{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b57253f7-3fc2-4f57-a4a7-a6c5717ba6f1",
          "code": "121521-90-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=121521-90-2",
          "code_system": "CAS",
          "references": [
            "ae573a08-98ea-4835-acb0-8da1b2179877",
            "cea4755e-e541-4de3-81d9-085bf586394e"
          ]
        },
        {
          "uuid": "fd61264f-62b4-4741-a0e8-4b491a1f8920",
          "code": "SUB130514",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "ae573a08-98ea-4835-acb0-8da1b2179877"
          ]
        },
        {
          "uuid": "b603dc95-fdd5-4f59-86df-927ca1542f25",
          "code": "6451084",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6451084",
          "code_system": "PUBCHEM",
          "references": [
            "ae573a08-98ea-4835-acb0-8da1b2179877"
          ]
        },
        {
          "uuid": "89ce0aff-fb4f-4cc5-971c-e43c32251cfa",
          "code": "C1GQ844199",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6ea5822c-f84a-b877-ed7e-b19302d308c3",
          "code": "1609818",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1609818",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "16102eb4-463e-f12a-c632-92ad53051e6f"
          ]
        },
        {
          "uuid": "2b42dad4-a286-d44b-13f8-6593c8557f77",
          "code": "134301",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:134301",
          "code_system": "CHEBI",
          "references": [
            "16102eb4-463e-f12a-c632-92ad53051e6f"
          ]
        },
        {
          "uuid": "98507695-7b85-9df9-82ae-b0982dfe2beb",
          "code": "DTXSID201031347",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201031347",
          "code_system": "EPA CompTox",
          "references": [
            "16102eb4-463e-f12a-c632-92ad53051e6f"
          ]
        },
        {
          "uuid": "05234cb4-ff92-fd26-5d88-b37a6f69a837",
          "code": "100000156573",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "61a0a7c6-3ee8-c378-3521-aa63a8dda3d0"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f1896215-9724-4d40-800d-659af4245b88",
          "name": "(2S,3S)-4-((1E)-3-((1R)-1-CARBOXY-2-(3,4-DIHYDROXYPHENYL)ETHOXY)-3-OXO-1-PROPEN-1-YL)-2-(3,4-DIHYDROXYPHENYL)-2,3-DIHYDRO-7-HYDROXY-3-BENZOFURANCARBOXYLIC ACID 3-((1R)-1-CARBOXY-2-(3,4-DIHYDROXYPHENYL)ETHYL) ESTER",
          "stdName": "(2S,3S)-4-((1E)-3-((1R)-1-CARBOXY-2-(3,4-DIHYDROXYPHENYL)ETHOXY)-3-OXO-1-PROPEN-1-YL)-2-(3,4-DIHYDROXYPHENYL)-2,3-DIHYDRO-7-HYDROXY-3-BENZOFURANCARBOXYLIC ACID 3-((1R)-1-CARBOXY-2-(3,4-DIHYDROXYPHENYL)ETHYL) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cbf20523-db5c-4f21-b165-9478bf2fe515"
          ],
          "display_name": false
        },
        {
          "uuid": "d80b5614-889a-4a39-b698-a79728d3c16c",
          "name": "3-Benzofurancarboxylic acid, 4-[(1E)-3-[(1R)-1-carboxy-2-(3,4-dihydroxyphenyl)ethoxy]-3-oxo-1-propen-1-yl]-2-(3,4-dihydroxyphenyl)-2,3-dihydro-7-hydroxy-, 3-[(1R)-1-carboxy-2-(3,4-dihydroxyphenyl)ethyl] ester, (2S,3S)-",
          "stdName": "3-BENZOFURANCARBOXYLIC ACID, 4-((1E)-3-((1R)-1-CARBOXY-2-(3,4-DIHYDROXYPHENYL)ETHOXY)-3-OXO-1-PROPEN-1-YL)-2-(3,4-DIHYDROXYPHENYL)-2,3-DIHYDRO-7-HYDROXY-, 3-((1R)-1-CARBOXY-2-(3,4-DIHYDROXYPHENYL)ETHYL) ESTER, (2S,3S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0eb97c31-1324-4f20-8813-47dc082057d1"
          ],
          "display_name": false
        },
        {
          "uuid": "3a7ff959-1972-45aa-bd06-d83f9f67c845",
          "name": "DAN SHEN SUAN B",
          "stdName": "DAN SHEN SUAN B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cbf20523-db5c-4f21-b165-9478bf2fe515"
          ],
          "display_name": false
        },
        {
          "uuid": "32fb0aaf-8285-43d5-84ee-dadbf2a4eb59",
          "name": "DANFENSUAN B",
          "stdName": "DANFENSUAN B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cbf20523-db5c-4f21-b165-9478bf2fe515"
          ],
          "display_name": false
        },
        {
          "uuid": "26f52d0a-e8f2-45a0-96d5-fdbc6931c76b",
          "name": "LITHOSPERMIC ACID B",
          "stdName": "LITHOSPERMIC ACID B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cbf20523-db5c-4f21-b165-9478bf2fe515"
          ],
          "display_name": false
        },
        {
          "uuid": "e2115224-d7fe-4bc4-9dc0-f75dfd812c43",
          "name": "SALVIANOLIC ACID B",
          "stdName": "SALVIANOLIC ACID B",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "32057f34-99b9-4abc-8def-f81ff29d1487",
            "deb5d37e-e60c-4aa9-9f09-fd6490f2a082",
            "cbf20523-db5c-4f21-b165-9478bf2fe515",
            "0330b110-90f3-4667-b4fd-b3b99ff55d17",
            "d62e4b42-1975-4b44-a1a5-621603ca276f"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3e0688b9-130c-44ba-9385-9352cf133465",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "9136f6a0-3fee-4006-803b-9ea6bdfbb25e",
          "name": "SALVIANOLIC ACID B (CONSTITUENT OF CHINESE SALVIA) [DSC]",
          "stdName": "SALVIANOLIC ACID B (CONSTITUENT OF CHINESE SALVIA) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10b68f69-6a96-4c9e-875b-f9a2ba3cf67c"
          ],
          "display_name": false
        },
        {
          "uuid": "fac820ad-2afc-47f7-aa55-a2a05a581388",
          "name": "SALVIANOLIC ACID B [USP-RS]",
          "stdName": "SALVIANOLIC ACID B [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0330b110-90f3-4667-b4fd-b3b99ff55d17"
          ],
          "display_name": false
        },
        {
          "uuid": "5cd22dcf-41b6-f3da-012a-58cabb924689",
          "name": "Salvianolic acid B [WHO-DD]",
          "stdName": "SALVIANOLIC ACID B [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea3ab7ba-5048-7071-b8aa-803b0b402415"
          ],
          "display_name": false
        },
        {
          "uuid": "9f075be1-fb24-444c-bdef-d314d12a5d6e",
          "name": "ZINC-49538628",
