{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ee766073-7874-4df5-b826-c20aae743fb8",
          "code": "N06AX01",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOANALEPTICS|ANTIDEPRESSANTS|Other antidepressants|oxitriptan",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N06AX01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "56f7af36-c463-4125-857a-202fcfa94875"
          ]
        },
        {
          "uuid": "c97bf186-2d43-41aa-8e4b-fb23c24ecc7b",
          "code": "QN06AX01",
          "comments": "VATC|PSYCHOANALEPTICS|ANTIDEPRESSANTS|Other antidepressants|oxitriptan",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN06AX01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "56f7af36-c463-4125-857a-202fcfa94875"
          ]
        },
        {
          "uuid": "b167fc74-70cd-4b44-a4aa-9dfaffceb079",
          "code": "4350-09-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4350-09-8",
          "code_system": "CAS",
          "references": [
            "56f7af36-c463-4125-857a-202fcfa94875",
            "470c35c8-3eb4-4e5f-85c8-fc53556841c4"
          ]
        },
        {
          "uuid": "e6efc769-0f21-4113-b9e6-e407a9252dba",
          "code": "D006916",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68006916",
          "code_system": "MESH",
          "references": [
            "56f7af36-c463-4125-857a-202fcfa94875"
          ]
        },
        {
          "uuid": "4f42cad9-10c8-484d-af40-29d5d6ffe49b",
          "code": "5-HYDROXYTRYPTOPHAN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/5-Hydroxytryptophan",
          "code_system": "WIKIPEDIA",
          "references": [
            "56f7af36-c463-4125-857a-202fcfa94875"
          ]
        },
        {
          "uuid": "69a29e90-b988-483c-8cd4-27473327608a",
          "code": "SUB09541MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "56f7af36-c463-4125-857a-202fcfa94875"
          ]
        },
        {
          "uuid": "ffc9463b-7f01-46e8-999e-11cc7aec2d77",
          "code": "4407",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4407",
          "code_system": "INN",
          "references": [
            "56f7af36-c463-4125-857a-202fcfa94875"
          ]
        },
        {
          "uuid": "69d09c26-69b8-4a9e-97ce-061d5d700134",
          "code": "224-411-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.022.193",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "56f7af36-c463-4125-857a-202fcfa94875"
          ]
        },
        {
          "uuid": "32a1e542-e9bc-4748-9f58-dc2d98417b75",
          "code": "C52181",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C52181",
          "code_system": "NCI_THESAURUS",
          "references": [
            "56f7af36-c463-4125-857a-202fcfa94875"
          ]
        },
        {
          "uuid": "204e4233-56be-42a5-ae74-c03e6cd8427a",
          "code": "94",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/94/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "56f7af36-c463-4125-857a-202fcfa94875"
          ]
        },
        {
          "uuid": "2474f9b9-f7ea-48a1-8415-bbc6b3be35ed",
          "code": "m6156",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6156?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "56f7af36-c463-4125-857a-202fcfa94875"
          ]
        },
        {
          "uuid": "f5cbee15-456a-43b5-b923-019315ed5cf6",
          "code": "DB02959",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB02959",
          "code_system": "DRUG BANK",
          "references": [
            "56f7af36-c463-4125-857a-202fcfa94875"
          ]
        },
        {
          "uuid": "02592c6c-d25b-46ca-8e35-643832183c18",
          "code": "CHEMBL350221",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL350221",
          "code_system": "ChEMBL",
          "references": [
            "56f7af36-c463-4125-857a-202fcfa94875"
          ]
        },
        {
          "uuid": "622be45d-545a-e53a-4bf1-7ad47d21edd1",
          "code": "DTXSID1025437",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1025437",
          "code_system": "EPA CompTox",
          "references": [
            "d3da1601-9e72-0a2e-b951-61bacaf67f51"
          ]
        },
        {
          "uuid": "f4c28a56-a0f4-f96d-f11a-5144f5900b0b",
          "code": "3984",
