{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "810732e4-42fa-460f-b9cf-09d89c9bf509", "code": "12220-28-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=12220-28-9", "code_system": "CAS", "references": [ "722250df-04b7-4217-ad12-4d752d942d64", "a778e985-bc4a-43db-af1c-e0bb315b8aa2" ] }, { "uuid": "93bdbee5-974d-b295-eef3-76283651fa33", "code": "DTXSID5051319", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5051319", "code_system": "EPA CompTox", "references": [ "ad114ed7-ff04-deae-e6e1-4b5ae47294fe" ] }, { "uuid": "08b69ae0-6d69-4120-959c-d78654779b4a", "code": "BW9BT8QM7B", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "references": [ { "uuid": "ff91d1a7-950f-4db0-8725-d2ee19145fa8", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "722250df-04b7-4217-ad12-4d752d942d64", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392138000, "tags": [ "NOMEN" ] }, { "uuid": "ad114ed7-ff04-deae-e6e1-4b5ae47294fe", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=12220-28-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "a778e985-bc4a-43db-af1c-e0bb315b8aa2", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "79da1e84-eeaa-40e0-93c4-263c799b4ad0", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "ee480e20-3b2b-4a8f-a26e-e2359e3b031e", "id": "ee480e20-3b2b-4a8f-a26e-e2359e3b031e", "molfile": "\n Marvin 01132112202D \n\n 1 0 0 0 0 0 999 V2000\n 2.5185 -0.7327 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "d5911532-3450-4c96-a86e-65499b8cfac2" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "874e27cf-d6a1-4aac-b826-8c0ce82cbff5", "id": "874e27cf-d6a1-4aac-b826-8c0ce82cbff5", "molfile": "\n Marvin 01132107012D \n\n 46 51 0 0 0 0 999 V2000\n 3.5831 -2.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8619 -2.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1521 -2.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4310 -2.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4310 -3.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1521 -4.1326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1521 -4.9568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8619 -3.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5831 -4.1326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3043 -3.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3043 -2.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0141 -2.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7353 -2.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4336 -2.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4336 -1.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1663 -1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1663 -0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4336 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7353 -0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7353 -1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0141 -1.6485 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3043 -2.0720 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4262 -2.3697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5905 -0.9387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1663 -2.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8646 -2.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5857 -2.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5857 -3.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8646 -4.1326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1663 -3.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4336 -4.1326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7353 -3.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0141 -4.1326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3070 -4.1326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0167 -3.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7379 -4.1326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7379 -4.9568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4477 -3.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4477 -2.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7379 -2.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0167 -2.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3070 -2.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7212 -4.1326 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -4.5447 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 0.3091 -3.4114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1218 -4.8424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 8 2 2 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 2 0 0 0 0\n 5 43 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 6 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 33 10 2 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 32 13 2 0 0 0 0\n 14 15 1 0 0 0 0\n 14 25 2 0 0 0 0\n 15 16 1 0 0 0 0\n 15 20 2 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 2 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 2 0 0 0 0\n 21 24 2 0 0 0 0\n 25 26 1 0 0 0 0\n 25 30 1 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 28 34 2 3 0 0 0\n 29 30 2 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 35 41 2 0 0 0 0\n 36 37 1 0 0 0 0\n 38 36 2 0 0 0 0\n 39 38 1 0 0 0 0\n 40 39 2 0 0 0 0\n 41 40 1 0 0 0 0\n 41 42 1 0 0 0 0\n 43 44 1 0 0 0 0\n 43 45 2 0 0 0 0\n 43 46 2 0 0 0 0\nM CHG 1 44 -1\nM END", "smiles": "Cc1cccc(C)c1N=c2ccc3-c(c2)oc4cc(ccc4c3-c5ccccc5S(=O)(=O)O)Nc6c(C)ccc(c6C)S(=O)(=O)[O-]", "formula": "C35H29N2O7S2", "atropisomerism": "No", "charge": -1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "1cc203d3-288f-4ddf-bfc9-252f509467a3" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "653.7474", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "f355c5cf-27e5-49b8-a9b7-578b877c5ae9", "version": "7", "structure": { "id": "f00e4a92-597f-4a2a-a32c-6842c53ef171", "molfile": "\n Marvin 01132112272D \n\n 47 51 0 0 0 0 999 V2000\n 6.4336 -2.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1663 -2.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8646 -2.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5857 -2.