{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0472a748-4759-4adf-a42e-f56e46321243",
          "code": "33703-08-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=33703-08-1",
          "code_system": "CAS",
          "references": [
            "6c5a58e7-c1f1-49e4-8586-7894b9b9d613",
            "7d6d3495-ad98-49ca-8b85-293f27cc6bbb"
          ]
        },
        {
          "uuid": "e15a216f-851f-49ff-97c9-994e874f0dce",
          "code": "C050775",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67050775",
          "code_system": "MESH",
          "references": [
            "6c5a58e7-c1f1-49e4-8586-7894b9b9d613"
          ]
        },
        {
          "uuid": "0e52702f-0704-4a99-9697-3274adaaa068",
          "code": "251-646-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.046.937",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "6c5a58e7-c1f1-49e4-8586-7894b9b9d613"
          ]
        },
        {
          "uuid": "565b583a-4b7e-4856-ab9d-7c3b43ea6418",
          "code": "6427097",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6427097",
          "code_system": "PUBCHEM",
          "references": [
            "6c5a58e7-c1f1-49e4-8586-7894b9b9d613"
          ]
        },
        {
          "uuid": "3b872e60-0b45-05c2-9017-59c0db0ef4fa",
          "code": "DTXSID5027982",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5027982",
          "code_system": "EPA CompTox",
          "references": [
            "8902ad7d-2625-ea91-8639-305d7d31f990"
          ]
        },
        {
          "uuid": "3e5f7800-d182-489d-b6c0-5a853b8a6217",
          "code": "BMQ5JF4857",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "589fdad6-9125-8793-d628-be3c232a961b",
          "code": "2533838",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2533838/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "0b46c224-2aa4-dda4-feca-4df3481ce7e7"
          ]
        },
        {
          "uuid": "48b928c6-f376-3095-5e37-63d8ef50594c",
          "code": "300000018743",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "be2a9334-70f1-a44c-8feb-91a2311f11d3"
          ]
        },
        {
          "uuid": "d29ff1c7-78ce-8246-8b5b-a09abb415117",
          "code": "BMQ5JF4857",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=BMQ5JF4857",
          "code_system": "DAILYMED",
          "references": [
            "7c0468f0-dfe3-1313-8128-6a2a2660e381"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "26ca47df-5709-4aa6-83ce-55b34eb2e1c7",
          "name": "ADIPIC ACID, DIISONONYL ESTER",
          "stdName": "ADIPIC ACID, DIISONONYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "645923f8-3360-43a8-b3d6-925da2fe7206",
            "cdedb5ad-d2ab-4fa0-b661-3bdfb7138a85"
          ],
          "display_name": false
        },
        {
          "uuid": "22891fbb-c616-4d12-bc38-2f616a7c283d",
          "name": "DIISONONYL ADIPATE",
          "stdName": "DIISONONYL ADIPATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7be4fba5-83a3-45f6-b1da-1371a32b55dd",
            "0c91e965-11f6-4782-917e-89d1d6608629",
            "645923f8-3360-43a8-b3d6-925da2fe7206",
            "f88624f1-14f0-4a3b-a691-5806bb46fcf0"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "1813241a-88c4-4cea-8eca-882717e90e4b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "61243648-1ace-48d2-ba13-a2ae1b6ac12e",
          "name": "DIISONONYL HEXANEDIOATE",
          "stdName": "DIISONONYL HEXANEDIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "645923f8-3360-43a8-b3d6-925da2fe7206",
            "f88624f1-14f0-4a3b-a691-5806bb46fcf0"
          ],
          "display_name": false
        },
        {
          "uuid": "358aa9ae-7323-4e4d-b4c4-8d108326eb92",
          "name": "HEXANEDIOIC ACID, 1,6-DIISONONYL ESTER",
          "stdName": "HEXANEDIOIC ACID, 1,6-DIISONONYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "645923f8-3360-43a8-b3d6-925da2fe7206",
            "cdedb5ad-d2ab-4fa0-b661-3bdfb7138a85"
          ],
          "display_name": false
        },
        {
          "uuid": "0c1f34c0-b0d1-4b17-8b90-0e80271de8c9",
          "name": "HEXANEDIOIC ACID, DIISONONYL ESTER",
          "stdName": "HEXANEDIOIC ACID, DIISONONYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "645923f8-3360-43a8-b3d6-925da2fe7206",
            "f88624f1-14f0-4a3b-a691-5806bb46fcf0"
          ],
          "display_name": false
        },
        {
          "uuid": "5fc7703f-7ed0-4736-b844-c4103affc732",
          "name": "ISONONYL ALCOHOL, ADIPATE",
          "stdName": "ISONONYL ALCOHOL, ADIPATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "645923f8-3360-43a8-b3d6-925da2fe7206",
            "cdedb5ad-d2ab-4fa0-b661-3bdfb7138a85"
          ],
          "display_name": false
        },
        {
          "uuid": "b59e1c28-3ef7-4438-aa2a-2cb9e7dcd7a1",
          "name": "JAYFLEX DINA 2",
          "stdName": "JAYFLEX DINA 2",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "645923f8-3360-43a8-b3d6-925da2fe7206",
            "cdedb5ad-d2ab-4fa0-b661-3bdfb7138a85"
          ],
          "display_name": false
        },
        {
          "uuid": "2b0c2462-1a89-45fc-be8d-5e27d9e5f539",
          "name": "MONOCIZER W 242",
          "stdName": "MONOCIZER W 242",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "645923f8-3360-43a8-b3d6-925da2fe7206",
            "cdedb5ad-d2ab-4fa0-b661-3bdfb7138a85"
          ],
          "display_name": false
        },
        {
          "uuid": "63aca6b7-44df-4ec0-b73b-cfeb05c36638",
          "name": "PLASTOMOLL DNA",
          "stdName": "PLASTOMOLL DNA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "645923f8-3360-43a8-b3d6-925da2fe7206",
            "cdedb5ad-d2ab-4fa0-b661-3bdfb7138a85"
          ],
          "display_name": false
        },
        {
          "uuid": "3fa0042a-38db-48ef-8534-382be3a1f82d",
          "name": "POLYCIZER W 242",
          "stdName": "POLYCIZER W 242",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "645923f8-3360-43a8-b3d6-925da2fe7206",
            "cdedb5ad-d2ab-4fa0-b661-3bdfb7138a85"
          ],
          "display_name": false
        },
        {
          "uuid": "c8afd62f-db7d-42fb-97f7-003f10819930",
          "name": "SANSOCIZER DINA",
          "stdName": "SANSOCIZER DINA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "645923f8-3360-43a8-b3d6-925da2fe7206",