          "comments": "ORPHAN DRUG|Designated|Treatment of postanoxic intention myoclonus.",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=3984",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "39e51f42-b52e-fb8e-7912-3f3c1cadb1d7",
          "code": "118298",
          "comments": "ORPHAN DRUG|Designated|Treatment of tetrahydrobiopterin deficiency.",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=118298",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "e497b8f3-97ff-0e75-d2dd-7b2674e0af5d",
          "code": "C73539",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Amino Acid, Peptide, or Protein[C232]|Amino Acid Derivative",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C73539",
          "code_system": "NCI_THESAURUS",
          "references": [
            "875b3537-2ca8-7d14-b2c2-da00391d8899"
          ]
        },
        {
          "uuid": "aaa3efed-3c96-c11f-e198-0179af35cf5a",
          "code": "74768-3",
          "comments": "LOINC|ACTIVE|CHEM|PRP|5-Hydroxytryptophan [Moles/volume] in Platelet rich plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/74768-3/",
          "code_system": "LOINC",
          "references": [
            "875b3537-2ca8-7d14-b2c2-da00391d8899"
          ]
        },
        {
          "uuid": "9f4fdfc3-1fe7-4c63-a88a-6d064f42bb7a",
          "code": "C1LJO185Q9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ba86d085-1fad-5087-2031-f3f0e48dfff4",
          "code": "1329913",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1329913",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "875b3537-2ca8-7d14-b2c2-da00391d8899"
          ]
        },
        {
          "uuid": "28308d12-ca2a-0de9-8251-0d98332ed73e",
          "code": "305 (Number of products:540)",
          "comments": "Dietary Supplement Label Database|Chemical|5-HTP",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=305&item=5-HTP",
          "code_system": "DSLD",
          "references": [
            "875b3537-2ca8-7d14-b2c2-da00391d8899"
          ]
        },
        {
          "uuid": "af25073b-00cb-d187-9199-60d5ffe16b08",
          "code": "439280",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439280",
          "code_system": "PUBCHEM",
          "references": [
            "96f8c813-caa7-752a-13a4-951783b3cc8a"
          ]
        },
        {
          "uuid": "bf19a85d-09cf-cc87-0688-4b246babeebb",
          "code": "4006",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4006",
          "code_system": "DRUG CENTRAL",
          "references": [
            "875b3537-2ca8-7d14-b2c2-da00391d8899"
          ]
        },
        {
          "uuid": "7b55749b-16dd-3ece-8d24-a96a91df8700",
          "code": "17780",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17780",
          "code_system": "CHEBI",
          "references": [
            "875b3537-2ca8-7d14-b2c2-da00391d8899"
          ]
        },
        {
          "uuid": "00d6d454-5655-83d7-0f2d-397aa38f101a",
          "code": "28171",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28171",
          "code_system": "CHEBI",
          "references": [
            "875b3537-2ca8-7d14-b2c2-da00391d8899"
          ]
        },
        {
          "uuid": "c2aadb7a-4933-dcab-5eec-d82862f9c2c7",
          "code": "58266",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:58266",
          "code_system": "CHEBI",
          "references": [
            "875b3537-2ca8-7d14-b2c2-da00391d8899"
          ]
        },
        {
          "uuid": "101968cb-778b-5bfd-5e57-328dfd88268d",
          "code": "C1LJO185Q9",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=C1LJO185Q9",
          "code_system": "DAILYMED",
          "references": [
            "1a3ef9e7-841b-0c4a-8586-d99e2dfaaf80"
          ]
        },
        {
          "uuid": "1a1a0e18-d6dc-bf5a-3954-b1590758b089",
          "code": "100000083049",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "e78d27ef-2007-6766-25ba-8c498817fae1"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "6bb05c18-b5aa-497d-b672-c420bcd90e65",
          "amount": {
            "uuid": "6e0a5d70-54d5-405c-9211-6f1a379c2d5c"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "79c2774a-0e7f-4ff4-b09f-a51ebaa7874b",
            "refuuid": "4b589abd-0ac3-4c88-8796-46a6f9ddf0d1",
