{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b3fec9a1-f1bd-4aaf-9ea2-3e00cf797c7e",
          "code": "104333-00-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=104333-00-8",
          "code_system": "CAS",
          "references": [
            "508e1f34-f621-433d-ada4-c5faaa6ef8ca",
            "8bb5740b-1d31-42db-89c1-7cafdc251dd9"
          ]
        },
        {
          "uuid": "83c47e71-6a83-46f5-a8e2-1b1a2cb48cac",
          "code": "C99823",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C99823",
          "code_system": "NCI_THESAURUS",
          "references": [
            "508e1f34-f621-433d-ada4-c5faaa6ef8ca"
          ]
        },
        {
          "uuid": "0f35c417-d5f9-4602-878d-b7dbd56455e1",
          "code": "5463805",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5463805",
          "code_system": "PUBCHEM",
          "references": [
            "508e1f34-f621-433d-ada4-c5faaa6ef8ca"
          ]
        },
        {
          "uuid": "51608336-0980-6356-5491-259178921406",
          "code": "C461",
          "comments": "Industrial Aid[C45678]|Dye",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C461",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e4121e0c-adeb-eccd-625a-eff2d8a58b08"
          ]
        },
        {
          "uuid": "8045ae18-e118-4602-80eb-0ebe983a5e5b",
          "code": "C3I439FV6T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "87ed0596-27ac-73b1-d947-b1260b0815f8",
          "code": "DTXSID50879804",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50879804",
          "code_system": "EPA CompTox",
          "references": [
            "e4121e0c-adeb-eccd-625a-eff2d8a58b08"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3c0ab239-dfae-41cc-8fa4-ff3c23ce433a",
          "name": "1,2-PROPANEDIOL, 3-((2-NITRO-4-(TRIFLUOROMETHYL)PHENYL)AMINO)-",
          "stdName": "1,2-PROPANEDIOL, 3-((2-NITRO-4-(TRIFLUOROMETHYL)PHENYL)AMINO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eec1885e-11a5-40b1-8367-c514b5cb791b",
            "0f1c7436-1442-4bed-b9b5-683964989a94"
          ],
          "display_name": false
        },
        {
          "uuid": "ee01f45b-2272-4610-9c88-c1a522de7e7d",
          "name": "3-(4-TRIFLUOROMETHYL-2-NITROANILINO)PROPANE-1,2-DIOL",
          "stdName": "3-(4-TRIFLUOROMETHYL-2-NITROANILINO)PROPANE-1,2-DIOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eec1885e-11a5-40b1-8367-c514b5cb791b",
            "0f1c7436-1442-4bed-b9b5-683964989a94"
          ],
          "display_name": false
        },
        {
          "uuid": "e92230f7-5a5b-4be2-9cb2-76e9cb2b9607",
          "name": "HC YELLOW 6",
          "stdName": "HC YELLOW 6",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eec1885e-11a5-40b1-8367-c514b5cb791b",
            "0f1c7436-1442-4bed-b9b5-683964989a94"
          ],
          "display_name": false
        },
        {
          "uuid": "974a82ea-2098-4d9a-8291-547c782d3a95",
          "name": "HC YELLOW NO. 6",
          "stdName": "HC YELLOW NO. 6",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f1c7436-1442-4bed-b9b5-683964989a94",
            "0c01ce17-2681-4e1e-884e-49e095d311e4",
            "27d10728-a0c5-4b21-b8a7-77a34b0025e9"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "96b196ff-6eb2-4b9a-9a03-6cd247c8d4c4",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "68caf584-7b69-4b40-ad5a-76ae3f6203fb",
          "name": "N-(2,3-DIHYDROXYPROPYL)-2-NITRO-4-(TRIFLUOROMETHYL)ANILINE",
          "stdName": "N-(2,3-DIHYDROXYPROPYL)-2-NITRO-4-(TRIFLUOROMETHYL)ANILINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eec1885e-11a5-40b1-8367-c514b5cb791b",
            "0f1c7436-1442-4bed-b9b5-683964989a94"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0c01ce17-2681-4e1e-884e-49e095d311e4",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0f1c7436-1442-4bed-b9b5-683964989a94",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eec1885e-11a5-40b1-8367-c514b5cb791b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "508e1f34-f621-433d-ada4-c5faaa6ef8ca",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391503000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "358e6e65-6ce0-43a6-a109-35654b05372c",
          "citation": "SRS import [C3I439FV6T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=C3I439FV6T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391503000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27d10728-a0c5-4b21-b8a7-77a34b0025e9",
