{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9b723f18-2cda-4e81-b3a5-b7c90a524cc4",
          "code": "5743-17-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5743-17-9",
          "code_system": "CAS",
          "references": [
            "543395d4-7187-4e94-bc95-bc63bfb93dcb",
            "ac1b447b-834e-4ec8-94ef-71aca062726d"
          ]
        },
        {
          "uuid": "c49cb5dd-25f3-430e-a467-001e8d809026",
          "code": "227-257-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.024.780",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "543395d4-7187-4e94-bc95-bc63bfb93dcb"
          ]
        },
        {
          "uuid": "8a175412-5cd8-4588-8220-e43fd688934b",
          "code": "64120",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/64120",
          "code_system": "PUBCHEM",
          "references": [
            "543395d4-7187-4e94-bc95-bc63bfb93dcb"
          ]
        },
        {
          "uuid": "7e7394ab-2929-3728-2280-8949b91b34f7",
          "code": "DTXSID10206016",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10206016",
          "code_system": "EPA CompTox",
          "references": [
            "693b4d94-bc46-fb66-7376-a1e73f2bec55"
          ]
        },
        {
          "uuid": "8eadbfee-40d2-448c-a98b-84f7c3a316cc",
          "code": "C2154V12SE",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b439d69b-913e-5c8d-1476-7f17bbc85762",
          "code": "C2154V12SE",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(C2154V12SE)",
          "code_system": "DAILYMED",
          "references": [
            "2ef9d526-c837-1db0-fdfd-a89f75743dda"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "95c1b368-b6ca-464f-a323-cc8ef17d4a61",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "379875bc-0158-4701-a976-69fd00266c75",
            "refuuid": "76d7e2f1-16f8-4289-8ee1-a8e17c4804bb",
            "name": "Benzoic Acid",
            "unii": "8SKN0B0MIM",
            "linking_id": "8SKN0B0MIM",
            "ref_pname": "Benzoic Acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "66d5f745-ee2e-41a1-af1f-ce43659839b0",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "33a65ac2-9633-4347-84e5-00dff9b769ff",
            "refuuid": "f9c12f2f-ad99-4f1c-b96b-ac7ec1dc08df",
            "name": "CAFFEINE",
            "unii": "3G6A5W338E",
            "linking_id": "3G6A5W338E",
            "ref_pname": "CAFFEINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "03baf2bc-2553-40ac-85f9-c11c3ef28244",
          "name": "1H-PURINE-2,6-DIONE, 3,7-DIHYDRO-1,3,7-TRIMETHYL-, BENZOATE (1:1)",
          "stdName": "1H-PURINE-2,6-DIONE, 3,7-DIHYDRO-1,3,7-TRIMETHYL-, BENZOATE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd579c45-d05a-432c-b20e-fdd37fd016e0",
            "027835b0-e4d1-40eb-9509-c14c18c35452"
          ],
          "display_name": false
        },
        {
          "uuid": "be8a11f9-d840-476f-bab9-9ccbd7efe037",
          "name": "1H-PURINE-2,6-DIONE, 3,7-DIHYDRO-1,3,7-TRIMETHYL-, MONOBENZOATE",
          "stdName": "1H-PURINE-2,6-DIONE, 3,7-DIHYDRO-1,3,7-TRIMETHYL-, MONOBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd579c45-d05a-432c-b20e-fdd37fd016e0",
            "027835b0-e4d1-40eb-9509-c14c18c35452"
          ],
          "display_name": false
        },
        {
          "uuid": "3054bdcd-3861-447c-8740-7a13188d67f1",
          "name": "BENZOIC ACID, COMPD. WITH 3,7-DIHYDRO-1,3,7-TRIMETHYL-1H-PURINE-2,6-DIONE (1:1)",
          "stdName": "BENZOIC ACID, COMPD. WITH 3,7-DIHYDRO-1,3,7-TRIMETHYL-1H-PURINE-2,6-DIONE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd579c45-d05a-432c-b20e-fdd37fd016e0",
            "027835b0-e4d1-40eb-9509-c14c18c35452"
          ],
          "display_name": false
        },
        {
          "uuid": "976d8f09-835d-44bf-837f-de6b594d490f",
          "name": "BENZOIC ACID, COMPD. WITH CAFFEINE (1:1)",
          "stdName": "BENZOIC ACID, COMPD. WITH CAFFEINE (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd579c45-d05a-432c-b20e-fdd37fd016e0",
            "027835b0-e4d1-40eb-9509-c14c18c35452"
          ],
          "display_name": false
        },
        {
          "uuid": "1ac303aa-c493-4ccc-9d71-0811f0af9963",
          "name": "CAFFEINE BENZOATE",
          "stdName": "CAFFEINE BENZOATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f69fa1f5-aef3-4591-b494-4113d74bc76b",
            "0b1a2dce-c1a7-4e7d-a893-643ede8c501d",
            "1d154da5-f78b-4577-9564-3d9377ed0ac7",
            "027835b0-e4d1-40eb-9509-c14c18c35452"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "8acfd92d-4fbf-4805-bac7-622c5ef1ccdc",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "dc326543-ce7f-49d5-b28f-880ef30adea7",
          "name": "CAFFEINE, MONOBENZOATE",
          "stdName": "CAFFEINE, MONOBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd579c45-d05a-432c-b20e-fdd37fd016e0",
            "027835b0-e4d1-40eb-9509-c14c18c35452"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f69fa1f5-aef3-4591-b494-4113d74bc76b",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1d154da5-f78b-4577-9564-3d9377ed0ac7",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "027835b0-e4d1-40eb-9509-c14c18c35452",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd579c45-d05a-432c-b20e-fdd37fd016e0",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "543395d4-7187-4e94-bc95-bc63bfb93dcb",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391015000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4350b2eb-09ea-4fc4-9616-1ff06143e214",
          "citation": "SRS import [C2154V12SE]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=C2154V12SE",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391015000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3be96e4b-6dc1-40b9-a191-f719fc3d4349",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b1a2dce-c1a7-4e7d-a893-643ede8c501d",