            "name": "OXITRIPTAN",
            "unii": "C1LJO185Q9",
            "linking_id": "C1LJO185Q9",
            "ref_pname": "OXITRIPTAN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0b3db8a4-1ee4-4338-b4a7-1735f7bf2be8",
          "amount": {
            "uuid": "41fd2cae-f210-4196-a420-628988b81681"
          },
          "type": "PARENT->METABOLITE",
          "references": [
            "59820225-7229-4cb7-bc91-f594dadb5e15"
          ],
          "related_substance": {
            "uuid": "c10a09fa-6504-463a-add5-18a49c8cbf9b",
            "refuuid": "2a139f77-b80e-45bf-aba5-6461ca8e139a",
            "name": "TRYPTOPHAN",
            "unii": "8DUH1N11BX",
            "linking_id": "8DUH1N11BX",
            "ref_pname": "TRYPTOPHAN"
          }
        },
        {
          "uuid": "88becb40-5d39-4465-ac01-0660aa420c92",
          "amount": {
            "uuid": "6e437b2b-54c4-47a7-8cdf-96d1c0d8b460"
          },
          "type": "TARGET->AGONIST",
          "references": [
            "0865a080-9698-472e-869c-ee56f2711123"
          ],
          "related_substance": {
            "uuid": "a79c915d-b126-40f1-9dad-b24812b0866f",
            "refuuid": "9bfef87f-df60-4cc3-a78f-4a9ab1339e24",
            "name": "5-HYDROXYTRYPTAMINE RECEPTOR 1A",
            "unii": "UKK18ES9TF",
            "linking_id": "UKK18ES9TF",
            "ref_pname": "5-HYDROXYTRYPTAMINE RECEPTOR 1A",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "919f2007-f658-46ae-a504-3a242491e79e",
          "amount": {
            "uuid": "40d59a97-752c-4fbb-8997-b99265721180",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "EP",
          "type": "PARENT->IMPURITY",
          "references": [
            "94876f42-4ae5-4d0c-5416-39e976f21194"
          ],
          "related_substance": {
            "uuid": "26d6a41f-462e-430d-a640-21082d4022b8",
            "refuuid": "2a139f77-b80e-45bf-aba5-6461ca8e139a",
            "name": "TRYPTOPHAN",
            "unii": "8DUH1N11BX",
            "linking_id": "8DUH1N11BX",
            "ref_pname": "TRYPTOPHAN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e5cf1892-5bbe-4a92-be2b-b07102a97504",
          "amount": {
            "uuid": "d3ebaf76-b18f-4e13-a9ee-61aeb9829446"
          },
          "type": "LABELED->NON-LABELED",
          "references": [
            "7bf9bcef-8223-4e09-9c4f-de3e3d8e7380"
          ],
          "related_substance": {
            "uuid": "d2539d44-b79d-45f6-8ed3-bfc95a55512c",
            "refuuid": "95857d36-c46a-4c76-8567-8b8531d3fe69",
            "name": "OXITRIPTAN C-11",
            "unii": "8A8TM3K6HF",
            "linking_id": "8A8TM3K6HF",
            "ref_pname": "OXITRIPTAN C-11",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c7f3e202-4de3-4745-832f-6b580b8f613a",
          "amount": {
            "uuid": "fa7c1ea0-0682-41ed-a5b1-927b458c4d60",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.25
          },
          "qualification": "EP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "812ca4a0-01c8-42be-a5cd-e9f3b78f59b9"
          ],
          "related_substance": {
            "uuid": "84c64efe-b1bc-4b25-9118-0152265359f7",
            "refuuid": "66faa5c8-a5ca-4804-8e3e-710e57a50782",
            "name": "N-ACETYL-DL-TRYPTOPHAN",
            "unii": "4460NBV53F",
            "linking_id": "4460NBV53F",
            "ref_pname": "N-ACETYL-DL-TRYPTOPHAN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "26651aaa-49c8-207c-860d-83c649795232",
          "name": "(2S)-2-AMINO-3-(5-HYDROXY-1H-INDOL-3-YL)PROPANOIC ACID",
          "stdName": "(2S)-2-AMINO-3-(5-HYDROXY-1H-INDOL-3-YL)PROPANOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94876f42-4ae5-4d0c-5416-39e976f21194"
          ],
          "display_name": false
        },
        {
          "uuid": "4bf5e64b-cbec-4b7e-b9ef-0e7b86915305",
          "name": "(S)-5-HYDROXYTRYPTOPHAN",
          "stdName": "(S)-5-HYDROXYTRYPTOPHAN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c335398-50a1-4c88-b0d6-d6327250eef1",
            "a59d7e0b-c816-4726-82bf-09d587bd13bd"
          ],
          "display_name": false
        },
        {
          "uuid": "9161935a-4408-4564-bfe2-12efcb78f48f",
          "name": "5-HYDROXY-L-TRYPTOPHAN",