          "citation": "HC YELLOW NO. 6 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e4121e0c-adeb-eccd-625a-eff2d8a58b08",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "8bb5740b-1d31-42db-89c1-7cafdc251dd9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "08598197-d0f3-58da-675b-6e12c570c12e",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "40ca803b-a361-4ba1-85e1-80e3a178d893",
          "id": "40ca803b-a361-4ba1-85e1-80e3a178d893",
          "molfile": "\n  Marvin  01132103252D          \n\n 19 19  0  0  0  0            999 V2000\n    4.4051   -6.1490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1180   -5.7433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8310   -6.1583    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.8310   -6.9816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5534   -5.7433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5534   -4.9200    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2569   -4.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2569   -3.6817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9582   -3.2761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7040   -3.6817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7040   -4.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9582   -4.9084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9582   -5.7433    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.2781   -6.1912    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.6265   -6.1700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4263   -3.2761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7335   -2.4434    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1402   -2.4434    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1487   -3.7029    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n 12  7  2  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 16  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 16 19  1  0  0  0  0\nM  CHG  2  13   1  14  -1\nM  END",
          "smiles": "c1cc(c(cc1C(F)(F)F)[N+](=O)[O-])NCC(CO)O",
          "formula": "C10H11F3N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f1e48c85-a8c2-4874-bb42-6c604db8b525"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "280.2009",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d5183fe8-d696-4e44-a8d5-9a0490e60b67",
      "version": "6",
      "structure": {
        "id": "1ae54c07-adee-4d0b-94b8-d3d52a885670",
        "molfile": "\n  Marvin  01132101342D          \n\n 19 19  0  0  0  0            999 V2000\n    4.4051   -6.1490    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8310   -6.9816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1180   -5.7433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7335   -2.4434    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1402   -2.4434    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1487   -3.7029    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8310   -6.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4263   -3.2761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5534   -5.7433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9582   -3.2761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2781   -6.1912    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.6265   -6.1700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7040   -3.6817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5534   -4.9200    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2569   -3.6817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9582   -5.7433    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    8.7040   -4.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2569   -4.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9582   -4.9084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 13 10  1  0  0  0  0\n  3  1  1  0  0  0  0\n  7  2  1  0  0  0  0\n  7  3  1  0  0  0  0\n  8  4  1  0  0  0  0\n  8  5  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  7  1  0  0  0  0\n 13  8  1  0  0  0  0\n 14  9  1  0  0  0  0\n 15 10  2  0  0  0  0\n 16 11  1  0  0  0  0\n 16 12  2  0  0  0  0\n 17 13  2  0  0  0  0\n 18 14  1  0  0  0  0\n 18 15  1  0  0  0  0\n 19 16  1  0  0  0  0\n 19 17  1  0  0  0  0\n 19 18  2  0  0  0  0\nM  CHG  2  11  -1  16   1\nM  END",
        "smiles": "c1cc(c(cc1C(F)(F)F)[N+](=O)[O-])NCC(CO)O",
        "formula": "C10H11F3N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "280.2009",
        "optical_activity": "( + / - )",
        "references": [
          "eec1885e-11a5-40b1-8367-c514b5cb791b",
          "358e6e65-6ce0-43a6-a109-35654b05372c"
        ],
        "stereo_centers": 1
      },
      "unii": "C3I439FV6T"
    }
  ]
}