{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "03fb5b2a-7c1d-4102-aa66-a8c0f35a6955", "code": "16502-99-1", "type": "SUPERSEDED", "url": "https://commonchemistry.cas.org/detail?cas_rn=16502-99-1", "code_system": "CAS", "references": [ "f6a8572f-032f-4768-af8c-dd3dd7675cd5", "d8ff5e5a-e34d-4df3-927d-2f9653759674" ] }, { "uuid": "ce5379e7-01c6-443c-aa60-f8dd39410960", "code": "1314421", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1314421/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "f6a8572f-032f-4768-af8c-dd3dd7675cd5" ] }, { "uuid": "ffaba064-7e71-4669-89d6-597fb89ed438", "code": "9828350", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9828350", "code_system": "PUBCHEM", "references": [ "f6a8572f-032f-4768-af8c-dd3dd7675cd5" ] }, { "uuid": "a6bf14cf-d842-d777-dbd2-0e50b810da60", "code": "DTXSID30167837", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30167837", "code_system": "EPA CompTox", "references": [ "393ceb0d-e7c8-cc13-75af-46f1828db480" ] }, { "uuid": "8d38e5dd-d7f8-4220-9f2a-7485f3addb34", "code": "BXW1GAI4TA", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "27e298ae-50ff-4e30-aad0-26c896cd8296", "code": "76414-35-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=76414-35-2", "code_system": "CAS", "references": [ "d8ff5e5a-e34d-4df3-927d-2f9653759674" ] }, { "uuid": "f7426a99-9ebb-14c0-9724-5953234ae954", "code": "BXW1GAI4TA", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=BXW1GAI4TA", "code_system": "DAILYMED", "references": [ "b7070c86-1cda-c158-58c4-6d935df97fc0" ] } ], "substance_class": "chemical", "names": [ { "uuid": "452e5e8c-70c5-44ea-b38b-97e88f5a932c", "name": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, TRIOCTYL ESTER", "stdName": "1,2,3-PROPANETRICARBOXYLIC ACID, 2-HYDROXY-, TRIOCTYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "90f8ce73-dab4-4541-9552-864bd42e5b27", "dc72c02d-d315-4909-b9e4-3b7434611994" ], "display_name": false }, { "uuid": "7dd15443-0537-4d00-a420-75384228843d", "name": "BERNEL ESTER TCC", "stdName": "BERNEL ESTER TCC", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "dc72c02d-d315-4909-b9e4-3b7434611994", "13ab6c70-30dc-408f-a09e-8d1ada63ea5c" ], "display_name": false }, { "uuid": "83d6f28d-9911-480a-9488-ab4ee3155f53", "name": "CITRIC ACID, TRIOCTYL ESTER", "stdName": "CITRIC ACID, TRIOCTYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "dc72c02d-d315-4909-b9e4-3b7434611994", "30512da7-0281-4748-a060-d77b5909be1d" ], "display_name": false }, { "uuid": "970c2ada-8ffd-4013-bbc3-271e37bddf22", "name": "TRI-N-OCTYL CITRATE", "stdName": "TRI-N-OCTYL CITRATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "dc72c02d-d315-4909-b9e4-3b7434611994", "30512da7-0281-4748-a060-d77b5909be1d" ], "display_name": false }, { "uuid": "31c96ee0-7979-441e-8b4a-86b880c1d36c", "name": "TRICAPRYLYL CITRATE", "stdName": "TRICAPRYLYL CITRATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "df38d1a0-9f6b-4f94-9543-9b149f862831", "31e79fca-ff1b-4726-9b53-2b645fec4d46", "dc72c02d-d315-4909-b9e4-3b7434611994", "13ab6c70-30dc-408f-a09e-8d1ada63ea5c" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "e0009f45-fa03-4e1d-b341-d4a25c866b40", "name_org": "INCI" } ] }, { "uuid": "20f92cb0-4136-4b18-8d0c-6e4bffeb16e9", "name": "TRIOCTYL CITRATE", "stdName": "TRIOCTYL CITRATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "dc72c02d-d315-4909-b9e4-3b7434611994", "30512da7-0281-4748-a060-d77b5909be1d" ], "display_name": false } ], "references": [ { "uuid": "13ab6c70-30dc-408f-a09e-8d1ada63ea5c", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "dc72c02d-d315-4909-b9e4-3b7434611994", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "90f8ce73-dab4-4541-9552-864bd42e5b27", "citation": "http://www.chemicalbook.com/ChemicalProductProperty_EN_CB9965254.htm", "url": "http://www.chemicalbook.com/ChemicalProductProperty_EN_CB9965254.htm", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "30512da7-0281-4748-a060-d77b5909be1d", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "31e79fca-ff1b-4726-9b53-2b645fec4d46", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f6a8572f-032f-4768-af8c-dd3dd7675cd5", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390313000, "tags": [ "NOMEN" ] }, { "uuid": "4e71e813-d2d4-45ea-9693-f700a53d432f", "citation": "SRS import [BXW1GAI4TA]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=BXW1GAI4TA", "doc_type": "SRS", "public_domain": true, "document_date": 1493390313000, "tags": [ "NOMEN" ] }, { "uuid": "df38d1a0-9f6b-4f94-9543-9b149f862831", "citation": "TRICAPRYLYL CITRATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "04ba48b6-35bf-29e7-163b-9a51fc5e15f6", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=16502-99-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "d8ff5e5a-e34d-4df3-927d-2f9653759674", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "b7070c86-1cda-c158-58c4-6d935df97fc0", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "393ceb0d-e7c8-cc13-75af-46f1828db480", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "b1a032b3-c72c-44e7-8690-701230a84d43", "id": "b1a032b3-c72c-44e7-8690-701230a84d43", "molfile": "\n Marvin 01132109122D \n\n 37 36 0 0 0 0 999 V2000\n 14.0290 -11.7159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3150 -11.3026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6011 -11.7159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8871 -11.3026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1731 -11.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4591 -11.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7452 -11.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0312 -11.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3172 -11.7117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6032 -11.2901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5949 -10.4717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8892 -11.