6e3-ed89-4666-8512-9e03078c3f87",
            "name": "DIHYDROCODEINE BITARTRATE",
            "unii": "8LXS95BSA9",
            "linking_id": "8LXS95BSA9",
            "ref_pname": "DIHYDROCODEINE BITARTRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "730a4260-772a-443d-acf1-2a3c1a03723e",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "8291757f-bb35-4153-bffb-febae266172f"
          ],
          "related_substance": {
            "uuid": "7a5b2bd8-8d02-4dee-a688-25bc46cbb121",
            "refuuid": "d818210e-3c95-4abe-bb0f-50256c9355af",
            "name": "DIHYDROMORPHINE MONOHYDRATE",
            "unii": "NU189G5QU4",
            "linking_id": "NU189G5QU4",
            "ref_pname": "DIHYDROMORPHINE MONOHYDRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "604ea685-da9b-4bb0-a359-a16d4107a347",
          "amount": {
            "uuid": "ebd18b78-b876-4936-88a2-360c9e95d64e"
          },
          "type": "TARGET->AGONIST",
          "references": [
            "9bac571f-951c-4421-bba6-f5e72ea896a2"
          ],
          "related_substance": {
            "uuid": "ea5f4f5f-ffab-4825-8ded-fe5cfc2d49e7",
            "refuuid": "39262e4f-d963-4b83-9b34-52fd55036f0e",
            "name": "MU-TYPE OPIOID RECEPTOR",
            "unii": "1PE72K8X46",
            "linking_id": "1PE72K8X46",
            "ref_pname": "MU-TYPE OPIOID RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ebd83faf-bd94-41e2-8bda-f037137e67ab",
          "amount": {
            "uuid": "b3e06c54-1ca7-4457-842a-79634d39a05d"
          },
          "type": "ACTIVE MOIETY",
          "references": [
            "9bac571f-951c-4421-bba6-f5e72ea896a2"
          ],
          "related_substance": {
            "uuid": "a1de1cf1-443f-4dc8-8cb6-1399bc5ebb8d",
            "refuuid": "fcd21810-8a14-4d84-9635-09821c844bda",
            "name": "DIHYDROMORPHINE",
            "unii": "C3S5FRP6JW",
            "linking_id": "C3S5FRP6JW",
            "ref_pname": "DIHYDROMORPHINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "719f0149-979c-4f94-9208-18d0df3a2ac0",
          "name": "(5.ALPHA.,6.ALPHA.)-4,5-EPOXY-17-METHYLMORPHINAN-3,6-DIOL",
          "stdName": "(5.ALPHA.,6.ALPHA.)-4,5-EPOXY-17-METHYLMORPHINAN-3,6-DIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82805eda-c2a6-4c49-83e6-ca6aa5855729"
          ],
          "display_name": false
        },
        {
          "uuid": "3583bc58-4eee-4990-a7cc-00f45f7ff743",
          "name": "3,6-DIHYDROXY-(5.ALPHA.,6.ALPHA.)-4,5-EPOXY-17-METHYLMORPHINAN",
          "stdName": "3,6-DIHYDROXY-(5.ALPHA.,6.ALPHA.)-4,5-EPOXY-17-METHYLMORPHINAN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a89f720-cdda-4545-94ad-c16016db103b"
          ],
          "display_name": false
        },
        {
          "uuid": "30a6d6d9-32ab-4618-8688-e12bc55529f3",
          "name": "6.ALPHA.-HYDROMORPHOL",
          "stdName": "6.ALPHA.-HYDROMORPHOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ccd4193-c8d1-49d8-b320-c1008a305cf2"
          ],
          "display_name": false
        },
        {
          "uuid": "5f756ecd-93a9-4d4a-92f6-b45e390711d9",
          "name": "DHM",
          "stdName": "DHM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a89f720-cdda-4545-94ad-c16016db103b"
          ],
          "display_name": false
        },
        {
          "uuid": "dfd0bf35-2485-4213-9ae2-1fea0765eecf",
          "name": "DIHYDROMORPHINE",
          "stdName": "DIHYDROMORPHINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bbaa8128-fad4-430d-9f83-9aefb93d4142",
            "9a83a6ba-b3b9-464b-9287-6d4dc0475daa",
            "7a89f720-cdda-4545-94ad-c16016db103b",
            "d9787d28-3084-4fc0-a946-bb69b30063f4",
            "48263c4d-46cf-4336-a03c-a8b9c67052ac"
          ],
          "display_name": true
        },
        {
          "uuid": "70b510fa-b48c-429f-91ce-5d50ceb15bc8",
          "name": "DIHYDROMORPHINE [MI]",
          "stdName": "DIHYDROMORPHINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48263c4d-46cf-4336-a03c-a8b9c67052ac"
          ],
          "display_name": false
        },
        {
          "uuid": "031707be-c990-55f1-fc74-22df56039872",
          "name": "DIHYDROMORPHINE [USP IMPURITY]",
          "stdName": "DIHYDROMORPHINE [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c93eec36-b42e-0b07-92c0-854b0b183777"
          ],
          "display_name": false
        },
        {
          "uuid": "d099d27e-224d-273e-5c10-e8d4da15a368",
          "name": "Dihydromorphine [WHO-DD]",
          "stdName": "DIHYDROMORPHINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7683c23c-1492-1b3f-00cb-66e8264fe55b"
          ],
          "display_name": false
        },
        {
          "uuid": "7e0e4748-5304-419b-b3d7-8257503532ce",
          "name": "HYDROMORPHOL, 6.ALPHA.-",
          "stdName": "HYDROMORPHOL, 6.ALPHA.-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf4cf6c3-ac48-41d6-aad2-1353ad385aa8"
          ],
          "display_name": false
        },
