{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cc62de61-8dbf-4043-a167-b5b6596612fd",
          "code": "866428-02-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=866428-02-6",
          "code_system": "CAS",
          "references": [
            "7f871736-269b-40da-86e2-0e96a261b387",
            "2fe70d91-f0b4-4c18-a18b-13e2fe928b2b"
          ]
        },
        {
          "uuid": "e8e755d9-ce18-4e74-acdf-1d991c7a1dd1",
          "code": "91864504",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91864504",
          "code_system": "PUBCHEM",
          "references": [
            "7f871736-269b-40da-86e2-0e96a261b387"
          ]
        },
        {
          "uuid": "c54e640b-c9a8-4e03-bdd1-6aa64586c0d4",
          "code": "C065OPR7CA",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "502da922-56ee-4db6-b328-51c39b46ae6f",
          "name": "BENZYLSULFONYLSERYLGLYCINE AMIDINOBENZAMIDE ACETATE",
          "stdName": "BENZYLSULFONYLSERYLGLYCINE AMIDINOBENZAMIDE ACETATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b080ef6c-ea85-4dad-a89e-839038c9fe7b",
            "bb3ee617-9fae-497a-9481-209a733acc55",
            "b97f3e46-f2e7-4d1b-9190-c7ae9ec79682"
          ],
          "display_name": true,
          "name_orgs": [
            {
              "uuid": "42df522b-6f99-4475-968c-e59b631b5c78",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "8ef26c81-6bb7-4e9d-899b-fb49b9313bfd",
          "name": "CJ-435 ACETATE",
          "stdName": "CJ-435 ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b080ef6c-ea85-4dad-a89e-839038c9fe7b",
            "98769f5e-a949-424a-a3fa-2260bcdaca21"
          ],
          "display_name": false
        },
        {
          "uuid": "7d86bfe7-100f-48c7-a599-69ebc94fb263",
          "name": "GLYCINAMIDE, N-((PHENYLMETHYL)SULFONYL)-D-SERYL-N-((4-(AMINOIMINOMETHYL)PHENYL)METHYL)-, MONOACETATE",
          "stdName": "GLYCINAMIDE, N-((PHENYLMETHYL)SULFONYL)-D-SERYL-N-((4-(AMINOIMINOMETHYL)PHENYL)METHYL)-, MONOACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d924bbec-fb05-4c39-98a4-8fcd5a749f41",
            "b080ef6c-ea85-4dad-a89e-839038c9fe7b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "bb3ee617-9fae-497a-9481-209a733acc55",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b080ef6c-ea85-4dad-a89e-839038c9fe7b",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d924bbec-fb05-4c39-98a4-8fcd5a749f41",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98769f5e-a949-424a-a3fa-2260bcdaca21",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f871736-269b-40da-86e2-0e96a261b387",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393131000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d12a7990-63b2-4c4e-ac69-3d183ebec966",
          "citation": "SRS import [C065OPR7CA]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=C065OPR7CA",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393131000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b97f3e46-f2e7-4d1b-9190-c7ae9ec79682",
          "citation": "BENZYLSULFONYLSERYLGLYCINE AMIDINOBENZAMIDE ACETATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2fe70d91-f0b4-4c18-a18b-13e2fe928b2b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "39a4e7d4-3bbe-4fa6-9de0-5c96d8e4dacc",
          "id": "39a4e7d4-3bbe-4fa6-9de0-5c96d8e4dacc",
          "molfile": "\n  Marvin  01132103042D          \n\n  4  3  0  0  1  0            999 V2000\n   11.0350  -10.0081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3206   -9.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3206   -8.7706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6056  -10.0081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)O",
          "formula": "C2H4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c265c2c3-54ff-4631-80b5-51080c57e13b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "60.052",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "2411bfad-2ee7-44ac-959b-40b9474d3dbd",
          "id": "2411bfad-2ee7-44ac-959b-40b9474d3dbd",
          "molfile": "\n  Marvin  01132102012D          \n\n 31 32  0  0  1  0            999 V2000\n    8.0294   -5.1630    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.9751   -4.3399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6610   -3.8813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3435   -5.6216    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6035   -5.2569    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8634   -4.8922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2387   -5.9969    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9681   -4.5170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5096   -3.8311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8742   -3.0912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4159   -2.4053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5926   -2.4595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2279   -3.1995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6864   -3.8852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7692   -5.5277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8235   -6.3510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4551   -5.0693    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1951   -5.4339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8809   -4.9753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8268   -4.1522    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6209   -5.3400    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3067   -4.8814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0468   -5.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1009   -6.0694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8409   -6.4340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5267   -5.9755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4726   -5.1523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7326   -4.7877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2668   -6.3401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3210   -7.1633    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9526   -5.8816    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  4  1  6  0  0  0\n  1 15  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  2  0  0  0  0\n  5  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 14  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  2  0  0  0  0\n 21 19  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 28  2  0  0  0  0\n 24 25  2  0  0  0  0\n 25 26  1  0  0  0  0\n 27 26  2  0  0  0  0\n 26 29  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 30  1  0  0  0  0\n 29 31  2  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)CS(=O)(=O)N[C@H](CO)C(=O)NCC(=O)NCc2ccc(cc2)C(=N)N",
          "formula": "C20H25N5O5S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "423cf3b7-ffda-4d15-a0a2-e144ae201afc"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "447.5099",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0369d72a-d15e-4083-bbcb-e798172e25fd",
      "version": "2",
      "structure": {
        "id": "0d4c9744-4a30-4717-8d04-68d414a562da",
        "molfile": "\n  Marvin  01132100562D          \n\n 35 35  0  0  1  0            999 V2000\n   10.3166   -9.5921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3166   -8.7671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6021  -10.0046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0310  -10.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3067   -4.8814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6209   -5.3400    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8809   -4.9753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1951   -5.4339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4551   -5.0693    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7692   -5.5277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0294   -5.1630    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.3435   -5.6216    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6035   -5.2569    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9681   -4.5170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5096   -3.8311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8742   -3.0912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4159   -2.4053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5926   -2.4595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2279   -3.1995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6864   -3.8852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8634   -4.8922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2387   -5.9969    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9751   -4.3399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6610   -3.8813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8235   -6.3510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8268   -4.1522    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0468   -5.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1009   -6.0694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8409   -6.4340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5267   -5.9755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2668   -6.3401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3210   -7.1633    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9526   -5.8816    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4726   -5.1523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7326   -4.7877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 15 20  1  0  0  0  0\n 13 21  2  0  0  0  0\n 13 22  2  0  0  0  0\n 11 23  1  6  0  0  0\n 23 24  1  0  0  0  0\n 10 25  2  0  0  0  0\n  7 26  2  0  0  0  0\n  5 27  1  0  0  0  0\n 27 28  2  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  2  0  0  0  0\n 30 31  1  0  0  0  0\n 31 32  2  0  0  0  0\n 31 33  1  0  0  0  0\n 34 30  1  0  0  0  0\n 35 34  2  0  0  0  0\n 27 35  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)CS(=O)(=O)N[C@H](CO)C(=O)NCC(=O)NCc2ccc(cc2)C(=N)N.CC(=O)O",
        "formula": "C20H25N5O5S.C2H4O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "507.5619",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "d12a7990-63b2-4c4e-ac69-3d183ebec966",
          "d924bbec-fb05-4c39-98a4-8fcd5a749f41"
        ],
        "stereo_centers": 1
      },
      "unii": "C065OPR7CA"
    }
  ]
}