{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8de21356-7d96-4f2e-87d3-ce68e6adf070",
          "code": "15356-74-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=15356-74-8",
          "code_system": "CAS",
          "references": [
            "1f5bfbd5-60e6-4074-ad52-df8ec00c5b16",
            "b45053af-33ff-4812-a6cd-5c84076cef3d"
          ]
        },
        {
          "uuid": "8bc94196-e78f-4e5a-bd1e-b3ed71002d28",
          "code": "m4458",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4458?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "1f5bfbd5-60e6-4074-ad52-df8ec00c5b16"
          ]
        },
        {
          "uuid": "1b4d4917-6355-4044-b3de-e79a14808e97",
          "code": "239-390-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.035.794",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1f5bfbd5-60e6-4074-ad52-df8ec00c5b16"
          ]
        },
        {
          "uuid": "06cb632d-3674-4230-853e-308a3165c2c0",
          "code": "27209",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/27209",
          "code_system": "PUBCHEM",
          "references": [
            "1f5bfbd5-60e6-4074-ad52-df8ec00c5b16"
          ]
        },
        {
          "uuid": "9fa8e273-9c1c-5a0e-7e61-723d421d48f7",
          "code": "DTXSID00864588",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00864588",
          "code_system": "EPA CompTox",
          "references": [
            "39775f5a-ca5b-5f2e-b90d-6ad9b9cb229e"
          ]
        },
        {
          "uuid": "4e1ebe72-f669-4865-93d3-c4a87caeeb13",
          "code": "BH8469LVA9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "217036e4-dc28-03f6-b90a-72a5d17f47ca",
          "code": "1155",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1155/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "b83f91c0-d838-1194-ce92-51e0becb8479"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2e52dea9-23c0-4e93-9589-7ad2acaba9d5",
          "name": "(2,6,6-TRIMETHYL-2-HYDROXYCYCLOHEXYLIDENE)ACETIC ACID .GAMMA.-LACTONE",
          "stdName": "(2,6,6-TRIMETHYL-2-HYDROXYCYCLOHEXYLIDENE)ACETIC ACID .GAMMA.-LACTONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67a306fd-33cb-4965-945a-b35447a60c2b"
          ],
          "display_name": false
        },
        {
          "uuid": "7a262f5d-a066-483f-8e88-3c67aba4aab5",
          "name": "(±)-(2,6,6,-TRIMETHYL-2-HYDROXYCYCLOHEXYLIDENE)ACETIC ACID .GAMMA.-LACTONE [FHFI]",
          "stdName": "(+/-)-(2,6,6,-TRIMETHYL-2-HYDROXYCYCLOHEXYLIDENE)ACETIC ACID .GAMMA.-LACTONE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "854f3041-761d-4dc0-bd82-fbe0150bcb81"
          ],
          "display_name": false
        },
        {
          "uuid": "8d0df16d-93e4-45bf-b746-35be4cbc7999",
          "name": "(±)-DIHYDROACTINIDIOLIDE",
          "stdName": "(+/-)-DIHYDROACTINIDIOLIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ffce29d-1485-4fe9-bb58-2e4c22d6f6f8"
          ],
          "display_name": false
        },
        {
          "uuid": "ebc51b27-131d-4ba6-91fa-ae557e17efc4",
          "name": "DIHYDROACTINIDIOLIDE [MI]",
          "stdName": "DIHYDROACTINIDIOLIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8c30015-6c2e-4513-b6e2-4a73bfd3afdc"
          ],
          "display_name": false
        },
        {
          "uuid": "953830d4-86d4-460e-a8c2-b3369e2b5b41",
          "name": "DIHYDROACTINIDIOLIDE, (±)-",
          "stdName": "DIHYDROACTINIDIOLIDE, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b48a59a-e7bc-4dc0-936c-f9bee7220cbf"
          ],
          "display_name": true
        },
        {
          "uuid": "e3e1d778-22b4-4789-b3f8-502168693f2a",
          "name": "FEMA NO. 4020",
          "stdName": "FEMA NO. 4020",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "854f3041-761d-4dc0-bd82-fbe0150bcb81"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "67a306fd-33cb-4965-945a-b35447a60c2b",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0b48a59a-e7bc-4dc0-936c-f9bee7220cbf",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "854f3041-761d-4dc0-bd82-fbe0150bcb81",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8c30015-6c2e-4513-b6e2-4a73bfd3afdc",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ffce29d-1485-4fe9-bb58-2e4c22d6f6f8",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f5bfbd5-60e6-4074-ad52-df8ec00c5b16",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392436000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0aa7082e-2f33-4ff8-bf92-7b90cc7e5800",
          "citation": "SRS import [BH8469LVA9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=BH8469LVA9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392436000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "39775f5a-ca5b-5f2e-b90d-6ad9b9cb229e",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "b45053af-33ff-4812-a6cd-5c84076cef3d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b83f91c0-d838-1194-ce92-51e0becb8479",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "684cde9d-81cd-408f-8afe-c7bf2a90934b",
          "id": "684cde9d-81cd-408f-8afe-c7bf2a90934b",
          "molfile": "\n  Marvin  01132105252D          \n\n 13 14  0  0  0  0            999 V2000\n   16.1301  -11.7595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0438  -10.9391    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   15.3292  -11.3516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6148  -10.9391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6148  -10.1141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3292   -9.7016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7990   -9.0696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8596   -9.0696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0438  -10.1141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8284   -9.8591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3134  -10.5266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1384  -10.5266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8284  -11.1940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  9  1  0  0  0  0\n  2 13  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9  6  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\nM  END",
          "smiles": "CC1(C)CCCC2(C)C1=CC(=O)O2",
          "formula": "C11H16O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "381da00a-fd40-4bae-b897-dd4ec3792a8d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "180.244",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f35e6d5a-4ad3-441a-bce9-611a7491f617",
      "version": "6",
      "structure": {
        "id": "bebcaff5-101a-42ed-8ddd-1d74725e3c0a",
        "molfile": "\n  Marvin  01132109522D          \n\n 13 14  0  0  0  0            999 V2000\n   16.1301  -11.7595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0438  -10.9391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3292  -11.3516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6148  -10.9391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6148  -10.1141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3292   -9.7016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7990   -9.0696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8596   -9.0696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0438  -10.1141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8284   -9.8591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3134  -10.5266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1384  -10.5266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8284  -11.1940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  9  6  1  0  0  0  0\n  2  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n  2 13  1  0  0  0  0\n 13 11  1  0  0  0  0\nM  END",
        "smiles": "CC1(C)CCCC2(C)C1=CC(=O)O2",
        "formula": "C11H16O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "180.244",
        "optical_activity": "( + / - )",
        "references": [
          "1ffce29d-1485-4fe9-bb58-2e4c22d6f6f8",
          "0aa7082e-2f33-4ff8-bf92-7b90cc7e5800"
        ],
        "stereo_centers": 1
      },
      "unii": "BH8469LVA9"
    }
  ]
}