{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "91ddf4aa-55a2-4948-842f-3fdb427c5cf6", "code": "1843-03-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1843-03-4", "code_system": "CAS", "references": [ "f739b7ed-ec3c-449b-a07c-b7ddcc98d647", "553382d9-7b14-4359-bb93-e486a48c788b" ] }, { "uuid": "5ed06ff4-e1d4-42b0-920e-91b6f2d7d9c7", "code": "217-420-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.015.837", "code_system": "ECHA (EC/EINECS)", "references": [ "f739b7ed-ec3c-449b-a07c-b7ddcc98d647" ] }, { "uuid": "b42a1a8e-200d-4127-847f-39f4e6f6a5a3", "code": "92905", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/92905", "code_system": "PUBCHEM", "references": [ "f739b7ed-ec3c-449b-a07c-b7ddcc98d647" ] }, { "uuid": "4d070b43-c91b-f6d0-9b11-cf0693e44be9", "code": "DTXSID0038883", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0038883", "code_system": "EPA CompTox", "references": [ "d7430596-805d-c683-5c02-ee03289c5c63" ] }, { "uuid": "dc22ddf0-bc70-7cc3-0e58-0628d6fa56d9", "code": "1872247", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1872247/allProperties.xml?prop=all", "code_system": "RXCUI" }, { "uuid": "f740ee84-5c5a-46b6-8bcf-5bde31b4f2d6", "code": "BF6E9O0XJN", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "94e37f33-7c01-1b47-8868-3db183c3c403", "code": "BF6E9O0XJN", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=BF6E9O0XJN", "code_system": "DAILYMED", "references": [ "0fc9bd85-273e-8aed-b299-57be24f9eb44" ] } ], "substance_class": "chemical", "names": [ { "uuid": "7e0d89c7-161c-4678-a2c9-be3de74cfa40", "name": "1,1,3-TRI(3-TERT-BUTYL-4-HYDROXY-6-METHYLPHENYL)BUTANE", "stdName": "1,1,3-TRI(3-TERT-BUTYL-4-HYDROXY-6-METHYLPHENYL)BUTANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c5d66a0a-9c32-4ac0-a92e-307f1e2f5dc7" ], "display_name": true }, { "uuid": "b1165d1b-7a86-4b86-a2c1-2823f410226c", "name": "1,1,3-TRIS(5-TERT-BUTYL-4-HYDROXY-2-METHYLPHENYL)BUTANE", "stdName": "1,1,3-TRIS(5-TERT-BUTYL-4-HYDROXY-2-METHYLPHENYL)BUTANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "279ba4c2-5d61-4f0b-9e37-209339ed6be9" ], "display_name": false }, { "uuid": "f3aec1ac-f0e8-4db9-bfd4-ca902dae392e", "name": "4,4',4''-(1-METHYL-1-PROPANYL-3-YLIDENE)TRIS(2-(1,1- DIMETHYLETHYL- )-5-METHYLPHNOL)", "stdName": "4,4',4''-(1-METHYL-1-PROPANYL-3-YLIDENE)TRIS(2-(1,1- DIMETHYLETHYL- )-5-METHYLPHNOL)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "95450fbb-122c-4f0b-beb5-d037713b230e" ], "display_name": false }, { "uuid": "3ac91918-2a07-4c74-9f4e-aaab7841a9d0", "name": "4,4',4''-(1-METHYLPROPANYL-3-YLIDENE)TRIS(6-TERT-BUTYL-M- CRESOL)", "stdName": "4,4',4''-(1-METHYLPROPANYL-3-YLIDENE)TRIS(6-TERT-BUTYL-M- CRESOL)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "95450fbb-122c-4f0b-beb5-d037713b230e" ], "display_name": false }, { "uuid": "bb25eed9-8ac8-4355-ab2b-b502cb020145", "name": "M-CRESOL, 4,4',4''-(1-METHYL-1-PROPANYL-3-YLIDENE)TRIS(6-TERT-BUTYL-", "stdName": "M-CRESOL, 4,4',4''-(1-METHYL-1-PROPANYL-3-YLIDENE)TRIS(6-TERT-BUTYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c5d66a0a-9c32-4ac0-a92e-307f1e2f5dc7" ], "display_name": false }, { "uuid": "2eb492ec-f5de-4394-9dcb-18c51a866b90", "name": "PHENOL, 4,4',4''-(1-METHYL-1-PROPANYL-3-YLIDENE)TRIS(2-(1,1-DIMETHYLETHYL)-5-METHYL-", "stdName": "PHENOL, 4,4',4''-(1-METHYL-1-PROPANYL-3-YLIDENE)TRIS(2-(1,1-DIMETHYLETHYL)-5-METHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c5d66a0a-9c32-4ac0-a92e-307f1e2f5dc7" ], "display_name": false }, { "uuid": "3d89e3b3-cadb-4a29-8fa4-896471948af5", "name": "TOPANOL CA", "stdName": "TOPANOL CA", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "95450fbb-122c-4f0b-beb5-d037713b230e" ], "display_name": false }, { "uuid": "09c98c29-e11c-41b8-bcfa-9a9b4f596983", "name": "TRI(BUTYLCRESYL)BUTANE", "stdName": "TRI(BUTYLCRESYL)BUTANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "95450fbb-122c-4f0b-beb5-d037713b230e" ], "display_name": false } ], "references": [ { "uuid": "279ba4c2-5d61-4f0b-9e37-209339ed6be9", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "95450fbb-122c-4f0b-beb5-d037713b230e", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c5d66a0a-9c32-4ac0-a92e-307f1e2f5dc7", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f739b7ed-ec3c-449b-a07c-b7ddcc98d647", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392540000, "tags": [ "NOMEN" ] }, { "uuid": "1c9a5d39-7eed-4dac-b3a5-4ecfaf2a9272", "citation": "SRS import [BF6E9O0XJN]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=BF6E9O0XJN", "doc_type": "SRS", "public_domain": true, "document_date": 1493392540000, "tags": [ "NOMEN" ] }, { "uuid": "d7430596-805d-c683-5c02-ee03289c5c63", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1843-03-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "553382d9-7b14-4359-bb93-e486a48c788b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "0fc9bd85-273e-8aed-b299-57be24f9eb44", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "f04472c8-8b36-4aa2-9370-fa31d3723518", "id": "f04472c8-8b36-4aa2-9370-fa31d3723518", "molfile": "\n Marvin 01132112282D \n\n 40 42 0 0 0 0 999 V2000\n -0.8692 0.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8692 -0.7941 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n -0.1547 -1.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5598 -0.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5598 0.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1547 0.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1547 1.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5598 1.6809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5598 2.5059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2743 1.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2743 0.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9887 0.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8692 1.6809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5836 2.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8692 2.5059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5836 1.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5836 -1.