{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f95b6551-3f2b-4f38-a126-e85e6dfa748e",
          "code": "528-50-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=528-50-7",
          "code_system": "CAS",
          "references": [
            "27eb6666-0a7c-456d-81f2-20b7c45ae443",
            "5793810c-fd4c-4716-b3fb-947cb3177d50"
          ]
        },
        {
          "uuid": "a46d80b7-e49a-4a5f-8aa6-0502317a6f83",
          "code": "208-436-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.670",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "27eb6666-0a7c-456d-81f2-20b7c45ae443"
          ]
        },
        {
          "uuid": "444fc777-da9f-408b-8560-0d6fab72ef51",
          "code": "m3233",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3233?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "27eb6666-0a7c-456d-81f2-20b7c45ae443"
          ]
        },
        {
          "uuid": "60e315fd-9f4b-4ffb-9243-1d7835200901",
          "code": "20056755",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/20056755",
          "code_system": "PUBCHEM",
          "references": [
            "27eb6666-0a7c-456d-81f2-20b7c45ae443"
          ]
        },
        {
          "uuid": "9b450f93-7b60-a024-5beb-2f96d136234f",
          "code": "Cellobiose",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Cellobiose",
          "code_system": "WIKIPEDIA",
          "references": [
            "1573006e-3938-0064-5343-c82634977f7d"
          ]
        },
        {
          "uuid": "fa0ded2c-f0b8-772c-30ed-51955fec27fa",
          "code": "DB02061",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB02061",
          "code_system": "DRUG BANK",
          "references": [
            "5cb875a9-53ab-9d30-bf3a-05f228b53a58"
          ]
        },
        {
          "uuid": "121d3f43-0e08-4bce-8a7d-a51fb118e3e8",
          "code": "BM3MOX055H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fc323840-080f-f5ce-c788-a73a794e2806",
          "code": "36217",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:36217",
          "code_system": "CHEBI",
          "references": [
            "5cb875a9-53ab-9d30-bf3a-05f228b53a58"
          ]
        },
        {
          "uuid": "947057cb-8f25-1305-0cac-80f9fdbab86a",
          "code": "17057",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17057",
          "code_system": "CHEBI",
          "references": [
            "5cb875a9-53ab-9d30-bf3a-05f228b53a58"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "43987ea5-c57a-4556-a1d2-72f7e41160ac",
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "c419b2e2-64ad-47dd-a976-4cafe2d7e945",
            "refuuid": "a0095134-a258-7ad4-5615-dfdcb3c172fb",
            "name": "ALTERNATIVE DEFINITION for [CELLOBIOSE]",
            "linking_id": "a0095134-a258-7ad4-5615-dfdcb3c172fb",
            "ref_pname": "NO NAME"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "89fb88ad-dd2c-4262-8e47-a793cd47b59a",
          "name": "4-.BETA.-D-GLUCOPYRANOSYL-D-GLUCOPYRANOSE",
          "stdName": "4-.BETA.-D-GLUCOPYRANOSYL-D-GLUCOPYRANOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca910b21-baae-47a6-b215-90f686acccb4",
            "93366e0a-e571-41fe-a97b-d9f0ac11f417"
          ],
          "display_name": false
        },
        {
          "uuid": "420ac454-5e97-4d6f-8ffc-f98b5bcd4840",
          "name": "4-O-.BETA.-D-GLUCOPYRANOSYL-D-GLUCOSE",
          "stdName": "4-O-.BETA.-D-GLUCOPYRANOSYL-D-GLUCOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca910b21-baae-47a6-b215-90f686acccb4",
            "93366e0a-e571-41fe-a97b-d9f0ac11f417"
          ],
          "display_name": false
        },
        {
          "uuid": "a23a889a-015c-4687-972b-1d75126c6c74",
          "name": "CELLOBIOSE",
          "stdName": "CELLOBIOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93366e0a-e571-41fe-a97b-d9f0ac11f417",
            "034353b7-d2c4-4c18-ada0-74401f2a44ff",
            "587c9c4f-ec41-46aa-bb8d-8d084f5c2bed"
          ],
          "display_name": true
        },
        {
          "uuid": "984c90f8-567e-4d5f-9484-7b4f20b3134f",
          "name": "CELLOBIOSE [MI]",
          "stdName": "CELLOBIOSE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93366e0a-e571-41fe-a97b-d9f0ac11f417",
            "034353b7-d2c4-4c18-ada0-74401f2a44ff"
          ],
          "display_name": false
        },
        {
          "uuid": "3028d574-c46a-44f2-aed5-8fe56946faf4",
          "name": "CELLOSE",
          "stdName": "CELLOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca910b21-baae-47a6-b215-90f686acccb4",
            "93366e0a-e571-41fe-a97b-d9f0ac11f417"
          ],
          "display_name": false
        },
        {
          "uuid": "92b19911-9811-4e25-8ff4-8649126b31d3",
          "name": "D-(+)-CELLOBIOSE",
          "stdName": "D-(+)-CELLOBIOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca910b21-baae-47a6-b215-90f686acccb4",
            "93366e0a-e571-41fe-a97b-d9f0ac11f417"
          ],
          "display_name": false
        },
        {
          "uuid": "fb1bad87-f166-4b18-a776-9737cab36f64",
          "name": "D-CELLOBIOSE",
          "stdName": "D-CELLOBIOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca910b21-baae-47a6-b215-90f686acccb4",
            "93366e0a-e571-41fe-a97b-d9f0ac11f417"
          ],
          "display_name": false
        },
        {
          "uuid": "7ef6d0fb-4952-4ae3-a966-3ca9c753f3a2",
          "name": "D-GLUCOSE, 4-O-.BETA.-D-GLUCOPYRANOSYL-",
          "stdName": "D-GLUCOSE, 4-O-.BETA.-D-GLUCOPYRANOSYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca910b21-baae-47a6-b215-90f686acccb4",
            "93366e0a-e571-41fe-a97b-d9f0ac11f417"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "034353b7-d2c4-4c18-ada0-74401f2a44ff",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "93366e0a-e571-41fe-a97b-d9f0ac11f417",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca910b21-baae-47a6-b215-90f686acccb4",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27eb6666-0a7c-456d-81f2-20b7c45ae443",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392689000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26dd3163-6174-4776-af84-d3282914f1cf",
          "citation": "SRS import [BM3MOX055H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=BM3MOX055H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392689000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "587c9c4f-ec41-46aa-bb8d-8d084f5c2bed",