          "stdName": "5-HYDROXY-L-TRYPTOPHAN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b39aec7-6a20-4281-ac86-29c08b12e77c",
            "a59d7e0b-c816-4726-82bf-09d587bd13bd",
            "04406d1d-2c36-440c-a3f0-7f98b1384058",
            "866f5dfc-a5b6-42a1-950b-7882e4bdbd16"
          ],
          "display_name": false
        },
        {
          "uuid": "afca6253-5231-4130-805a-48e8e110e842",
          "name": "5-HYDROXY-L-TRYPTOPHAN [USP-RS]",
          "stdName": "5-HYDROXY-L-TRYPTOPHAN [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a59d7e0b-c816-4726-82bf-09d587bd13bd",
            "866f5dfc-a5b6-42a1-950b-7882e4bdbd16"
          ],
          "display_name": false
        },
        {
          "uuid": "13078e36-171a-463a-b00a-b55aa8b143aa",
          "name": "5-HYDROXYTRYPTOPHAN",
          "stdName": "5-HYDROXYTRYPTOPHAN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dfead887-8389-42da-87cb-9ff11bda177e",
            "a59d7e0b-c816-4726-82bf-09d587bd13bd"
          ],
          "display_name": false
        },
        {
          "uuid": "9a9c1502-0267-42e2-88e6-7da2481ed468",
          "name": "5-HYDROXYTRYPTOPHAN L-FORM",
          "stdName": "5-HYDROXYTRYPTOPHAN L-FORM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dfead887-8389-42da-87cb-9ff11bda177e",
            "a59d7e0b-c816-4726-82bf-09d587bd13bd",
            "c5f91fc4-2872-45e0-b7e1-53eb0e11fa3a"
          ],
          "display_name": false
        },
        {
          "uuid": "fd6948cb-7cfa-442a-82b3-70971aee47b0",
          "name": "5-HYDROXYTRYPTOPHAN L-FORM [MI]",
          "stdName": "5-HYDROXYTRYPTOPHAN L-FORM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dfead887-8389-42da-87cb-9ff11bda177e",
            "a59d7e0b-c816-4726-82bf-09d587bd13bd"
          ],
          "display_name": false
        },
        {
          "uuid": "64401920-1959-4535-96cd-83b5e226f736",
          "name": "CINCOFARM",
          "stdName": "CINCOFARM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c335398-50a1-4c88-b0d6-d6327250eef1",
            "a59d7e0b-c816-4726-82bf-09d587bd13bd"
          ],
          "display_name": false
        },
        {
          "uuid": "1183eab0-478a-48e3-813a-58781de41e66",
          "name": "HYDROXYTRYPTOPHAN",
          "stdName": "HYDROXYTRYPTOPHAN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "e86ba75d-51dc-49fb-ba0f-d72b7dc6b583",
            "36ce53f5-daee-4528-b2a4-e86001c016c2",
            "a59d7e0b-c816-4726-82bf-09d587bd13bd",
            "c77bfe03-6337-47ba-a198-2b747c34b8e5",
            "ede67265-e1e0-4f89-a2bd-e2c853fccf55"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "dcbe4965-af69-48a8-86fb-5f951ef8a078",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "9ba1f920-7d86-491d-83a4-98b1c95b10c8",
          "name": "HYDROXYTRYPTOPHAN [VANDF]",
          "stdName": "HYDROXYTRYPTOPHAN [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a59d7e0b-c816-4726-82bf-09d587bd13bd",
            "c77bfe03-6337-47ba-a198-2b747c34b8e5"
          ],
          "display_name": false
        },
        {
          "uuid": "b228e077-4d8b-4f96-9902-37832ef1e36c",
          "name": "L-5-HTP",
          "stdName": "L-5-HTP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c335398-50a1-4c88-b0d6-d6327250eef1",
            "a59d7e0b-c816-4726-82bf-09d587bd13bd"
          ],
          "display_name": false
        },
        {
          "uuid": "97ba8968-7d17-431b-8eaf-603aabec44c3",
          "name": "L-5-HYDROXYTRYPTOPHAN",
          "stdName": "L-5-HYDROXYTRYPTOPHAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a59d7e0b-c816-4726-82bf-09d587bd13bd",
            "c309154d-3a4e-4db0-9a87-1ee28fa74f63"
          ],
          "display_name": false
        },
        {
          "uuid": "bd3c6827-ad3f-4e13-a316-fc6ce2138138",
          "name": "L-TRYPTOPHAN, 5-HYDROXY-",
          "stdName": "L-TRYPTOPHAN, 5-HYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c335398-50a1-4c88-b0d6-d6327250eef1",
            "a59d7e0b-c816-4726-82bf-09d587bd13bd"
          ],
          "display_name": false
        },
        {
          "uuid": "9fd0dca9-de38-4cde-8a56-26f968dfadc4",
          "name": "LEVOTHYM",
          "stdName": "LEVOTHYM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c335398-50a1-4c88-b0d6-d6327250eef1",