          "citation": "CAFFEINE BENZOATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "693b4d94-bc46-fb66-7376-a1e73f2bec55",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5743-17-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ac1b447b-834e-4ec8-94ef-71aca062726d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2ef9d526-c837-1db0-fdfd-a89f75743dda",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e261fecb-d068-4970-89dc-2aea2432971d",
          "id": "e261fecb-d068-4970-89dc-2aea2432971d",
          "molfile": "\n  Marvin  01132111432D          \n\n  9  9  0  0  0  0            999 V2000\n   11.8637   -5.0416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1464   -4.6329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1464   -3.8097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4370   -5.0475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7204   -4.6395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0076   -5.0515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0076   -5.8773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7224   -6.2893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4370   -5.8768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  9  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)C(=O)O",
          "formula": "C7H6O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ede79c35-a016-46e4-8eb6-03eca3223766"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "122.1216",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "122ca761-99e7-4cfe-9cba-63ed173ccf7a",
          "id": "122ca761-99e7-4cfe-9cba-63ed173ccf7a",
          "molfile": "\n  Marvin  01132101102D          \n\n 14 15  0  0  0  0            999 V2000\n    5.8690   -3.7050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6096   -4.4896    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0905   -5.1515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6071   -5.8175    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8296   -5.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1150   -5.9750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1150   -6.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4051   -5.5670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6884   -5.9807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4051   -4.7419    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6864   -4.3318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1150   -4.3248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1150   -3.4997    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8296   -4.7419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 14  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n 14  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  8  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 12  1  0  0  0  0\nM  END",
          "smiles": "Cn1cnc2c1c(=O)n(C)c(=O)n2C",
          "formula": "C8H10N4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "795b0a5e-514e-4679-a33b-9bba351fe702"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "194.1909",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7ea186d3-1e88-4a65-bd88-f197f94d6eda",
      "version": "5",
      "structure": {
        "id": "548af997-f3e9-4a20-88fb-8f49c662c7d4",
        "molfile": "\n  Marvin  01132104242D          \n\n 23 24  0  0  0  0            999 V2000\n    3.3989   -4.7333    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6815   -4.3239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3989   -5.5569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6835   -5.9698    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1075   -5.9641    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8208   -5.5510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8208   -4.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1075   -4.3169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1075   -3.4933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5994   -4.4814    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8583   -3.6983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0794   -5.1421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5969   -5.8069    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1075   -6.7876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0114   -5.0536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0114   -5.8798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7265   -6.2919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4414   -5.8793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4414   -5.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7245   -4.6414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1511   -4.6348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8687   -5.0437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1511   -3.8113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  8  9  2  0  0  0  0\n  1  8  1  0  0  0  0\n 10  7  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  2  0  0  0  0\n  6 13  1  0  0  0  0\n  5 14  1  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 15  1  0  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  2  0  0  0  0\nM  END",
        "smiles": "Cn1cnc2c1c(=O)n(C)c(=O)n2C.c1ccc(cc1)C(=O)O",
        "formula": "C8H10N4O2.C7H6O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "316.3125",
        "optical_activity": "NONE",
        "references": [
          "4350b2eb-09ea-4fc4-9616-1ff06143e214",
          "3be96e4b-6dc1-40b9-a191-f719fc3d4349"
        ],
        "stereo_centers": 0
      },
      "unii": "C2154V12SE"
    }
  ]
}