{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "16a03fc6-d3cc-4bb3-d29f-4a19f72f8e4d", "code": "1543", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1543", "code_system": "PUBCHEM", "references": [ "1e5aa24e-a2b1-bf4f-8a68-aa43eff92e98" ] }, { "uuid": "9f3d07c0-ead0-66d7-b6b7-f1335297ccb9", "code": "96187-27-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=96187-27-8", "code_system": "CAS", "references": [ "f22a691d-2a8a-415b-860f-791c6b9f9905" ] }, { "uuid": "5df514c0-ec82-f0d2-3584-fa7ac1e39486", "code": "DTXSID90274314", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90274314", "code_system": "EPA CompTox" }, { "uuid": "d0b12e6d-3e35-4011-b685-95dac4f8e35c", "code": "BZ7Z2Q49PA", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "f22a691d-2a8a-415b-860f-791c6b9f9905" ] } ], "substance_class": "chemical", "names": [ { "uuid": "22e2f848-49d6-4a0f-80ba-2addc5bd881a", "name": "2-[1,1′-Biphenyl]-4-yl-6-fluoro-3-methyl-4-quinolinecarboxylic acid", "stdName": "2-(1,1'-BIPHENYL)-4-YL-6-FLUORO-3-METHYL-4-QUINOLINECARBOXYLIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f22a691d-2a8a-415b-860f-791c6b9f9905" ], "display_name": true }, { "uuid": "2e3dae8e-88dd-46df-9164-9bbea2387376", "name": "4-Quinolinecarboxylic acid, 2-[1,1′-biphenyl]-4-yl-6-fluoro-3-methyl-", "stdName": "4-QUINOLINECARBOXYLIC ACID, 2-(1,1'-BIPHENYL)-4-YL-6-FLUORO-3-METHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f22a691d-2a8a-415b-860f-791c6b9f9905" ], "display_name": false }, { "uuid": "2608ac8a-44cc-147e-90a4-8f7bd3039470", "name": "6-Fluoranyl-3-methyl-2-(4-phenylphenyl)quinoline-4-carboxylic acid", "stdName": "6-FLUORANYL-3-METHYL-2-(4-PHENYLPHENYL)QUINOLINE-4-CARBOXYLIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4afa0a19-5c69-b0a4-a473-88c55ef7d689" ], "display_name": false } ], "references": [ { "uuid": "4afa0a19-5c69-b0a4-a473-88c55ef7d689", "citation": "ZINC", "url": "http://zinc.docking.org/substances/subsets/in-vivo/", "doc_type": "WEBSITE", "public_domain": true }, { "uuid": "f22a691d-2a8a-415b-860f-791c6b9f9905", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "1e5aa24e-a2b1-bf4f-8a68-aa43eff92e98", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "166136db-bf18-4b14-9724-17457fb4e847", "id": "166136db-bf18-4b14-9724-17457fb4e847", "molfile": "\n Marvin 01132101212D \n\n 27 30 0 0 0 0 999 V2000\n -0.8250 -2.8580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 -2.1435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 -2.1435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 -2.8580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 -3.5724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 -4.2869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6500 -4.2869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0625 -5.0014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6500 -5.7159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0625 -6.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8876 -6.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3001 -5.7159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8876 -5.0014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0625 -3.5724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6500 -2.8580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 -1.4290 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8250 1.4290 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8250 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8250 -1.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6500 -1.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0625 -0.7145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0625 -2.1435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 24 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 16 1 0 0 0 0\n 4 5 2 0 0 0 0\n 15 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 7 14 1 0 0 0 0\n 8 9 2 0 0 0 0\n 13 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 14 15 2 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 23 17 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 25 27 1 0 0 0 0\nM END", "smiles": "Cc1c(c2cc(ccc2nc1-c3ccc(cc3)-c4ccccc4)F)C(=O)O", "formula": "C23H16FNO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "4475a77e-05a9-4a2d-abb3-5725b7fb2bc0" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "357.3779", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "22b7279d-c54c-41b7-9a7e-dc4c154eecb1", "version": "7", "structure": { "id": "f4a70acc-4131-4fe1-862c-8f210f7829d0", "molfile": "\n JSDraw207052418022D\n\n 27 30 0 0 0 0 0 V2000\n 23.9722 -4.9650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.6213 -5.7452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2693 -4.9652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9173 -5.7452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5653 -4.9652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2133 -5.7452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2133 -7.3052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5653 -8.0852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9173 -7.3052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2693 -8.0852 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 22.6213 -7.3052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.9722 -8.0854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.3242 -7.3054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6762 -8.0854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6762 -9.6454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.3242 -10.4254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.9722 -9.6454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0270 -10.4256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3787 -9.6450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.7296 -10.4252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.7288 -11.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3771 -12.7668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0263 -11.9865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8624 -4.9650 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2693 -3.4052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.6203 -2.6252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9183 -2.6252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 4 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 2 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 12 17 1 0 0 0 0\n 15 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 18 23 1 0 0 0 0\n 6 24 1 0 0 0 0\n 3 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 25 27 1 0 0 0 0\nM END", "smiles": "Cc1c(c2cc(ccc2nc1-c3ccc(cc3)-c4ccccc4)F)C(=O)O", "formula": "C23H16FNO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "357.3779", "optical_activity": "NONE", "references": [ "4afa0a19-5c69-b0a4-a473-88c55ef7d689", "f22a691d-2a8a-415b-860f-791c6b9f9905" ], "stereo_centers": 0 }, "unii": "BZ7Z2Q49PA" } ] }