{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "09feb1e7-39ff-43a2-9b65-bf6127d425c9",
          "code": "6701-13-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6701-13-9",
          "code_system": "CAS",
          "references": [
            "67cd325d-7e27-461d-98e1-ffdd5c5e95df",
            "a54a6d4a-02ea-4831-9dd5-73d39c043520"
          ]
        },
        {
          "uuid": "3eb4a8a6-a6f1-4c8d-aae2-77c7e5bfef80",
          "code": "229-745-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.027.042",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "67cd325d-7e27-461d-98e1-ffdd5c5e95df"
          ]
        },
        {
          "uuid": "484b9b84-8d2a-4791-b46b-b6a43fb11041",
          "code": "81196",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/81196",
          "code_system": "PUBCHEM",
          "references": [
            "67cd325d-7e27-461d-98e1-ffdd5c5e95df"
          ]
        },
        {
          "uuid": "f557bddf-fd0c-88f5-98f2-f89c7cbf0c7c",
          "code": "DTXSID7044972",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7044972",
          "code_system": "EPA CompTox",
          "references": [
            "3b7488d9-db67-5d7f-885c-df4d5f487075"
          ]
        },
        {
          "uuid": "86a0c00a-8b90-4a6b-99f3-319e701d47cd",
          "code": "BU9449K3UC",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "485a0529-93b3-4d0f-8c1e-e503b9733528",
          "name": "1,10-BIS(METHACRYLOYLOXY)DECANE",
          "stdName": "1,10-BIS(METHACRYLOYLOXY)DECANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92149d3d-3afe-4426-bcda-395169ee46a5",
            "330c35ae-1d3e-429c-a2f6-70137839651a"
          ],
          "display_name": false
        },
        {
          "uuid": "fb6ce4a4-5493-4bc5-a87b-5915bbc594f6",
          "name": "1,10-DECAMETHYLENE DIMETHACRYLATE",
          "stdName": "1,10-DECAMETHYLENE DIMETHACRYLATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92149d3d-3afe-4426-bcda-395169ee46a5",
            "330c35ae-1d3e-429c-a2f6-70137839651a"
          ],
          "display_name": true
        },
        {
          "uuid": "763b078e-208a-467e-bab9-29823e37482f",
          "name": "1,10-DECAMETHYLENE GLYCOL DIMETHACRYLATE",
          "stdName": "1,10-DECAMETHYLENE GLYCOL DIMETHACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92149d3d-3afe-4426-bcda-395169ee46a5",
            "330c35ae-1d3e-429c-a2f6-70137839651a"
          ],
          "display_name": false
        },
        {
          "uuid": "ad8d84a2-b6ec-477a-b400-703f444a29e1",
          "name": "1,10-DECANEDIOL DIMETHACRYLATE",
          "stdName": "1,10-DECANEDIOL DIMETHACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "37b17faf-0afd-41ca-8950-682ff80ba841",
            "330c35ae-1d3e-429c-a2f6-70137839651a"
          ],
          "display_name": false
        },
        {
          "uuid": "9bf25d57-f09e-480a-80a4-742b04619a1e",
          "name": "1,10-DECANEDIOL, DIMETHACRYLATE",
          "stdName": "1,10-DECANEDIOL, DIMETHACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92149d3d-3afe-4426-bcda-395169ee46a5",
            "330c35ae-1d3e-429c-a2f6-70137839651a"
          ],
          "display_name": false
        },
        {
          "uuid": "e19b1555-6168-4439-9155-066fcf200917",
          "name": "2-PROPENOIC ACID, 2-METHYL-, 1,1'-(1,10-DECANEDIYL) ESTER",
          "stdName": "2-PROPENOIC ACID, 2-METHYL-, 1,1'-(1,10-DECANEDIYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4878833-31b2-403f-b0f3-95585a655320",
            "330c35ae-1d3e-429c-a2f6-70137839651a"
          ],
          "display_name": false
        },
        {
          "uuid": "c7bb0f08-8d06-4919-9b0a-4e3e3cc51d7b",
          "name": "2-PROPENOIC ACID, 2-METHYL-, 1,10-DECANEDIYL ESTER",
          "stdName": "2-PROPENOIC ACID, 2-METHYL-, 1,10-DECANEDIYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92149d3d-3afe-4426-bcda-395169ee46a5",
            "330c35ae-1d3e-429c-a2f6-70137839651a"
          ],
          "display_name": false
        },
        {
          "uuid": "e1267cf6-4e16-44cf-b5ba-f62ba2b3a8d2",
          "name": "DECAMETHYLENE DIMETHACRYLATE",
          "stdName": "DECAMETHYLENE DIMETHACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92149d3d-3afe-4426-bcda-395169ee46a5",
            "330c35ae-1d3e-429c-a2f6-70137839651a"
          ],
          "display_name": false
        },
        {
          "uuid": "6573cacc-7b68-43ef-b884-d99b41c835d2",
          "name": "DECAMETHYLENE GLYCOL DIMETHACRYLATE",
          "stdName": "DECAMETHYLENE GLYCOL DIMETHACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92149d3d-3afe-4426-bcda-395169ee46a5",
            "330c35ae-1d3e-429c-a2f6-70137839651a"
          ],
          "display_name": false
        },
        {
          "uuid": "90bcc0f7-f3de-45ca-a8ae-045dd34a047f",
          "name": "DECAMETHYLENE METHACRYLATE",
          "stdName": "DECAMETHYLENE METHACRYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92149d3d-3afe-4426-bcda-395169ee46a5",
            "330c35ae-1d3e-429c-a2f6-70137839651a"
          ],
          "display_name": false
        },
        {
          "uuid": "3e8b92db-a901-4b9b-9db0-b0778ec14249",
          "name": "DMM 10",
          "stdName": "DMM 10",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92149d3d-3afe-4426-bcda-395169ee46a5",
            "330c35ae-1d3e-429c-a2f6-70137839651a"
          ],
          "display_name": false
        },
        {
          "uuid": "465fa0be-d04b-4c82-8ad8-4fefa08963e2",
          "name": "DMM-10",
          "stdName": "DMM-10",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2e0631b-09a2-42fe-aaf0-f817454e8dbd",
            "330c35ae-1d3e-429c-a2f6-70137839651a"
          ],
          "display_name": false
        },
        {
          "uuid": "6404280e-0054-41d6-9641-4daa3f7d566f",
          "name": "METHACRYLIC ACID, DECAMETHYLENE ESTER",
          "stdName": "METHACRYLIC ACID, DECAMETHYLENE ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92149d3d-3afe-4426-bcda-395169ee46a5",