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2981 -0.8559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0126 -1.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0126 -2.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7270 -2.5059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2981 -2.5059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5836 -2.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8692 -2.5059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7477 -0.6703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7477 0.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4415 -0.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4415 -1.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5836 -1.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2981 -0.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0126 -1.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0126 -2.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7270 -2.4441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2981 -2.4441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5836 -2.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8692 -2.4441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7270 -0.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4415 -0.3816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7270 0.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4415 -1.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 29 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 17 1 0 0 0 0\n 6 5 1 0 0 0 0\n 5 11 2 0 0 0 0\n 7 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 7 13 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 2 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 13 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 17 23 2 0 0 0 0\n 19 18 2 0 0 0 0\n 20 19 1 0 0 0 0\n 19 25 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 22 2 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 27 1 0 0 0 0\n 25 28 1 0 0 0 0\n 30 29 1 0 0 0 0\n 29 35 2 0 0 0 0\n 31 30 2 0 0 0 0\n 32 31 1 0 0 0 0\n 31 37 1 0 0 0 0\n 32 33 1 0 0 0 0\n 32 34 2 0 0 0 0\n 35 34 1 0 0 0 0\n 35 36 1 0 0 0 0\n 37 38 1 0 0 0 0\n 37 39 1 0 0 0 0\n 37 40 1 0 0 0 0\nM END", "smiles": "CC(CC(c1cc(c(cc1C)O)C(C)(C)C)c2cc(c(cc2C)O)C(C)(C)C)c3cc(c(cc3C)O)C(C)(C)C", "formula": "C37H52O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "8092c838-4847-40da-bf30-0bbd8bd41c1a" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "544.8084", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "cc13b9a4-7236-43e0-8fe3-7995986b0efe", "version": "5", "structure": { "id": "1aa003fb-e43c-4e98-9898-d8b498a71b8f", "molfile": "\n Marvin 01132101342D \n\n 40 42 0 0 0 0 999 V2000\n -0.8692 -0.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1547 -1.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5598 -0.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8692 0.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0126 -2.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.0126 -1.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2981 -0.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5836 -1.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5836 -2.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2981 -2.4441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7270 -2.4441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8692 -2.4441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7270 -0.7941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4415 -0.3816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7270 0.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.4415 -1.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5598 1.6809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1547 1.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.1547 0.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5598 0.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2743 0.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2743 1.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5598 2.5059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9887 0.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8692 1.6809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5836 2.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8692 2.5059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5836 1.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0126 -2.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0126 -1.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2981 -0.8559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5836 -1.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5836 -2.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2981 -2.5059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7270 -2.5059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8692 -2.5059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7477 -0.6703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7477 0.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4415 -0.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4415 -1.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 1 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 5 10 2 0 0 0 0\n 5 11 1 0 0 0 0\n 9 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 13 16 1 0 0 0 0\n 6 13 1 0 0 0 0\n 1 8 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 17 22 2 0 0 0 0\n 17 23 1 0 0 0 0\n 21 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 27 1 0 0 0 0\n 25 28 1 0 0 0 0\n 18 25 1 0 0 0 0\n 3 20 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 33 34 1 0 0 0 0\n 29 34 2 0 0 0 0\n 29 35 1 0 0 0 0\n 33 36 1 0 0 0 0\n 37 38 1 0 0 0 0\n 37 39 1 0 0 0 0\n 37 40 1 0 0 0 0\n 30 37 1 0 0 0 0\n 3 32 1 0 0 0 0\nM END", "smiles": "CC(CC(c1cc(c(cc1C)O)C(C)(C)C)c2cc(c(cc2C)O)C(C)(C)C)c3cc(c(cc3C)O)C(C)(C)C", "formula": "C37H52O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "544.8084", "optical_activity": "( + / - )", "references": [ "c5d66a0a-9c32-4ac0-a92e-307f1e2f5dc7", "1c9a5d39-7eed-4dac-b3a5-4ecfaf2a9272" ], "stereo_centers": 1 }, "unii": "BF6E9O0XJN" } ] }