        {
          "uuid": "5a73047f-1b40-763b-f1ec-7e860d1fa6c4",
          "name": "HYDROMORPHONE HYDROCHLORIDE IMPURITY D [EP IMPURITY]",
          "stdName": "HYDROMORPHONE HYDROCHLORIDE IMPURITY D [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "658b4416-34a6-1354-bd67-e2b08f97f780"
          ],
          "display_name": false
        },
        {
          "uuid": "13a6383d-3c37-3749-9a00-21d02c6b11a1",
          "name": "HYDROMORPHONE HYDROCHLORIDE IMPURITY, DIHYDROMORPHINE (DHM)- [USP IMPURITY]",
          "stdName": "HYDROMORPHONE HYDROCHLORIDE IMPURITY, DIHYDROMORPHINE (DHM)- [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ab74205-cd5a-48b9-a9b4-4205b33c7de0"
          ],
          "display_name": false
        },
        {
          "uuid": "6790de40-b401-491e-b603-14354f802620",
          "name": "IDS-ND-009",
          "stdName": "IDS-ND-009",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf3eca8-dcaa-4042-9ead-f41a759fe447"
          ],
          "display_name": false
        },
        {
          "uuid": "b6efaf2a-adc6-4422-899e-2365c431c416",
          "name": "NSC-117865",
          "stdName": "NSC-117865",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82805eda-c2a6-4c49-83e6-ca6aa5855729"
          ],
          "display_name": false
        },
        {
          "uuid": "8ed4c6ae-46eb-4c3c-8b0a-cd3d4fe98a28",
          "name": "PARAMORFAN",
          "stdName": "PARAMORFAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a89f720-cdda-4545-94ad-c16016db103b"
          ],
          "display_name": false
        },
        {
          "uuid": "db5e36d8-f276-4f8b-84c7-3e3629f069f5",
          "name": "PARAMORPHAN",
          "stdName": "PARAMORPHAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a89f720-cdda-4545-94ad-c16016db103b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7a89f720-cdda-4545-94ad-c16016db103b",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d9787d28-3084-4fc0-a946-bb69b30063f4",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ab74205-cd5a-48b9-a9b4-4205b33c7de0",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "547c8e6a-af70-41a8-9808-1daf6328c2a9",
          "citation": "EP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48263c4d-46cf-4336-a03c-a8b9c67052ac",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ccd4193-c8d1-49d8-b320-c1008a305cf2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf4cf6c3-ac48-41d6-aad2-1353ad385aa8",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8cf3eca8-dcaa-4042-9ead-f41a759fe447",
          "citation": "INCB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82805eda-c2a6-4c49-83e6-ca6aa5855729",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c0f3a67-c6d1-49b1-ac24-d239744b48bf",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391648000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "429be272-96bc-4f86-aef3-3a69a4bbd487",
          "citation": "J ANAL TOXICOL. 2010 OCT;34(8):476-90.",
          "url": "http://www.ncbi.nlm.nih.gov/pubmed/21819793",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e729954-e5c9-49aa-86e7-12f71f78925c",
          "citation": "INTERNATIONAL NARCOTICS CONTROL BOARD - YELLOW LIST; ANNEX TO FORMS A, B AND C; 52ND EDITION, DECEMBER 2013; HTTP://WWW.INCB.ORG/",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6cc4a3b-912d-48a2-b3d2-ac38f2f91eb6",
          "citation": "SRS import [C3S5FRP6JW]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=C3S5FRP6JW",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391648000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3dbb3c22-6eac-4270-b40d-ba77b42580df",
          "citation": "chemid",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bbaa8128-fad4-430d-9f83-9aefb93d4142",
          "citation": "DIHYDROMORPHINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9a83a6ba-b3b9-464b-9287-6d4dc0475daa",
          "citation": "DIHYDROMORPHINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d1d703b8-c1f6-897f-d773-d4c56d2be0f9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=509-60-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8291757f-bb35-4153-bffb-febae266172f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4ce7d596-43e8-bb45-e15e-b9c3a8f0d3cd",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ecef02d4-449a-49c9-92ee-a049a38b04da",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c93eec36-b42e-0b07-92c0-854b0b183777",
          "citation": "USP43-NF38 - 1386, Dihydrocodeine Bitartrate Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9bac571f-951c-4421-bba6-f5e72ea896a2",
          "citation": "https://en.wikipedia.org/wiki/Dihydromorphine",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "658b4416-34a6-1354-bd67-e2b08f97f780",
          "citation": "EP 10.6",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "7683c23c-1492-1b3f-00cb-66e8264fe55b",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c65b1fc4-b6e7-7ae3-3125-8bd62c3cba47",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5e64dda7-0bd2-4e05-aa41-37ea8b025e49",
