{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "af045d34-3b83-4067-b899-c1c6ba6a3517",
          "code": "434-16-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=434-16-2",
          "code_system": "CAS",
          "references": [
            "11f1dff5-dbe5-4d1a-afa9-9f06f7f277ed",
            "3646987b-e1e6-4a3a-aa3f-fafb7ded6383"
          ]
        },
        {
          "uuid": "f8f42013-0609-42d7-b7b7-e00f6a193af9",
          "code": "C016705",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67016705",
          "code_system": "MESH",
          "references": [
            "11f1dff5-dbe5-4d1a-afa9-9f06f7f277ed"
          ]
        },
        {
          "uuid": "600be9c7-c88b-4cf9-83a6-0f0972154dce",
          "code": "207-100-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.456",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "11f1dff5-dbe5-4d1a-afa9-9f06f7f277ed"
          ]
        },
        {
          "uuid": "5991ab24-2e6e-4608-a9bf-b95f25ba8f56",
          "code": "1362616",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1362616/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "11f1dff5-dbe5-4d1a-afa9-9f06f7f277ed"
          ]
        },
        {
          "uuid": "d0eec941-79a5-4f4f-99e2-77d606e4283c",
          "code": "m4141",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4141?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "11f1dff5-dbe5-4d1a-afa9-9f06f7f277ed"
          ]
        },
        {
          "uuid": "f87041c3-88a1-4b7d-b1d9-65ae0cad405d",
          "code": "439423",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439423",
          "code_system": "PUBCHEM",
          "references": [
            "11f1dff5-dbe5-4d1a-afa9-9f06f7f277ed"
          ]
        },
        {
          "uuid": "1fb2a252-8c1a-ad69-cfcb-bff6a031be25",
          "code": "7-Dehydrocholesterol",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/7-Dehydrocholesterol",
          "code_system": "WIKIPEDIA",
          "references": [
            "e5269bf5-e902-7cc1-2510-9527ba7bd888"
          ]
        },
        {
          "uuid": "fe61d314-c1c4-8c6f-f91d-520cc5880940",
          "code": "32289-1",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|7-Dehydrocholesterol [Moles/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/32289-1/",
          "code_system": "LOINC",
          "references": [
            "4e720a79-923d-3004-030f-824b5cf0570b"
          ]
        },
        {
          "uuid": "d3e435c9-1529-3478-fce1-deecfbbe2fdc",
          "code": "22676-1",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|7-Dehydrocholesterol [Presence] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/22676-1/",
          "code_system": "LOINC",
          "references": [
            "4e720a79-923d-3004-030f-824b5cf0570b"
          ]
        },
        {
          "uuid": "cdb4a982-958e-a505-c7d1-aacfeb5ca9a4",
          "code": "33275-9",
          "comments": "LOINC|ACTIVE|CHEM|Ser/Plas|7-Dehydrocholesterol [Mass/volume] in Serum or Plasma",
          "type": "PRIMARY",
          "url": "https://loinc.org/33275-9/",
          "code_system": "LOINC",
          "references": [
            "4e720a79-923d-3004-030f-824b5cf0570b"
          ]
        },
        {
          "uuid": "ced86db4-a127-173a-e73c-6e5b81d28c7d",
          "code": "46700-1",
          "comments": "LOINC|ACTIVE|CHEM|Amnio fld|7-Dehydrocholesterol [Moles/volume] in Amniotic fluid",
          "type": "PRIMARY",
          "url": "https://loinc.org/46700-1/",
          "code_system": "LOINC",
          "references": [
            "4e720a79-923d-3004-030f-824b5cf0570b"
          ]
        },
        {
          "uuid": "71af210c-96b5-9f26-f16e-911bdb97d831",
          "code": "48610-0",
          "comments": "LOINC|ACTIVE|CHEM|Amnio fld|7-Dehydrocholesterol [Mass/volume] in Amniotic fluid",
          "type": "PRIMARY",
          "url": "https://loinc.org/48610-0/",
          "code_system": "LOINC",
          "references": [
            "4e720a79-923d-3004-030f-824b5cf0570b"
          ]
        },
        {
          "uuid": "54194670-3d75-4fe4-52dc-a5b5ff8af63d",
          "code": "50799-6",
          "comments": "LOINC|ACTIVE|CHEM|Body fld|7-Dehydrocholesterol [Moles/volume] in Body fluid",
          "type": "PRIMARY",
          "url": "https://loinc.org/50799-6/",
          "code_system": "LOINC",
          "references": [
            "4e720a79-923d-3004-030f-824b5cf0570b"
          ]
        },
        {
          "uuid": "c910468e-795b-d5af-1a71-5ef16d88437c",
          "code": "40597-7",
          "comments": "LOINC|ACTIVE|CHEM|Amnio fld|7-Dehydrocholesterol [Presence] in Amniotic fluid",
          "type": "PRIMARY",
          "url": "https://loinc.org/40597-7/",
          "code_system": "LOINC",
          "references": [
