{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "386c6bd3-64cd-430e-a9dc-9233bf963eac",
          "code": "N06BX17",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOANALEPTICS|PSYCHOSTIMULANTS, AGENTS USED FOR ADHD AND NOOTROPICS|Other psychostimulants and nootropics|adrafinil",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N06BX17&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "10f7b245-86e6-4c92-a1fc-be6acb8a2a78"
          ]
        },
        {
          "uuid": "d8494e24-7aa2-4521-87ec-27490b920fdc",
          "code": "QN06BX17",
          "comments": "VATC|PSYCHOANALEPTICS|PSYCHOSTIMULANTS, AGENTS USED FOR ADHD AND NOOTROPICS|Other psychostimulants and nootropics|adrafinil",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN06BX17&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "10f7b245-86e6-4c92-a1fc-be6acb8a2a78"
          ]
        },
        {
          "uuid": "0e0d537c-94d7-4f1c-aabc-c6a8f6c59aa6",
          "code": "63547-13-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=63547-13-7",
          "code_system": "CAS",
          "references": [
            "10f7b245-86e6-4c92-a1fc-be6acb8a2a78",
            "4a11c468-20a2-4bfa-a562-8bfd35371709"
          ]
        },
        {
          "uuid": "95302aeb-f93f-4576-b558-efba8d5bbc2a",
          "code": "C81369",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81369",
          "code_system": "NCI_THESAURUS",
          "references": [
            "10f7b245-86e6-4c92-a1fc-be6acb8a2a78"
          ]
        },
        {
          "uuid": "46c43bd8-3f1d-4f90-8224-5a6ef63c9b54",
          "code": "C022116",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67022116",
          "code_system": "MESH",
          "references": [
            "10f7b245-86e6-4c92-a1fc-be6acb8a2a78"
          ]
        },
        {
          "uuid": "6ad2df13-e79c-4207-ad79-718e26dd47cd",
          "code": "ADRAFINIL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Adrafinil",
          "code_system": "WIKIPEDIA",
          "references": [
            "10f7b245-86e6-4c92-a1fc-be6acb8a2a78"
          ]
        },
        {
          "uuid": "8da1f25a-536e-421e-adf8-19c9de7f1d11",
          "code": "SUB05278MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "10f7b245-86e6-4c92-a1fc-be6acb8a2a78"
          ]
        },
        {
          "uuid": "f2684055-f1d1-447e-aa74-9b9b08ba8eab",
          "code": "5110",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5110",
          "code_system": "INN",
          "references": [
            "10f7b245-86e6-4c92-a1fc-be6acb8a2a78"
          ]
        },
        {
          "uuid": "4b847e1e-e619-401a-8698-bbe12528346d",
          "code": "45938",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/45938/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "10f7b245-86e6-4c92-a1fc-be6acb8a2a78"
          ]
        },
        {
          "uuid": "40c64496-81d7-44f5-a026-99096663a730",
          "code": "m1429",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1429?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "10f7b245-86e6-4c92-a1fc-be6acb8a2a78"
          ]
        },
        {
          "uuid": "1097404c-a48c-405b-a378-119dc9685e2f",
          "code": "CHEMBL93077",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL93077",
          "code_system": "ChEMBL",
          "references": [
            "10f7b245-86e6-4c92-a1fc-be6acb8a2a78"
          ]
        },
        {
          "uuid": "e84f3c75-a065-4c4e-90d2-7e9348d0280f",
          "code": "264-303-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.058.440",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "10f7b245-86e6-4c92-a1fc-be6acb8a2a78"
          ]
        },
        {
          "uuid": "ff596fff-3372-4349-a68a-b6dbff26e1e3",
          "code": "3033226",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3033226",
          "code_system": "PUBCHEM",
          "references": [
            "10f7b245-86e6-4c92-a1fc-be6acb8a2a78"
          ]
        },
        {
          "uuid": "7ebecf4c-e94b-8250-ac92-9c91e57b756e",
          "code": "DTXSID4046498",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4046498",
          "code_system": "EPA CompTox",
          "references": [
            "ce7bc775-a2c8-c0eb-14a8-8566b478259c"
          ]
        },
        {
          "uuid": "c51b4f43-e5c8-715d-7726-aacc0f3c33fb",
          "code": "C29709",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Adrenergic Agent[C29747]|Adrenergic Agonist[C87053]|Alpha-Adrenergic Agonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29709",
          "code_system": "NCI_THESAURUS",
          "references": [
            "fafe6981-b60a-8ea9-154e-6b632c221789"
          ]
        },
        {
          "uuid": "d8d3bbd7-e68b-4f40-8062-87c5970bc785",
          "code": "BI81Z4542G",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f5f1ce7e-178a-6ab3-ba33-f8a22f3ddd2f",
          "code": "3424 (Number of products:4)",
          "comments": "Dietary Supplement Label Database|other|Adrafinil",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3424&item=Adrafinil",
          "code_system": "DSLD",
          "references": [
            "fafe6981-b60a-8ea9-154e-6b632c221789"
          ]
        },
        {
          "uuid": "3298461d-06ec-7a6f-1fd3-ae4ee5db8648",
          "code": "95",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/95",
          "code_system": "DRUG CENTRAL",
          "references": [
            "fafe6981-b60a-8ea9-154e-6b632c221789"
          ]
        },
        {
          "uuid": "647fba85-0c56-c898-3f6f-51076fb49c37",
          "code": "DB08925",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB08925",
          "code_system": "DRUG BANK",