          "id": "5e64dda7-0bd2-4e05-aa41-37ea8b025e49",
          "molfile": "\n  Marvin  01132104532D          \n\n 21 25  0  0  1  0            999 V2000\n    3.5224   -3.1982    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    2.6998   -3.6935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8631   -3.1982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2698   -2.4830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8631   -1.7819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2698   -1.0433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1065   -1.0433    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.5037   -0.4031    0.0000 N   0  0  1  0  0  0  0  0  0  0  0  0\n    3.5037    0.2794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6250   -0.4031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6250   -1.7444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1065   -2.4830    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.5224   -1.7819    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.3638   -1.7819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7563   -2.4970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3404   -3.1982    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.2378   -4.2684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0404   -1.7819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6292   -2.4830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0404   -3.1982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4983   -3.7310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1 12  1  0  0  0  0\n  1 16  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 20  3  2  0  0  0  0\n  5  4  2  0  0  0  0\n 12  4  1  6  0  0  0\n  6  5  1  0  0  0  0\n 18  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  1  0  0  0\n 13  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  6  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  6  0  0  0\n 19 18  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 20  1  0  0  0  0\nM  END",
          "smiles": "CN1CC[C@@]23[C@H]4CC[C@@H]([C@@H]2Oc5c(ccc(C[C@H]41)c53)O)O",
          "formula": "C17H21NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9b493fc7-6f4c-4cc5-b6ba-016aa6175b38"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "287.3542",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fcd21810-8a14-4d84-9635-09821c844bda",
      "version": "30",
      "structure": {
        "id": "17197254-217d-4f43-8dee-55ef3ea951f7",
        "molfile": "\n  Marvin  01132101232D          \n\n 23 27  0  0  1  0            999 V2000\n    0.4997   -3.7414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0433   -3.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8683   -3.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7073   -3.7038    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5322   -3.2071    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.3525   -3.2071    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.7696   -2.5040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3759   -1.7869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5322   -1.7869    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.1151   -1.0463    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.2761   -1.0463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8683   -1.7869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2761   -2.4900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1151   -2.4900    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.6323   -1.7493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6323   -0.4043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5135   -0.4043    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n    3.5135    0.2801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0433   -1.7869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6310   -2.4900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9306   -1.0838    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2524   -4.2803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5322   -4.0040    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n  3 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  1  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 10 17  1  1  0  0  0\n  9 14  1  0  0  0  0\n  5 14  1  0  0  0  0\n 19 12  1  0  0  0  0\n 20 19  2  0  0  0  0\n 20  2  1  0  0  0  0\n  9 21  1  1  0  0  0\n  6 22  1  6  0  0  0\n  5 23  1  1  0  0  0\nM  END",
        "smiles": "CN1CC[C@@]23[C@@]4([H])CC[C@@H]([C@]2([H])Oc5c(ccc(C[C@H]41)c53)O)O",
        "formula": "C17H21NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "287.3542",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "3dbb3c22-6eac-4270-b40d-ba77b42580df",
          "c6cc4a3b-912d-48a2-b3d2-ac38f2f91eb6"
        ],
        "stereo_centers": 5
      },
      "unii": "C3S5FRP6JW"
    }
  ]
}