{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ac524b3d-ffcc-4c15-bccd-296b654e696c",
          "code": "6440-58-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6440-58-0",
          "code_system": "CAS",
          "references": [
            "7776d0fe-7c87-4401-af61-4e09822c3794",
            "997db42c-8bfb-4aa4-bc10-05ab17d31b0c"
          ]
        },
        {
          "uuid": "de16359d-e7f5-479b-a27b-975227736852",
          "code": "C77541",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C77541",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7776d0fe-7c87-4401-af61-4e09822c3794"
          ]
        },
        {
          "uuid": "a8cd42a0-48c5-456d-ad26-9acf606a5646",
          "code": "C056057",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67056057",
          "code_system": "MESH",
          "references": [
            "7776d0fe-7c87-4401-af61-4e09822c3794"
          ]
        },
        {
          "uuid": "1dd26c41-432f-4ccd-93fd-c805c16c66d4",
          "code": "FCN NO. 104",
          "comments": "FCN|MINERAL SLURRY PRESERVATIVE|PAPER",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=104",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "7776d0fe-7c87-4401-af61-4e09822c3794"
          ]
        },
        {
          "uuid": "cfc2657d-ae15-464d-99f0-8fd8526d3e3e",
          "code": "FCN NO. 99",
          "comments": "FCN|BLEACHING ADJUVANT|PAPER",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=99",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "7776d0fe-7c87-4401-af61-4e09822c3794"
          ]
        },
        {
          "uuid": "7e54ab6a-3a32-4629-8cab-67e838bd0082",
          "code": "DMDM HYDANTOIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/DMDM_hydantoin",
          "code_system": "WIKIPEDIA",
          "references": [
            "7776d0fe-7c87-4401-af61-4e09822c3794"
          ]
        },
        {
          "uuid": "06e5f3ce-dbe1-4b06-a45b-1c07829d7f2a",
          "code": "FCN NO. 221",
          "comments": "FCN|MINERAL SLURRY PRESERVATIVE|PAPER COATINGS",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=221",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "7776d0fe-7c87-4401-af61-4e09822c3794"
          ]
        },
        {
          "uuid": "4c71db7d-a9b5-4075-a208-19751e26c7ee",
          "code": "FCN NO. 168",
          "comments": "FCN|BLEACHING ADJUVANTS|PAPER",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=168",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "7776d0fe-7c87-4401-af61-4e09822c3794"
          ]
        },
        {
          "uuid": "c73651ec-14cb-40dc-a9e2-d3bdf4a9bf3a",
          "code": "115501",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:430",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "7776d0fe-7c87-4401-af61-4e09822c3794"
          ]
        },
        {
          "uuid": "af7545d8-b208-411c-9e23-9e2df2df5abf",
          "code": "229-222-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.026.566",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7776d0fe-7c87-4401-af61-4e09822c3794"
          ]
        },
        {
          "uuid": "a1285500-1441-4b59-9807-808f3cd5838b",
          "code": "1310543",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1310543/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7776d0fe-7c87-4401-af61-4e09822c3794"
          ]
        },
        {
          "uuid": "342ef8ad-3974-4ede-8b31-d33ef95f2825",
          "code": "SUB32587",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "7776d0fe-7c87-4401-af61-4e09822c3794"
          ]
        },
        {
          "uuid": "8f89f511-5e71-4bea-87c0-85cf670689b4",
          "code": "22947",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/22947",
          "code_system": "PUBCHEM",
          "references": [
            "7776d0fe-7c87-4401-af61-4e09822c3794"
          ]
        },
        {
          "uuid": "65791a9b-6797-88a0-aca1-0893252b165b",
          "code": "7488",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7488",
          "code_system": "HSDB",
          "references": [
            "ae49e57d-a0a9-7734-a5f5-4f8f60462f1b"
          ]
        },
        {
          "uuid": "c92ff81b-2dcc-0299-713e-dfd1a9108148",
          "code": "DTXSID8035217",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8035217",
          "code_system": "EPA CompTox",
          "references": [
            "a7058de7-6924-78cc-0da5-2cd7be763497"
          ]
        },
        {
          "uuid": "64988869-eb4d-28e5-d3f9-f8bc2c5ab2b6",
          "code": "C78284",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Integumentary System",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C78284",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c05f51d5-9397-cf85-ef97-ce3bd750a5ac"
          ]
        },
        {
          "uuid": "e219e9d7-c6a4-44d6-a1f4-4d07277dd280",
          "code": "BYR0546TOW",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e88719cb-004b-5b0f-fb9f-2b421428d4d6",
          "code": "100000126159",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "723756ac-5767-fd37-9e63-7a78e4d6485c"
          ]
        },
        {
          "uuid": "ecc2aa51-9b79-293e-c017-584601fdcaf9",
          "code": "BYR0546TOW",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=BYR0546TOW",
          "code_system": "DAILYMED",
          "references": [
            "0ae6667e-5a13-8160-ab2a-bf836eea6190"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "19b063d3-71f7-4392-9e47-2ff2498562d8",
