{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8a36a716-5b78-44ae-a310-b087873708a5",
          "code": "1067-33-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1067-33-0",
          "code_system": "CAS",
          "references": [
            "2e6d8c51-4145-4d1b-b326-9e5cdf4027ff",
            "6d70006f-bf87-4335-b3b3-636397df937e"
          ]
        },
        {
          "uuid": "87f9fc7a-f875-41ac-9193-56953a402213",
          "code": "213-928-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.663",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2e6d8c51-4145-4d1b-b326-9e5cdf4027ff"
          ]
        },
        {
          "uuid": "9315061d-95eb-1f3a-7cdf-bf65c51dfcb1",
          "code": "4115",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/4115",
          "code_system": "HSDB",
          "references": [
            "ae7ebde1-8337-0e20-d254-f5e2f2d9e289"
          ]
        },
        {
          "uuid": "deac78dc-627a-ae0d-8d3c-45d3254cb4d6",
          "code": "DTXSID3020419",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3020419",
          "code_system": "EPA CompTox",
          "references": [
            "a7115ed5-a0b9-5133-54b7-115b072ddff8"
          ]
        },
        {
          "uuid": "e5e81b4d-af74-0ba5-a888-0a3e9e6d2865",
          "code": "9798523",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9798523",
          "code_system": "PUBCHEM",
          "references": [
            "67bd00d7-c3f0-8dc0-937f-ac3e31cfc6f9"
          ]
        },
        {
          "uuid": "cf9d92b9-3564-442e-a6ad-cf80c72d3157",
          "code": "BC9AZH1UZG",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f3368e4b-5070-e980-62bf-f20c9e206317",
          "code": "8786",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=8786",
          "code_system": "NSC",
          "references": [
            "8cef47fe-6c38-c2f7-ed1d-34dc2c417181"
          ]
        },
        {
          "uuid": "67984ccd-f4b3-6cb8-8149-bf13533ed057",
          "code": "300000053306",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "bbbe2439-006e-1f77-4129-827fd6333c8c"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d8c72b82-9268-4592-9280-f8e343562009",
          "name": "ACETIC ACID, 1,1'-(DIBUTYLSTANNYLENE) ESTER",
          "stdName": "ACETIC ACID, 1,1'-(DIBUTYLSTANNYLENE) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6b2f12d-1330-4973-bffb-fe6b35bc8f4c",
            "631b2a6b-706b-4d12-ba1e-62748593aae8"
          ],
          "display_name": false
        },
        {
          "uuid": "5c10fa06-2fda-42ae-bce3-8b907f622a8e",
          "name": "BIS(ACETYLOXY)DIBUTYLSTANNANE",
          "stdName": "BIS(ACETYLOXY)DIBUTYLSTANNANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6b2f12d-1330-4973-bffb-fe6b35bc8f4c",
            "631b2a6b-706b-4d12-ba1e-62748593aae8"
          ],
          "display_name": false
        },
        {
          "uuid": "82688676-43dd-41d1-85b4-98e8977d0c45",
          "name": "DIACETOXYBUTYLTIN",
          "stdName": "DIACETOXYBUTYLTIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6b2f12d-1330-4973-bffb-fe6b35bc8f4c",
            "631b2a6b-706b-4d12-ba1e-62748593aae8"
          ],
          "display_name": false
        },
        {
          "uuid": "86dbd4b6-0a64-4648-8e6e-6c8569f71d53",
          "name": "DIBUTYLSTANNIUM DIACETATE",
          "stdName": "DIBUTYLSTANNIUM DIACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6b2f12d-1330-4973-bffb-fe6b35bc8f4c",
            "631b2a6b-706b-4d12-ba1e-62748593aae8"
          ],
          "display_name": false
        },
        {
          "uuid": "8d1cbe2e-e9e3-4913-a5f7-9cf53d78598d",
          "name": "DIBUTYLTIN ACETATE",
          "stdName": "DIBUTYLTIN ACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "631b2a6b-706b-4d12-ba1e-62748593aae8",
            "48a23844-854d-4017-bd86-5e125b37dd1a"
          ],
          "display_name": false
        },
        {
          "uuid": "d5e5bf2f-3c50-4e16-9b53-5e75fd018f97",
          "name": "DIBUTYLTIN DI(ACETATE)",
          "stdName": "DIBUTYLTIN DI(ACETATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6b2f12d-1330-4973-bffb-fe6b35bc8f4c",
            "631b2a6b-706b-4d12-ba1e-62748593aae8"
          ],
          "display_name": false
        },
        {
          "uuid": "cb876997-089f-4494-a721-0e1f1dc9871f",
          "name": "DIBUTYLTIN DIACETATE",
          "stdName": "DIBUTYLTIN DIACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82bce3eb-3a09-46af-95c2-3d2b85356692",
            "ccb76cb7-1c08-4b47-a415-bfe9b298e9af",
            "5c9ba760-ceec-44db-968f-ad7e3d2ffcbf",
            "631b2a6b-706b-4d12-ba1e-62748593aae8"
          ],
          "display_name": true
        },
        {
          "uuid": "bd050770-a28c-47f6-8c2c-929b20722d36",
          "name": "DIBUTYLTIN DIACETATE [HSDB]",
          "stdName": "DIBUTYLTIN DIACETATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82bce3eb-3a09-46af-95c2-3d2b85356692",
            "631b2a6b-706b-4d12-ba1e-62748593aae8"
          ],
          "display_name": false
        },
        {
          "uuid": "920d04be-5b33-4414-8161-2f7f2e0d82c7",
          "name": "NSC-8786",
          "stdName": "NSC-8786",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6b2f12d-1330-4973-bffb-fe6b35bc8f4c",
            "631b2a6b-706b-4d12-ba1e-62748593aae8"
          ],
          "display_name": false
        },
        {
          "uuid": "1b1c703d-2b73-4e40-9244-50672189bfcb",
          "name": "STANNANE, BIS(ACETYLOXY)DIBUTYL-",
          "stdName": "STANNANE, BIS(ACETYLOXY)DIBUTYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6b2f12d-1330-4973-bffb-fe6b35bc8f4c",
            "631b2a6b-706b-4d12-ba1e-62748593aae8"
          ],
          "display_name": false
