{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "05c3721b-a753-4a4e-8834-865d0a4440f9",
          "code": "QP53AF07",
          "comments": "VATC|ECTOPARACITICIDES,  INSECTICIDES AND REPELLENTS|ECTOPARASITICIDES FOR TOPICAL USE, INCL. INSECTICIDES|Organophosphorous compounds|fention",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QP53AF07&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "4bcbfeb4-e232-4d74-9036-2ba8529a54fd"
          ]
        },
        {
          "uuid": "618c5ba1-a843-4170-82fc-d73a35be4e1b",
          "code": "QP53BB02",
          "comments": "VATC|ECTOPARACITICIDES,  INSECTICIDES AND REPELLENTS|ECTOPARASITICIDES FOR SYSTEMIC USE|Organophosphorous compounds|fenthion",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QP53BB02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "4bcbfeb4-e232-4d74-9036-2ba8529a54fd"
          ]
        },
        {
          "uuid": "ebc95cc7-26ba-4795-a777-e32dd28734ef",
          "code": "55-38-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=55-38-9",
          "code_system": "CAS",
          "references": [
            "4bcbfeb4-e232-4d74-9036-2ba8529a54fd",
            "9e624b45-ce97-4dd5-b62d-623c1ed745d6"
          ]
        },
        {
          "uuid": "a9d393fd-7087-45f4-a731-65cbffc7ff98",
          "code": "D005284",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68005284",
          "code_system": "MESH",
          "references": [
            "4bcbfeb4-e232-4d74-9036-2ba8529a54fd"
          ]
        },
        {
          "uuid": "e269ecd3-1716-4391-924b-75bbc1756acd",
          "code": "53301",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:2364",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "4bcbfeb4-e232-4d74-9036-2ba8529a54fd"
          ]
        },
        {
          "uuid": "92f76336-2e80-40c8-a06e-1f1fe000048f",
          "code": "C76873",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76873",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4bcbfeb4-e232-4d74-9036-2ba8529a54fd"
          ]
        },
        {
          "uuid": "af3a6548-5007-4585-9b32-d6756e51f3e9",
          "code": "m5299",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5299?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4bcbfeb4-e232-4d74-9036-2ba8529a54fd"
          ]
        },
        {
          "uuid": "9acd78d5-5bf1-4f71-b301-54ce8aa35502",
          "code": "21 CFR 524.920",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 524 OPHTHALMIC AND TOPICAL DOSAGE FORM NEW ANIMAL DRUGS|SEC. 524.920 Fenthion.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=524.920",
          "code_system": "CFR",
          "references": [
            "4bcbfeb4-e232-4d74-9036-2ba8529a54fd"
          ]
        },
        {
          "uuid": "c257e868-ba10-46a5-aba1-fe96a7813fdb",
          "code": "CHEMBL1604375",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1604375",
          "code_system": "ChEMBL",
          "references": [
            "4bcbfeb4-e232-4d74-9036-2ba8529a54fd"
          ]
        },
        {
          "uuid": "dbe4da58-a12c-4550-ab05-7d60c46350b7",
          "code": "200-231-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.211",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4bcbfeb4-e232-4d74-9036-2ba8529a54fd"
          ]
        },
        {
          "uuid": "e7b40541-3bc6-411f-bd5a-e34181df7389",
          "code": "3346",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3346",
          "code_system": "PUBCHEM",
          "references": [
            "4bcbfeb4-e232-4d74-9036-2ba8529a54fd"
          ]
        },
        {
          "uuid": "f898b223-9ad0-3061-ba79-56f2e283f06c",
          "code": "Fenthion",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Fenthion",
          "code_system": "WIKIPEDIA",
          "references": [
            "6f00e696-ad52-8473-bf63-38777899aea7"
          ]
        },
        {
          "uuid": "5cae05d8-b29e-57c1-de34-4d44c1e4f0e7",
          "code": "1403",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1403",
          "code_system": "HSDB",
          "references": [
            "3e40f3c2-ad13-b03c-17fb-99001aeed30d"
          ]
        },
        {
          "uuid": "cc0f07dd-7699-e42c-fbfb-3f95bdb2404c",
          "code": "DTXSID8020620",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8020620",
          "code_system": "EPA CompTox",
          "references": [