            "330c35ae-1d3e-429c-a2f6-70137839651a"
          ],
          "display_name": false
        },
        {
          "uuid": "483acc62-3020-4bc5-9b0a-46473d702f5b",
          "name": "NK ESTER DOD-N",
          "stdName": "NK ESTER DOD-N",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92149d3d-3afe-4426-bcda-395169ee46a5",
            "330c35ae-1d3e-429c-a2f6-70137839651a"
          ],
          "display_name": false
        },
        {
          "uuid": "2c864110-f0a1-4199-a746-56f6b5ce07a9",
          "name": "SARBIO 5201",
          "stdName": "SARBIO 5201",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92149d3d-3afe-4426-bcda-395169ee46a5",
            "330c35ae-1d3e-429c-a2f6-70137839651a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d4878833-31b2-403f-b0f3-95585a655320",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "330c35ae-1d3e-429c-a2f6-70137839651a",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c2e0631b-09a2-42fe-aaf0-f817454e8dbd",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92149d3d-3afe-4426-bcda-395169ee46a5",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37b17faf-0afd-41ca-8950-682ff80ba841",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67cd325d-7e27-461d-98e1-ffdd5c5e95df",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391658000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "507f6182-7c49-49d8-a9fa-54b59cd74ba6",
          "citation": "SRS import [BU9449K3UC]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=BU9449K3UC",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391658000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a2766090-2680-4b74-b0ba-201448dd801a",
          "citation": "CHEMID RECORD 6701-13-9",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b7488d9-db67-5d7f-885c-df4d5f487075",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6701-13-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a54a6d4a-02ea-4831-9dd5-73d39c043520",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ae42e0f1-ee25-43b3-8c6d-1c0811e5bba1",
          "id": "ae42e0f1-ee25-43b3-8c6d-1c0811e5bba1",
          "molfile": "\n  Marvin  01132109022D          \n\n 22 21  0  0  0  0            999 V2000\n   10.7064   -1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9969   -1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2792   -1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9990   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7167    0.2062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2895    0.2062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5717   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8622    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1445   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4267    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7172   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9995    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2900   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5722    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8545   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1450    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4272   -0.2062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7177    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.2062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7198    1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0103    1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4376    1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  2  0  0  0  0\nM  END",
          "smiles": "C=C(C)C(=O)OCCCCCCCCCCOC(=O)C(=C)C",
          "formula": "C18H30O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4d15c831-3f86-41e5-9a4a-00dc40dfd7cc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "310.4291",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b4c4176c-0a1c-41ce-b2d9-6054588bf6e0",
      "version": "3",
      "structure": {
        "id": "b938d363-421b-47c7-8241-4a7cfc8ccbd5",
        "molfile": "\n  Marvin  01132109352D          \n\n 22 21  0  0  0  0            999 V2000\n    0.0000   -0.2062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7177    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4272   -0.2062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1450    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8545   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5722    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2900   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9995    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7172   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4267    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1445   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8622    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5717   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2895    0.2062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9990   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7167    0.2062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9969   -1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2792   -1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7064   -1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7198    1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4376    1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0103    1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n  2 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  1  0  0  0  0\nM  END",
        "smiles": "C=C(C)C(=O)OCCCCCCCCCCOC(=O)C(=C)C",
        "formula": "C18H30O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "310.4291",
        "optical_activity": "NONE",
        "references": [
          "507f6182-7c49-49d8-a9fa-54b59cd74ba6",
          "a2766090-2680-4b74-b0ba-201448dd801a"
        ],
        "stereo_centers": 0
      },
      "unii": "BU9449K3UC"
    }
  ]
}