{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9b8b5d51-bfe1-424d-8729-8180bd996155",
          "code": "2478-20-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2478-20-8",
          "code_system": "CAS",
          "references": [
            "4fe42fd0-c710-4963-8ce2-09e4169dc81e",
            "bff210f9-8d18-48d1-9d4f-d9b1f435032d"
          ]
        },
        {
          "uuid": "4873a3e1-cdbf-4003-9c54-8e6d7a2695ba",
          "code": "219-607-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.017.826",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4fe42fd0-c710-4963-8ce2-09e4169dc81e"
          ]
        },
        {
          "uuid": "0174c7e3-f18f-46b7-9204-90100e35be16",
          "code": "75589",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/75589",
          "code_system": "PUBCHEM",
          "references": [
            "4fe42fd0-c710-4963-8ce2-09e4169dc81e"
          ]
        },
        {
          "uuid": "964e57ab-3c68-fe46-ba1c-b80152c3eab6",
          "code": "DTXSID7062453",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7062453",
          "code_system": "EPA CompTox",
          "references": [
            "3aff65d1-080b-115d-059d-6553e99e5ac7"
          ]
        },
        {
          "uuid": "cbe61a8a-3934-4730-a0e6-06f4946c57f5",
          "code": "BM6Y3B8SJY",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a2dfbfb6-0aca-4a78-bf58-65720011875a",
          "name": "1H-BENZ(DE)ISOQUINOLINE-1,3(2H)-DIONE, 6-AMINO-2-(2,4-DIMETHYLPHENYL)-",
          "stdName": "1H-BENZ(DE)ISOQUINOLINE-1,3(2H)-DIONE, 6-AMINO-2-(2,4-DIMETHYLPHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "878c1975-b90d-4e9a-a698-86b8fb67ab6a"
          ],
          "display_name": false
        },
        {
          "uuid": "16cd0d2c-3a32-6602-8b46-07a7f86da68f",
          "name": "4-AMINO-1,8-NAPHTHAL-2',4'-DIMETHYLPHENYLIMIDE",
          "stdName": "4-AMINO-1,8-NAPHTHAL-2',4'-DIMETHYLPHENYLIMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b5c86b4-c178-b5da-5c36-47d8d183502b"
          ],
          "display_name": false
        },
        {
          "uuid": "c46a9437-d078-a9a5-fab5-45599217b8d4",
          "name": "C.I. 56200",
          "stdName": "C.I. 56200",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b5c86b4-c178-b5da-5c36-47d8d183502b"
          ],
          "display_name": false
        },
        {
          "uuid": "90afbe27-6300-4e4d-e5a2-7a9ae1a10a33",
          "name": "C.I. DISPERSE YELLOW 11",
          "stdName": "C.I. DISPERSE YELLOW 11",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b5c86b4-c178-b5da-5c36-47d8d183502b"
          ],
          "display_name": false
        },
        {
          "uuid": "96874ddb-41a0-dfac-2c06-14334ff1d686",
          "name": "C.I. SOLVENT YELLOW 44",
          "stdName": "C.I. SOLVENT YELLOW 44",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b5c86b4-c178-b5da-5c36-47d8d183502b"
          ],
          "display_name": false
        },
        {
          "uuid": "ec80f830-cd7a-63bb-a16d-ab0d200938cf",
          "name": "CI 56200",
          "stdName": "CI 56200",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b5c86b4-c178-b5da-5c36-47d8d183502b"
          ],
          "display_name": false
        },
        {
          "uuid": "902119f2-3007-6161-fd49-76a90856ef0c",
          "name": "DISPERSE YELLOW 11",
          "stdName": "DISPERSE YELLOW 11",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b5c86b4-c178-b5da-5c36-47d8d183502b"
          ],
          "display_name": false
        },
        {
          "uuid": "ee1abdd3-4f7a-3ccb-0e8f-9e1f4e8b2c82",
          "name": "NAPHTHALIMIDE, 4-AMINO-N-2,4-XYLYL-",
          "stdName": "NAPHTHALIMIDE, 4-AMINO-N-2,4-XYLYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b5c86b4-c178-b5da-5c36-47d8d183502b"
          ],
          "display_name": false
        },
        {
          "uuid": "27ac7e82-d953-a793-4c2d-e9126a849ca9",
          "name": "SOLVENT YELLOW 44",
          "stdName": "SOLVENT YELLOW 44",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b07b4158-d15e-f1bd-5082-9f2e0bcbed3f"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4d98303e-1155-498f-97b5-6678db52d958",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "878c1975-b90d-4e9a-a698-86b8fb67ab6a",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4fe42fd0-c710-4963-8ce2-09e4169dc81e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392792000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3aff65d1-080b-115d-059d-6553e99e5ac7",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2478-20-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3b5c86b4-c178-b5da-5c36-47d8d183502b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b07b4158-d15e-f1bd-5082-9f2e0bcbed3f",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bff210f9-8d18-48d1-9d4f-d9b1f435032d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c587994d-be79-4645-b198-7d4532cd758d",
          "id": "c587994d-be79-4645-b198-7d4532cd758d",
