{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1cce9e94-f000-4a5d-9e94-8f250026fcb0",
          "code": "13515-40-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=13515-40-7",
          "code_system": "CAS",
          "references": [
            "f9300eb3-7997-45d5-b38c-698e483563f7",
            "54c7cefa-b2b8-4978-9d61-61bc02bc240f"
          ]
        },
        {
          "uuid": "cfe8f579-b679-4ce6-a592-de60f3ce996f",
          "code": "236-852-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.033.487",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f9300eb3-7997-45d5-b38c-698e483563f7"
          ]
        },
        {
          "uuid": "0aa17fca-7764-492a-8961-071bf286f98f",
          "code": "61637",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/61637",
          "code_system": "PUBCHEM",
          "references": [
            "f9300eb3-7997-45d5-b38c-698e483563f7"
          ]
        },
        {
          "uuid": "45dc9d9b-c834-e3b6-a97b-68e689596385",
          "code": "DTXSID6051691",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6051691",
          "code_system": "EPA CompTox",
          "references": [
            "d48b791a-2545-a29e-4777-716ca80bfa39"
          ]
        },
        {
          "uuid": "92a15d0b-d3d1-445e-b2bc-9af0e66b9ced",
          "code": "BXL1J43EKI",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1e20edec-5d81-4d18-a16c-a8c60a018da6",
          "name": "(±)-PIGMENT YELLOW 73",
          "stdName": "(+/-)-PIGMENT YELLOW 73",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fff15d4c-a4a2-44cc-a000-1be7ec5ddaa7",
            "69926e36-8609-4448-a327-ef844245edf3"
          ],
          "display_name": false
        },
        {
          "uuid": "c7cebe07-2d63-4e24-8195-44b9c6b418d6",
          "name": "BUTANAMIDE, 2-((4-CHLORO-2-NITROPHENYL)AZO)-N-(2-METHOXYPHENYL)-3-OXO-",
          "stdName": "BUTANAMIDE, 2-((4-CHLORO-2-NITROPHENYL)AZO)-N-(2-METHOXYPHENYL)-3-OXO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fff15d4c-a4a2-44cc-a000-1be7ec5ddaa7",
            "88a5bca4-2005-4df2-a0db-fd5855319d33"
          ],
          "display_name": false
        },
        {
          "uuid": "7bdd8eed-635e-42ca-8f17-23d6d35b2163",
          "name": "BUTANAMIDE, 2-(2-(4-CHLORO-2-NITROPHENYL)DIAZENYL)-N-(2-METHOXYPHENYL)-3-OXO-",
          "stdName": "BUTANAMIDE, 2-(2-(4-CHLORO-2-NITROPHENYL)DIAZENYL)-N-(2-METHOXYPHENYL)-3-OXO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fff15d4c-a4a2-44cc-a000-1be7ec5ddaa7",
            "88a5bca4-2005-4df2-a0db-fd5855319d33"
          ],
          "display_name": false
        },
        {
          "uuid": "65c3b3fa-cf4a-45b8-856b-419a51effadd",
          "name": "C.I. PIGMENT YELLOW 73",
          "stdName": "C.I. PIGMENT YELLOW 73",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fff15d4c-a4a2-44cc-a000-1be7ec5ddaa7",
            "88a5bca4-2005-4df2-a0db-fd5855319d33"
          ],
          "display_name": false
        },
        {
          "uuid": "d008b499-663b-4217-ad45-2ef50eb93a25",
          "name": "CI 11738",
          "stdName": "CI 11738",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fff15d4c-a4a2-44cc-a000-1be7ec5ddaa7",
            "202eb7b9-410a-4d36-b6d9-5a53aa54e76a"
          ],
          "display_name": false
        },
        {
          "uuid": "894f5f28-4a57-419d-af6b-318bb04ad670",
          "name": "HANCOCK YELLOW 73",
          "stdName": "HANCOCK YELLOW 73",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fff15d4c-a4a2-44cc-a000-1be7ec5ddaa7",
            "202eb7b9-410a-4d36-b6d9-5a53aa54e76a"
          ],
          "display_name": false
        },
        {
          "uuid": "98058dc2-9128-40ad-a12c-7292f5733fbb",
          "name": "HANSA BRILLIANT YELLOW 4GX",
          "stdName": "HANSA BRILLIANT YELLOW 4GX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fff15d4c-a4a2-44cc-a000-1be7ec5ddaa7",
            "88a5bca4-2005-4df2-a0db-fd5855319d33"
          ],
          "display_name": false
        },
        {
          "uuid": "993bc4fe-97bb-449c-acba-ad55fcf175c3",
          "name": "O-ACETOACETANISIDIDE, 2-((4-CHLORO-2-NITROPHENYL)AZO)-",
          "stdName": "O-ACETOACETANISIDIDE, 2-((4-CHLORO-2-NITROPHENYL)AZO)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fff15d4c-a4a2-44cc-a000-1be7ec5ddaa7",
            "88a5bca4-2005-4df2-a0db-fd5855319d33"
          ],
          "display_name": false
        },
        {
          "uuid": "dd5e5c72-5ae2-4b33-b016-f5fb3c75948e",
          "name": "PIGMENT YELLOW 73",
          "stdName": "PIGMENT YELLOW 73",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04275385-dc89-4e6b-8eab-52df0f82d403",
            "fff15d4c-a4a2-44cc-a000-1be7ec5ddaa7",
            "202eb7b9-410a-4d36-b6d9-5a53aa54e76a"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f7fcf08e-7072-413e-9be6-0d4e17a53d32",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "202eb7b9-410a-4d36-b6d9-5a53aa54e76a",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fff15d4c-a4a2-44cc-a000-1be7ec5ddaa7",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88a5bca4-2005-4df2-a0db-fd5855319d33",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69926e36-8609-4448-a327-ef844245edf3",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9300eb3-7997-45d5-b38c-698e483563f7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391543000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02058d4b-7546-4bc5-9579-81b49faf3b0d",
          "citation": "SRS import [BXL1J43EKI]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=BXL1J43EKI",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391543000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "04275385-dc89-4e6b-8eab-52df0f82d403",
          "citation": "PIGMENT YELLOW 73 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d48b791a-2545-a29e-4777-716ca80bfa39",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=13515-40-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "54c7cefa-b2b8-4978-9d61-61bc02bc240f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fe129b14-58c0-4754-8ae9-3b06a623bd1a",
