{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0a11ac8d-e0e7-40ca-a99c-9d0db126a2b1",
          "code": "78617-12-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=78617-12-6",
          "code_system": "CAS",
          "references": [
            "7343d59b-7cd2-ccbf-5864-0637693d729b"
          ]
        },
        {
          "uuid": "e1305d91-3209-4ad7-a215-f63dec7eb2fe",
          "code": "128052-80-2",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=128052-80-2",
          "code_system": "CAS",
          "references": [
            "7343d59b-7cd2-ccbf-5864-0637693d729b"
          ]
        },
        {
          "uuid": "c441edc8-4ab0-40cc-888e-2fda4b82c29d",
          "code": "448173",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/448173",
          "code_system": "PUBCHEM",
          "references": [
            "670d67e0-fdef-db1a-56ab-87d56574b7ac"
          ]
        },
        {
          "uuid": "10dd884e-a060-1580-75c5-3443bd3c9019",
          "code": "DB03338",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB03338",
          "code_system": "DRUG BANK",
          "references": [
            "c82f3007-69d7-92f3-23d1-a9a484e3fe41"
          ]
        },
        {
          "uuid": "4beb933f-1ab6-4bc6-92db-2b3636b3eac4",
          "code": "BU2OC48XBR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5a89ea5d-214f-8794-0a55-c2d666d5bdfd",
          "code": "2462498",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2462498/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "0332f9d0-ed06-bed9-1dd0-c8fe8ccbc4e9"
          ]
        },
        {
          "uuid": "7fadb64e-5f72-a7c7-0eb7-67a60214c429",
          "code": "BU2OC48XBR",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=BU2OC48XBR",
          "code_system": "DAILYMED",
          "references": [
            "1826fcae-4725-c946-a564-9752f9ba99b0"
          ]
        },
        {
          "uuid": "23d739b6-7842-01a2-3675-8bb73a74f4a5",
          "code": "DTXSID70877362",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70877362",
          "code_system": "EPA CompTox",
          "references": [
            "162f1731-6fa8-0657-d81d-e97c3fd41cc3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "91add532-d968-439b-9e02-ef821ed5e4da",
          "name": ".BETA.-D-GLUCOPYRANOSIDE, HEPTYL",
          "stdName": ".BETA.-D-GLUCOPYRANOSIDE, HEPTYL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7343d59b-7cd2-ccbf-5864-0637693d729b"
          ],
          "display_name": false
        },
        {
          "uuid": "0bafe2fa-21ea-6f20-7bef-158a4490f8cf",
          "name": "1-HEPTYL .BETA.-D-GLUCOSIDE",
          "stdName": "1-HEPTYL .BETA.-D-GLUCOSIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7343d59b-7cd2-ccbf-5864-0637693d729b"
          ],
          "display_name": false
        },
        {
          "uuid": "faf2cb32-cd36-ed3e-5323-9ca695251e49",
          "name": "HEPTYL .BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "HEPTYL .BETA.-D-GLUCOPYRANOSIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7343d59b-7cd2-ccbf-5864-0637693d729b"
          ],
          "display_name": false
        },
        {
          "uuid": "0324ed14-85c0-055c-0a2c-5d34a4ec9b17",
          "name": "HEPTYL GLUCOSIDE",
          "stdName": "HEPTYL GLUCOSIDE",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7343d59b-7cd2-ccbf-5864-0637693d729b"
          ],
          "display_name": true
        },
        {
          "uuid": "cf81b075-4d88-1042-0848-225b8b2f062d",
          "name": "N-HEPTYL .BETA.-D-GLUCOPYRANOSIDE",
          "stdName": "N-HEPTYL .BETA.-D-GLUCOPYRANOSIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7343d59b-7cd2-ccbf-5864-0637693d729b"
          ],
          "display_name": false
        },
        {
          "uuid": "532989ee-4b08-dc46-0d7c-cea5437ce1ee",
          "name": "N-HEPTYL .BETA.-D-GLUCOSIDE",
          "stdName": "N-HEPTYL .BETA.-D-GLUCOSIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7343d59b-7cd2-ccbf-5864-0637693d729b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0332f9d0-ed06-bed9-1dd0-c8fe8ccbc4e9",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "670d67e0-fdef-db1a-56ab-87d56574b7ac",
          "citation": "PUBCHEM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "7343d59b-7cd2-ccbf-5864-0637693d729b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "ba0e70e3-8dd8-3be8-5c91-fe43c321f87e",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "c82f3007-69d7-92f3-23d1-a9a484e3fe41",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "1826fcae-4725-c946-a564-9752f9ba99b0",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "162f1731-6fa8-0657-d81d-e97c3fd41cc3",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7df4edd3-f0c6-c782-6f5c-c528972ab002",
          "id": "7df4edd3-f0c6-c782-6f5c-c528972ab002",
          "molfile": "\n  Marvin  12082113322D          \n\n 19 19  0  0  1  0            999 V2000\n    7.1706   -5.0646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8908   -4.6622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5994   -5.0847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3196   -4.6824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0281   -5.1049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7483   -4.7026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4569   -5.1252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1771   -4.7228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4620   -4.6420    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.4736   -3.8171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7651   -3.3945    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.7767   -2.5696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0682   -2.1470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0449   -3.7969    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.3363   -3.3743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0332   -4.6218    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.3130   -5.0241    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7417   -5.0444    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.7301   -5.8692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  9  1  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 18  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  1  0  0  0\n 11 14  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  1  6  0  0  0\n 16 14  1  0  0  0  0\n 16 17  1  1  0  0  0\n 18 16  1  0  0  0  0\n 18 19  1  6  0  0  0\nM  END",
          "smiles": "CCCCCCCO[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O",
          "formula": "C13H26O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d7b32ebe-4204-44fd-b15e-115ee2a40ba1"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "278.3425",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1ab864e9-27ac-472b-89b3-1889602a2e94",
      "version": "16",
      "structure": {
        "id": "a918b587-da98-cf03-a3f7-cf03ebac0a42",
        "molfile": "chemical1.mol\n   JSDraw212082113322D\n\n 19 19  0  0  1  0              0 V2000\n   23.1363   -9.6936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4982   -8.9329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8380   -9.7318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1998   -8.9710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5396   -9.7700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.9015   -9.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.2413   -9.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   32.6032   -9.0474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7964   -8.8945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.8184   -7.3347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4786   -6.5358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.5007   -4.9759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1609   -4.1768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1168   -7.2965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7769   -6.4976    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.0947   -8.8564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7328   -9.6171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4345   -9.6555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4124  -11.2152    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  1  1  1  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  1  0  0  0\n 12 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 14 15  1  6  0  0  0\n 16 14  1  0  0  0  0\n 16 17  1  1  0  0  0\n 18 16  1  0  0  0  0\n 18 19  1  6  0  0  0\n  9 18  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCCO[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O",
        "formula": "C13H26O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "278.3425",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "7343d59b-7cd2-ccbf-5864-0637693d729b"
        ],
        "stereo_centers": 5
      },
      "modifications": {
        "uuid": "1fa4cfea-c906-4ba5-a858-67dfd1b7fc6b"
      },
      "unii": "BU2OC48XBR"
    }
  ]
}