{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "6c7e577e-76ff-45a8-9bc7-90b6fc49b030", "code": "518-17-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=518-17-2", "code_system": "CAS", "references": [ "e7c29fd2-f95d-4db5-b6d6-42adaa57b265", "0d75ae08-94c3-4593-8474-1e6a760bad04" ] }, { "uuid": "e38b3871-d062-4683-b3c0-8ccb8915f012", "code": "m5221", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m5221?q=authorize", "code_system": "MERCK INDEX", "references": [ "e7c29fd2-f95d-4db5-b6d6-42adaa57b265" ] }, { "uuid": "9e8effea-61c9-4277-b692-17d9f9ba94ca", "code": "442088", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/442088", "code_system": "PUBCHEM", "references": [ "e7c29fd2-f95d-4db5-b6d6-42adaa57b265" ] }, { "uuid": "6f4a2bb5-75e2-5a18-bb21-a5f4e5dc19cc", "code": "Evodiamine", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Evodiamine", "code_system": "WIKIPEDIA", "references": [ "1811a8c4-8431-afe3-e134-f846537129cb" ] }, { "uuid": "3aa4e49e-b3c0-869e-89b2-b8d41dddcef4", "code": "2199291", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2199291/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "e7bd834e-3002-3b4a-23ac-b6752d83ac7f" ] }, { "uuid": "ea0ad650-c0a6-d2b1-9317-1adff25883e0", "code": "2858 (Number of products:108)", "comments": "Dietary Supplement Label Database|chemical|Evodiamine", "type": "PRIMARY", "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2858&item=Evodiamine", "code_system": "DSLD", "references": [ "e7ee2bda-adf2-32f6-1527-2b3daf46da87" ] }, { "uuid": "ae9d963f-5097-40c1-96bf-96dce3ff01d4", "code": "C01825BVNL", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "41275f79-3a00-719b-9039-d629ac8ec95d", "code": "DTXSID10966123", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10966123", "code_system": "EPA CompTox", "references": [ "e7ee2bda-adf2-32f6-1527-2b3daf46da87" ] }, { "uuid": "583bc59f-7b98-11b4-63cc-ca7dbd44ffda", "code": "300000033934", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "1566693c-fd46-766e-35f1-0c74a6c01497" ] } ], "substance_class": "chemical", "names": [ { "uuid": "d3317be6-f120-4dac-a708-e88874d99bcc", "name": "(+)-EVODIAMINE", "stdName": "(+)-EVODIAMINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ac55ba09-cb1b-4def-a0e1-5b04f4d516d4", "70c3f205-afeb-4d84-a3a0-c992a41dba60" ], "display_name": false }, { "uuid": "454c591c-5108-46b9-bcac-93037dd3d5d6", "name": "D-EVODIAMINE", "stdName": "D-EVODIAMINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ac55ba09-cb1b-4def-a0e1-5b04f4d516d4", "70c3f205-afeb-4d84-a3a0-c992a41dba60" ], "display_name": false }, { "uuid": "31d6b60c-d2f0-4969-ba6d-2483d5d9898e", "name": "EVODIAMINE", "stdName": "EVODIAMINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "133d56b4-a8d9-4599-b9ee-cbe9ec21563f", "d126a77f-1cc0-401b-b8f8-1403bcbd980b", "ac55ba09-cb1b-4def-a0e1-5b04f4d516d4", "e5aa5957-3649-4cbe-8304-559718c3587e", "3451f8c3-4348-4595-a86f-bb7a2de893ef", "3dccf85d-8959-4549-ae6f-349d8ea21d5a" ], "display_name": true }, { "uuid": "96f9e889-94e7-4efa-8d72-9bbea8760d40", "name": "EVODIAMINE [MI]", "stdName": "EVODIAMINE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ac55ba09-cb1b-4def-a0e1-5b04f4d516d4", "e5aa5957-3649-4cbe-8304-559718c3587e" ], "display_name": false }, { "uuid": "5a6ec3ad-ead3-44e6-8fd9-97b89dac2c47", "name": "EVODIAMINE, (+)-", "stdName": "EVODIAMINE, (+)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ac55ba09-cb1b-4def-a0e1-5b04f4d516d4", "70c3f205-afeb-4d84-a3a0-c992a41dba60" ], "display_name": false }, { "uuid": "a7c3f48c-5de1-684f-ce02-62f2222f6a17", "name": "Evodiamine [WHO-DD]", "stdName": "EVODIAMINE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "43110823-dd7c-8458-0085-6e004d75942c" ], "display_name": false }, { "uuid": "e9bfb301-3904-42d6-9d3f-48a34552cfcb", "name": "INDOLO(2',3':3,4)PYRIDO(2,1-B)QUINAZOLIN-5(7H)-ONE, 8,13,13B,14-TETRAHYDRO-14-METHYL-, (13BS)-", "stdName": "INDOLO(2',3':3,4)PYRIDO(2,1-B)QUINAZOLIN-5(7H)-ONE, 8,13,13B,14-TETRAHYDRO-14-METHYL-, (13BS)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ac55ba09-cb1b-4def-a0e1-5b04f4d516d4", "70c3f205-afeb-4d84-a3a0-c992a41dba60" ], "display_name": false } ], "references": [ { "uuid": "3451f8c3-4348-4595-a86f-bb7a2de893ef", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "ac55ba09-cb1b-4def-a0e1-5b04f4d516d4", "citation": "WHO DRUG DICTIONARY", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3dccf85d-8959-4549-ae6f-349d8ea21d5a", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e5aa5957-3649-4cbe-8304-559718c3587e", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "70c3f205-afeb-4d84-a3a0-c992a41dba60", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e7c29fd2-f95d-4db5-b6d6-42adaa57b265", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392360000, "tags": [ "NOMEN" ] }, { "uuid": "1d2006a8-2b30-4534-bf65-a261ef314e62", "citation": "SRS import [C01825BVNL]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=C01825BVNL", "doc_type": "SRS", "public_domain": true, "document_date": 1493392360000, "tags": [ "NOMEN" ] }, { "uuid": "d126a77f-1cc0-401b-b8f8-1403bcbd980b", "citation": "EVODIAMINE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "133d56b4-a8d9-4599-b9ee-cbe9ec21563f", "citation": "EVODIAMINE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "1811a8c4-8431-afe3-e134-f846537129cb", "citation": "WIKI", "url": "https://en.wikipedia.org/wiki/Evodiamine", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e7bd834e-3002-3b4a-23ac-b6752d83ac7f", "citation": "RXNORM", "doc_type": "NLM", "public_domain": true }, { "uuid": "0d75ae08-94c3-4593-8474-1e6a760bad04", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "e7ee2bda-adf2-32f6-1527-2b3daf46da87", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "43110823-dd7c-8458-0085-6e004d75942c", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "59f4a3d2-9f16-66cd-7d94-6196a1584a38", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "1566693c-fd46-766e-35f1-0c74a6c01497", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "7f7995fe-c2cc-46ce-b985-bdfd2c5aa08f", "id": "7f7995fe-c2cc-46ce-b985-bdfd2c5aa08f", "molfile": "\n Marvin 01132106372D \n\n 23 27 0 0 1 0 999 V2000\n 3.4853 -1.6541 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 3.7112 -2.4476 0.0000 N 0 0 2 0 0 0 0 0 0 0 0 0\n 3.1374 -3.0397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5107 -2.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7366 -3.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5301 -3.6440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1039 -3.0580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8780 -2.2645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0845 -2.0570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8587 -1.2696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4385 -0.6715 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0591 -1.0621 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8333 -0.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0336 -0.0672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4599 -0.6653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6857 -1.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0021 -1.9166 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3489 -1.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5310 -1.5565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.9217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2808 -0.1404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0987 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6298 -0.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 12 1 1 0 0 0 0\n 1 16 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 9 2 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 12 10 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 23 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 23 18 2 0 0 0 0\n 20 19 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\nM END", "smiles": "CN1c2ccccc2C(=O)N3CCc4c5ccccc5[nH]c4[C@@H]13", "formula": "C19H17N3O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "2c1adfab-3535-4cfe-9a43-d34a9667fe6d" }, "defined_stereo": 1, "ez_centers": 0, "molecular_weight": "303.3585", "optical_activity": "UNSPECIFIED", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "8876ddee-064b-486a-abfa-4695ccaa8760", "version": "12", "structure": { "id": "60f97d91-e123-4b9e-ade9-df62587b534b", "molfile": "\n Marvin 01132105012D \n\n 24 28 0 0 1 0 999 V2000\n 0.0000 -0.9217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2808 -0.1404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0987 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6298 -0.6348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3489 -1.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5310 -1.5565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4599 -0.6653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6857 -1.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0021 -1.9166 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0336 -0.0672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8333 -0.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0591 -1.0621 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4853 -1.6541 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.7112 -2.4476 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5107 -2.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0845 -2.0570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8587 -1.2696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7366 -3.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5301 -3.6440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1039 -3.0580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8780 -2.2645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4385 -0.6715 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2717 -0.8545 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1374 -3.0397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 1 6 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 4 7 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 9 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 10 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 13 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 17 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 23 1 1 0 0 0\n 14 15 1 0 0 0 0\n 14 24 1 0 0 0 0\n 15 16 2 0 0 0 0\n 15 18 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 21 1 0 0 0 0\n 17 22 2 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\nM END", "smiles": "CN1c2ccccc2C(=O)N3CCc4c5ccccc5[nH]c4[C@@]13[H]", "formula": "C19H17N3O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 1, "ez_centers": 0, "molecular_weight": "303.3585", "optical_activity": "UNSPECIFIED", "references": [ "1d2006a8-2b30-4534-bf65-a261ef314e62", "3dccf85d-8959-4549-ae6f-349d8ea21d5a" ], "stereo_centers": 1 }, "unii": "C01825BVNL" } ] }