            "a59d7e0b-c816-4726-82bf-09d587bd13bd"
          ],
          "display_name": false
        },
        {
          "uuid": "a1bfcf91-3230-47c5-ae0b-92c808eaf2b6",
          "name": "LEVOTININE",
          "stdName": "LEVOTININE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c335398-50a1-4c88-b0d6-d6327250eef1",
            "a59d7e0b-c816-4726-82bf-09d587bd13bd"
          ],
          "display_name": false
        },
        {
          "uuid": "4e447070-cfe0-43c7-237c-00b1357924a2",
          "name": "N-ACETYLTRYPTOPHAN IMPURITY D [EP IMPURITY]",
          "stdName": "N-ACETYLTRYPTOPHAN IMPURITY D [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "812ca4a0-01c8-42be-a5cd-e9f3b78f59b9"
          ],
          "display_name": false
        },
        {
          "uuid": "3770d73d-ef96-4862-bf75-0051b1edac1a",
          "name": "OXITRIPTAN",
          "stdName": "OXITRIPTAN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34018610-3f8a-44e7-b54e-fb192417805c",
            "d6188b19-8ba8-4612-b4ca-32b7e53c2d97",
            "0865a080-9698-472e-869c-ee56f2711123",
            "efd3d821-94d0-46cb-9eac-5412a8fea4ea",
            "7aa15667-ce47-4000-8e8e-62ded204cfca",
            "a59d7e0b-c816-4726-82bf-09d587bd13bd",
            "e8a75f61-08f0-4386-96a8-6f3c977aa3f1",
            "e7d64273-93ec-4b90-863d-4325365a5a43"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "eca020e1-4466-4c8a-aa62-701a2c4d2508",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "1b54c45a-f2c3-4b93-ab59-91bd68965880",
          "name": "OXITRIPTAN [MART.]",
          "stdName": "OXITRIPTAN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0865a080-9698-472e-869c-ee56f2711123"
          ],
          "display_name": false
        },
        {
          "uuid": "18abf66c-7374-4702-b0bb-859eac11f927",
          "name": "OXYFAN",
          "stdName": "OXYFAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c335398-50a1-4c88-b0d6-d6327250eef1",
            "a59d7e0b-c816-4726-82bf-09d587bd13bd"
          ],
          "display_name": false
        },
        {
          "uuid": "cdda7a0a-7c86-50ff-272a-38ff770c8151",
          "name": "Oxitriptan [WHO-DD]",
          "stdName": "OXITRIPTAN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe060ba0-9d10-cac1-0521-45520ae7d4c4"
          ],
          "display_name": false
        },
        {
          "uuid": "6530f863-4ff7-4b82-8ae3-70d1a4e83b21",
          "name": "PRETONINE",
          "stdName": "PRETONINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c335398-50a1-4c88-b0d6-d6327250eef1",
            "a59d7e0b-c816-4726-82bf-09d587bd13bd"
          ],
          "display_name": false
        },
        {
          "uuid": "a9c3e2d1-e21e-4453-a02c-06881f43b13d",
          "name": "QUIETIM",
          "stdName": "QUIETIM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c335398-50a1-4c88-b0d6-d6327250eef1",
            "a59d7e0b-c816-4726-82bf-09d587bd13bd"
          ],
          "display_name": false
        },
        {
          "uuid": "ab53a54e-f4f3-41c6-bc75-b55fe2c9c4f9",
          "name": "SEROTONYL",
          "stdName": "SEROTONYL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c335398-50a1-4c88-b0d6-d6327250eef1",
            "a59d7e0b-c816-4726-82bf-09d587bd13bd"
          ],
          "display_name": false
        },
        {
          "uuid": "62d69ae5-1727-4baa-89c3-ba9d6edd71dd",
          "name": "TELESOL",
          "stdName": "TELESOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c335398-50a1-4c88-b0d6-d6327250eef1",
            "a59d7e0b-c816-4726-82bf-09d587bd13bd"
          ],
          "display_name": false
        },
        {
          "uuid": "f281751b-3f10-45a7-80ae-361a5ccfe8b0",
          "name": "TRIPTENE",
          "stdName": "TRIPTENE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c335398-50a1-4c88-b0d6-d6327250eef1",
            "a59d7e0b-c816-4726-82bf-09d587bd13bd"
          ],
          "display_name": false
        },
        {
          "uuid": "d5c675b4-f5b5-f9af-5e64-2ba998c87298",
          "name": "TRYPTOPHAN IMPURITY D [EP IMPURITY]",
          "stdName": "TRYPTOPHAN IMPURITY D [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94876f42-4ae5-4d0c-5416-39e976f21194"
          ],
          "display_name": false
        },
        {