            "4e720a79-923d-3004-030f-824b5cf0570b"
          ]
        },
        {
          "uuid": "5b1a885b-2f30-446f-976b-a59f0ed5e009",
          "code": "BK1IU07GKF",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a53b27e3-5801-dcef-2354-5694b5462d45",
          "code": "17759",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17759",
          "code_system": "CHEBI",
          "references": [
            "4e720a79-923d-3004-030f-824b5cf0570b"
          ]
        },
        {
          "uuid": "9440ae1d-ee60-5d0e-5cac-a21f2f6f44a0",
          "code": "DTXSID20861933",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20861933",
          "code_system": "EPA CompTox",
          "references": [
            "4e720a79-923d-3004-030f-824b5cf0570b"
          ]
        },
        {
          "uuid": "dbfdfa6b-6543-3738-81d9-fe154b827d25",
          "code": "18159",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=18159",
          "code_system": "NSC",
          "references": [
            "103fa20a-84a5-f204-0730-d76da9d0ba03"
          ]
        },
        {
          "uuid": "fbaab9d5-2a61-ce62-6f53-684c20156d94",
          "code": "BK1IU07GKF",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=BK1IU07GKF",
          "code_system": "DAILYMED",
          "references": [
            "b2a0809f-4135-5e73-659b-841a9d65f408"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ea492b8a-cdff-454f-9783-da5b05811721",
          "amount": {
            "uuid": "203c6e1c-3f0a-400b-84a3-2e03630fca4e"
          },
          "type": "METABOLITE ACTIVE->PARENT",
          "references": [
            "1ea12568-07ed-449a-9eb9-da96acdae696"
          ],
          "related_substance": {
            "uuid": "8caae47e-29e4-4045-abbf-113c8099e583",
            "refuuid": "fb131ef1-dd0b-45ba-a50e-e6a2ea49aa3c",
            "name": "Cholecalciferol",
            "unii": "1C6V77QF41",
            "linking_id": "1C6V77QF41",
            "ref_pname": "Cholecalciferol",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "07bf4107-3f06-4f81-b4c1-0e8d800e46f5",
          "amount": {
            "uuid": "6e39c0d4-c35a-497d-8381-9cb0bac6bf6a"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "efa742f9-10e9-466f-931a-eafefd7fb917"
          ],
          "related_substance": {
            "uuid": "44b9404f-5f6d-43e1-9d15-7b0adab9bc40",
            "refuuid": "d50273e9-449d-4d78-ab07-3edf746366b3",
            "name": "25-HYDROXY-7-DEHYDROCHOLESTEROL",
            "unii": "9A664165GR",
            "linking_id": "9A664165GR",
            "ref_pname": "25-HYDROXY-7-DEHYDROCHOLESTEROL"
          }
        },
        {
          "uuid": "7f4646bd-c723-4bd4-959a-d610bd2640bc",
          "amount": {
            "uuid": "7062db52-5602-4e6c-8838-31aca43b87bc"
          },
          "comments": "Formed from UV radiation during exposure to ultraviolet rays of sunlight (wavelengths 290–320 nm). ",
          "type": "METABOLITE ACTIVE->PARENT",
          "references": [
            "1ea12568-07ed-449a-9eb9-da96acdae696"
          ],
          "related_substance": {
            "uuid": "5b16145d-0469-401f-b007-bb353afeee66",
            "refuuid": "2f4cd490-f4f2-4677-a761-945aa92ea566",
            "name": "PREVITAMIN D3",
            "unii": "HDA46400N5",
            "linking_id": "HDA46400N5",
            "ref_pname": "PREVITAMIN D3",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7c63c96e-ef48-4793-a620-4e340ebb7465",
          "name": "(3.BETA.)-7-DEHYDROCHOLESTEROL [MI]",
          "stdName": "(3.BETA.)-7-DEHYDROCHOLESTEROL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89269564-96b2-4956-ada4-35de442b2904",
            "e088d6c9-dc79-4d7c-9eb2-9381f2a079b6"
          ],
          "display_name": false
        },
        {
          "uuid": "766e9760-bfbd-49c4-b0f8-47d5280f622e",
          "name": "7-DEHYDROCHOLESTEROL",
          "stdName": "7-DEHYDROCHOLESTEROL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7663b4db-4b6d-4ef2-bacf-bbb91b98ed4c",
            "5c0871f2-8036-48e0-b3f5-05eaa8fa2ea7",
            "89269564-96b2-4956-ada4-35de442b2904",
            "3fa006e2-e25e-437b-876d-d0abf6c62e49",
            "529158bd-4f73-47bd-b693-7c9cbaf6b834"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a6694c4e-fc3f-4940-a8af-0dad74f1b75f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "7d6ae472-0aa1-2cb3-395f-b9ede8706181",
          "name": "9.BETA.,10.ALPHA.-CHOLESTA-5,7-DIEN-3.BETA.-OL",
          "stdName": "9.BETA.,10.ALPHA.-CHOLESTA-5,7-DIEN-3.BETA.-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3a3d79a8-e255-6154-b025-7e539e4a3129",
            "dd95bd80-f083-5899-7ea1-555b0e3547ef"
          ],
          "display_name": false
        },
        {
          "uuid": "c3e47c31-c3b4-9047-79c2-824ac9875f75",
          "name": "CHOLECALCIFEROL IMPURITY B [EP IMPURITY]",
