{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "cc56adc4-f4fd-4f9a-8dd8-2c5ede371e2d", "code": "2043-06-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2043-06-3", "code_system": "CAS", "references": [ "2d9b758f-56fc-4371-bb2f-90b21ff8cb2c", "6b38d784-54d9-4b6c-b046-e96b915fd9bf" ] }, { "uuid": "0a6fb708-d2f2-4ed5-a454-6eb309e3d658", "code": "218-046-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.016.407", "code_system": "ECHA (EC/EINECS)", "references": [ "2d9b758f-56fc-4371-bb2f-90b21ff8cb2c" ] }, { "uuid": "68c32312-e944-4011-9be5-6130e8fb8440", "code": "96840", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/96840", "code_system": "PUBCHEM", "references": [ "2d9b758f-56fc-4371-bb2f-90b21ff8cb2c" ] }, { "uuid": "21400edc-0a30-33a0-cf8b-4fea8cb677d0", "code": "DTXSID80174374", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80174374", "code_system": "EPA CompTox", "references": [ "0525146c-31a2-5feb-3e6b-86822c3db627" ] }, { "uuid": "897e5345-9753-4e80-84b3-6ef073d08e08", "code": "C3HW3HH4YV", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "36126c03-b569-285d-ee78-3ce3d12ad394", "code": "90317", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=90317", "code_system": "NSC", "references": [ "ea3da957-cae2-816c-7e73-6dfc97977b9f" ] } ], "substance_class": "chemical", "names": [ { "uuid": "a002f926-4143-bc16-6a4a-4ebc02d3a0cd", "name": "1,3,4-OXADIAZOLE, 2,5-BIS((1,1'-BIPHENYL)-4-YL)-", "stdName": "1,3,4-OXADIAZOLE, 2,5-BIS((1,1'-BIPHENYL)-4-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "dbd5fc50-d816-0917-f559-18412fb29eba" ], "display_name": false }, { "uuid": "5f3fdf58-4a40-9d91-4fe9-3284872ff7ef", "name": "1,3,4-OXADIAZOLE, 2,5-BIS(4-BIPHENYLYL)-", "stdName": "1,3,4-OXADIAZOLE, 2,5-BIS(4-BIPHENYLYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "dbd5fc50-d816-0917-f559-18412fb29eba" ], "display_name": false }, { "uuid": "e11a39d1-4858-4212-95bb-e464f4dd54a6", "name": "2,5-BIS((1,1'-BIPHENYL)-4-YL)-1,3,4-OXADIAZOLE", "stdName": "2,5-BIS((1,1'-BIPHENYL)-4-YL)-1,3,4-OXADIAZOLE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4f22ca22-3c4a-4de3-8250-48ed3fea2eb7", "12c76bd9-6514-4ac3-9049-a76ba9434960" ], "display_name": true }, { "uuid": "af4d9436-7503-3734-0fb7-d28477bcb294", "name": "2,5-BIS(4-BIPHENYLYL)-1,3,4-OXADIAZOLE", "stdName": "2,5-BIS(4-BIPHENYLYL)-1,3,4-OXADIAZOLE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "dbd5fc50-d816-0917-f559-18412fb29eba" ], "display_name": false }, { "uuid": "a641c6b1-ae2f-a4e9-9d4c-02d91a974a13", "name": "2,5-DI(4-BIPHENYLYL)-1,3,4-OXADIAZOLE", "stdName": "2,5-DI(4-BIPHENYLYL)-1,3,4-OXADIAZOLE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "dbd5fc50-d816-0917-f559-18412fb29eba" ], "display_name": false }, { "uuid": "6519fa30-f19f-a513-e8da-c33f8efe087b", "name": "BBD", "stdName": "BBD", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "dbd5fc50-d816-0917-f559-18412fb29eba" ], "display_name": false }, { "uuid": "22c3b2d5-8f76-45d5-97a2-5e57fd17d36c", "name": "NSC-90317", "stdName": "NSC-90317", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "4f22ca22-3c4a-4de3-8250-48ed3fea2eb7", "12c76bd9-6514-4ac3-9049-a76ba9434960" ], "display_name": false } ], "references": [ { "uuid": "12c76bd9-6514-4ac3-9049-a76ba9434960", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4f22ca22-3c4a-4de3-8250-48ed3fea2eb7", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2d9b758f-56fc-4371-bb2f-90b21ff8cb2c", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493394036000, "tags": [ "NOMEN" ] }, { "uuid": "0525146c-31a2-5feb-3e6b-86822c3db627", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2043-06-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "dbd5fc50-d816-0917-f559-18412fb29eba", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ea3da957-cae2-816c-7e73-6dfc97977b9f", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "6b38d784-54d9-4b6c-b046-e96b915fd9bf", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4057d7e6-5a40-4357-9dbd-4e5bd6680fe3", "id": "4057d7e6-5a40-4357-9dbd-4e5bd6680fe3", "molfile": "\n Marvin 01132103242D \n\n 29 33 0 0 0 0 999 V2000\n 0.4675 0.6599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0862 1.2065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8630 0.9487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0314 0.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4127 -0.4090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6290 -0.1444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8151 -0.1203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4303 0.4262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2106 0.1718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3790 -0.6393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7638 -1.1858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9766 -0.9246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1627 -0.