{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cd4d3601-5b7f-4348-8ca5-1762483c4f89",
          "code": "187939-06-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=187939-06-6",
          "code_system": "CAS",
          "references": [
            "9337a399-6654-4c2c-ac30-382e5aaad7b8",
            "d0637100-6a76-4f32-b6ae-ab8a618c3a28"
          ]
        },
        {
          "uuid": "0d6077df-d93e-465b-b096-452103457322",
          "code": "1356706",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1356706/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "9337a399-6654-4c2c-ac30-382e5aaad7b8"
          ]
        },
        {
          "uuid": "223aad94-62bd-4a2a-aea8-257cfcd79427",
          "code": "22616669",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/22616669",
          "code_system": "PUBCHEM",
          "references": [
            "9337a399-6654-4c2c-ac30-382e5aaad7b8"
          ]
        },
        {
          "uuid": "2e46d951-ab94-1078-b066-0938106edb0c",
          "code": "DTXSID80172118",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80172118",
          "code_system": "EPA CompTox",
          "references": [
            "8070a6e2-fc79-1a28-db7d-5d7eed43a3bd"
          ]
        },
        {
          "uuid": "c0b7e324-649c-49fe-9c63-b51e8bc020d7",
          "code": "C054DF30K0",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d15e35cf-1d96-b0f7-4340-c1566f028c70",
          "code": "C054DF30K0",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=C054DF30K0",
          "code_system": "DAILYMED",
          "references": [
            "d4febdc3-94a6-ac77-9685-b031af4f28fd"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3e43456c-56aa-443f-9446-8492a4e4e9a6",
          "name": "BENZOIC ACID, 2-((HYDROXYDIMETHYLSILYL)OXY)-",
          "stdName": "BENZOIC ACID, 2-((HYDROXYDIMETHYLSILYL)OXY)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "daff4db5-2a49-49a0-8198-a1d6c4eea800"
          ],
          "display_name": false
        },
        {
          "uuid": "e4f22ee2-2282-4002-ba49-af45b952ff92",
          "name": "D.S.B. C",
          "stdName": "D.S.B. C",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e43d29c-f694-479d-a27b-744719008ef5"
          ],
          "display_name": false
        },
        {
          "uuid": "4e6b119f-771c-4baf-9edc-558d5c520ad5",
          "name": "SILANEDIOL SALICYLATE",
          "stdName": "SILANEDIOL SALICYLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fb3dfbd-8300-47c3-8e17-d21b8bd08b52",
            "1e43d29c-f694-479d-a27b-744719008ef5",
            "7bb440f7-9395-4d6f-9c76-f574315a8a7c"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ceeb8c58-c971-4ee3-8cf9-e56e7607b9ca",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "5fb3dfbd-8300-47c3-8e17-d21b8bd08b52",
          "citation": "CAPILLISIL MSDS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1e43d29c-f694-479d-a27b-744719008ef5",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "daff4db5-2a49-49a0-8198-a1d6c4eea800",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9337a399-6654-4c2c-ac30-382e5aaad7b8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391626000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4aa8b92d-fcaf-4640-ae9f-86f61c0d3174",
          "citation": "SRS import [C054DF30K0]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=C054DF30K0",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391626000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7bb440f7-9395-4d6f-9c76-f574315a8a7c",
          "citation": "SILANEDIOL SALICYLATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8070a6e2-fc79-1a28-db7d-5d7eed43a3bd",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=187939-06-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d0637100-6a76-4f32-b6ae-ab8a618c3a28",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d4febdc3-94a6-ac77-9685-b031af4f28fd",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a74441f4-15ac-48cc-b02f-9549b7989423",
          "id": "a74441f4-15ac-48cc-b02f-9549b7989423",
          "molfile": "\n  Marvin  01132108412D          \n\n 14 14  0  0  0  0            999 V2000\n    8.4428   -2.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5117   -4.0629    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    9.5345   -4.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2247   -3.6479    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7943   -4.4733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0814   -4.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0814   -3.2376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3638   -4.4733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6509   -4.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9379   -4.4733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9379   -5.2987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6509   -5.7137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3638   -5.2987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0814   -5.7137    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n 13  8  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\nM  END",
          "smiles": "C[Si](C)(O)OC(=O)c1ccccc1O",
          "formula": "C9H12O4Si",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "83be6293-03a1-48ea-8ca3-83aa04d1c91c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "212.2749",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a714ffd4-9d98-4560-b5cd-080bace009e4",
      "version": "5",
      "structure": {
        "id": "8bdd32ef-aa98-40c0-816f-01f428efce2e",
        "molfile": "\n  Marvin  01132107162D          \n\n 14 14  0  0  0  0            999 V2000\n    9.2247   -3.6479    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5117   -4.0629    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n    7.7943   -4.4733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0814   -4.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0814   -3.2376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3638   -4.4733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6509   -4.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9379   -4.4733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9379   -5.2987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6509   -5.7137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3638   -5.2987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0814   -5.7137    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4428   -2.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5345   -4.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11  6  2  0  0  0  0\n  2 13  1  0  0  0  0\n  2 14  1  0  0  0  0\nM  END",
        "smiles": "C[Si](C)(O)OC(=O)c1ccccc1O",
        "formula": "C9H12O4Si",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "212.2749",
        "optical_activity": "NONE",
        "references": [
          "5fb3dfbd-8300-47c3-8e17-d21b8bd08b52",
          "4aa8b92d-fcaf-4640-ae9f-86f61c0d3174"
        ],
        "stereo_centers": 0
      },
      "unii": "C054DF30K0"
    }
  ]
}