{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5c775ccc-c90a-4ea7-a81d-7933e7c594cd",
          "code": "1401090-53-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1401090-53-6",
          "code_system": "CAS",
          "references": [
            "d8dbaa6b-b726-4552-9c9a-4899a32a04c2",
            "790827be-df1d-4747-a2cf-c9704d81e929"
          ]
        },
        {
          "uuid": "9dafe7e8-1d9f-4c1f-932e-2fdf20ed593c",
          "code": "10063",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=10063",
          "code_system": "INN",
          "references": [
            "d8dbaa6b-b726-4552-9c9a-4899a32a04c2"
          ]
        },
        {
          "uuid": "c8834032-72f0-4c9c-bd29-712bc4def90b",
          "code": "60199242",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/60199242",
          "code_system": "PUBCHEM",
          "references": [
            "d8dbaa6b-b726-4552-9c9a-4899a32a04c2"
          ]
        },
        {
          "uuid": "3e99c01e-5d9c-2689-5145-88964b873494",
          "code": "439814",
          "comments": "ORPHAN DRUG|Designated|Treatment of Fabry's disease",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=439814",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "e503ff74-fd18-10ce-4028-33ccea7fc1bc",
          "code": "C152852",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C152852",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c21cb5ec-2b28-245a-1bf6-96970ce7916a"
          ]
        },
        {
          "uuid": "394c15ed-d21b-5d68-c44d-b96f413745d7",
          "code": "443414",
          "comments": "ORPHAN DRUG|Designated|Treatment of Gaucher disease",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=443414",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "91cd5087-55c6-973f-73b9-9294540494eb",
          "code": "637218",
          "comments": "ORPHAN DRUG|Designated|Treatment of Autosomal Dominant Polycystic Kidney Disease",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=637218",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "b727d462-5a91-6a8b-9179-396155aa1c75",
          "code": "C471",
          "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C471",
          "code_system": "NCI_THESAURUS",
          "references": [
            "16407ef0-be07-f6ed-de80-41d0a59d31ab"
          ]
        },
        {
          "uuid": "82146388-d230-46bd-d6cb-a7eb3400cc9d",
          "code": "EU/3/18/2122",
          "comments": "EU ORPHAN DRUG|Positive|Treatment of autosomal dominant polycystic kidney disease",
          "type": "PRIMARY",
          "url": "https://www.ema.europa.eu/en/medicines/human/orphan-designations/eu3182122",
          "code_system": "EU-Orphan Drug",
          "references": [
            "16407ef0-be07-f6ed-de80-41d0a59d31ab"
          ]
        },
        {
          "uuid": "0117f400-97a5-4fcb-8409-de2b3e23f72f",
          "code": "BLP1XA3FZA",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b6bbfffe-4320-6637-f5f2-89d9fedeab83",
          "code": "DB14966",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB14966",
          "code_system": "DRUG BANK",
          "references": [
            "16407ef0-be07-f6ed-de80-41d0a59d31ab"
          ]
        },
        {
          "uuid": "eade064a-aff6-87c2-68ca-e86c70b1fdc5",
          "code": "100000177429",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "4135b878-dfae-dc40-b49b-11a8b0f16ebf"
          ]
        },
        {
          "uuid": "8e4dbd43-6a27-de36-a8ed-bffd34d34b29",
          "code": "GH-116",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/GH-116/relevant/1/",
          "code_system": "USAN",
          "references": [
            "40cf6069-83c7-3e13-70ab-47ed90bb08fb"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "52dcb851-da72-449c-b1e0-feb5572f3c38",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "bd40b458-3843-4127-a698-b4d29aa29e0e",
            "refuuid": "99d695a5-63e0-4e02-8987-1cdd95e33949",
            "name": "VENGLUSTAT HYDROCHLORIDE",
            "unii": "OK1S17555O",
            "linking_id": "OK1S17555O",
            "ref_pname": "VENGLUSTAT HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e8c07b81-cd0f-453f-9159-a2239e93ef9e",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "95fa4025-f513-4245-8375-be1f21d195b1",
            "refuuid": "28645c6f-4c6c-4458-a8d5-a2e758222fe3",
            "name": "VENGLUSTAT",
            "unii": "BLP1XA3FZA",
            "linking_id": "BLP1XA3FZA",
            "ref_pname": "VENGLUSTAT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b4914f29-bc63-4446-9002-aaef1c911dc4",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "1e893017-b215-4fe8-9cac-b710da6136fc",
            "refuuid": "f32fc415-c4a7-41d0-ae57-fb63ceadf4ce",
            "name": "VENGLUSTAT MALATE",
            "unii": "94855LQZ8D",
            "linking_id": "94855LQZ8D",