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4171 -1.6877 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2420 -1.6877 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4998 -0.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8296 -0.4193 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2835 -0.6393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9022 -1.1893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6790 -0.9315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8474 -0.1237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2390 0.4262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4519 0.1685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6311 0.1341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2498 -0.4193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0300 -0.1615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1985 0.6462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5901 1.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8030 0.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 6 2 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 5 4 2 0 0 0 0\n 4 7 1 0 0 0 0\n 6 5 1 0 0 0 0\n 8 7 1 0 0 0 0\n 7 12 2 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 2 0 0 0 0\n 10 13 1 0 0 0 0\n 12 11 1 0 0 0 0\n 14 13 2 0 0 0 0\n 13 17 1 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 18 16 1 0 0 0 0\n 19 18 1 0 0 0 0\n 23 18 2 0 0 0 0\n 20 19 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 24 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 29 24 2 0 0 0 0\n 26 25 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 28 29 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)-c2ccc(cc2)-c3nnc(-c4ccc(cc4)-c5ccccc5)o3", "formula": "C26H18N2O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "20efd36a-ab8d-4d68-b3e5-69ab869c1b61" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "374.4349", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "87181678-a649-4638-9887-4979439098a2", "version": "6", "structure": { "id": "e01090c2-c178-4a10-a62c-1e78d3cc6836", "molfile": "\n Marvin 01132111362D \n\n 29 33 0 0 0 0 999 V2000\n 5.8296 -0.4193 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2420 -1.6877 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4171 -1.6877 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1627 -0.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4998 -0.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3790 -0.6393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2835 -0.6393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8151 -0.1203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8474 -0.1237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2106 0.1718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9022 -1.1893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7638 -1.1858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4519 0.1685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6790 -0.9315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9766 -0.9246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2390 0.4262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4303 0.4262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0314 0.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6311 0.1341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4127 -0.4090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8630 0.9487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2498 -0.4193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8030 0.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0862 1.2065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0300 -0.1615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5901 1.1962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6290 -0.1444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4675 0.6599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1985 0.6462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 5 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 1 1 0 0 0 0\n 5 1 1 0 0 0 0\n 6 4 1 0 0 0 0\n 7 5 1 0 0 0 0\n 8 15 1 0 0 0 0\n 9 16 1 0 0 0 0\n 10 6 2 0 0 0 0\n 11 7 2 0 0 0 0\n 12 6 1 0 0 0 0\n 13 7 1 0 0 0 0\n 14 11 1 0 0 0 0\n 15 12 2 0 0 0 0\n 16 13 2 0 0 0 0\n 17 10 1 0 0 0 0\n 18 8 1 0 0 0 0\n 19 9 1 0 0 0 0\n 20 18 1 0 0 0 0\n 21 18 2 0 0 0 0\n 22 19 2 0 0 0 0\n 23 19 1 0 0 0 0\n 24 21 1 0 0 0 0\n 25 22 1 0 0 0 0\n 26 23 2 0 0 0 0\n 27 20 2 0 0 0 0\n 28 24 2 0 0 0 0\n 29 26 1 0 0 0 0\n 2 3 1 0 0 0 0\n 14 9 2 0 0 0 0\n 17 8 2 0 0 0 0\n 25 29 2 0 0 0 0\n 28 27 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)-c2ccc(cc2)-c3nnc(-c4ccc(cc4)-c5ccccc5)o3", "formula": "C26H18N2O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "374.4349", "optical_activity": "NONE", "references": [ "dbd5fc50-d816-0917-f559-18412fb29eba", "12c76bd9-6514-4ac3-9049-a76ba9434960" ], "stereo_centers": 0 }, "unii": "C3HW3HH4YV" } ] }