{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "147d80a4-a48b-48e1-9e97-81663357b873", "code": "28978-02-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=28978-02-1", "code_system": "CAS", "references": [ "cdabffeb-3b3a-4a07-8e65-3c9b7cd7a72f", "7f304f42-5db7-4528-85a3-db558b44173e" ] }, { "uuid": "d8024ca9-d691-46fb-8bb6-060a9b78b8c5", "code": "168849", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/168849", "code_system": "PUBCHEM", "references": [ "cdabffeb-3b3a-4a07-8e65-3c9b7cd7a72f" ] }, { "uuid": "4a558999-2b52-509a-a189-29af1c69a41f", "code": "Pectolinarin", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Pectolinarin", "code_system": "WIKIPEDIA", "references": [ "b9674a24-1e40-e92d-a050-3fcefb377814" ] }, { "uuid": "b74524aa-d3c2-4b25-bcbf-4c29d988a84a", "code": "BY44L9O1RR", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "9bc95af2-4e86-02f1-7db2-68f15b668765", "code": "DTXSID70951590", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70951590", "code_system": "EPA CompTox", "references": [ "5da2f364-b890-1dc1-ad7b-058287a30fa8" ] } ], "substance_class": "chemical", "names": [ { "uuid": "ac956901-2625-c01c-a0ed-71d52526bc7b", "name": "4H-1-BENZOPYRAN-4-ONE, 7-((6-O-(6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL)-.BETA.-D-GLUCOPYRANOSYL)OXY)-5-HYDROXY-6-METHOXY-2-(4-METHOXYPHENYL)-", "stdName": "4H-1-BENZOPYRAN-4-ONE, 7-((6-O-(6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL)-.BETA.-D-GLUCOPYRANOSYL)OXY)-5-HYDROXY-6-METHOXY-2-(4-METHOXYPHENYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8b3ec094-4293-6381-21bc-dd4e54e73d40" ], "display_name": false }, { "uuid": "85aaa850-9765-c1e4-93f5-daa72d64ce5d", "name": "7-((6-O-(6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL)-.BETA.-D-GLUCOPYRANOSYL)OXY)-5-HYDROXY-6-METHOXY-2-(4-METHOXYPHENYL)-4H-1-BENZOPYRAN-4-ONE", "stdName": "7-((6-O-(6-DEOXY-.ALPHA.-L-MANNOPYRANOSYL)-.BETA.-D-GLUCOPYRANOSYL)OXY)-5-HYDROXY-6-METHOXY-2-(4-METHOXYPHENYL)-4H-1-BENZOPYRAN-4-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "8b3ec094-4293-6381-21bc-dd4e54e73d40" ], "display_name": false }, { "uuid": "4097d966-2a1d-4f20-99e2-dd924659e937", "name": "PECTOLINARIN", "stdName": "PECTOLINARIN", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "8b3ec094-4293-6381-21bc-dd4e54e73d40" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "4b6ec560-d2ef-4d36-a80a-8d54c732823e", "name_org": "INCI" } ] }, { "uuid": "56a65aae-39c9-e7cb-a4ad-9010ed94d722", "name": "PECTOLINAROSIDE", "stdName": "PECTOLINAROSIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8b3ec094-4293-6381-21bc-dd4e54e73d40" ], "display_name": true } ], "references": [ { "uuid": "cdabffeb-3b3a-4a07-8e65-3c9b7cd7a72f", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391038000, "tags": [ "NOMEN" ] }, { "uuid": "9ed8bb56-f0c3-4fcf-bf47-9b07adc6e7d4", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b9674a24-1e40-e92d-a050-3fcefb377814", "citation": "Pectolinarin", "url": "https://en.wikipedia.org/wiki/Pectolinarin", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "8b3ec094-4293-6381-21bc-dd4e54e73d40", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "e3e26cfc-23f6-f30c-236e-6e05368c7f6c", "citation": "PCPC", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true }, { "uuid": "7f304f42-5db7-4528-85a3-db558b44173e", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "5da2f364-b890-1dc1-ad7b-058287a30fa8", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "022490c3-d5cd-4aab-9cf5-25a143f4b3b5", "id": "022490c3-d5cd-4aab-9cf5-25a143f4b3b5", "molfile": "\n Marvin 01132100262D \n\n 44 48 0 0 0 0 999 V2000\n 3.8363 -6.4567 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 3.8363 -5.6270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5534 -6.8668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5534 -7.6918 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 5.2654 -8.1066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9776 -7.6918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6944 -8.1066 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 7.4113 -7.6918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1234 -8.1066 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 8.8357 -7.6918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8357 -6.8668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1234 -6.4567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1234 -5.6270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4113 -5.2169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4113 -4.3919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1234 -3.9771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8357 -4.3919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5526 -3.9771 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8357 -5.2169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5526 -5.6270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2694 -5.2169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5526 -6.4567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2694 -6.8668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2694 -7.6918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6944 -3.9771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6944 -3.1522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9776 -2.7420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2654 -3.1522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5534 -2.7420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5534 -1.9171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2654 -3.9771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9776 -4.3919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1234 -8.9315 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 8.8357 -9.3417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4113 -9.3417 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 7.4113 -10.1666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6944 -8.9315 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 5.9776 -9.3417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8363 -8.1066 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 3.8363 -8.9315 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1195 -7.6918 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 2.4026 -8.1066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1195 -6.8668 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 2.4026 -6.4567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 43 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 1 0 0 0\n 39 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 1 0 0 0\n 7 8 1 0 0 0 0\n 37 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 1 0 0 0\n 33 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 2 0 0 0 0\n 11 22 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 19 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 15 25 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 17 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 20 2 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 32 2 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 28 31 2 0 0 0 0\n 29 30 1 0 0 0 0\n 31 32 1 0 0 0 0\n 33 34 1 6 0 0 0\n 35 33 1 0 0 0 0\n 35 36 1 1 0 0 0\n 37 35 1 0 0 0 0\n 37 38 1 6 0 0 0\n 39 40 1 6 0 0 0\n 41 39 1 0 0 0 0\n 41 42 1 6 0 0 0\n 43 41 1 0 0 0 0\n 43 44 1 1 0 0 0\nM END", "smiles": "C[C@H]1[C@@H]([C@H]([C@H]([C@H](OC[C@@H]2[C@H]([C@@H]([C@H]([C@H](Oc3cc4c(c(=O)cc(-c5ccc(cc5)OC)o4)c(c3OC)O)O2)O)O)O)O1)O)O)O", "formula": "C29H34O15", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "132b9b6e-9680-48c0-ada5-df12b651b4aa" }, "defined_stereo": 10, "ez_centers": 0, "molecular_weight": "622.5724", "optical_activity": "UNSPECIFIED", "stereo_centers": 10 } ], "definition_level": "INCOMPLETE", "uuid": "d24fe01b-2f4e-4e77-bc99-2b02556ac30d", "version": "13", "structure": { "id": "3302017a-fa15-41c6-bd21-94d15f009a1a", "molfile": "\n Marvin 01132102442D \n\n 44 48 0 0 1 0 999 V2000\n 19.6369 -3.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3490 -2.8850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0613 -3.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0613 -4.1248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3490 -4.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.6369 -4.1248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3490 -5.3646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0613 -5.7747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7782 -5.3646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7782 -4.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4950 -4.1248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4950 -5.7747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4950 -6.5997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0613 -6.5997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3490 -7.0145 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 20.3490 -7.8394 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 21.0613 -8.2496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.6369 -8.2496 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 19.6369 -9.0745 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9200 -7.8394 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 18.2031 -8.2496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9200 -7.0145 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 19.6369 -6.5997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2031 -6.5997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4909 -7.0145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7789 -6.5997 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.0619 -7.0145 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 16.0619 -7.8394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3451 -6.5997 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.6281 -7.0145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3451 -5.7747 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.6281 -5.3646 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0619 -5.3646 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.7789 -5.7747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0619 -4.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7782 -2.8850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9200 -2.8850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9200 -2.0601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2031 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4909 -2.0601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4909 -2.8850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2031 -3.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7789 -1.6499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9127 -0.5240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 1 6 1 0 0 0 0\n 5 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 4 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 9 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 8 14 1 0 0 0 0\n 15 14 1 1 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 6 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 1 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 6 0 0 0\n 20 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 15 23 1 0 0 0 0\n 22 24 1 1 0 0 0\n 24 25 1 0 0 0 0\n 26 25 1 1 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 6 0 0 0\n 27 29 1 0 0 0 0\n 29 30 1 6 0 0 0\n 29 31 1 0 0 0 0\n 31 32 1 1 0 0 0\n 31 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 26 34 1 0 0 0 0\n 33 35 1 6 0 0 0\n 3 36 2 0 0 0 0\n 1 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 2 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 2 0 0 0 0\n 41 42 1 0 0 0 0\n 37 42 2 0 0 0 0\n 40 43 1 0 0 0 0\n 43 44 1 0 0 0 0\nM END", "smiles": "C[C@H]1[C@@H]([C@H]([C@H]([C@H](OC[C@@H]2[C@H]([C@@H]([C@H]([C@H](Oc3cc4c(c(=O)cc(-c5ccc(cc5)OC)o4)c(c3OC)O)O2)O)O)O)O1)O)O)O", "formula": "C29H34O15", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 10, "ez_centers": 0, "molecular_weight": "622.5724", "optical_activity": "UNSPECIFIED", "references": [ "9ed8bb56-f0c3-4fcf-bf47-9b07adc6e7d4" ], "stereo_centers": 10 }, "unii": "BY44L9O1RR" } ] }