{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "58574753-0c58-4d66-b62a-c6e7c9d70b81",
          "code": "33704-61-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=33704-61-9",
          "code_system": "CAS",
          "references": [
            "255c82c7-dcb2-4e4f-93c5-cc1d838cf5b9",
            "e71ea10a-7cc6-4366-bf51-d5ae8a638a94"
          ]
        },
        {
          "uuid": "85f3da03-3a74-4c0b-b53f-2280d280a236",
          "code": "C110694",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67110694",
          "code_system": "MESH",
          "references": [
            "255c82c7-dcb2-4e4f-93c5-cc1d838cf5b9"
          ]
        },
        {
          "uuid": "a65aa90b-97e4-409b-a45c-25b89ba4cd41",
          "code": "251-649-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.046.940",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "255c82c7-dcb2-4e4f-93c5-cc1d838cf5b9"
          ]
        },
        {
          "uuid": "96d40526-5a01-479c-828f-f582a7164476",
          "code": "92292",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/92292",
          "code_system": "PUBCHEM",
          "references": [
            "255c82c7-dcb2-4e4f-93c5-cc1d838cf5b9"
          ]
        },
        {
          "uuid": "b2d3f7f1-029a-76ab-a6c1-558f747849aa",
          "code": "DTXSID8047399",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8047399",
          "code_system": "EPA CompTox",
          "references": [
            "0a508f94-e125-92f6-88b8-19d2e7fc2c2c"
          ]
        },
        {
          "uuid": "c6de4e2f-82be-f8a5-ae3b-d4f4c086b208",
          "code": "2372918",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2372918/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "dd8b4bf6-8125-94c6-840d-136657d8fbc2"
          ]
        },
        {
          "uuid": "0f1a928f-ff8b-43ce-bb5a-9a63560d69c2",
          "code": "BZR4438MY4",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "16671908-bc9f-fd53-03e8-bb2c8a02fc39",
          "code": "Cashmeran",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Cashmeran",
          "code_system": "WIKIPEDIA",
          "references": [
            "1e23c8c8-a8fe-9764-056b-1a96013663f1"
          ]
        },
        {
          "uuid": "0ec8542b-388b-d0fa-4de2-47418e851fb3",
          "code": "BZR4438MY4",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=BZR4438MY4",
          "code_system": "DAILYMED",
          "references": [
            "44680709-08f2-47d9-0c84-d3d8a92a5a94"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "862f3431-742f-4b84-a0a0-3ce87faa7879",
          "name": "(±)-CASHMERAN",
          "stdName": "(+/-)-CASHMERAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5c80a11-ac63-4d9c-9341-dd063244ed01",
            "43ee3138-89f9-47fe-b316-da2e316fd08f"
          ],
          "display_name": false
        },
        {
          "uuid": "cd527116-2165-416b-a0f9-a992b0d56a2f",
          "name": "4(5H)-INDANONE, 6,7-DIHYDRO-1,1,2,3,3-PENTAMETHYL-",
          "stdName": "4(5H)-INDANONE, 6,7-DIHYDRO-1,1,2,3,3-PENTAMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5c80a11-ac63-4d9c-9341-dd063244ed01",
            "43ee3138-89f9-47fe-b316-da2e316fd08f"
          ],
          "display_name": false
        },
        {
          "uuid": "2ece2f7d-56bd-4dee-9b86-6f4392234c42",
          "name": "4H-INDEN-4-ONE, 1,2,3,5,6,7-HEXAHYDRO-1,1,2,3,3-PENTAMETHYL-",
          "stdName": "4H-INDEN-4-ONE, 1,2,3,5,6,7-HEXAHYDRO-1,1,2,3,3-PENTAMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5c80a11-ac63-4d9c-9341-dd063244ed01",
            "43ee3138-89f9-47fe-b316-da2e316fd08f"
          ],
          "display_name": false
        },
        {
          "uuid": "6dd50434-7cdc-4b90-bcca-7924305bb2c2",
          "name": "6,7-DIHYDRO-1,1,2,3,3-PENTAMETHYL-4(5H)-INDANONE",
          "stdName": "6,7-DIHYDRO-1,1,2,3,3-PENTAMETHYL-4(5H)-INDANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5c80a11-ac63-4d9c-9341-dd063244ed01",
            "43ee3138-89f9-47fe-b316-da2e316fd08f"
          ],
          "display_name": false
        },
        {
          "uuid": "f6d640ae-c6dc-4e0b-9880-f7064d2d374e",
          "name": "CASHMERAN",
          "stdName": "CASHMERAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43ee3138-89f9-47fe-b316-da2e316fd08f",
            "3cc8fb3e-ff13-4826-9514-bb98108f86a5"
          ],
          "display_name": false
        },
        {
          "uuid": "b12de35b-eaa0-4c89-8af9-2199ebbe7e86",
          "name": "DIHYDRO PENTAMETHYLINDANONE",
          "stdName": "DIHYDRO PENTAMETHYLINDANONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7dcbd7d1-c903-4353-9f7e-e24c670a3a33",
            "43ee3138-89f9-47fe-b316-da2e316fd08f",
            "3cc8fb3e-ff13-4826-9514-bb98108f86a5"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "c56aa0ec-707b-4e68-bcc4-dec664c771e4",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "fc14167f-aee4-4b0a-b7f6-c0eba2f45d17",
          "name": "DIHYDRO-1,1,2,3,3-PENTAMETHYL-4(5H)-INDANONE",
          "stdName": "DIHYDRO-1,1,2,3,3-PENTAMETHYL-4(5H)-INDANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6deace96-cde4-467b-b11a-59d1426215c6",
            "43ee3138-89f9-47fe-b316-da2e316fd08f"
          ],
          "display_name": false
        },
        {
          "uuid": "c92d89ee-db4a-4696-9ab0-d7e5f114bce1",
          "name": "DIHYDROPENTAMETHYLINDANONE",