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5857 -3.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8646 -4.1326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1663 -3.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4336 -4.1326 0.0000 O 0 3 0 0 0 0 0 0 0 0 0 0\n 5.7353 -3.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0141 -4.1326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3043 -3.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3043 -2.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0141 -2.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7353 -2.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4336 -1.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7353 -1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7353 -0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4336 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1663 -0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1663 -1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0141 -1.6485 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4262 -2.3697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5905 -0.9387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3043 -2.0720 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 3.5831 -4.1326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8619 -3.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1521 -4.1326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4310 -3.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4310 -2.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1521 -2.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8619 -2.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5831 -2.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1521 -4.9568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7212 -4.1326 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3091 -3.4114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1218 -4.8424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -4.5447 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 9.3070 -4.1326 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0167 -3.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0167 -2.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7379 -2.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4477 -2.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4477 -3.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7379 -4.1326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7379 -4.9568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3070 -2.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5185 -0.7327 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 14 2 0 0 0 0\n 1 15 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 7 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 38 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 9 14 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 11 25 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 20 2 0 0 0 0\n 16 17 2 0 0 0 0\n 16 21 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 21 22 2 0 0 0 0\n 21 23 2 0 0 0 0\n 21 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 26 31 2 0 0 0 0\n 27 28 2 0 0 0 0\n 27 33 1 0 0 0 0\n 28 29 1 0 0 0 0\n 28 34 1 0 0 0 0\n 29 30 2 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 34 35 2 0 0 0 0\n 34 36 2 0 0 0 0\n 34 37 1 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 39 44 2 0 0 0 0\n 40 41 2 0 0 0 0\n 40 46 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 2 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 1 0 0 0 0\nM CHG 4 8 1 24 -1 37 -1 47 1\nM END", "smiles": "Cc1cccc(C)c1Nc2ccc3c(c2)[o+]c4cc(ccc4c3-c5ccccc5S(=O)(=O)[O-])Nc6c(C)ccc(c6C)S(=O)(=O)[O-].[Na+]", "formula": "C35H29N2O7S2.Na", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "676.7372", "optical_activity": "NONE", "references": [ "ff91d1a7-950f-4db0-8725-d2ee19145fa8" ], "stereo_centers": 0 }, "unii": "BW9BT8QM7B", "relationships": [ { "uuid": "682d2afd-702f-40bf-8b83-318e9e58a38d", "amount": { "uuid": "19b5e984-0fa3-44ac-bcbb-4ca5bf4c66a8" }, "type": "PARENT->SALT/SOLVATE", "references": [ "79da1e84-eeaa-40e0-93c4-263c799b4ad0" ], "related_substance": { "uuid": "aad40854-6e80-4dbe-9350-18ce130685fb", "refuuid": "30afbce3-2600-406f-a5ea-b2f803c84b0a", "name": "Acid Red 289 free acid", "unii": "7JKD3UM3GP", "linking_id": "7JKD3UM3GP", "ref_pname": "Acid Red 289 free acid", "substance_class": "reference" } } ], "names": [ { "uuid": "60143bb1-6e59-48cd-9027-099ebaba9960", "name": "Acid Red 289", "stdName": "ACID RED 289", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a778e985-bc4a-43db-af1c-e0bb315b8aa2" ], "display_name": true }, { "uuid": "87a48991-f510-4c86-8437-1ed39be7add3", "name": "C.I. 45110", "stdName": "C.I. 45110", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a778e985-bc4a-43db-af1c-e0bb315b8aa2" ], "display_name": false }, { "uuid": "4536e7b7-21fa-4416-98a6-64f4342b0037", "name": "C.I. Acid Red 289", "stdName": "C.I. ACID RED 289", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a778e985-bc4a-43db-af1c-e0bb315b8aa2" ], "display_name": false }, { "uuid": "3747c994-fafa-4e05-bd48-cc57b61f581b", "name": "C.I. Acid Red 305", "stdName": "C.I. ACID RED 305", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a778e985-bc4a-43db-af1c-e0bb315b8aa2" ], "display_name": false }, { "uuid": "d096e66d-6798-49fd-8348-afe4ae533620", "name": "CI 45110", "stdName": "CI 45110", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a778e985-bc4a-43db-af1c-e0bb315b8aa2" ], "display_name": false }, { "uuid": "3ddf0801-e579-4bbb-8410-60550cf11e98", "name": "Xanthylium, 3-[(2,6-dimethylphenyl)amino]-6-[(2,6-dimethylsulfophenyl)amino]-9-(2-sulfophenyl)-, inner salt, sodium salt (1:1)", "stdName": "XANTHYLIUM, 3-((2,6-DIMETHYLPHENYL)AMINO)-6-((2,6-DIMETHYLSULFOPHENYL)AMINO)-9-(2-SULFOPHENYL)-, INNER SALT, SODIUM SALT (1:1)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a778e985-bc4a-43db-af1c-e0bb315b8aa2" ], "display_name": false } ], "modifications": { "uuid": "ede3070d-5777-4a2b-9845-352f049e8b44" } } ] }