            "ref_pname": "VENGLUSTAT MALATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "029665a1-644e-4d81-add2-1ec2e0cbe783",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "a0d06ec4-a249-445d-8180-7a939564db08",
            "refuuid": "9f6c3889-136e-4c7b-925e-eb66c8a24110",
            "name": "VENGLUSTAT SUCCINATE",
            "unii": "XW65IGE2BT",
            "linking_id": "XW65IGE2BT",
            "ref_pname": "VENGLUSTAT SUCCINATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "707cf326-a34e-4a25-8021-fc75b83dced6",
          "amount": {
            "uuid": "131b6d23-5222-4385-9a9b-b3c4c8a9a374"
          },
          "type": "TARGET->INHIBITOR",
          "related_substance": {
            "uuid": "1777b7e6-7941-4aac-82f6-ede7f374a520",
            "refuuid": "2f81844a-9c04-475a-a6cc-e977a79de439",
            "name": "CERAMIDE GLUCOSYLTRANSFERASE",
            "unii": "NYE1YH8MV4",
            "linking_id": "NYE1YH8MV4",
            "ref_pname": "CERAMIDE GLUCOSYLTRANSFERASE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "53247a52-36db-4c2c-89e5-d68c39c11ec6",
          "name": "(3S)-1-Azabicyclo[2.2.2]octan-3-yl N-{2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]propan-2-yl}carbamate",
          "stdName": "(3S)-1-AZABICYCLO(2.2.2)OCTAN-3-YL N-(2-(2-(4-FLUOROPHENYL)-1,3-THIAZOL-4-YL)PROPAN-2-YL)CARBAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a51a1bdc-b3f3-4136-8d50-f6cec44c455f",
            "7e944ff1-aab7-4ba4-805a-41c9233acb1f"
          ],
          "display_name": false
        },
        {
          "uuid": "ec3e39a4-8887-46ea-81ce-356847ae4246",
          "name": "CARBAMIC ACID, N-(1-(2-(4-FLUOROPHENYL)-4-THIAZOLYL)-1-METHYLETHYL)-, (3S)-1-AZABICYCLO(2.2.2)OCT-3-YL ESTER",
          "stdName": "CARBAMIC ACID, N-(1-(2-(4-FLUOROPHENYL)-4-THIAZOLYL)-1-METHYLETHYL)-, (3S)-1-AZABICYCLO(2.2.2)OCT-3-YL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2de1feaf-77b7-4757-937a-9a3cb19184db",
            "7e944ff1-aab7-4ba4-805a-41c9233acb1f"
          ],
          "display_name": false
        },
        {
          "uuid": "cab68398-c9ba-24a9-1da3-a539d9336c5c",
          "name": "GENZ-682452",
          "stdName": "GENZ-682452",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94c59106-8795-0045-c985-a7acb0866221"
          ],
          "display_name": false
        },
        {
          "uuid": "95e4371e-4b12-02c5-4d3c-70c166be58e1",
          "name": "GENZ-682452-AA",
          "stdName": "GENZ-682452-AA",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "541fe874-e12f-b8ae-ba95-da4b603b72d2"
          ],
          "display_name": false
        },
        {
          "uuid": "6ad6f9ec-802e-22b7-55c5-b3d74a034a39",
          "name": "GZ-402671",
          "stdName": "GZ-402671",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94c59106-8795-0045-c985-a7acb0866221"
          ],
          "display_name": false
        },
        {
          "uuid": "7b78f9e1-2e98-b007-b504-28c9f21571ae",
          "name": "GZ/SAR-402671",
          "stdName": "GZ/SAR-402671",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "541fe874-e12f-b8ae-ba95-da4b603b72d2"
          ],
          "display_name": false
        },
        {
          "uuid": "2a157cbb-3bd8-f0f5-9f03-0ab51219d1a8",
          "name": "GZ/SAR402671",
          "stdName": "GZ/SAR402671",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "541fe874-e12f-b8ae-ba95-da4b603b72d2"
          ],
          "display_name": false
        },
        {
          "uuid": "1d920aef-fd05-5609-4505-26c124a84ab2",
          "name": "GZ402671",
          "stdName": "GZ402671",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2de1feaf-77b7-4757-937a-9a3cb19184db"
          ],
          "display_name": false
        },
        {
          "uuid": "93d82935-781b-4e3a-bca5-97051dbcd192",
          "name": "IBIGLUSTAT",
          "stdName": "IBIGLUSTAT",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a51a1bdc-b3f3-4136-8d50-f6cec44c455f",
            "7e944ff1-aab7-4ba4-805a-41c9233acb1f"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "56019670-2adb-43e2-a4cf-e7aa3e8ed935",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "78e91680-5ec6-4ea2-a464-a0afe27a4193",
          "name": "SAR-402671",
          "stdName": "SAR-402671",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e944ff1-aab7-4ba4-805a-41c9233acb1f",
            "541fe874-e12f-b8ae-ba95-da4b603b72d2"
          ],
          "display_name": false
        },
        {
          "uuid": "e797391f-87fd-4e66-8485-080dd4382057",
          "name": "SAR402671",
          "stdName": "SAR402671",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7e944ff1-aab7-4ba4-805a-41c9233acb1f",
            "541fe874-e12f-b8ae-ba95-da4b603b72d2"
          ],
          "display_name": false
        },
        {
          "uuid": "065d3ae7-e8c5-455e-83fc-09e2b8731f5a",
          "name": "VENGLUSTAT",