          "references": [
            "fafe6981-b60a-8ea9-154e-6b632c221789"
          ]
        },
        {
          "uuid": "6efc3c07-6ef1-c6fb-4e8b-885c677d7283",
          "code": "100000087705",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "37fdfdaa-36f0-d21d-e1f0-55345e3c49cd"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "9bb124c7-2733-4a25-98cd-4f836075b774",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ae31db9b-1021-4876-a506-5f05f9715041",
            "refuuid": "b2f2c770-e9c0-4805-995e-b130149a0295",
            "name": "ADRAFINIL",
            "unii": "BI81Z4542G",
            "linking_id": "BI81Z4542G",
            "ref_pname": "ADRAFINIL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f1b49180-a84c-4b2c-a405-fbd15c845a60",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "5aad45d9-7485-45e0-8d66-63a2ecc6bda2",
            "refuuid": "f6ccbd9e-3dea-4b1c-95da-a2a13a9d97a5",
            "name": "ADRAFINIL, (S)-",
            "unii": "7J4NMN2710",
            "linking_id": "7J4NMN2710",
            "ref_pname": "ADRAFINIL, (S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e244ca46-1941-420f-bde7-dbb0568f4d4a",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "77b145fb-af59-4c9d-b7f8-3e39de5af72a",
            "refuuid": "189e741f-c0bb-48ed-801d-f0ddc26dd629",
            "name": "ADRAFINIL, (R)-",
            "unii": "Z61JQF40LJ",
            "linking_id": "Z61JQF40LJ",
            "ref_pname": "ADRAFINIL, (R)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b6d626b7-b0a0-46f2-b82d-97aceab9209b",
          "name": "2-((DIPHENYLMETHYL)SULFINYL)ACETOHYDROXAMIC ACID",
          "stdName": "2-((DIPHENYLMETHYL)SULFINYL)ACETOHYDROXAMIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5bd34648-00e7-4867-bf7e-968fa9a37da0"
          ],
          "display_name": false
        },
        {
          "uuid": "a015f4f5-1997-4b64-8649-0a2bd371e243",
          "name": "ADRAFINIL",
          "stdName": "ADRAFINIL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6dd066b-ae68-443f-89d9-049bb4eba811",
            "b0445278-88ba-4394-b9d3-65f1801040ac",
            "bf0eb3cf-e323-45bc-b49f-94e4fa009d40",
            "4548d672-2512-408b-8d0d-6dc66298cd40",
            "518aaf10-eca5-4854-9d7f-bde20ca710dd",
            "099d8a6c-4afb-4ef8-a689-bba1087489c3",
            "36a95bcd-1a2a-4dff-9a1f-2310a2b4d8e9",
            "51e9876c-5d54-4951-b45d-358a80ae7fd1",
            "1188b5f2-176e-4445-bee4-798ed3138659",
            "0cb8616e-bf07-f210-042f-85b6edbb288a"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "89ecc2bc-88e8-426a-9335-b4f4ee24134c",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "72df06cf-3b38-4443-9928-65e989476588",
          "name": "ADRAFINIL [MART.]",
          "stdName": "ADRAFINIL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4548d672-2512-408b-8d0d-6dc66298cd40"
          ],
          "display_name": false
        },
        {
          "uuid": "d1fba9ce-e894-449a-b6a2-fe98924b3711",
          "name": "ADRAFINIL [MI]",
          "stdName": "ADRAFINIL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6dd066b-ae68-443f-89d9-049bb4eba811"
          ],
          "display_name": false
        },
        {
          "uuid": "b68d5231-7106-b624-3c0c-662332bbd5c0",
          "name": "ADRAFINIL [NFLIS-DRUG]",
          "stdName": "ADRAFINIL [NFLIS-DRUG]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0cb8616e-bf07-f210-042f-85b6edbb288a"
          ],
          "display_name": false
        },
        {
          "uuid": "0fdecc2b-7fe2-baca-672b-24dc1b9a173c",
          "name": "Adrafinil [WHO-DD]",
          "stdName": "ADRAFINIL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49a041f2-a611-c4f2-b676-c820b3373240"
          ],
          "display_name": false
        },
        {
          "uuid": "a2893ca6-40a9-43b7-87af-fb1291a0016e",
          "name": "OLMIFON",
          "stdName": "OLMIFON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "499ccafe-9212-4428-b71a-379bd73b76b5",
            "87b06a6f-1541-4572-b35e-7fbb7af2e6b4"
          ],
          "display_name": false
        },
        {
          "uuid": "9cd1f784-6a60-4678-926d-156c92a26a47",
          "name": "adrafinil [INN]",
          "stdName": "ADRAFINIL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bf0eb3cf-e323-45bc-b49f-94e4fa009d40"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "099d8a6c-4afb-4ef8-a689-bba1087489c3",
          "citation": "USP  DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5bd34648-00e7-4867-bf7e-968fa9a37da0",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf0eb3cf-e323-45bc-b49f-94e4fa009d40",
          "citation": "INN Proposed List 69",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL69.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4548d672-2512-408b-8d0d-6dc66298cd40",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6dd066b-ae68-443f-89d9-049bb4eba811",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "499ccafe-9212-4428-b71a-379bd73b76b5",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87b06a6f-1541-4572-b35e-7fbb7af2e6b4",
          "citation": "D07348",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "51e9876c-5d54-4951-b45d-358a80ae7fd1",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10f7b245-86e6-4c92-a1fc-be6acb8a2a78",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389667000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96c774c1-4b1d-4fdf-99a4-cea0bb7446ab",
          "citation": "SRS import [BI81Z4542G]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=BI81Z4542G",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389667000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5008915d-cb18-4234-824b-f04f344c1ecb",
