{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "da025090-36a7-4186-9772-d12cc725363b",
          "code": "19286-75-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=19286-75-0",
          "code_system": "CAS",
          "references": [
            "6d3e9351-812a-4f12-9b1c-e0a8cb388c25",
            "0b1d700b-ceb2-4b74-86b4-c024cb56e4ae"
          ]
        },
        {
          "uuid": "68d88a7e-764c-4432-9024-d900e38a9308",
          "code": "242-939-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.039.020",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "6d3e9351-812a-4f12-9b1c-e0a8cb388c25"
          ]
        },
        {
          "uuid": "406cb293-bd66-4edc-bd3a-b4a374849adf",
          "code": "88001",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/88001",
          "code_system": "PUBCHEM",
          "references": [
            "6d3e9351-812a-4f12-9b1c-e0a8cb388c25"
          ]
        },
        {
          "uuid": "af485d9a-eeef-7630-e8f6-84a83b0b3369",
          "code": "DTXSID3066477",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3066477",
          "code_system": "EPA CompTox",
          "references": [
            "7438d62c-50c6-a469-7963-26ff90fb6db8"
          ]
        },
        {
          "uuid": "94845d3d-a784-425f-a321-782f173effab",
          "code": "BN3Q055JL5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "540bcbb6-9762-2544-20e4-bff3c7021afd",
          "code": "118283",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=118283",
          "code_system": "NSC",
          "references": [
            "891a60f2-7573-4d99-2bf7-7b52059b0541"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a76201a7-931c-eee0-6c16-7b764f7828da",
          "name": "1-(PHENYLAMINO)-4-HYDROXYANTHRAQUINONE",
          "stdName": "1-(PHENYLAMINO)-4-HYDROXYANTHRAQUINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": false
        },
        {
          "uuid": "39d1e6e2-b2ad-8c3a-640b-41c73bfa9c74",
          "name": "1-ANILINO-4-HYDROXYANTHRAQUINONE",
          "stdName": "1-ANILINO-4-HYDROXYANTHRAQUINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": false
        },
        {
          "uuid": "5461ec84-f161-c38e-a723-e7e708988d58",
          "name": "1-HYDROXY-4-(PHENYLAMINO)-9,10-ANTHRACENEDIONE",
          "stdName": "1-HYDROXY-4-(PHENYLAMINO)-9,10-ANTHRACENEDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": false
        },
        {
          "uuid": "5a415735-417c-cf19-3a62-888a71ae8595",
          "name": "1-HYDROXY-4-(PHENYLAMINO)ANTHRAQUINONE",
          "stdName": "1-HYDROXY-4-(PHENYLAMINO)ANTHRAQUINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": false
        },
        {
          "uuid": "9c9d5d63-865d-acaf-5138-6de109afc6c5",
          "name": "1-HYDROXY-4-ANILINOANTHRAQUINONE",
          "stdName": "1-HYDROXY-4-ANILINOANTHRAQUINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": true
        },
        {
          "uuid": "99b2ef3f-8196-7fd8-3583-310daad69485",
          "name": "9,10-ANTHRACENEDIONE, 1-HYDROXY-4-(PHENYLAMINO)-",
          "stdName": "9,10-ANTHRACENEDIONE, 1-HYDROXY-4-(PHENYLAMINO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": false
        },
        {
          "uuid": "87dd94a6-d416-7d91-c59d-70d756fb48bf",
          "name": "ANTHRAQUINONE, 1-ANILINO-4-HYDROXY-",
          "stdName": "ANTHRAQUINONE, 1-ANILINO-4-HYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": false
        },
        {
          "uuid": "903401ae-41df-1bc4-628c-4075b00caef2",
          "name": "C.I. 60724",
          "stdName": "C.I. 60724",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": false
        },
        {
          "uuid": "3748a4c9-2595-14ee-7698-b29ea42ef9a3",
          "name": "C.I. DISPERSE VIOLET 103",
          "stdName": "C.I. DISPERSE VIOLET 103",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": false
        },
        {
          "uuid": "4d9a13df-4a56-7495-f0f7-13ea0ead99c9",
          "name": "C.I. DISPERSE VIOLET 23",
          "stdName": "C.I. DISPERSE VIOLET 23",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": false
        },
        {
          "uuid": "ad950cda-c62d-329a-5a0b-d60d92f1e5c0",
          "name": "C.I. DISPERSE VIOLET 27",
          "stdName": "C.I. DISPERSE VIOLET 27",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": false
        },
        {
          "uuid": "be9e41db-3d6a-fab6-6cc0-8e1abef33963",
          "name": "C.I. DISPERSE VIOLET 30",
          "stdName": "C.I. DISPERSE VIOLET 30",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": false
        },
        {
          "uuid": "9a8411aa-1755-013c-714f-d585f6a54f1f",
          "name": "C.I. DISPERSE VIOLET 37",
          "stdName": "C.I. DISPERSE VIOLET 37",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": false
        },
        {
          "uuid": "3bafafbd-a7d2-4751-940f-099c3010e7f2",
          "name": "CI 60724",
          "stdName": "CI 60724",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "a7bd740a-35de-4504-abe3-6c99bd57267f"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "7438ff7f-31f6-4e95-803e-69119bdf109e",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "50336903-d905-2552-689a-ef4918afb495",
          "name": "DISPERSE VIOLET 103",
          "stdName": "DISPERSE VIOLET 103",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": false
        },
        {
          "uuid": "35a0bf50-a938-bb11-b789-3a5ae09cefa2",
          "name": "DISPERSE VIOLET 27",
          "stdName": "DISPERSE VIOLET 27",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": false
        },
        {
          "uuid": "f1953950-fd14-41f5-cb9d-eb281cfa2952",
          "name": "DISPERSE VIOLET 37",
          "stdName": "DISPERSE VIOLET 37",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": false
        },
        {
          "uuid": "1607a854-e234-937a-777d-8c48a9dc786a",
          "name": "FORON BRILLIANT VIOLET E-BL",
          "stdName": "FORON BRILLIANT VIOLET E-BL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": false
        },
        {
          "uuid": "bf1fa9e8-37b8-5af0-3911-0c3cd4179bd0",
          "name": "FORON BRILLIANT VIOLET E-BLN",
          "stdName": "FORON BRILLIANT VIOLET E-BLN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": false
        },
        {
          "uuid": "ba3a616f-e207-6188-ce17-694ace25023c",
          "name": "LATYL VIOLET BN",
          "stdName": "LATYL VIOLET BN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": false
        },
        {
          "uuid": "ed12f410-2925-c3fe-c350-1d32c85a1d50",
          "name": "MIKETON POLYESTER VIOLET BN",
          "stdName": "MIKETON POLYESTER VIOLET BN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": false
        },
        {
          "uuid": "117c6c39-7b77-44b5-bb9d-e22b064f524a",