          "stdName": "ZINC-49538628",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9dae464d-16b5-4761-85bb-fe3faa5bedfc"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0330b110-90f3-4667-b4fd-b3b99ff55d17",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "deb5d37e-e60c-4aa9-9f09-fd6490f2a082",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9dae464d-16b5-4761-85bb-fe3faa5bedfc",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cbf20523-db5c-4f21-b165-9478bf2fe515",
          "citation": "http://www.sigmaaldrich.com/catalog/product/sigma/sml0048?lang=en&region=US",
          "url": "http://www.sigmaaldrich.com/catalog/product/sigma/sml0048?lang=en&region=US",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10b68f69-6a96-4c9e-875b-f9a2ba3cf67c",
          "citation": "DSC, VOL.2, 2015",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae573a08-98ea-4835-acb0-8da1b2179877",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392795000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4bdc2406-fda6-47f0-b423-4e90f089a8b2",
          "citation": "SRS import [C1GQ844199]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=C1GQ844199",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392795000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "32057f34-99b9-4abc-8def-f81ff29d1487",
          "citation": "SALVIANOLIC ACID B [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d62e4b42-1975-4b44-a1a5-621603ca276f",
          "citation": "SALVIANOLIC ACID B [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ea3ab7ba-5048-7071-b8aa-803b0b402415",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "cea4755e-e541-4de3-81d9-085bf586394e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "16102eb4-463e-f12a-c632-92ad53051e6f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0eb97c31-1324-4f20-8813-47dc082057d1",
          "citation": "STN",
          "doc_type": "CAS",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "61a0a7c6-3ee8-c378-3521-aa63a8dda3d0",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c95e8016-140f-4df9-827a-33e73b0f4e89",
          "id": "c95e8016-140f-4df9-827a-33e73b0f4e89",
          "molfile": "\n  Marvin  01132110242D          \n\n 52 56  0  0  1  0            999 V2000\n   12.7085   -9.0674    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   12.7085   -8.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4229   -7.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4229   -7.0049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1374   -6.5924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8519   -7.0049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5664   -6.5924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8519   -7.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5664   -8.2424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1374   -8.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9940   -9.4799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2795   -9.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2795   -8.2424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5651   -9.4799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8506   -9.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1361   -9.4799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1361  -10.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4216  -10.7174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7072  -10.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9927  -10.7174    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7072   -9.4799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0941   -8.9279    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4296   -8.1742    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.0171   -7.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1921   -7.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7796   -6.7453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1921   -6.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7796   -5.3164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0171   -6.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4296   -5.3164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4296   -6.7453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2501   -8.2605    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.8022   -7.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6091   -7.8189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5472   -6.8628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0992   -6.2497    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    9.9062   -6.4212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4583   -5.8081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2652   -5.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8173   -5.3665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5623   -4.5819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1144   -3.9688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7553   -4.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5004   -3.6258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2033   -5.0235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8443   -5.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0373   -5.2935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3963   -4.8519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4216   -9.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4229   -9.4799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4229  -10.3049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1374   -9.0674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 11  1  6  0  0  0\n  1 50  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 10  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 49  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  2  0  0  0  0\n 22 21  1  0  0  0  0\n 49 21  1  0  0  0  0\n 23 22  1  6  0  0  0\n 23 24  1  0  0  0  0\n 23 32  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 31  2  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\n 27 28  1  0  0  0  0\n 29 27  2  0  0  0  0\n 29 30  1  0  0  0  0\n 31 29  1  0  0  0  0\n 32 33  1  1  0  0  0\n 32 49  1  0  0  0  0\n 33 34  2  0  0  0  0\n 33 35  1  0  0  0  0\n 36 35  1  1  0  0  0\n 36 37  1  0  0  0  0\n 36 46  1  0  0  0  0\n 37 38  1  0  0  0  0\n 38 39  1  0  0  0  0\n 38 45  2  0  0  0  0\n 40 39  2  0  0  0  0\n 41 40  1  0  0  0  0\n 41 42  1  0  0  0  0\n 43 41  2  0  0  0  0\n 43 44  1  0  0  0  0\n 45 43  1  0  0  0  0\n 46 47  1  0  0  0  0\n 46 48  2  0  0  0  0\n 50 51  1  0  0  0  0\n 50 52  2  0  0  0  0\nM  END",