            "6744080f-ebe9-e717-fb2d-80d34ad01858"
          ]
        },
        {
          "uuid": "adcb2b75-7d62-2510-7527-c3ffda2d8ecf",
          "code": "C737",
          "comments": "Industrial Aid[C45678]|Pesticide",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C737",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5c51e04c-4571-2714-49cf-708adff48b5f"
          ]
        },
        {
          "uuid": "7d9eb896-acb5-c0b5-7c50-5dd9d54c15c5",
          "code": "DB11412",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11412",
          "code_system": "DRUG BANK",
          "references": [
            "5c51e04c-4571-2714-49cf-708adff48b5f"
          ]
        },
        {
          "uuid": "cce0bca1-c931-46d5-9308-0e292fb08eb7",
          "code": "BL0L45OVKT",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6fb3ef89-f030-784a-01c0-4edfd72a6d6c",
          "code": "34761",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34761",
          "code_system": "CHEBI",
          "references": [
            "5c51e04c-4571-2714-49cf-708adff48b5f"
          ]
        },
        {
          "uuid": "bfe163e5-bdc5-8d86-bcfd-d33bc8649431",
          "code": "300000029423",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "4b67a9e6-4f29-cfc4-8f6c-392f8987c48d"
          ]
        },
        {
          "uuid": "84cdbdd9-023f-2477-6ffa-3f87af806caf",
          "code": "fenthion",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/fenthion.html",
          "code_system": "ALANWOOD",
          "references": [
            "7b6c2e5e-a182-d165-3d9b-5aec501887e6"
          ]
        },
        {
          "uuid": "c7655307-f0e0-48e9-4f26-815fecfbaa45",
          "code": "755881",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=755881",
          "code_system": "NSC",
          "references": [
            "f454a5c5-10b1-51db-7acd-5cd773496500"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "7f5e57e5-dcd4-49f1-b2a8-c171c50fc7b3",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "c017f5a8-f6b8-4e80-b275-9d1af00ba91f",
            "refuuid": "bb4ebdd1-2a83-4f7c-bdfc-3aa1f8a06c0b",
            "name": "FENTHION",
            "unii": "BL0L45OVKT",
            "linking_id": "BL0L45OVKT",
            "ref_pname": "FENTHION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d90fa360-8bd5-403e-8d2b-e6daac291f22",
          "name": "FENTHION",
          "stdName": "FENTHION",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7efceb6b-e962-41e6-9b22-f34b621785d1",
            "65465e77-5f4a-4b7d-9316-c1e01defd901",
            "969d5daa-113b-4231-9355-cbd3bc573671",
            "ad3b78f7-3326-4d27-b3c4-17842a64f598",
            "7ac45333-baa8-40b4-9b6a-b2a286d31976",
            "1b06ce5f-9bf1-46f9-a1cf-f600364a8b59",
            "b94719ab-c5e3-4bc2-bb1b-8448dc752f55",
            "0c25a30c-6772-40e0-9bb2-f466d1941143",
            "b9feb231-41cc-4bb6-a864-f3768c69b459",
            "38f49b0b-eeb1-49b6-9b24-300df0d65a81",
            "8791195d-b309-4705-b1aa-cd0d2729fa9d"
          ],
          "display_name": true
        },
        {
          "uuid": "ea1cca1c-80a0-48a8-821a-834f3378ab0d",
          "name": "FENTHION [GREEN BOOK]",
          "stdName": "FENTHION [GREEN BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8791195d-b309-4705-b1aa-cd0d2729fa9d"
          ],
          "display_name": false
        },
        {
          "uuid": "07658463-b354-46d0-8a05-33f10817dc75",
          "name": "FENTHION [HSDB]",
          "stdName": "FENTHION [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "65465e77-5f4a-4b7d-9316-c1e01defd901"
          ],
          "display_name": false
        },
        {
          "uuid": "50edc996-a56f-4065-8603-05215fc342cf",
          "name": "FENTHION [ISO]",
          "stdName": "FENTHION [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b9feb231-41cc-4bb6-a864-f3768c69b459"
          ],
          "display_name": false
        },
        {
          "uuid": "d0e631a2-93e0-4fab-88c5-a5dc0bda5156",
          "name": "FENTHION [MART.]",
          "stdName": "FENTHION [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7efceb6b-e962-41e6-9b22-f34b621785d1"
          ],
          "display_name": false
        },
        {
          "uuid": "1bfaf770-b23d-4d5d-985d-7a9b92503a12",
          "name": "FENTHION [MI]",