        },
        {
          "uuid": "96a58f08-7576-4f79-8938-7d237d70e9b7",
          "name": "STANNANE, DIACETOXYDIBUTYL-",
          "stdName": "STANNANE, DIACETOXYDIBUTYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e6b2f12d-1330-4973-bffb-fe6b35bc8f4c",
            "631b2a6b-706b-4d12-ba1e-62748593aae8"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5c9ba760-ceec-44db-968f-ad7e3d2ffcbf",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "82bce3eb-3a09-46af-95c2-3d2b85356692",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "631b2a6b-706b-4d12-ba1e-62748593aae8",
          "citation": "NLM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6b2f12d-1330-4973-bffb-fe6b35bc8f4c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48a23844-854d-4017-bd86-5e125b37dd1a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e6d8c51-4145-4d1b-b326-9e5cdf4027ff",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390921000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48f1fa96-2286-43d0-9f62-52879de75c54",
          "citation": "SRS import [BC9AZH1UZG]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=BC9AZH1UZG",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390921000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa8b5317-8131-4949-8f2a-5b2a7f79ac73",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ccb76cb7-1c08-4b47-a415-bfe9b298e9af",
          "citation": "DIBUTYLTIN DIACETATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ae7ebde1-8337-0e20-d254-f5e2f2d9e289",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+1067-33-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a7115ed5-a0b9-5133-54b7-115b072ddff8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1067-33-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "67bd00d7-c3f0-8dc0-937f-ac3e31cfc6f9",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "6d70006f-bf87-4335-b3b3-636397df937e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8cef47fe-6c38-c2f7-ed1d-34dc2c417181",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "bbbe2439-006e-1f77-4129-827fd6333c8c",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fcff2eb7-16f5-4cf7-ad73-3cf16229ee96",
          "id": "fcff2eb7-16f5-4cf7-ad73-3cf16229ee96",
          "molfile": "\n  Marvin  01132113062D          \n\n 17 16  0  0  0  0            999 V2000\n    8.5383   -2.8636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8243   -3.2769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8243   -4.1038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1104   -4.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1104   -5.2721    0.0000 Sn  0  0  0  0  0  0  0  0  0  0  0  0\n    6.3195   -5.2721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9385   -4.5427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1124   -4.5427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7312   -3.7770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1104   -5.9910    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3964   -6.4043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3964   -7.2311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6826   -5.9910    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8294   -5.2721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2427   -5.9860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0651   -5.9860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8294   -6.6999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  1  0  0  0  0\n  5 14  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\nM  END",
          "smiles": "CCCC[Sn](CCCC)(OC(=O)C)OC(=O)C",
          "formula": "C12H24O4Sn",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d184e881-d8e2-4f05-a839-1f296e6b8abe"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "351.0271",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "17214658-b856-4fc2-bb75-be53bf727a39",
      "version": "7",
      "structure": {
        "id": "98ff2280-283d-44c6-b75f-d3087f06095b",
        "molfile": "\n  Marvin  01132107572D          \n\n 17 16  0  0  0  0            999 V2000\n    6.3195   -5.2721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1104   -5.2721    0.0000 Sn  0  0  0  0  0  0  0  0  0  0  0  0\n    7.1104   -4.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8243   -4.1038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8243   -3.2769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5383   -2.8636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1104   -5.9910    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3964   -6.4043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3964   -7.2311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6826   -5.9910    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8294   -5.2721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2427   -5.9860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0651   -5.9860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8294   -6.6999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9385   -4.5427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1124   -4.5427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7312   -3.7770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n  2 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n  1 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
        "smiles": "CCCC[Sn](CCCC)(OC(=O)C)OC(=O)C",
        "formula": "C12H24O4Sn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "351.0271",
        "optical_activity": "NONE",
        "references": [
          "aa8b5317-8131-4949-8f2a-5b2a7f79ac73",
          "48f1fa96-2286-43d0-9f62-52879de75c54"
        ],
        "stereo_centers": 0
      },
      "unii": "BC9AZH1UZG"
    }
  ]
}