          "smiles": "c1cc(c(cc1C[C@H](C(=O)O)OC(=O)/C=C/c2ccc(c3c2[C@@H]([C@@H](c4ccc(c(c4)O)O)O3)C(=O)O[C@H](Cc5ccc(c(c5)O)O)C(=O)O)O)O)O",
          "formula": "C36H30O16",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d82b74d3-dc6e-4c96-90f4-bcdad03ef491"
          },
          "defined_stereo": 4,
          "ez_centers": 1,
          "molecular_weight": "718.6152",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "bcb5e927-4485-4991-813c-d385c2fd19e9",
      "version": "16",
      "structure": {
        "id": "984af93d-d8a4-4f50-a4b7-62d017720fab",
        "molfile": "\n  Marvin  01132107552D          \n\n 52 56  0  0  1  0            999 V2000\n    7.0941   -8.9279    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4296   -8.1742    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.2501   -8.2605    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.4216   -9.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7072   -9.4799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7072  -10.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4216  -10.7174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1361  -10.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1361   -9.4799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8506   -9.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5651   -9.4799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2795   -9.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2795   -8.2424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9940   -9.4799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7085   -9.0674    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.7085   -8.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4229   -7.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1374   -8.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8519   -7.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8519   -7.0049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1374   -6.5924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4229   -7.0049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5664   -6.5924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5664   -8.2424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4229   -9.4799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4229  -10.3049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1374   -9.0674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9927  -10.7174    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8022   -7.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6091   -7.8189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5472   -6.8628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0992   -6.2497    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.9062   -6.4212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4583   -5.8081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2033   -5.0235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7553   -4.4104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5623   -4.5819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8173   -5.3665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2652   -5.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1144   -3.9688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5004   -3.6258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8443   -5.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0373   -5.2935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3963   -4.8519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0171   -7.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4296   -6.7453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0171   -6.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1921   -6.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7796   -6.7453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1921   -7.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7796   -5.3164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4296   -5.3164    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  1  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n  9  4  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  6  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 17 22  2  0  0  0  0\n 20 23  1  0  0  0  0\n 19 24  1  0  0  0  0\n 15 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 25 27  1  0  0  0  0\n  6 28  1  0  0  0  0\n  3 29  1  1  0  0  0\n 29 30  2  0  0  0  0\n 29 31  1  0  0  0  0\n 31 32  1  0  0  0  0\n 32 33  1  1  0  0  0\n 33 34  1  0  0  0  0\n 34 35  1  0  0  0  0\n 35 36  2  0  0  0  0\n 36 37  1  0  0  0  0\n 37 38  2  0  0  0  0\n 38 39  1  0  0  0  0\n 34 39  2  0  0  0  0\n 37 40  1  0  0  0  0\n 36 41  1  0  0  0  0\n 32 42  1  0  0  0  0\n 42 43  2  0  0  0  0\n 42 44  1  0  0  0  0\n  2 45  1  6  0  0  0\n 45 46  1  0  0  0  0\n 46 47  2  0  0  0  0\n 47 48  1  0  0  0  0\n 48 49  2  0  0  0  0\n 49 50  1  0  0  0  0\n 45 50  2  0  0  0  0\n 48 51  1  0  0  0  0\n 47 52  1  0  0  0  0\nM  END",
        "smiles": "c1cc(c(cc1C[C@H](C(=O)O)OC(=O)/C=C/c2ccc(c3c2[C@@H]([C@@H](c4ccc(c(c4)O)O)O3)C(=O)O[C@H](Cc5ccc(c(c5)O)O)C(=O)O)O)O)O",
        "formula": "C36H30O16",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 1,
        "molecular_weight": "718.6152",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "4bdc2406-fda6-47f0-b423-4e90f089a8b2",
          "cbf20523-db5c-4f21-b165-9478bf2fe515"
        ],
        "stereo_centers": 4
      },
      "unii": "C1GQ844199"
    }
  ]
}