          "uuid": "bb7812c1-6e7b-48fb-b696-f90eb232a0af",
          "name": "oxitriptan [INN]",
          "stdName": "OXITRIPTAN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7d64273-93ec-4b90-863d-4325365a5a43"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "94876f42-4ae5-4d0c-5416-39e976f21194",
          "citation": "European Pharmacopoeia Online 9.8, Tryptophan Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dfead887-8389-42da-87cb-9ff11bda177e",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a59d7e0b-c816-4726-82bf-09d587bd13bd",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6188b19-8ba8-4612-b4ca-32b7e53c2d97",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "04406d1d-2c36-440c-a3f0-7f98b1384058",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7d64273-93ec-4b90-863d-4325365a5a43",
          "citation": "INN Proposed List 39",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL39.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2c335398-50a1-4c88-b0d6-d6327250eef1",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0865a080-9698-472e-869c-ee56f2711123",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "866f5dfc-a5b6-42a1-950b-7882e4bdbd16",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "efd3d821-94d0-46cb-9eac-5412a8fea4ea",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c77bfe03-6337-47ba-a198-2b747c34b8e5",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ede67265-e1e0-4f89-a2bd-e2c853fccf55",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c309154d-3a4e-4db0-9a87-1ee28fa74f63",
          "citation": "orphan drug",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56f7af36-c463-4125-857a-202fcfa94875",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389646000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7fe34da7-7419-48cf-a152-dd468ceffe04",
          "citation": "SRS import [C1LJO185Q9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=C1LJO185Q9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389646000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7aa15667-ce47-4000-8e8e-62ded204cfca",
          "citation": "OXITRIPTAN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e8a75f61-08f0-4386-96a8-6f3c977aa3f1",
          "citation": "OXITRIPTAN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4b39aec7-6a20-4281-ac86-29c08b12e77c",
          "citation": "5-HYDROXY-L-TRYPTOPHAN [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "34018610-3f8a-44e7-b54e-fb192417805c",
          "citation": "OXITRIPTAN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "36ce53f5-daee-4528-b2a4-e86001c016c2",
          "citation": "HYDROXYTRYPTOPHAN [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e86ba75d-51dc-49fb-ba0f-d72b7dc6b583",
          "citation": "HYDROXYTRYPTOPHAN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c5f91fc4-2872-45e0-b7e1-53eb0e11fa3a",
          "citation": "5-HYDROXYTRYPTOPHAN L-FORM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d3da1601-9e72-0a2e-b951-61bacaf67f51",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4350-09-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "875b3537-2ca8-7d14-b2c2-da00391d8899",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b121cc63-3be5-4c6a-9534-34afb2efb8e0",
          "citation": "Höglund, Erik, Øyvind Øverli, and Svante Winberg. \"Tryptophan metabolic pathways and brain serotonergic activity: a comparative review.\" Frontiers in endocrinology 10 (2019).",
          "url": "https://www.ncbi.nlm.nih.gov/pmc/articles/PMC6463810/",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "470c35c8-3eb4-4e5f-85c8-fc53556841c4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "96f8c813-caa7-752a-13a4-951783b3cc8a",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "7bf9bcef-8223-4e09-9c4f-de3e3d8e7380",
          "citation": "Norlén, Olov, et al. \"11C-5-hydroxytryptophan positron emission tomography after radiofrequency ablation of neuroendocrine tumor liver metastases.\" Nuclear medicine and biology 39.6 (2012): 883-890.",
          "url": "https://www.sciencedirect.com/science/article/pii/S0969805112000066",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "812ca4a0-01c8-42be-a5cd-e9f3b78f59b9",
