{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "5803bd62-0ecc-427f-b696-7049ba4e94f7", "code": "4000", "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids", "type": "PRIMARY", "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111", "code_system": "DEA NO.", "references": [ "75b5b986-5776-43ed-93d8-f145a48d7615" ] }, { "uuid": "3abde6c2-eae1-4a58-af35-cb4ca90ae4c5", "code": "1-ANDROSTENEDIONE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/1-Androstenedione", "code_system": "WIKIPEDIA", "references": [ "75b5b986-5776-43ed-93d8-f145a48d7615" ] }, { "uuid": "fe79c750-a839-4ba9-88cb-6c7ca9001311", "code": "571-40-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=571-40-4", "code_system": "CAS", "references": [ "75b5b986-5776-43ed-93d8-f145a48d7615", "fc70959d-11ad-46a6-be0d-23bb1b0dce69" ] }, { "uuid": "8ff64138-6050-4514-b808-4e5ece61095a", "code": "11196935", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11196935", "code_system": "PUBCHEM", "references": [ "75b5b986-5776-43ed-93d8-f145a48d7615" ] }, { "uuid": "bb5b4105-f62c-0b15-091e-5bd9cadb174c", "code": "DTXSID60458467", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60458467", "code_system": "EPA CompTox", "references": [ "cc050d7f-0d41-3a98-1a3c-8b8597cb09b2" ] }, { "uuid": "60ad6694-1e68-f0da-784a-d40dbe28c574", "code": "DB01451", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB01451", "code_system": "DRUG BANK", "references": [ "6e5a62d0-687e-d106-4428-b6d7035c237b" ] }, { "uuid": "2333bca8-760c-46aa-bf3c-61d3c9392693", "code": "C1091EX356", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "8bb49e38-09fe-4115-b1a0-332c6bb5314b", "code": "133930", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:133930", "code_system": "CHEBI", "references": [ "6e5a62d0-687e-d106-4428-b6d7035c237b" ] } ], "relationships": [ { "uuid": "69a7689e-b4ad-4615-870d-8a741c4b24c3", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "467078b7-fca9-4168-8a94-287ebede3983", "refuuid": "4d11d9d9-25f1-44db-a527-c990c1c5a35f", "name": "1-ANDROSTENEDIONE", "unii": "C1091EX356", "linking_id": "C1091EX356", "ref_pname": "1-ANDROSTENEDIONE", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "61d594fa-ed84-43a2-bd41-50d36f559a21", "name": "(5.ALPHA.)-ANDROST-1-EN-3,17-DIONE", "stdName": "(5.ALPHA.)-ANDROST-1-EN-3,17-DIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "efcc5968-d74d-48b9-a0ac-0d12dc9ca633" ], "display_name": false }, { "uuid": "08d4afc9-eecf-4714-bbd6-3d1234941644", "name": ".DELTA.1-5.ALPHA.-ANDROSTENE-3,17-DIONE", "stdName": ".DELTA.1-5.ALPHA.-ANDROSTENE-3,17-DIONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "1749f79e-ba92-4930-99cc-028ef0b04b7e" ], "display_name": false }, { "uuid": "dd920777-960f-40a5-9daf-c210490b2bac", "name": "1-ANDROSTENEDIONE", "stdName": "1-ANDROSTENEDIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4eac942a-b054-4bbd-9597-ef5b801ccbdd" ], "display_name": true }, { "uuid": "b0b5b932-1927-4f37-a6d4-eee180c2d028", "name": "ANDROST-1-ENE-3,17-DIONE, (5.ALPHA.)-", "stdName": "ANDROST-1-ENE-3,17-DIONE, (5.ALPHA.)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1749f79e-ba92-4930-99cc-028ef0b04b7e" ], "display_name": false }, { "uuid": "26a0080d-45fe-4f08-81a0-525aa9deba03", "name": "J79.663H", "stdName": "J79.663H", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "72b64cd2-6032-42ad-bf97-ef90bbb2a551" ], "display_name": false } ], "references": [ { "uuid": "4eac942a-b054-4bbd-9597-ef5b801ccbdd", "citation": "dea list", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "efcc5968-d74d-48b9-a0ac-0d12dc9ca633", "citation": "http://forendex.southernforensic.org/index.php/detail/index/496", "url": "http://forendex.southernforensic.org/index.php/detail/index/496", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1749f79e-ba92-4930-99cc-028ef0b04b7e", "citation": "SciFinder", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "72b64cd2-6032-42ad-bf97-ef90bbb2a551", "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J79.663H", "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J79.663H", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "75b5b986-5776-43ed-93d8-f145a48d7615", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393306000, "tags": [ "NOMEN" ] }, { "uuid": "f7603036-9e47-4540-9fd9-2eba9fa45ed2", "citation": "SRS import [C1091EX356]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=C1091EX356", "doc_type": "SRS", "public_domain": true, "document_date": 1493393306000, "tags": [ "NOMEN" ] }, { "uuid": "a78fedd2-9312-7aaf-0613-8047ac860655", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=571-40-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "6e5a62d0-687e-d106-4428-b6d7035c237b", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "fc70959d-11ad-46a6-be0d-23bb1b0dce69", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "cc050d7f-0d41-3a98-1a3c-8b8597cb09b2", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "6241126d-ab3f-4f4f-8b00-2aa6d6d130f7", "id": "6241126d-ab3f-4f4f-8b00-2aa6d6d130f7", "molfile": "\n