          "citation": "CELLOBIOSE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1573006e-3938-0064-5343-c82634977f7d",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Cellobiose",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b4199b96-795a-39d3-e4a8-3a687812b8f8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=528-50-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5cb875a9-53ab-9d30-bf3a-05f228b53a58",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "5793810c-fd4c-4716-b3fb-947cb3177d50",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "71857240-ea76-4293-868a-6fe3a96be76d",
          "id": "71857240-ea76-4293-868a-6fe3a96be76d",
          "molfile": "\n  Marvin  01132105532D          \n\n 23 23  0  0  1  0            999 V2000\n   15.9744   -6.5792    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   16.6889   -6.1667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2599   -6.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5455   -6.5792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9744   -7.4042    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   15.2599   -7.8167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2599   -8.6417    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   15.9744   -9.0542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9744   -9.8792    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   16.6889  -10.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4034   -9.8792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2599  -10.2917    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   15.2599  -11.1167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5455   -9.8792    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   13.8310  -10.2917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5455   -9.0542    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   13.8310   -8.6417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6889   -7.8167    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   16.6889   -8.6417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4034   -7.4042    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   17.4034   -6.5792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1178   -7.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.8323   -7.4042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5 18  1  0  0  0  0\n  7  6  1  6  0  0  0\n  7  8  1  0  0  0  0\n 16  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  6  0  0  0\n  9 12  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 13  1  1  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  6  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  1  0  0  0\n 18 19  1  1  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  1  0  0  0\n 20 22  1  0  0  0  0\n 22 23  2  0  0  0  0\nM  END",
          "smiles": "C(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O",
          "formula": "C12H22O11",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "254ac805-b3d8-4621-beec-2d9627829349"
          },
          "defined_stereo": 9,
          "ez_centers": 0,
          "molecular_weight": "342.297",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 9
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5f4ccafb-f37f-4429-a402-b91a4a55b068",
      "version": "16",
      "structure": {
        "id": "157d6f5e-3a58-4d57-a7fd-a571fba72373",
        "molfile": "\n  Marvin  01132101192D          \n\n 24 24  0  0  1  0            999 V2000\n   15.2599   -7.8167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2599   -8.6417    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.5455   -9.0542    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.8310   -8.6417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5455   -9.8792    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   13.8310  -10.2917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2599  -10.2917    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   15.2599  -11.1167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9744   -9.8792    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   16.6889  -10.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4034   -9.8792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9744   -9.0542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9744   -7.4042    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   15.2599   -6.9917    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9744   -6.5792    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   16.6889   -6.1667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2599   -6.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5455   -6.5792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6889   -7.8167    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   16.6889   -8.6417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4034   -7.4042    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   17.4034   -6.5792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1178   -7.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.8323   -7.4042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  6  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  1  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  1  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  6  0  0  0\n 10 11  1  0  0  0  0\n 12  9  1  0  0  0  0\n  2 12  1  0  0  0  0\n  1 13  1  0  0  0  0\n 13 14  1  1  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  1  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 13 19  1  0  0  0  0\n 19 20  1  1  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  1  0  0  0\n 21 23  1  0  0  0  0\n 23 24  2  0  0  0  0\nM  END",
        "smiles": "C(=O)[C@@H]([C@H]([C@@]([H])([C@@H](CO)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O)O)O",
        "formula": "C12H22O11",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 9,
        "ez_centers": 0,
        "molecular_weight": "342.297",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "ca910b21-baae-47a6-b215-90f686acccb4",
          "26dd3163-6174-4776-af84-d3282914f1cf"
        ],
        "stereo_centers": 9
      },
      "unii": "BM3MOX055H"
    }
  ]
}