{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8e1af9fd-e07f-4842-b750-89a50d06188c",
          "code": "41760-23-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=41760-23-0",
          "code_system": "CAS",
          "references": [
            "282a76a1-369a-479a-a1f7-6525282e1a75",
            "00ae484b-a068-4705-a1e5-eb5260b9915b"
          ]
        },
        {
          "uuid": "9f18d4da-b6e1-49e3-a5b0-dbe3295f0962",
          "code": "255-537-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.050.470",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "282a76a1-369a-479a-a1f7-6525282e1a75"
          ]
        },
        {
          "uuid": "e194091c-8c95-4d1a-a591-cdfbff9f5043",
          "code": "21124886",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21124886",
          "code_system": "PUBCHEM",
          "references": [
            "282a76a1-369a-479a-a1f7-6525282e1a75"
          ]
        },
        {
          "uuid": "b6e0aeaa-636f-43c7-9791-e87421f311b1",
          "code": "BV1DW20UDP",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "18cbb5ec-9007-84f3-056d-c7fbbfdd4ecd",
          "code": "DTXSID10885845",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10885845",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "91a94b9e-40fc-4330-8d7f-e7657cb99a37",
          "name": "DICAPRYLOYL CYSTINE",
          "stdName": "DICAPRYLOYL CYSTINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1534c89-1184-4d09-a791-1546cb229273",
            "62e7a481-8b36-4dac-a761-07e2873d3480",
            "4a889c79-b926-46cf-a42b-79392622a8ed"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f8bf7dcb-b324-41b1-92bc-df263b76ee6f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "edb37c6d-b127-4369-85d4-1139804d822e",
          "name": "DICAPRYLYL-L-CYSTINE",
          "stdName": "DICAPRYLYL-L-CYSTINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1534c89-1184-4d09-a791-1546cb229273",
            "fe23ce38-976b-4852-b42d-e60693b24a82"
          ],
          "display_name": false
        },
        {
          "uuid": "3f8ff670-f3d8-4b8a-9e75-ce6540bf8376",
          "name": "L-CYSTINE, N,N'-BIS(1-OXOOCTYL)-",
          "stdName": "L-CYSTINE, N,N'-BIS(1-OXOOCTYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1534c89-1184-4d09-a791-1546cb229273",
            "fe23ce38-976b-4852-b42d-e60693b24a82"
          ],
          "display_name": false
        },
        {
          "uuid": "9309c690-4bba-49a0-8004-da3ad29d16a4",
          "name": "N,N'-DIOCTANOYL-L-CYSTINE",
          "stdName": "N,N'-DIOCTANOYL-L-CYSTINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1534c89-1184-4d09-a791-1546cb229273",
            "fe23ce38-976b-4852-b42d-e60693b24a82"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4a889c79-b926-46cf-a42b-79392622a8ed",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b1534c89-1184-4d09-a791-1546cb229273",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe23ce38-976b-4852-b42d-e60693b24a82",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "282a76a1-369a-479a-a1f7-6525282e1a75",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392308000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "812e0e4c-3438-402e-b88d-597aa17e7381",
          "citation": "SRS import [BV1DW20UDP]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=BV1DW20UDP",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392308000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "62e7a481-8b36-4dac-a761-07e2873d3480",
          "citation": "DICAPRYLOYL CYSTINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "00ae484b-a068-4705-a1e5-eb5260b9915b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "aef70430-adae-406a-a8cf-7f2747940e5e",
          "id": "aef70430-adae-406a-a8cf-7f2747940e5e",
          "molfile": "\n  Marvin  01132109052D          \n\n 32 31  0  0  1  0            999 V2000\n   13.5928   -3.2438    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   12.8784   -3.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1639   -3.2438    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4494   -3.6563    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7349   -3.2439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0204   -3.6563    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   10.0204   -4.4813    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3059   -4.8939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3059   -5.7189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5914   -4.4813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8769   -4.8939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1624   -4.4814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4479   -4.8939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7334   -4.4814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0190   -4.8939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3045   -4.4814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3059   -3.2439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3059   -2.4188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5914   -3.6563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3073   -3.6563    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0218   -3.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0218   -2.4188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7363   -3.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4508   -3.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1653   -3.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8798   -3.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5943   -3.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3088   -3.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0233   -3.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5928   -2.4188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3073   -2.0063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8784   -2.0063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 20  1  1  0  0  0\n  1 30  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6 17  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 21 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 30 31  1  0  0  0  0\n 30 32  2  0  0  0  0\nM  END",
          "smiles": "CCCCCCCC(=O)N[C@@H](CSSC[C@@H](C(=O)O)NC(=O)CCCCCCC)C(=O)O",
          "formula": "C22H40N2O6S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0d62973a-d8ba-4eb4-90c1-1a567c5a7ae2"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "492.6958",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3ca26714-4667-46c0-ac3a-8c149c7bc11e",
      "version": "5",
      "structure": {
        "id": "1a09d0fd-e11f-4640-b8de-e260b2884aae",
        "molfile": "\n  Marvin  01132101322D          \n\n 32 31  0  0  1  0            999 V2000\n   13.5928   -3.2438    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.0204   -3.6563    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   13.5928   -2.4188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3073   -2.0063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8784   -2.0063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8784   -3.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1639   -3.2438    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4494   -3.6563    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7349   -3.2439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3059   -3.2439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3059   -2.4188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5914   -3.6563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0204   -4.4813    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3059   -4.8939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3059   -5.7189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5914   -4.4813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8769   -4.8939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1624   -4.4814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4479   -4.8939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7334   -4.4814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0190   -4.8939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3045   -4.4814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3073   -3.6563    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0218   -3.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0218   -2.4188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7363   -3.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4508   -3.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1653   -3.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8798   -3.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5943   -3.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3088   -3.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0233   -3.6563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  3  1  1  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  2  1  0  0  0  0\n  8  9  1  0  0  0  0\n  2 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n  2 13  1  6  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n  1 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 24 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  1  0  0  0  0\n 31 32  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCCC(=O)N[C@@H](CSSC[C@@H](C(=O)O)NC(=O)CCCCCCC)C(=O)O",
        "formula": "C22H40N2O6S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "492.6958",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "812e0e4c-3438-402e-b88d-597aa17e7381",
          "fe23ce38-976b-4852-b42d-e60693b24a82"
        ],
        "stereo_centers": 2
      },
      "unii": "BV1DW20UDP"
    }
  ]
}