Marvin 01132105062D \n\n 21 24 0 0 1 0 999 V2000\n 9.0581 -10.7481 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 9.8373 -11.0055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3260 -10.3376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8373 -9.6741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0949 -8.8848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0581 -9.9270 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 9.0581 -9.1007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3423 -9.5158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6266 -9.9270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6266 -10.7481 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 8.3423 -11.1585 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.3423 -11.9895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6266 -12.3999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9162 -11.9895 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 6.2005 -12.3999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4900 -11.9895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7741 -12.3999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4900 -11.1585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2005 -10.7481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9162 -11.1585 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 6.9162 -10.3376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 6 1 0 0 0 0\n 11 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 6 4 1 0 0 0 0\n 6 7 1 1 0 0 0\n 6 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 9 1 1 0 0 0\n 11 10 1 0 0 0 0\n 10 20 1 0 0 0 0\n 11 12 1 6 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 1 0 0 0\n 20 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 2 0 0 0 0\n 18 16 1 0 0 0 0\n 18 19 2 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 1 0 0 0\nM END", "smiles": "C[C@@]12C=CC(=O)C[C@@H]2CC[C@H]3[C@@H]4CCC(=O)[C@@]4(C)CC[C@@H]31", "formula": "C19H26O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "4db5e37a-e0df-4792-b993-4ce6f4b68d9e" }, "defined_stereo": 6, "ez_centers": 0, "molecular_weight": "286.4093", "optical_activity": "UNSPECIFIED", "stereo_centers": 6 } ], "definition_level": "COMPLETE", "uuid": "4d11d9d9-25f1-44db-a527-c990c1c5a35f", "version": "7", "structure": { "id": "40e8db5f-b0a6-44ee-9cef-48a4012e9026", "molfile": "\n Marvin 01132103262D \n\n 25 28 0 0 1 0 999 V2000\n 5.4900 -11.1585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4900 -11.9895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2005 -12.3999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9162 -11.9895 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.9162 -11.1585 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.2005 -10.7481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6266 -10.7481 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.3423 -11.1585 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.3423 -11.9895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6266 -12.3999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0581 -10.7481 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.0581 -9.9270 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.3423 -9.5158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6266 -9.9270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8373 -9.6741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3260 -10.3376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8373 -11.0055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0949 -8.8848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0581 -9.1007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0581 -11.5790 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3423 -10.3376 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6266 -11.5790 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9162 -10.3376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9162 -12.8000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7741 -12.3999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 1 6 2 0 0 0 0\n 5 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 4 10 1 0 0 0 0\n 8 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 7 14 1 0 0 0 0\n 12 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 11 17 1 0 0 0 0\n 15 18 2 0 0 0 0\n 12 19 1 1 0 0 0\n 11 20 1 6 0 0 0\n 8 21 1 1 0 0 0\n 7 22 1 6 0 0 0\n 5 23 1 1 0 0 0\n 4 24 1 6 0 0 0\n 2 25 2 0 0 0 0\nM END", "smiles": "C[C@@]12C=CC(=O)C[C@]2([H])CC[C@@]3([H])[C@]4([H])CCC(=O)[C@@]4(C)CC[C@@]31[H]", "formula": "C19H26O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 6, "ez_centers": 0, "molecular_weight": "286.4093", "optical_activity": "UNSPECIFIED", "references": [ "f7603036-9e47-4540-9fd9-2eba9fa45ed2", "efcc5968-d74d-48b9-a0ac-0d12dc9ca633" ], "stereo_centers": 6 }, "unii": "C1091EX356" } ] }