          "id": "fe129b14-58c0-4754-8ae9-3b06a623bd1a",
          "molfile": "\n  Marvin  01132113092D          \n\n 27 28  0  0  0  0            999 V2000\n    7.2932   -5.3201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5619   -5.7294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5619   -6.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8486   -6.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8486   -7.7938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5799   -8.2031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2932   -7.7938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2932   -6.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0155   -6.5449    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7106   -6.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7106   -7.7938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4269   -6.5449    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.4269   -5.7294    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7287   -5.3201    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7287   -4.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0155   -4.1072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0155   -3.2526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7287   -2.8523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7287   -2.0277    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.4269   -3.2526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4269   -4.1072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1492   -4.5075    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   10.8715   -4.1072    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   10.1492   -5.3381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1492   -6.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8624   -6.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1492   -7.7938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  8  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 25  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 21  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 18  2  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  2  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  2  0  0  0  0\nM  CHG  2  22   1  23  -1\nM  END",
          "smiles": "CC(=O)C(C(=O)Nc1ccccc1OC)/N=N/c2ccc(cc2[N+](=O)[O-])Cl",
          "formula": "C17H15ClN4O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ca32fe2b-0c2c-4229-8baf-599e6167dd07"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "390.7784",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6f65fcd4-c0be-4344-a996-6af040fd5a04",
      "version": "4",
      "structure": {
        "id": "08b6b568-fe59-4e6b-89b5-2d6eba368be8",
        "molfile": "\n  Marvin  01132100432D          \n\n 27 28  0  0  0  0            999 V2000\n    7.2932   -5.3201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8486   -7.7938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5799   -8.2031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5619   -5.7294    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8486   -6.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2932   -7.7938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5619   -6.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2932   -6.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1492   -7.7938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8624   -6.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7106   -7.7938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0155   -6.5449    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1492   -6.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7106   -6.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7287   -2.0277    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.4269   -6.5449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8715   -4.1072    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   10.1492   -5.3381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7287   -2.8523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0155   -3.2526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4269   -5.7294    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1492   -4.5075    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    9.4269   -3.2526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0155   -4.1072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7287   -5.3201    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4269   -4.1072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7287   -4.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  3  2  2  0  0  0  0\n 20 19  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  4  1  0  0  0  0\n  7  5  2  0  0  0  0\n  8  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n 12  8  1  0  0  0  0\n 13  9  2  0  0  0  0\n 13 10  1  0  0  0  0\n 14 11  2  0  0  0  0\n 14 12  1  0  0  0  0\n 16 13  1  0  0  0  0\n 16 14  1  0  0  0  0\n 19 15  1  0  0  0  0\n 21 16  1  0  0  0  0\n 22 17  1  0  0  0  0\n 22 18  2  0  0  0  0\n 23 19  1  0  0  0  0\n 24 20  1  0  0  0  0\n 25 21  2  0  0  0  0\n 26 22  1  0  0  0  0\n 26 23  2  0  0  0  0\n 27 24  2  0  0  0  0\n 27 25  1  0  0  0  0\n 27 26  1  0  0  0  0\nM  CHG  2  17  -1  22   1\nM  END",
        "smiles": "CC(=O)C(C(=O)Nc1ccccc1OC)/N=N/c2ccc(cc2[N+](=O)[O-])Cl",
        "formula": "C17H15ClN4O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "390.7784",
        "optical_activity": "( + / - )",
        "references": [
          "02058d4b-7546-4bc5-9579-81b49faf3b0d",
          "88a5bca4-2005-4df2-a0db-fd5855319d33"
        ],
        "stereo_centers": 1
      },
      "unii": "BXL1J43EKI"
    }
  ]
}