          "stdName": "VENGLUSTAT",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "95596f2f-9000-46f6-a206-ea1ed0338dcd",
            "a51a1bdc-b3f3-4136-8d50-f6cec44c455f",
            "10219b09-4521-4a66-b944-ed2338ef255a",
            "7e944ff1-aab7-4ba4-805a-41c9233acb1f",
            "a9cbe203-da80-41e6-9581-391b0fa58e21",
            "541fe874-e12f-b8ae-ba95-da4b603b72d2"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "01b3ba78-73e5-4cea-ad31-1acf1be0d1cc",
              "name_org": "INN"
            },
            {
              "uuid": "7aa95f3d-cb5d-4ab6-b904-4268e2116407",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "4ca92502-ad64-8ced-e88b-154ce42ec5a9",
          "name": "VENGLUSTAT [USAN]",
          "stdName": "VENGLUSTAT [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "541fe874-e12f-b8ae-ba95-da4b603b72d2"
          ],
          "display_name": false
        },
        {
          "uuid": "b6bcfb02-e39d-90d7-a742-22f4944df9b7",
          "name": "Venglustat [WHO-DD]",
          "stdName": "VENGLUSTAT [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74d355cb-2926-4727-6196-645761294fd4"
          ],
          "display_name": false
        },
        {
          "uuid": "308b18c8-34f7-4b70-a0b4-0f65ee010595",
          "name": "venglustat [INN]",
          "stdName": "VENGLUSTAT [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a51a1bdc-b3f3-4136-8d50-f6cec44c455f",
            "7e944ff1-aab7-4ba4-805a-41c9233acb1f",
            "88d7a409-0bf4-48ab-8447-6096e981a709"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a51a1bdc-b3f3-4136-8d50-f6cec44c455f",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7e944ff1-aab7-4ba4-805a-41c9233acb1f",
          "citation": "INN",
          "doc_type": "INN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "95596f2f-9000-46f6-a206-ea1ed0338dcd",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2de1feaf-77b7-4757-937a-9a3cb19184db",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8dbaa6b-b726-4552-9c9a-4899a32a04c2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390819000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c262f3aa-6c25-4f1b-b4d2-a196916e3372",
          "citation": "SRS import [BLP1XA3FZA]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=BLP1XA3FZA",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390819000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10219b09-4521-4a66-b944-ed2338ef255a",
          "citation": "VENGLUSTAT [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a9cbe203-da80-41e6-9581-391b0fa58e21",
          "citation": "VENGLUSTAT [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c21cb5ec-2b28-245a-1bf6-96970ce7916a",
          "citation": "NCIT",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "94c59106-8795-0045-c985-a7acb0866221",
          "citation": "https://www.medkoo.com/products/7329",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "dca448de-e216-6ca7-4b5b-6ce35c88a0ba",
          "citation": "https://en.wikipedia.org/wiki/Ceramide_glucosyltransferase",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "16407ef0-be07-f6ed-de80-41d0a59d31ab",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "40cf6069-83c7-3e13-70ab-47ed90bb08fb",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "63df9da7-e4f6-570d-9b44-f58a92b6aa6e",
          "citation": "USAN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "1721a6ea-c48d-e1dd-d1c0-d9e56f63314d",
          "citation": "INN",
          "doc_type": "INN_LIST",
          "public_domain": true
        },
        {
          "uuid": "541fe874-e12f-b8ae-ba95-da4b603b72d2",
          "citation": "USAN COUN 2019",
          "doc_type": "USANCOUN",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "790827be-df1d-4747-a2cf-c9704d81e929",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "88d7a409-0bf4-48ab-8447-6096e981a709",
          "citation": "INN Proposed List 114",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL114.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "74d355cb-2926-4727-6196-645761294fd4",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "4135b878-dfae-dc40-b49b-11a8b0f16ebf",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1994d2e6-275f-4192-899e-bb1ba3db5f3d",
          "id": "1994d2e6-275f-4192-899e-bb1ba3db5f3d",