          "stdName": "CHOLECALCIFEROL IMPURITY B [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dd95bd80-f083-5899-7ea1-555b0e3547ef"
          ],
          "display_name": false
        },
        {
          "uuid": "8819fd2a-0a29-f2d0-a032-8fc71956b46f",
          "name": "CHOLESTA-5,7-DIEN-3.BETA.-OL",
          "stdName": "CHOLESTA-5,7-DIEN-3.BETA.-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dd95bd80-f083-5899-7ea1-555b0e3547ef"
          ],
          "display_name": false
        },
        {
          "uuid": "0c568c78-4888-4f03-8dc0-8433ccb7e9ef",
          "name": "NSC-18159",
          "stdName": "NSC-18159",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89269564-96b2-4956-ada4-35de442b2904",
            "895492f7-3d3a-4ece-87e2-36f41fac242e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5c0871f2-8036-48e0-b3f5-05eaa8fa2ea7",
          "citation": "pcpc-db",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "529158bd-4f73-47bd-b693-7c9cbaf6b834",
          "citation": "MERCK",
          "doc_type": "SCALENET",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e088d6c9-dc79-4d7c-9eb2-9381f2a079b6",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89269564-96b2-4956-ada4-35de442b2904",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7663b4db-4b6d-4ef2-bacf-bbb91b98ed4c",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "895492f7-3d3a-4ece-87e2-36f41fac242e",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11f1dff5-dbe5-4d1a-afa9-9f06f7f277ed",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391011000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b38380b1-c7f1-4481-bb69-fbcb6950f897",
          "citation": "SRS import [BK1IU07GKF]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=BK1IU07GKF",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391011000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3fa006e2-e25e-437b-876d-d0abf6c62e49",
          "citation": "7-DEHYDROCHOLESTEROL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e5269bf5-e902-7cc1-2510-9527ba7bd888",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/7-Dehydrocholesterol",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dd95bd80-f083-5899-7ea1-555b0e3547ef",
          "citation": "EP",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "3a3d79a8-e255-6154-b025-7e539e4a3129",
          "citation": "EP",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "4e720a79-923d-3004-030f-824b5cf0570b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "3646987b-e1e6-4a3a-aa3f-fafb7ded6383",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "efa742f9-10e9-466f-931a-eafefd7fb917",
          "citation": "J Steroid Biochem Mol Biol. 2014 Mar;140:7-16.",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b2a0809f-4135-5e73-659b-841a9d65f408",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "103fa20a-84a5-f204-0730-d76da9d0ba03",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "1ea12568-07ed-449a-9eb9-da96acdae696",
          "citation": "Dominguez, Ligia J., et al. \"Vitamin D sources, metabolism, and deficiency: available compounds and guidelines for its treatment.\" Metabolites 11.4 (2021): 255.",
          "url": "file:///C:/Users/CALLAHANL/Downloads/metabolites-11-00255-v2.pdf",
          "doc_type": "JA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d46118eb-975f-46a3-986a-4dbfdd66df95",
          "id": "d46118eb-975f-46a3-986a-4dbfdd66df95",
          "molfile": "\n  Marvin  01132111002D          \n\n 28 31  0  0  1  0            999 V2000\n    8.2562   -3.9932    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.7016   -3.4018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0463   -3.8499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5269   -4.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4002   -4.4044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9177   -5.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7357   -4.9312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5573   -5.8276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9929   -4.7464    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.4871   -5.4210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9929   -6.0957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2489   -5.8324    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.5372   -6.2574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5372   -7.0799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8255   -7.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0863   -7.0799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3655   -7.