{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "8f659755-2d38-470c-b1c3-5fc49612cbe9", "code": "207-843-5", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.131", "code_system": "ECHA (EC/EINECS)", "references": [ "fe4da9d5-b76c-48c6-a521-dc546835b34a" ] }, { "uuid": "a0ae30a0-37e5-435b-b06b-433d2178563b", "code": "1314350", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1314350/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "fe4da9d5-b76c-48c6-a521-dc546835b34a" ] }, { "uuid": "94e028a6-c69a-4dc9-83a7-bdfb3d56d8c3", "code": "m4990", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m4990?q=authorize", "code_system": "MERCK INDEX", "references": [ "fe4da9d5-b76c-48c6-a521-dc546835b34a" ] }, { "uuid": "f6d53df4-0506-4c0a-83a1-e83269c41db5", "code": "5351619", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5351619", "code_system": "PUBCHEM", "references": [ "fe4da9d5-b76c-48c6-a521-dc546835b34a" ] }, { "uuid": "3fe8c2ee-f7ec-470a-88c1-46969fa01649", "code": "497-30-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=497-30-3", "code_system": "CAS", "references": [ "fe4da9d5-b76c-48c6-a521-dc546835b34a", "640fcdd3-dab7-440f-9a51-65d3d8596021" ] }, { "uuid": "c95af410-15f5-4c7a-af94-83b909a57436", "code": "D004880", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/68004880", "code_system": "MESH", "references": [ "fe4da9d5-b76c-48c6-a521-dc546835b34a" ] }, { "uuid": "e73231dc-8073-4ba8-8f5c-713e01bfeffd", "code": "ERGOTHIONEINE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Ergothioneine", "code_system": "WIKIPEDIA", "references": [ "fe4da9d5-b76c-48c6-a521-dc546835b34a" ] }, { "uuid": "05e88ae6-24cf-b5f7-b463-56d545287b44", "code": "4323 (Number of products:1)", "comments": "Dietary Supplement Label Database|TBD|Ergothioneine", "type": "PRIMARY", "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=4323&item=Ergothioneine", "code_system": "DSLD", "references": [ "a57375e1-48fb-861d-7181-a9b32e5c9c51" ] }, { "uuid": "89ece1a5-7888-44a0-bf46-871f22a93099", "code": "BDZ3DQM98W", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "a28ab3ec-a1b6-f365-fad5-34d8bfff7b93", "code": "134344", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:134344", "code_system": "CHEBI", "references": [ "a57375e1-48fb-861d-7181-a9b32e5c9c51" ] }, { "uuid": "465cde96-315c-e3eb-e9c0-b2cf4e556641", "code": "4828", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:4828", "code_system": "CHEBI", "references": [ "a57375e1-48fb-861d-7181-a9b32e5c9c51" ] }, { "uuid": "cb2cb6de-8828-068d-bcf7-c9c86b0ae8b8", "code": "82707", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:82707", "code_system": "CHEBI", "references": [ "a57375e1-48fb-861d-7181-a9b32e5c9c51" ] }, { "uuid": "0b65f57d-add6-5b75-9c59-58ca0a8cf918", "code": "DTXSID901020082", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID901020082", "code_system": "EPA CompTox", "references": [ "a57375e1-48fb-861d-7181-a9b32e5c9c51" ] }, { "uuid": "cfec7f70-cb80-2221-e07e-9ca94e05c503", "code": "300000022775", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "a9960b97-4d70-f689-c6ab-7ef66c8c485b" ] }, { "uuid": "584c466d-9b93-80d1-6aa9-a317ab99f005", "code": "7175", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=7175", "code_system": "NSC", "references": [ "3015d969-461d-ab19-43e4-45e57e47c6ac" ] }, { "uuid": "9d5411e5-5cda-b5b6-e974-50533069636f", "code": "BDZ3DQM98W", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=BDZ3DQM98W", "code_system": "DAILYMED", "references": [ "0dbcc059-402a-bc31-b584-57268c43667a" ] }, { "uuid": "59fb9992-1c5c-1c2f-e92d-41ab223c51eb", "code": "734", "type": "PRIMARY", "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=734", "code_system": "GRAS Notification (GRN No.)", "references": [ "a57375e1-48fb-861d-7181-a9b32e5c9c51" ] }, { "uuid": "1a22d412-bfbf-4ccd-a525-797643f5a3a8", "code": "918722", "comments": "ORPHAN DRUG|Designated|Treatment of Cystinuria", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=918722", "code_system": "FDA ORPHAN DRUG" } ], "substance_class": "chemical", "references": [ { "uuid": "7b3d8163-e915-426f-b5a4-58a38c8de61e", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "814c1bbd-ad1d-4e91-ac7e-ecb8442ca18a", "citation": "MERCK