          "stdName": "FENTHION [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad3b78f7-3326-4d27-b3c4-17842a64f598"
          ],
          "display_name": false
        },
        {
          "uuid": "4c804a3a-37ac-5069-478e-32108605c5a7",
          "name": "NSC-755881",
          "stdName": "NSC-755881",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f454a5c5-10b1-51db-7acd-5cd773496500"
          ],
          "display_name": false
        },
        {
          "uuid": "8876bdd8-0401-4b77-85f0-e3e0fea6ada2",
          "name": "O,O-DIMETHYL O-(3-METHYL-4-(METHYLTHIO)PHENYL) PHOSPHOROTHIOATE",
          "stdName": "O,O-DIMETHYL O-(3-METHYL-4-(METHYLTHIO)PHENYL) PHOSPHOROTHIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0ac2f70-327f-4928-b8b8-e4fe3a3da379",
            "10ada543-9515-48be-b25d-e2c831ac67fa"
          ],
          "display_name": false
        },
        {
          "uuid": "4e15c420-641b-4992-be09-f567360c105e",
          "name": "O,O-DIMETHYL O-4-METHYLTHIO-M-TOLYL PHOSPHOROTHIOATE",
          "stdName": "O,O-DIMETHYL O-4-METHYLTHIO-M-TOLYL PHOSPHOROTHIOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d05f3059-7853-4246-bd01-c2c8171dead8"
          ],
          "display_name": false
        },
        {
          "uuid": "f50ad663-1d2f-4aae-9af2-4dcc94bd6146",
          "name": "PRO-SPOT",
          "stdName": "PRO-SPOT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ac45333-baa8-40b4-9b6a-b2a286d31976"
          ],
          "display_name": false
        },
        {
          "uuid": "594dec99-ae73-42a1-9ce1-b322e1d5e3cd",
          "name": "SPOTTON",
          "stdName": "SPOTTON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ac45333-baa8-40b4-9b6a-b2a286d31976"
          ],
          "display_name": false
        },
        {
          "uuid": "605b87ee-c6ea-4a54-8854-961c4081124d",
          "name": "TIGUVON",
          "stdName": "TIGUVON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ac45333-baa8-40b4-9b6a-b2a286d31976"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7ac45333-baa8-40b4-9b6a-b2a286d31976",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d05f3059-7853-4246-bd01-c2c8171dead8",
          "citation": "usp dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f0ac2f70-327f-4928-b8b8-e4fe3a3da379",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10ada543-9515-48be-b25d-e2c831ac67fa",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7efceb6b-e962-41e6-9b22-f34b621785d1",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad3b78f7-3326-4d27-b3c4-17842a64f598",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8791195d-b309-4705-b1aa-cd0d2729fa9d",
          "citation": "FDA SRS 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "65465e77-5f4a-4b7d-9316-c1e01defd901",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9feb231-41cc-4bb6-a864-f3768c69b459",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4bcbfeb4-e232-4d74-9036-2ba8529a54fd",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389701000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af933ea9-6183-4176-ac42-017680a84cee",
          "citation": "SRS import [BL0L45OVKT]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=BL0L45OVKT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389701000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c69b359f-5270-4ab1-b37a-cbcfaa2f5801",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b06ce5f-9bf1-46f9-a1cf-f600364a8b59",
          "citation": "FENTHION [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b94719ab-c5e3-4bc2-bb1b-8448dc752f55",
          "citation": "FENTHION [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0c25a30c-6772-40e0-9bb2-f466d1941143",
          "citation": "FENTHION [GREEN BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "969d5daa-113b-4231-9355-cbd3bc573671",
          "citation": "FENTHION [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "38f49b0b-eeb1-49b6-9b24-300df0d65a81",