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6585   -7.0799    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.9562   -7.4634    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6585   -6.2574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3655   -5.8324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0863   -6.2574    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.0863   -5.4210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8255   -5.8324    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.8255   -5.0190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5372   -4.5800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2489   -5.0190    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.2489   -4.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  9  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9 10  1  1  0  0  0\n  9 27  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  1  0  0  0\n 27 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 24 13  1  1  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 16 22  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  1  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  1  0  0  0\n 22 24  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 27 28  1  1  0  0  0\nM  END",
          "smiles": "CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2C3=CC=C4C[C@H](CC[C@]4(C)[C@H]3CC[C@]12C)O",
          "formula": "C27H44O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "32c7e3e5-aead-497f-aee4-1cfa444647bc"
          },
          "defined_stereo": 7,
          "ez_centers": 0,
          "molecular_weight": "384.6387",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 7
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f01d709a-fa5b-47b1-8dac-bfb1e0f94bac",
      "version": "25",
      "structure": {
        "id": "8a22be4e-b4ed-46c0-b8d0-fd73906bde14",
        "molfile": "\n  Marvin  01132107112D          \n\n 31 34  0  0  1  0            999 V2000\n    6.5063   -6.2278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2146   -5.8048    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.2146   -4.9953    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.9551   -4.7240    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.2172   -3.9743    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.0035   -3.8317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4819   -4.5078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3511   -4.3836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8661   -5.0137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6802   -4.9079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5074   -5.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6652   -3.3857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7874   -4.7240    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4470   -5.3954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9551   -6.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2146   -4.1906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5063   -4.5584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7980   -4.9953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7980   -5.8048    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.0623   -6.2278    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.3449   -5.8048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6412   -6.2278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6412   -7.0464    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.3449   -7.4695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0623   -7.0464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7980   -7.4695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5063   -7.0464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9422   -7.4281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0623   -5.3954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7980   -6.6463    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2146   -6.6463    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  1  0  0  0  0\n  5 12  1  6  0  0  0\n  4 13  1  6  0  0  0\n 14  4  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15  2  1  0  0  0  0\n  3 16  1  1  0  0  0\n 17  3  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 27  1  2  0  0  0  0\n 25 20  1  0  0  0  0\n 23 28  1  1  0  0  0\n 20 29  1  1  0  0  0\n 19  1  1  0  0  0  0\n 19 30  1  6  0  0  0\n  2 31  1  6  0  0  0\nM  END",
        "smiles": "CC(C)CCC[C@@H](C)[C@@]1([H])CC[C@@]2([H])C3=CC=C4C[C@H](CC[C@]4(C)[C@@]3([H])CC[C@]12C)O",
        "formula": "C27H44O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 7,
        "ez_centers": 0,
        "molecular_weight": "384.6387",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "5c0871f2-8036-48e0-b3f5-05eaa8fa2ea7",
          "b38380b1-c7f1-4481-bb69-fbcb6950f897"
        ],
        "stereo_centers": 7
      },
      "unii": "BK1IU07GKF"
    }
  ]
}