          "citation": "EP 10.6",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fe060ba0-9d10-cac1-0521-45520ae7d4c4",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "1a3ef9e7-841b-0c4a-8586-d99e2dfaaf80",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "e78d27ef-2007-6766-25ba-8c498817fae1",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "59820225-7229-4cb7-bc91-f594dadb5e15",
          "citation": "Höglund, Erik, Øyvind Øverli, and Svante Winberg. \"Tryptophan metabolic pathways and brain serotonergic activity: a comparative review.\" Frontiers in endocrinology 10 (2019).",
          "url": "https://www.ncbi.nlm.nih.gov/pmc/articles/PMC6463810/",
          "doc_type": "JA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "da24e237-8680-41d4-b929-7645dcac6dd3",
          "id": "da24e237-8680-41d4-b929-7645dcac6dd3",
          "molfile": "\n  Marvin  01132111192D          \n\n 16 17  0  0  1  0            999 V2000\n    4.5229   -0.8038    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.5187   -1.6284    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8107   -0.3873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5192    0.3873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9690    1.0745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4525    1.7158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6821    1.4243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9491    1.8033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2535    1.3577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2952    0.5289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5747    0.1207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0282    0.1582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7195    0.6038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2392   -0.3957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2351    0.4289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9514   -0.8121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 14  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n 13  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7 13  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  2  0  0  0  0\nM  END",
          "smiles": "c1cc2c(cc1O)c(C[C@@H](C(=O)O)N)c[nH]2",
          "formula": "C11H12N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2ad17a23-7842-4bc3-b535-b21acca72a58"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "220.225",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4b589abd-0ac3-4c88-8796-46a6f9ddf0d1",
      "version": "37",
      "structure": {
        "id": "e670fe5f-39e6-49a2-85d5-e6638c6b02ef",
        "molfile": "\n   JSDraw202032411072D\n\n 16 17  0  0  1  0              0 V2000\n   19.5631   -7.6123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.1975   -9.0371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7471   -9.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.6623   -7.9347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.0279   -6.5099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4783   -6.3539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8410   -4.9301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1495   -8.4235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.4131   -7.5087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.8372   -8.1456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.1008   -7.2309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9404   -5.6791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   29.5249   -7.8678    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.9977   -9.6974    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1495   -9.9835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.6623  -10.4619    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 10 14  1  1  0  0  0\n  8 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n  3 16  1  0  0  0  0\nM  END",
        "smiles": "c1cc2c(cc1O)c(C[C@@H](C(=O)O)N)c[nH]2",
        "formula": "C11H12N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "220.225",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "d6188b19-8ba8-4612-b4ca-32b7e53c2d97",
          "7fe34da7-7419-48cf-a152-dd468ceffe04",
          "e7d64273-93ec-4b90-863d-4325365a5a43"
        ],
        "stereo_centers": 1
      },
      "unii": "C1LJO185Q9"
    }
  ]
}