          "name": "NSC-118283",
          "stdName": "NSC-118283",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22937ab6-1f31-4382-8434-414dce133549"
          ],
          "display_name": false
        },
        {
          "uuid": "84c00541-27e1-a4d1-d9c8-c088e0f6c74e",
          "name": "SUMIKARON VIOLET E-RL",
          "stdName": "SUMIKARON VIOLET E-RL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": false
        },
        {
          "uuid": "e0963549-52b9-d2b2-4bfc-5782f67450e4",
          "name": "SUMIKARON VIOLET R",
          "stdName": "SUMIKARON VIOLET R",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": false
        },
        {
          "uuid": "bb857ed0-29a7-3cb2-c4f8-9759db85ec43",
          "name": "SUMIKARON VIOLET RL",
          "stdName": "SUMIKARON VIOLET RL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cf7e780-6955-378f-dca8-f51a18baa24e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a7bd740a-35de-4504-abe3-6c99bd57267f",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22937ab6-1f31-4382-8434-414dce133549",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d3e9351-812a-4f12-9b1c-e0a8cb388c25",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392265000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7438d62c-50c6-a469-7963-26ff90fb6db8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=19286-75-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8cf7e780-6955-378f-dca8-f51a18baa24e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ef703753-441c-10eb-4d1b-477b87da9e8d",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "0b1d700b-ceb2-4b74-86b4-c024cb56e4ae",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "891a60f2-7573-4d99-2bf7-7b52059b0541",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9e5bc7e7-3e64-4a05-b8f1-797bf00353eb",
          "id": "9e5bc7e7-3e64-4a05-b8f1-797bf00353eb",
          "molfile": "\n  Marvin  01132108142D          \n\n 24 27  0  0  0  0            999 V2000\n    4.6448   -4.1197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9322   -3.7073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2144   -4.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5018   -3.7073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4858   -2.8876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6661   -2.8983    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2429   -2.1911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4179   -2.1965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4018   -0.7714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2268   -0.7607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6501   -1.4733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2144   -2.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2144   -1.6447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5018   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9322   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9322   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6448    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3573   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3573   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6448   -1.6447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6448   -2.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3573   -2.8822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9322   -2.8822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 24  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 13  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 12  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 24  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 14  1  0  0  0  0\n 16 17  1  0  0  0  0\n 21 16  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  2  0  0  0  0\n 24 22  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)Nc2ccc(c3c2C(=O)c4ccccc4C3=O)O",
          "formula": "C20H13NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f50ea397-6d9b-4c3d-a3f8-d6f6f16dabe2"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "315.3229",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d99edfc7-bbaa-4bdc-8210-aee99f79bbb0",
      "version": "9",
      "structure": {
        "id": "591210bf-0b93-435e-a736-9410b59a5974",
        "molfile": "\n  Marvin  01132104372D          \n\n 24 27  0  0  0  0            999 V2000\n    1.6661   -2.8983    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4858   -2.8876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2144   -2.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9322   -2.8822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9322   -3.7073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2144   -4.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5018   -3.7073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6448   -4.1197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6448   -2.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6448   -1.6447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9322   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9322   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6448    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3573   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3573   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2144   -1.6447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3573   -2.8822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2429   -2.1911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4179   -2.1965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4018   -0.7714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2268   -0.7607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6501   -1.4733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5018   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 18  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  7  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 16  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  9  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  8  1  0  0  0  0\n  6  7  2  0  0  0  0\n  9 10  1  0  0  0  0\n  9 17  2  0  0  0  0\n 10 11  2  0  0  0  0\n 10 15  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 16  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 24  2  0  0  0  0\n 18 19  2  0  0  0  0\n 18 23  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)Nc2ccc(c3c2C(=O)c4ccccc4C3=O)O",
        "formula": "C20H13NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "315.3229",
        "optical_activity": "NONE",
        "references": [
          "8cf7e780-6955-378f-dca8-f51a18baa24e",
          "a7bd740a-35de-4504-abe3-6c99bd57267f"
        ],
        "stereo_centers": 0
      },
      "unii": "BN3Q055JL5"
    }
  ]
}