            "cdedb5ad-d2ab-4fa0-b661-3bdfb7138a85"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7be4fba5-83a3-45f6-b1da-1371a32b55dd",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f88624f1-14f0-4a3b-a691-5806bb46fcf0",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "645923f8-3360-43a8-b3d6-925da2fe7206",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cdedb5ad-d2ab-4fa0-b661-3bdfb7138a85",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c5a58e7-c1f1-49e4-8586-7894b9b9d613",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390895000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "70d1d64f-c8af-4564-a706-f8c97b38750b",
          "citation": "SRS import [BMQ5JF4857]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=BMQ5JF4857",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390895000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37d05047-5f85-4fe6-937b-64280b65594b",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c91e965-11f6-4782-917e-89d1d6608629",
          "citation": "DIISONONYL ADIPATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8902ad7d-2625-ea91-8639-305d7d31f990",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=33703-08-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7d6d3495-ad98-49ca-8b85-293f27cc6bbb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0b46c224-2aa4-dda4-feca-4df3481ce7e7",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "7c0468f0-dfe3-1313-8128-6a2a2660e381",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "be2a9334-70f1-a44c-8feb-91a2311f11d3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "22a97643-6c13-47d4-8e21-e58c316fb885",
          "id": "22a97643-6c13-47d4-8e21-e58c316fb885",
          "molfile": "\n  Marvin  01132101572D          \n\n 28 27  0  0  0  0            999 V2000\n   14.9145   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2000   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2000   -5.9530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4855   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7711   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0566   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3421   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6276   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9132   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1987   -4.7155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4843   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4843   -5.9530    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7698   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0553   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3409   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6264   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9119   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9119   -3.8904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1975   -5.1280    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4830   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7684   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0541   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3396   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6251   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0893   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8039   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5183   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8039   -3.8904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 26 28  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CCCCCCOC(=O)CCCCC(=O)OCCCCCCC(C)C",
          "formula": "C24H46O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "47bf32d9-82de-47c4-9b86-3ba7cf582f08"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "398.6206",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "REPRESENTATIVE",
      "uuid": "9e493806-6db3-4477-9371-b9c29897afac",
      "version": "7",
      "structure": {
        "id": "ca833cb8-d803-4400-9927-e79eaab2fac8",
        "molfile": "\n  Marvin  01132110272D          \n\n 28 27  0  0  0  0            999 V2000\n    7.7698   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4843   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1987   -4.7155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9132   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6276   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3421   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0566   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7711   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4855   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2000   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9145   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2000   -5.9530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4843   -5.9530    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0553   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3409   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6264   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9119   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1975   -5.1280    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4830   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7684   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0541   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3396   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6251   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0893   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8039   -4.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5183   -5.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8039   -3.8904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9119   -3.8904    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n  2 13  2  0  0  0  0\n  1 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 17 28  2  0  0  0  0\nM  END",
        "smiles": "CC(C)CCCCCCOC(=O)CCCCC(=O)OCCCCCCC(C)C",
        "formula": "C24H46O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "398.6206",
        "optical_activity": "NONE",
        "references": [
          "70d1d64f-c8af-4564-a706-f8c97b38750b",
          "37d05047-5f85-4fe6-937b-64280b65594b"
        ],
        "stereo_centers": 0
      },
      "unii": "BMQ5JF4857"
    }
  ]
}