          "stdName": "DIHYDROPENTAMETHYLINDANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43ee3138-89f9-47fe-b316-da2e316fd08f",
            "3e4549d9-e9c4-4810-8911-eff588db5c0d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3cc8fb3e-ff13-4826-9514-bb98108f86a5",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "43ee3138-89f9-47fe-b316-da2e316fd08f",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5c80a11-ac63-4d9c-9341-dd063244ed01",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e4549d9-e9c4-4810-8911-eff588db5c0d",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6deace96-cde4-467b-b11a-59d1426215c6",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "255c82c7-dcb2-4e4f-93c5-cc1d838cf5b9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391494000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11e1bb98-63d5-4106-931e-40e852266f11",
          "citation": "SRS import [BZR4438MY4]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=BZR4438MY4",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391494000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7dcbd7d1-c903-4353-9f7e-e24c670a3a33",
          "citation": "DIHYDRO PENTAMETHYLINDANONE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0a508f94-e125-92f6-88b8-19d2e7fc2c2c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=33704-61-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1e23c8c8-a8fe-9764-056b-1a96013663f1",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "dd8b4bf6-8125-94c6-840d-136657d8fbc2",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "e71ea10a-7cc6-4366-bf51-d5ae8a638a94",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "44680709-08f2-47d9-0c84-d3d8a92a5a94",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8bda2ab2-0328-4a91-b376-4f71b706ca9c",
          "id": "8bda2ab2-0328-4a91-b376-4f71b706ca9c",
          "molfile": "\n  Marvin  01132107162D          \n\n 15 16  0  0  0  0            999 V2000\n   10.6303   -8.2421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8059   -8.2421    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.3212   -8.9096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1483   -9.7182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9330   -9.4639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5344   -8.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5344   -7.8289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8213   -7.4177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8213   -6.5913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1061   -7.8289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1061   -8.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8213   -9.0666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3212   -7.5766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9330   -7.0244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1483   -6.7681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n 13  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  6  2  0  0  0  0\n  6 12  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 13  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\nM  END",
          "smiles": "CC1C(C)(C)C2=C(C(=O)CCC2)C1(C)C",
          "formula": "C14H22O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "96508a1d-d68d-4fe7-9f41-8f4c1eece4ab"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "206.3244",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8b22612f-5064-4b13-b3a5-9ce803e69b40",
      "version": "7",
      "structure": {
        "id": "dc737a92-6cff-4b6d-8a2e-076d8fff70d8",
        "molfile": "\n  Marvin  01132111262D          \n\n 15 16  0  0  0  0            999 V2000\n   10.6303   -8.2421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1061   -8.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1483   -9.7182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9330   -9.4639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8213   -6.5913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1061   -7.8289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9330   -7.0244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1483   -6.7681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8059   -8.2421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8213   -9.0666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3212   -8.9096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8213   -7.4177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3212   -7.5766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5344   -8.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5344   -7.8289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  6  2  1  0  0  0  0\n 11  9  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11  3  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  5  2  0  0  0  0\n 12  6  1  0  0  0  0\n 13  7  1  0  0  0  0\n 13  8  1  0  0  0  0\n 13  9  1  0  0  0  0\n 14 10  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 12  1  0  0  0  0\n 15 13  1  0  0  0  0\n 15 14  2  0  0  0  0\nM  END",
        "smiles": "CC1C(C)(C)C2=C(C(=O)CCC2)C1(C)C",
        "formula": "C14H22O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "206.3244",
        "optical_activity": "( + / - )",
        "references": [
          "e5c80a11-ac63-4d9c-9341-dd063244ed01",
          "11e1bb98-63d5-4106-931e-40e852266f11"
        ],
        "stereo_centers": 1
      },
      "unii": "BZR4438MY4"
    }
  ]
}