          "molfile": "\n  Marvin  01132110132D          \n\n 24 27  0  0  0  0            999 V2000\n    1.4282   -7.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4282   -6.1749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7141   -5.7689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7141   -4.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4282   -4.5297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4282   -3.7036    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7141   -3.2975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.7036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7141   -2.4714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.0583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7141   -0.8261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4282   -1.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1423   -0.8261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1423    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8564   -1.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8564   -2.0583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1423   -2.4714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1423   -3.2975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8564   -3.7036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4282   -2.0583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1423   -4.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8564   -4.5297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1423   -5.7689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n 24  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n 22  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n 19  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 21  2  0  0  0  0\n 11 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 21  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 14  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 18 21  1  0  0  0  0\n 19 20  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 22  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccc(c(C)c1)N2C(=O)c3cccc4c(ccc(c43)C2=O)N",
          "formula": "C20H16N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a059458a-cf76-44b2-8c4c-115f2e3d245f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "316.354",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "01659973-c2fc-4d82-9620-604d8063d4d7",
      "version": "6",
      "structure": {
        "id": "8ffc2e3f-a397-4eed-83ef-7585fb65e582",
        "molfile": "\n  Marvin  01132107282D          \n\n 24 27  0  0  0  0            999 V2000\n    1.4282   -7.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8564   -4.5297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7141   -0.8261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.0583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7141   -5.7689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8564   -2.0583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8564   -1.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7141   -4.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1423   -5.7689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4282   -6.1749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1423   -4.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4282   -1.2322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7141   -2.4714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1423   -2.4714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1423   -0.8261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4282   -4.5297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4282   -2.0583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7141   -3.2975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1423   -3.2975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1423    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4282   -3.7036    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.7036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8564   -3.7036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1 11  1  0  0  0  0\n  2 12  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  4 13  1  0  0  0  0\n  5 14  2  0  0  0  0\n  6  9  2  0  0  0  0\n  6 11  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7 15  1  0  0  0  0\n  8 16  1  0  0  0  0\n  9 17  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 17  2  0  0  0  0\n 13 16  2  0  0  0  0\n 13 18  1  0  0  0  0\n 14 18  1  0  0  0  0\n 14 19  1  0  0  0  0\n 15 18  2  0  0  0  0\n 15 20  1  0  0  0  0\n 16 21  1  0  0  0  0\n 17 22  1  0  0  0  0\n 19 22  1  0  0  0  0\n 19 23  2  0  0  0  0\n 20 22  1  0  0  0  0\n 20 24  2  0  0  0  0\nM  END",
        "smiles": "Cc1ccc(c(C)c1)N2C(=O)c3cccc4c(ccc(c43)C2=O)N",
        "formula": "C20H16N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "316.354",
        "optical_activity": "NONE",
        "references": [
          "878c1975-b90d-4e9a-a698-86b8fb67ab6a",
          "3b5c86b4-c178-b5da-5c36-47d8d183502b"
        ],
        "stereo_centers": 0
      },
      "unii": "BM6Y3B8SJY"
    }
  ]
}