DL", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0f10cba5-5a7c-4d45-98af-1f51dfdb2258", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "82f52bba-507d-417b-bc34-286b51597ed1", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "10b7c68b-d03b-4d26-933f-0a3faa6429a1", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "53733f5e-dc4e-44ca-970d-8fb4be163585", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fe4da9d5-b76c-48c6-a521-dc546835b34a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390466000, "tags": [ "NOMEN" ] }, { "uuid": "06a4c614-108a-4b21-b5d6-c7d706ac9191", "citation": "SRS import [BDZ3DQM98W]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=BDZ3DQM98W", "doc_type": "SRS", "public_domain": true, "document_date": 1493390466000, "tags": [ "NOMEN" ] }, { "uuid": "d3e27e57-6b29-4306-9ac4-201386b3d057", "citation": "ERGOTHIONEINE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "49fe5905-a8d1-43a5-93f7-2950142bb187", "citation": "ERGOTHIONEINE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "065a36ff-61a4-4fb0-8769-609be28f9075", "citation": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&sort=GRN_No&order=DESC&startrow=1&type=basic&search=", "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&sort=GRN_No&order=DESC&startrow=1&type=basic&search=", "doc_type": "CFSAN", "public_domain": true }, { "uuid": "a57375e1-48fb-861d-7181-a9b32e5c9c51", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "640fcdd3-dab7-440f-9a51-65d3d8596021", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "3015d969-461d-ab19-43e4-45e57e47c6ac", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "0dbcc059-402a-bc31-b584-57268c43667a", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "a9960b97-4d70-f689-c6ab-7ef66c8c485b", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "5dc35661-1d98-4f75-9c43-7b1a8bfbbb62", "citation": "FDA", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=918722", "doc_type": "ORPHAN DRUG", "public_domain": true }, { "uuid": "d1c478c5-bf5e-4087-ba00-082e9cae244a", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c26df891-5bf9-4868-9af2-896ef774febe", "id": "c26df891-5bf9-4868-9af2-896ef774febe", "molfile": "\n Marvin 01132110032D \n\n 15 15 0 0 1 0 999 V2000\n 5.5308 -2.6533 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 4.8163 -2.2407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1019 -2.6533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0156 -3.4737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2086 -3.6452 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7962 -2.9308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9756 -2.8445 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3482 -2.3177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2453 -2.2407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9597 -2.6533 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 6.2453 -1.4157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5308 -3.4783 0.0000 N 0 3 1 0 0 0 0 0 0 3 0 0\n 6.2453 -3.8907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8163 -3.8907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5308 -4.3033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 9 1 0 0 0 0\n 1 12 1 1 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 3 8 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 2 0 0 0 0\n 8 6 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 2 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 12 15 1 0 0 0 0\nM CHG 2 10 -1 12 1\nM END", "smiles": "C[N+](C)(C)[C@@H](Cc1c[nH]c(=S)[nH]1)C(=O)[O-]", "formula": "C9H15N3O2S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "EPIMERIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "bdd8255b-25f4-41ce-ab2e-7bfbdf8cbbc3" }, "defined_stereo": 1, "ez_centers": 0, "molecular_weight": "229.3007", "optical_activity": "UNSPECIFIED", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "91dcabad-2d77-4d14-b696-3e1f013e520e", "version": "16", "structure": { "id": "f8092fd3-b33c-4143-b25f-92f9f1efa7f5", "molfile": "\n Marvin 01132112512D \n\n 15 15 0 0 1 0 999 V2000\n 5.5308 -2.6533 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 4.8163 -2.2407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1019 -2.6533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3482 -2.3177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7962 -2.9308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2086 -3.6452 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0156 -3.4737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9756 -2.8445 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5308 -3.4783 0.0000 N 0 3 1 0 0 0 0 0 0 0 0 0\n 6.2453 -3.8907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8163 -3.8907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5308 -4.3033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2453 -2.2407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9597 -2.6533 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 6.2453 -1.4157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 6 1 0 0 0 0\n 3 7 2 0 0 0 0\n 5 8 2 0 0 0 0\n 1 9 1 1 0 0 0\n 9 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 9 12 1 0 0 0 0\n 1 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 2 0 0 0 0\nM CHG 2 9 1 14 -1\nM END", "smiles": "C[N+](C)(C)[C@@H](Cc1c[nH]c(=S)[nH]1)C(=O)[O-]", "formula": "C9H15N3O2S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 1, "ez_centers": 0, "molecular_weight": "229.3007", "optical_activity": "UNSPECIFIED", "references": [ "7b3d8163-e915-426f-b5a4-58a38c8de61e", "06a4c614-108a-4b21-b5d6-c7d706ac9191" ], "stereo_centers": 1 }, "unii": "BDZ3DQM98W", "relationships": [ { "uuid": "33c1feae-eaad-427a-8c28-d65b52037af5", "amount": { "uuid": "ab4973ad-648a-4bcc-b676-557cad8623cb" }, "type": "SALT/SOLVATE->PARENT", "references": [ "d1c478c5-bf5e-4087-ba00-082e9cae244a" ], "related_substance": { "uuid": "ba53b64c-aef0-4a66-a7af-7c232c663357", "refuuid": "b82b5ff9-2166-4a02-a19a-4dc4849c1e10", "name": "ERGOTHIONEINE HYDROCHLORIDE", "unii": "V688K433V6", "linking_id": "V688K433V6", "ref_pname": "ERGOTHIONEINE HYDROCHLORIDE", "substance_class": "reference" } } ], "names": [ { "uuid": "bd9fe345-1bb4-4b67-b27b-35ddc6db2a4c", "name": "(.ALPHA.S)-.ALPHA.-CARBOXY-2,3-DIHYDRO-N,N,N-TRIMETHYL-2-THIOXO-1H-IMIDAZOLE-4-ETHANAMINIUM INNER SALT", "stdName": "(.ALPHA.S)-.ALPHA.-CARBOXY-2,3-DIHYDRO-N,N,N-TRIMETHYL-2-THIOXO-1H-IMIDAZOLE-4-ETHANAMINIUM INNER SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7b3d8163-e915-426f-b5a4-58a38c8de61e", "0f10cba5-5a7c-4d45-98af-1f51dfdb2258" ], "display_name": false }, { "uuid": "97c0cb1b-f0f2-49ba-adfb-b1aa76c5ca13", "name": "ERGOTHIONEINE", "stdName": "ERGOTHIONEINE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "10b7c68b-d03b-4d26-933f-0a3faa6429a1", "7b3d8163-e915-426f-b5a4-58a38c8de61e", "82f52bba-507d-417b-bc34-286b51597ed1", "0f10cba5-5a7c-4d45-98af-1f51dfdb2258", "49fe5905-a8d1-43a5-93f7-2950142bb187", "814c1bbd-ad1d-4e91-ac7e-ecb8442ca18a", "d3e27e57-6b29-4306-9ac4-201386b3d057" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "67746559-2d4a-4296-92af-e968a8f267bd", "name_org": "INCI" } ] }, { "uuid": "eac60056-b472-46f0-a981-b72ec8eb52d1", "name": "ERGOTHIONEINE [MI]", "stdName": "ERGOTHIONEINE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "82f52bba-507d-417b-bc34-286b51597ed1", "0f10cba5-5a7c-4d45-98af-1f51dfdb2258" ], "display_name": false }, { "uuid": "3ebbed5f-a569-4f72-886c-efc8eb20e1be", "name": "ERGOTHIONINE", "stdName": "ERGOTHIONINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "065a36ff-61a4-4fb0-8769-609be28f9075" ], "display_name": false }, { "uuid": "d50a586f-ce60-41d3-affd-5d2fcc1beca1", "name": "L(+)-ERGOTHIONEINE", "stdName": "L(+)-ERGOTHIONEINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7b3d8163-e915-426f-b5a4-58a38c8de61e", "0f10cba5-5a7c-4d45-98af-1f51dfdb2258" ], "display_name": false }, { "uuid": "773ac348-8db8-4581-bb55-f304d169c8ab", "name": "L-Ergothioneine", "stdName": "L-ERGOTHIONEINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5dc35661-1d98-4f75-9c43-7b1a8bfbbb62" ], "display_name": false }, { "uuid": "fe6ee31d-3b53-4308-846e-bc1d07b67c5e", "name": "NSC-7175", "stdName": "NSC-7175", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "53733f5e-dc4e-44ca-970d-8fb4be163585", "0f10cba5-5a7c-4d45-98af-1f51dfdb2258" ], "display_name": false }, { "uuid": "52bdf8f7-e407-440d-a10a-91402b0f7118", "name": "SYMPECTOTHION", "stdName": "SYMPECTOTHION", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7b3d8163-e915-426f-b5a4-58a38c8de61e", "0f10cba5-5a7c-4d45-98af-1f51dfdb2258" ], "display_name": false }, { "uuid": "492d1235-453d-449d-a93d-d91f8df756b6", "name": "THIASINE", "stdName": "THIASINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7b3d8163-e915-426f-b5a4-58a38c8de61e", "0f10cba5-5a7c-4d45-98af-1f51dfdb2258" ], "display_name": false }, { "uuid": "a1a93a0b-d468-4fdf-947a-9e72f19080e1", "name": "THIONEINE", "stdName": "THIONEINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7b3d8163-e915-426f-b5a4-58a38c8de61e", "0f10cba5-5a7c-4d45-98af-1f51dfdb2258" ], "display_name": false } ], "modifications": { "uuid": "c1826384-b5f6-45d0-85da-b1856c56ecd8" } } ] }