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1753 -11.2901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1670 -10.4717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4613 -11.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7473 -11.2901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7390 -10.4717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0333 -11.7117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3194 -11.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6054 -11.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8914 -11.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1774 -11.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4635 -11.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2505 -11.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9645 -11.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6785 -11.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1670 -12.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4530 -12.5259 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8809 -12.5301 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5949 -12.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3089 -12.5301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0229 -12.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7368 -12.5301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4508 -12.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1648 -12.5259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8788 -12.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5927 -12.5176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 2 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 13 1 0 0 0 0\n 27 13 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 16 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 28 27 2 0 0 0 0\n 29 27 1 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 1 0 0 0 0\n 37 36 1 0 0 0 0\nM END", "smiles": "CCCCCCCCOC(=O)CC(CC(=O)OCCCCCCCC)(C(=O)OCCCCCCCC)O", "formula": "C30H56O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "34742d54-efd9-4731-951b-58bb1d328d63" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "528.7626", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "5b65001c-9d31-4987-8718-595523788f6b", "version": "8", "structure": { "id": "ed71c3cc-6f23-447d-9b42-46d392f948e2", "molfile": "\n Marvin 01132112172D \n\n 37 36 0 0 0 0 999 V2000\n 6.1753 -11.2901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4613 -11.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8892 -11.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1670 -12.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6032 -11.2901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7473 -11.2901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4530 -12.5259 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5949 -10.4717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7390 -10.4717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1670 -10.4717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8809 -12.5301 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0333 -11.7117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3172 -11.7117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5949 -12.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3194 -11.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0312 -11.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6054 -11.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7452 -11.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3089 -12.5301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8788 -12.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3150 -11.3026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9645 -11.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1648 -12.5259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2505 -11.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6011 -11.7159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4508 -12.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4591 -11.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1731 -11.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8871 -11.3026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8914 -11.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1774 -11.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4635 -11.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0229 -12.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7368 -12.5301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0290 -11.7159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5927 -12.5176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6785 -11.7117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 1 1 0 0 0 0\n 4 1 1 0 0 0 0\n 5 3 1 0 0 0 0\n 6 2 1 0 0 0 0\n 7 4 2 0 0 0 0\n 8 5 2 0 0 0 0\n 9 6 2 0 0 0 0\n 10 1 1 0 0 0 0\n 11 4 1 0 0 0 0\n 12 6 1 0 0 0 0\n 13 5 1 0 0 0 0\n 14 11 1 0 0 0 0\n 15 12 1 0 0 0 0\n 16 13 1 0 0 0 0\n 17 15 1 0 0 0 0\n 18 16 1 0 0 0 0\n 19 14 1 0 0 0 0\n 20 23 1 0 0 0 0\n 21 25 1 0 0 0 0\n 22 24 1 0 0 0 0\n 23 26 1 0 0 0 0\n 24 32 1 0 0 0 0\n 25 29 1 0 0 0 0\n 26 34 1 0 0 0 0\n 27 18 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 17 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 19 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 21 1 0 0 0 0\n 36 20 1 0 0 0 0\n 37 22 1 0 0 0 0\nM END", "smiles": "CCCCCCCCOC(=O)CC(CC(=O)OCCCCCCCC)(C(=O)OCCCCCCCC)O", "formula": "C30H56O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "528.7626", "optical_activity": "NONE", "references": [ "4e71e813-d2d4-45ea-9693-f700a53d432f", "13ab6c70-30dc-408f-a09e-8d1ada63ea5c" ], "stereo_centers": 0 }, "modifications": { "uuid": "fd684583-914c-4db6-928d-f0d9c81902c1" }, "unii": "BXW1GAI4TA" } ] }