          "molfile": "\n  Marvin  01132101312D          \n\n 27 30  0  0  1  0            999 V2000\n    5.1050   -4.4307    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.1050   -3.6057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3905   -3.1932    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6760   -3.6057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6760   -4.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3905   -4.8432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0094   -4.1832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7715   -3.8533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8195   -4.8432    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5339   -4.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5339   -3.6057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2484   -4.8432    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9629   -4.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3753   -3.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5504   -3.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6773   -4.8432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7636   -5.6637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5705   -5.8352    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9830   -5.1208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4310   -4.5077    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8035   -5.0346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1390   -4.2809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9595   -4.1946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4444   -4.8621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2649   -4.7758    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1089   -5.6157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2884   -5.7019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  6  1  0  0  0  0\n  1  9  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  8  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 20  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 27  2  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 26 24  2  0  0  0  0\n 27 26  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(c1csc(-c2ccc(cc2)F)n1)NC(=O)O[C@@H]3CN4CCC3CC4",
          "formula": "C20H24FN3O2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "07bb4d99-bd35-4150-b016-b81c4cfb7eba"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "389.4887",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "28645c6f-4c6c-4458-a8d5-a2e758222fe3",
      "version": "29",
      "structure": {
        "id": "c24ba8e3-f8f9-47c0-9552-2d46019a7a32",
        "molfile": "\n  Marvin  01132110032D          \n\n 27 30  0  0  1  0            999 V2000\n    7.9629   -4.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2484   -4.8432    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5339   -4.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8195   -4.8432    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1050   -4.4307    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.3905   -4.8432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6760   -4.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6760   -3.6057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3905   -3.1932    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7715   -3.8533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0094   -4.1832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1050   -3.6057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5339   -3.6057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3753   -3.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5504   -3.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6773   -4.8432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4310   -4.5077    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9830   -5.1208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8035   -5.0346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1390   -4.2809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9595   -4.1946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4444   -4.8621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2649   -4.7758    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1089   -5.6157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2884   -5.7019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5705   -5.8352    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7636   -5.6637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  1  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  6 11  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12  9  1  0  0  0  0\n  5 12  1  0  0  0  0\n  3 13  2  0  0  0  0\n  1 14  1  0  0  0  0\n  1 15  1  0  0  0  0\n  1 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 24 22  1  0  0  0  0\n 25 24  2  0  0  0  0\n 19 25  1  0  0  0  0\n 18 26  1  0  0  0  0\n 27 26  1  0  0  0  0\n 16 27  2  0  0  0  0\nM  END",
        "smiles": "CC(C)(c1csc(-c2ccc(cc2)F)n1)NC(=O)O[C@@H]3CN4CCC3CC4",
        "formula": "C20H24FN3O2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "389.4887",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "c262f3aa-6c25-4f1b-b4d2-a196916e3372",
          "a51a1bdc-b3f3-4136-8d50-f6cec44c455f",
          "541fe874-e12f-b8ae-ba95-da4b603b72d2",
          "88d7a409-0bf4-48ab-8447-6096e981a709"
        ],
        "stereo_centers": 1
      },
      "unii": "BLP1XA3FZA"
    }
  ]
}