          "name": "1,3 BIS(HYDROXYMETHYL)-5,5- DIMETHYLHYDANTOINDIMETHYLHYDANTOIN",
          "stdName": "1,3 BIS(HYDROXYMETHYL)-5,5- DIMETHYLHYDANTOINDIMETHYLHYDANTOIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f197533-ca1a-4261-81bd-31a06df2fca8",
            "524953bd-199f-4caa-84b6-27e93209e749"
          ],
          "display_name": false
        },
        {
          "uuid": "2edc0f5b-beca-4477-ab51-3e648d40eb19",
          "name": "1,3-BIS(HYDROXYMETHYL)-5,5-DIMETHYL-2,4-IMIDAZOLIDINEDIONE",
          "stdName": "1,3-BIS(HYDROXYMETHYL)-5,5-DIMETHYL-2,4-IMIDAZOLIDINEDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c406d8cf-374a-4f82-94cf-c8edea2a3ca2",
            "3e19afb8-1631-4f18-a72d-3f22422a8519"
          ],
          "display_name": false
        },
        {
          "uuid": "7289913d-9bbf-425c-a1f3-940012a31a07",
          "name": "1,3-BIS(HYDROXYMETHYL)-5,5-DIMETHYLHYDANTOIN",
          "stdName": "1,3-BIS(HYDROXYMETHYL)-5,5-DIMETHYLHYDANTOIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c406d8cf-374a-4f82-94cf-c8edea2a3ca2",
            "3e19afb8-1631-4f18-a72d-3f22422a8519"
          ],
          "display_name": false
        },
        {
          "uuid": "3eda2409-7783-4c84-92f8-a4d7ef910a30",
          "name": "1,3-DIMETHYLOL-5,5-DIMETHYL-HYDANTOIN",
          "stdName": "1,3-DIMETHYLOL-5,5-DIMETHYL-HYDANTOIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c406d8cf-374a-4f82-94cf-c8edea2a3ca2",
            "fcc448a6-8f71-497b-9f74-8571a5b0d07d"
          ],
          "display_name": false
        },
        {
          "uuid": "e51cc7a1-1cfa-4d83-b7c4-1b5f2d15572a",
          "name": "1,3-DIMETHYLOL-5,5-DIMETHYLHYDANTOIN",
          "stdName": "1,3-DIMETHYLOL-5,5-DIMETHYLHYDANTOIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f54ebca3-0fc9-4631-9440-7c3c971080de",
            "99133469-e4aa-4ff0-816d-762c522015d0",
            "ab030783-6f62-469d-9180-5e4479e20618",
            "524953bd-199f-4caa-84b6-27e93209e749"
          ],
          "display_name": false
        },
        {
          "uuid": "2dacb2b1-1b3f-469b-ab67-7f541a1e7bb7",
          "name": "1,3-DIMETHYLOL-5,5-DIMETHYLHYDANTOIN [HSDB]",
          "stdName": "1,3-DIMETHYLOL-5,5-DIMETHYLHYDANTOIN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab030783-6f62-469d-9180-5e4479e20618",
            "524953bd-199f-4caa-84b6-27e93209e749"
          ],
          "display_name": false
        },
        {
          "uuid": "d9bbae5d-a332-4a9d-ab49-b165eea7a239",
          "name": "DIMETHYLOL-5,5-DIMETHYLHYDANTOIN",
          "stdName": "DIMETHYLOL-5,5-DIMETHYLHYDANTOIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9469db40-6eca-4b1b-a3f0-b2710ecd0f39",
            "524953bd-199f-4caa-84b6-27e93209e749"
          ],
          "display_name": false
        },
        {
          "uuid": "b98661cb-d36f-4bc0-8cb1-1a371196f741",
          "name": "DMDM HYDANTION [VANDF]",
          "stdName": "DMDM HYDANTION [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc5dbf06-1d19-4e4f-a12f-b45b1f4471ac",
            "524953bd-199f-4caa-84b6-27e93209e749"
          ],
          "display_name": false
        },
        {
          "uuid": "305761fd-9800-43f3-992f-2cb3d4125837",
          "name": "DMDM HYDANTOIN",
          "stdName": "DMDM HYDANTOIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc5dbf06-1d19-4e4f-a12f-b45b1f4471ac",
            "6d7e1ca5-8fed-40d6-a4d2-55c178ce61f5",
            "fe68f9f6-0147-46a9-beaa-a05694306bb1",
            "1b368134-9878-4ed9-a4ef-8a87c6159cd4",
            "b39d6dfa-1a42-45ac-81cd-2ec36655c59f",
            "aae3d014-1ef9-46e2-abe2-0096630195d8",
            "524953bd-199f-4caa-84b6-27e93209e749"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "88db50f1-cc60-422e-9bf7-34b7a46c07d7",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "5095a852-fb23-4e78-aff6-3aed13ab31dd",
          "name": "DMDM HYDANTOIN [II]",
          "stdName": "DMDM HYDANTOIN [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aae3d014-1ef9-46e2-abe2-0096630195d8"
          ],
          "display_name": false
        },
        {
          "uuid": "d941d32c-f6cf-4e44-af6e-c75317e113ea",
          "name": "DMDM HYDANTOIN [VANDF]",
          "stdName": "DMDM HYDANTOIN [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc5dbf06-1d19-4e4f-a12f-b45b1f4471ac",
            "524953bd-199f-4caa-84b6-27e93209e749"
          ],
          "display_name": false
        },
        {
          "uuid": "8e30592d-4933-4edb-a6b0-5a1040bc3f6d",
          "name": "GLYDANT",
          "stdName": "GLYDANT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aae3d014-1ef9-46e2-abe2-0096630195d8"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "aae3d014-1ef9-46e2-abe2-0096630195d8",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fcc448a6-8f71-497b-9f74-8571a5b0d07d",
          "citation": "ChemIDplus 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c406d8cf-374a-4f82-94cf-c8edea2a3ca2",
          "citation": "STN 2007",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e19afb8-1631-4f18-a72d-3f22422a8519",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe68f9f6-0147-46a9-beaa-a05694306bb1",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "524953bd-199f-4caa-84b6-27e93209e749",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9469db40-6eca-4b1b-a3f0-b2710ecd0f39",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab030783-6f62-469d-9180-5e4479e20618",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f197533-ca1a-4261-81bd-31a06df2fca8",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc5dbf06-1d19-4e4f-a12f-b45b1f4471ac",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99133469-e4aa-4ff0-816d-762c522015d0",