          "citation": "USP DICTIONARY 2008; INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "518aaf10-eca5-4854-9d7f-bde20ca710dd",
          "citation": "ADRAFINIL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1188b5f2-176e-4445-bee4-798ed3138659",
          "citation": "ADRAFINIL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "36a95bcd-1a2a-4dff-9a1f-2310a2b4d8e9",
          "citation": "ADRAFINIL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b0445278-88ba-4394-b9d3-65f1801040ac",
          "citation": "ADRAFINIL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ce7bc775-a2c8-c0eb-14a8-8566b478259c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=63547-13-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fafe6981-b60a-8ea9-154e-6b632c221789",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4a11c468-20a2-4bfa-a562-8bfd35371709",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0cb8616e-bf07-f210-042f-85b6edbb288a",
          "citation": "NFLIS-DRUG List (Date 4/5/2017)",
          "url": "https://www.nflis.deadiversion.usdoj.gov/DesktopModules/DrugList/NFLISDrugListDateSorted.pdf",
          "doc_type": "WEBSITE",
          "public_domain": true
        },
        {
          "uuid": "49a041f2-a611-c4f2-b676-c820b3373240",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "37fdfdaa-36f0-d21d-e1f0-55345e3c49cd",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "13d2bf8e-54b1-4e7d-8f92-b7e46dba7d60",
          "id": "13d2bf8e-54b1-4e7d-8f92-b7e46dba7d60",
          "molfile": "\n  Marvin  01132101142D          \n\n 20 21  0  0  0  0            999 V2000\n    9.7527   -7.0981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9306   -7.0981    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5194   -6.3775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9306   -5.6800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6973   -6.3775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2769   -5.6384    0.0000 S   0  0  0  0  0  0  0  0  0  3  0  0\n    7.6973   -4.9410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4640   -5.6384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0437   -6.3775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2215   -6.3775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8058   -7.0749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2215   -7.7956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0437   -7.7956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4640   -7.0749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0437   -4.9410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2122   -4.9410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8058   -4.2111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2215   -3.4906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0437   -3.4906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4455   -4.2111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  2  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 15  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 14  9  2  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 20 15  2  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)C(c2ccccc2)S(=O)CC(=O)NO",
          "formula": "C15H15NO3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9453e10a-8ec5-4b8e-8d1c-dde3f01039f8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "289.3512",
          "optical_activity": "NONE",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b2f2c770-e9c0-4805-995e-b130149a0295",
      "version": "15",
      "structure": {
        "id": "905412ac-4208-4833-af93-4b0f2cfcf59b",
        "molfile": "\n  Marvin  01132107292D          \n\n 20 21  0  0  0  0            999 V2000\n    7.2769   -5.6384    0.0000 S   0  3  0  0  0  0  0  0  0  0  0  0\n    7.6973   -6.3775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5194   -6.3775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9306   -5.6800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9306   -7.0981    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7527   -7.0981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4640   -5.6384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0437   -6.3775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2215   -6.3775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8058   -7.0749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2215   -7.7956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0437   -7.7956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4640   -7.0749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0437   -4.9410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2122   -4.9410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8058   -4.2111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2215   -3.4906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0437   -3.4906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4455   -4.2111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6973   -4.9410    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13  8  2  0  0  0  0\n 14  7  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 14  1  0  0  0  0\n 20  1  1  0  0  0  0\nM  CHG  2   1   1  20  -1\nM  END",
        "smiles": "c1ccc(cc1)C(c2ccccc2)[S+](CC(=O)NO)[O-]",
        "formula": "C15H15NO3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "289.3512",
        "optical_activity": "( + / - )",
        "references": [
          "96c774c1-4b1d-4fdf-99a4-cea0bb7446ab",
          "5008915d-cb18-4234-824b-f04f344c1ecb",
          "bf0eb3cf-e323-45bc-b49f-94e4fa009d40"
        ],
        "stereo_centers": 1
      },
      "unii": "BI81Z4542G"
    }
  ]
}