          "citation": "FENTHION [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6f00e696-ad52-8473-bf63-38777899aea7",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Isonicotinic_acid",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3e40f3c2-ad13-b03c-17fb-99001aeed30d",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+55-38-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6744080f-ebe9-e717-fb2d-80d34ad01858",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=55-38-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5c51e04c-4571-2714-49cf-708adff48b5f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7b6c2e5e-a182-d165-3d9b-5aec501887e6",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "9e624b45-ce97-4dd5-b62d-623c1ed745d6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f454a5c5-10b1-51db-7acd-5cd773496500",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "4b67a9e6-4f29-cfc4-8f6c-392f8987c48d",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5cbe5e68-5126-4896-b871-1b9237137a79",
          "id": "5cbe5e68-5126-4896-b871-1b9237137a79",
          "molfile": "\n  Marvin  01132104482D          \n\n 16 16  0  0  0  0            999 V2000\n    6.4492   -7.6855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7856   -7.3732    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7856   -6.6132    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5846   -6.6132    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7829   -5.8012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4284   -5.3639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0152   -6.6002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1798   -6.6002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7946   -5.8975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9696   -5.8975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5323   -6.6002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7021   -6.5924    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0489   -6.5924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9696   -7.3341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5245   -8.0446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7738   -7.3341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  3  1  0  0  0  0\n  7  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 16  8  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 14 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 16  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(ccc1SC)OP(=S)(OC)OC",
          "formula": "C10H15O3PS2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c1aa8c3c-9fa3-470c-a6a4-26d2d583b60d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "278.3306",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "bb4ebdd1-2a83-4f7c-bdfc-3aa1f8a06c0b",
      "version": "13",
      "structure": {
        "id": "578ee679-38c3-45bc-9be2-10167c4dc5c3",
        "molfile": "\n  Marvin  01132104332D          \n\n 16 16  0  0  0  0            999 V2000\n    5.7856   -6.6132    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5846   -6.6132    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0152   -6.6002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9696   -7.3341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5323   -6.6002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7738   -7.3341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1798   -6.6002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9696   -5.8975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7856   -7.3732    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7829   -5.8012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7021   -6.5924    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7946   -5.8975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5245   -8.0446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0489   -6.5924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4492   -7.6855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4284   -5.3639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  6  2  0  0  0  0\n  5  8  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  3  1  0  0  0  0\n  8 12  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  1  1  0  0  0  0\n 11  5  1  0  0  0  0\n 12  7  2  0  0  0  0\n 13  4  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15  9  1  0  0  0  0\n 16 10  1  0  0  0  0\n  4  5  1  0  0  0  0\nM  END",
        "smiles": "Cc1cc(ccc1SC)OP(=S)(OC)OC",
        "formula": "C10H15O3PS2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "278.3306",
        "optical_activity": "NONE",
        "references": [
          "af933ea9-6183-4176-ac42-017680a84cee",
          "c69b359f-5270-4ab1-b37a-cbcfaa2f5801"
        ],
        "stereo_centers": 0
      },
      "unii": "BL0L45OVKT"
    }
  ]
}