{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b1cd4488-33dc-4052-af1f-8ef1f3f1f38d",
          "code": "141-62-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=141-62-8",
          "code_system": "CAS",
          "references": [
            "daac3f81-a4bc-4c52-a069-0417258e1335",
            "f1a1ce00-9391-4529-a4c3-29cb31d807f4"
          ]
        },
        {
          "uuid": "ead8efa9-257d-4a1c-8655-fdf37c08b284",
          "code": "205-491-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.993",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "daac3f81-a4bc-4c52-a069-0417258e1335"
          ]
        },
        {
          "uuid": "a595fb53-a618-4b70-bf7c-fa3077823ca7",
          "code": "1366739",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1366739/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "daac3f81-a4bc-4c52-a069-0417258e1335"
          ]
        },
        {
          "uuid": "73756b58-7324-4a82-b9f9-10dd191c5c00",
          "code": "m4124",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4124?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "daac3f81-a4bc-4c52-a069-0417258e1335"
          ]
        },
        {
          "uuid": "4dfd24b4-5557-4d58-bd98-291711057d9a",
          "code": "8852",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8852",
          "code_system": "PUBCHEM",
          "references": [
            "daac3f81-a4bc-4c52-a069-0417258e1335"
          ]
        },
        {
          "uuid": "dd2b4ad8-0478-bc4d-5f48-222608708c16",
          "code": "DTXSID2044551",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2044551",
          "code_system": "EPA CompTox",
          "references": [
            "8a589231-f7b2-9675-8b82-d14155cbb467"
          ]
        },
        {
          "uuid": "2e5681ec-3b99-4417-81e5-3b61ca4be8b0",
          "code": "C23WAL597T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "315858ef-0559-080e-bec3-e66718010f0f",
          "code": "C23WAL597T",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=C23WAL597T",
          "code_system": "DAILYMED",
          "references": [
            "d17304b8-83b4-2d34-c370-26ad0bfe8dd2"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "176446f6-d139-4de7-9b6c-59c2cf181519",
          "name": "1,1,1,3,3,5,5,7,7,7-DECAMETHYLTETRASILOXANE",
          "stdName": "1,1,1,3,3,5,5,7,7,7-DECAMETHYLTETRASILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c85e520c-0c03-4ca2-bae2-73a87179aefb",
            "4380eeaa-a16e-4745-ba11-27f0220f87d7"
          ],
          "display_name": false
        },
        {
          "uuid": "7f0575de-f71d-4c5a-b95b-125c2ac56c96",
          "name": "DECAMETHYLTETRASILOXANE",
          "stdName": "DECAMETHYLTETRASILOXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c85e520c-0c03-4ca2-bae2-73a87179aefb",
            "08f81206-4a55-4f4a-8216-bd5bbe5e9991",
            "116ae304-31b4-4659-b622-78e2c1924822",
            "2c679594-47c5-457b-8c3d-5b0e48522f39"
          ],
          "display_name": true
        },
        {
          "uuid": "61f0408f-f8bc-4517-941e-def4719ce9ff",
          "name": "DECAMETHYLTETRASILOXANE [MI]",
          "stdName": "DECAMETHYLTETRASILOXANE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c85e520c-0c03-4ca2-bae2-73a87179aefb",
            "2c679594-47c5-457b-8c3d-5b0e48522f39"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "116ae304-31b4-4659-b622-78e2c1924822",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2c679594-47c5-457b-8c3d-5b0e48522f39",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c85e520c-0c03-4ca2-bae2-73a87179aefb",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4380eeaa-a16e-4745-ba11-27f0220f87d7",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "daac3f81-a4bc-4c52-a069-0417258e1335",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391114000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "774ffd10-10b9-4379-a033-bf03e10b635d",
          "citation": "SRS import [C23WAL597T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=C23WAL597T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391114000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "031d9c66-3529-4853-89aa-00b92047e8df",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08f81206-4a55-4f4a-8216-bd5bbe5e9991",
          "citation": "DECAMETHYLTETRASILOXANE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8a589231-f7b2-9675-8b82-d14155cbb467",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=141-62-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f1a1ce00-9391-4529-a4c3-29cb31d807f4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d17304b8-83b4-2d34-c370-26ad0bfe8dd2",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d5d6ef9b-17f2-4c6f-9454-143443eaae4f",
          "id": "d5d6ef9b-17f2-4c6f-9454-143443eaae4f",
          "molfile": "\n  Marvin  01132111052D          \n\n 17 16  0  0  0  0            999 V2000\n    9.6607   -4.3333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8355   -4.3333    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    8.8355   -5.1409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8355   -3.4985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0066   -4.3333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5875   -5.0507    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    8.3308   -5.4528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8812   -4.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1840   -5.7701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3745   -5.7701    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    6.3745   -6.6051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3745   -4.9864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5335   -5.7701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1142   -5.0705    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    4.4003   -5.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8363   -4.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6991   -4.3662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9  6  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\nM  END",
          "smiles": "C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C",
          "formula": "C10H30O3Si4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d24d9bb8-02ff-4979-a543-ba8c84b6c149"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "310.6853",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "abb06fe9-72fa-4a76-9350-eb734b3bbc8f",
      "version": "4",
      "structure": {
        "id": "217c04c0-3f04-402a-a34c-0bc2fd618d91",
        "molfile": "\n  Marvin  01132101532D          \n\n 17 16  0  0  0  0            999 V2000\n    7.1840   -5.7701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5875   -5.0507    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    8.0066   -4.3333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8355   -4.3333    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    9.6607   -4.3333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8355   -5.1409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8355   -3.4985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3308   -5.4528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8812   -4.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3745   -5.7701    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    5.5335   -5.7701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1142   -5.0705    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    4.4003   -5.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8363   -4.6589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6991   -4.3662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3745   -6.6051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3745   -4.9864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  2  8  1  0  0  0  0\n  2  9  1  0  0  0  0\n  1 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n 10 16  1  0  0  0  0\n 10 17  1  0  0  0  0\nM  END",
        "smiles": "C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C",
        "formula": "C10H30O3Si4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "310.6853",
        "optical_activity": "NONE",
        "references": [
          "031d9c66-3529-4853-89aa-00b92047e8df",
          "774ffd10-10b9-4379-a033-bf03e10b635d"
        ],
        "stereo_centers": 0
      },
      "unii": "C23WAL597T"
    }
  ]
}