          "citation": "RXNORM",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7776d0fe-7c87-4401-af61-4e09822c3794",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389668000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "47ddc486-934d-445c-b885-fd10da8faa5b",
          "citation": "SRS import [BYR0546TOW]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=BYR0546TOW",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389668000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d7e1ca5-8fed-40d6-a4d2-55c178ce61f5",
          "citation": "DMDM HYDANTOIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1b368134-9878-4ed9-a4ef-8a87c6159cd4",
          "citation": "DMDM HYDANTOIN [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f54ebca3-0fc9-4631-9440-7c3c971080de",
          "citation": "1,3-DIMETHYLOL-5,5-DIMETHYLHYDANTOIN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b39d6dfa-1a42-45ac-81cd-2ec36655c59f",
          "citation": "DMDM HYDANTOIN [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3fd5296d-9cdb-463b-8f85-ee83717f264f",
          "citation": "DMDM HYDANTION [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ae49e57d-a0a9-7734-a5f5-4f8f60462f1b",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+6440-58-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a7058de7-6924-78cc-0da5-2cd7be763497",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6440-58-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c05f51d5-9397-cf85-ef97-ce3bd750a5ac",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "997db42c-8bfb-4aa4-bc10-05ab17d31b0c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0ae6667e-5a13-8160-ab2a-bf836eea6190",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "723756ac-5767-fd37-9e63-7a78e4d6485c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d3d72541-94ea-4475-b8cb-058d432e7d96",
          "id": "d3d72541-94ea-4475-b8cb-058d432e7d96",
          "molfile": "\n  Marvin  01132110582D          \n\n 13 13  0  0  0  0            999 V2000\n    3.4349   -1.1295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7180   -1.5421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2983   -2.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3235   -0.8459    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6690   -0.0722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4891    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5034   -1.0006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8897   -0.4590    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4183   -1.8206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7143   -2.2307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.8206    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1739   -2.1533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3441   -2.9501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2 12  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  7  1  0  0  0  0\n  6  5  1  0  0  0  0\n  8  7  2  0  0  0  0\n  7  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 12  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 13 12  2  0  0  0  0\nM  END",
          "smiles": "CC1(C)C(=O)N(CO)C(=O)N1CO",
          "formula": "C7H12N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "63966dcf-afb7-4807-a465-9f301d7a82d0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "188.1815",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c66fc8d0-d091-47e8-bc11-eb0633f32689",
      "version": "9",
      "structure": {
        "id": "29861c7c-7f81-42c8-b127-480706accc43",
        "molfile": "\n  Marvin  01132102162D          \n\n 13 13  0  0  0  0            999 V2000\n    1.4183   -1.8206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3235   -0.8459    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5034   -1.0006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1739   -2.1533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7180   -1.5421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8897   -0.4590    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7143   -2.2307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6690   -0.0722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3441   -2.9501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4349   -1.1295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2983   -2.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4891    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.8206    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  3  2  0  0  0  0\n  7  1  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  4  2  0  0  0  0\n 10  5  1  0  0  0  0\n 11  5  1  0  0  0  0\n 12  8  1  0  0  0  0\n 13  7  1  0  0  0  0\n  5  2  1  0  0  0  0\nM  END",
        "smiles": "CC1(C)C(=O)N(CO)C(=O)N1CO",
        "formula": "C7H12N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "188.1815",
        "optical_activity": "NONE",
        "references": [
          "47ddc486-934d-445c-b885-fd10da8faa5b",
          "fcc448a6-8f71-497b-9f74-8571a5b0d07d"
        ],
        "stereo_centers": 0
      },
      "unii": "BYR0546TOW"
    }
  ]
}