{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "40edfb66-2cdd-4b0e-9f9f-e14c1d37c8e7",
          "code": "645-84-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=645-84-1",
          "code_system": "CAS",
          "references": [
            "9528214d-b966-44c8-aca0-f6d50b7a59b1",
            "3b628997-70b1-4a05-a47f-88a290f4ccd7"
          ]
        },
        {
          "uuid": "730dfa4f-cca5-4b70-b6bb-cff5bad154bc",
          "code": "D010767",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68010767",
          "code_system": "MESH",
          "references": [
            "9528214d-b966-44c8-aca0-f6d50b7a59b1"
          ]
        },
        {
          "uuid": "20071742-7b9d-4ae7-b7ea-4377dd221a98",
          "code": "135437",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135437",
          "code_system": "PUBCHEM",
          "references": [
            "9528214d-b966-44c8-aca0-f6d50b7a59b1"
          ]
        },
        {
          "uuid": "f7d99ea1-9b48-f35d-b986-ea8f218120c7",
          "code": "2155",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2155",
          "code_system": "DRUG CENTRAL",
          "references": [
            "5a4a9f6d-fc7b-a3a0-e4b6-2680086c95f5"
          ]
        },
        {
          "uuid": "fb4b1251-6496-49d0-bd40-a827955af0c8",
          "code": "BRP7TI555O",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f88d8acb-cb5d-d6c5-2426-ee2cfe3ade0d",
          "code": "18132",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:18132",
          "code_system": "CHEBI",
          "references": [
            "5a4a9f6d-fc7b-a3a0-e4b6-2680086c95f5"
          ]
        },
        {
          "uuid": "c50597ae-9770-4f09-f37e-ebbd7399248f",
          "code": "DTXSID80983064",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80983064",
          "code_system": "EPA CompTox",
          "references": [
            "5a4a9f6d-fc7b-a3a0-e4b6-2680086c95f5"
          ]
        },
        {
          "uuid": "fa0e58c2-b453-ad90-7610-1709ce5fc087",
          "code": "2585444",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2585444/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "7b770621-cf58-69ef-9c05-255d0b13cfe9"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "71c8401d-70c2-451a-88a5-74753393620d",
          "name": "2-(TRIMETHYLAMMONIO)ETHYL HYDROGEN PHOSPHATE",
          "stdName": "2-(TRIMETHYLAMMONIO)ETHYL HYDROGEN PHOSPHATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eac30628-217b-446f-a33f-215e3cd36177",
            "23e7b6fb-bd69-45db-82a6-38c658ba0c59"
          ],
          "display_name": false
        },
        {
          "uuid": "f086c594-5acc-4601-ac05-6de506ab9c48",
          "name": "PHOSPHORYLCHOLINE",
          "stdName": "PHOSPHORYLCHOLINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac561f9d-763c-465a-a484-c59b4424364a"
          ],
          "display_name": true
        },
        {
          "uuid": "230f457e-13f6-759c-779b-c633ff143bae",
          "name": "Phosphorylcholine [WHO-DD]",
          "stdName": "PHOSPHORYLCHOLINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "81efba84-044d-01ae-7d2a-6b3c6f9c1c7e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ac561f9d-763c-465a-a484-c59b4424364a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "23e7b6fb-bd69-45db-82a6-38c658ba0c59",
          "citation": "http://www.chemindustry.com/chemicals/01535527.html",
          "url": "http://www.chemindustry.com/chemicals/01535527.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eac30628-217b-446f-a33f-215e3cd36177",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9528214d-b966-44c8-aca0-f6d50b7a59b1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391033000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ed775117-0e6d-4816-8267-5a3786b45277",
          "citation": "SRS import [BRP7TI555O]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=BRP7TI555O",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391033000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ade539d7-87b3-4865-a764-bce11e90f0f8",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b770621-cf58-69ef-9c05-255d0b13cfe9",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "5a4a9f6d-fc7b-a3a0-e4b6-2680086c95f5",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "3b628997-70b1-4a05-a47f-88a290f4ccd7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "81efba84-044d-01ae-7d2a-6b3c6f9c1c7e",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f7653337-78e1-ae94-74aa-ff5a5ab6637e",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a20904c5-77cf-4475-8780-98c28ca77de6",
          "id": "a20904c5-77cf-4475-8780-98c28ca77de6",
          "molfile": "\n  Marvin  01132108252D          \n\n 11 10  0  0  0  0            999 V2000\n    6.1552   -5.7733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7387   -5.0538    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    5.0193   -5.4701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3272   -4.3389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4582   -4.6421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1731   -5.0538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8879   -4.6421    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6073   -5.0538    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1910   -5.7733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3269   -5.4701    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.0190   -4.3389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  2  0  0  0  0\nM  CHG  2   2   1  10  -1\nM  END",
          "smiles": "C[N+](C)(C)CCOP(=O)(O)[O-]",
          "formula": "C5H14NO4P",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a54a0423-f591-4d70-821c-ebb8511e0a43"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "183.1429",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ccdc5544-f067-451c-ab9f-4a4054fc8f03",
      "version": "11",
      "structure": {
        "id": "e57a98c9-71dd-4b2c-bd5d-90cf092a6d1f",
        "molfile": "\n  Marvin  01132111532D          \n\n 11 10  0  0  0  0            999 V2000\n    5.7387   -5.0538    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    6.4582   -4.6421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1731   -5.0538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8879   -4.6421    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6073   -5.0538    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0190   -4.3389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3269   -5.4701    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.1910   -5.7733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1552   -5.7733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0193   -5.4701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3272   -4.3389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  1  9  1  0  0  0  0\n  1 10  1  0  0  0  0\n  1 11  1  0  0  0  0\nM  CHG  2   1   1   7  -1\nM  END",
        "smiles": "C[N+](C)(C)CCOP(=O)(O)[O-]",
        "formula": "C5H14NO4P",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "183.1429",
        "optical_activity": "NONE",
        "references": [
          "ade539d7-87b3-4865-a764-bce11e90f0f8",
          "ed775117-0e6d-4816-8267-5a3786b45277"
        ],
        "stereo_centers": 0
      },
      "unii": "BRP7TI555O"
    }
  ]
}