{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b208bfff-50a4-47b4-8b28-7eb0d50a4f72",
          "code": "129541-36-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=129541-36-2",
          "code_system": "CAS",
          "references": [
            "52aa1aa7-dc79-44af-a7aa-0f0a549cc36b",
            "6a947946-8ee0-4d69-acc1-9177a4bfe1e6"
          ]
        },
        {
          "uuid": "336b5436-ee5e-4e9e-9e3a-61c4a4df4835",
          "code": "131635401",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/131635401",
          "code_system": "PUBCHEM",
          "references": [
            "52aa1aa7-dc79-44af-a7aa-0f0a549cc36b"
          ]
        },
        {
          "uuid": "cc4f3b18-2f2e-4d8f-a2f2-b8e3225149d1",
          "code": "B9M5HHR5V0",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3c10a31b-d068-4bb5-97e4-5438a46ba606",
          "name": "D-GLUCONIC ACID, COMPD. WITH N-(3-(DIMETHYLAMINO)PROPYL)ISOOCTADECANAMIDE (1:1)",
          "stdName": "D-GLUCONIC ACID, COMPD. WITH N-(3-(DIMETHYLAMINO)PROPYL)ISOOCTADECANAMIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac64ef10-124d-4800-8f9e-d52057c3f0ef",
            "96c951c2-ea19-4d06-8505-ab6b3e5e260c"
          ],
          "display_name": false
        },
        {
          "uuid": "af205a28-0bf7-48cf-8016-f1584c5c88d1",
          "name": "ISOOCTADECANAMIDE, N-(3-(DIMETHYLAMINO)PROPYL)-, MONO-D-GLUCONATE",
          "stdName": "ISOOCTADECANAMIDE, N-(3-(DIMETHYLAMINO)PROPYL)-, MONO-D-GLUCONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac64ef10-124d-4800-8f9e-d52057c3f0ef",
            "96c951c2-ea19-4d06-8505-ab6b3e5e260c"
          ],
          "display_name": false
        },
        {
          "uuid": "af0858b1-63a0-4dc0-badf-1648a22cf335",
          "name": "ISOSTEARAMIDOPROPYL DIMETHYLAMINE GLUCONATE",
          "stdName": "ISOSTEARAMIDOPROPYL DIMETHYLAMINE GLUCONATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b8e2938-adc4-4f39-95aa-75fddc9dc2fb",
            "ac64ef10-124d-4800-8f9e-d52057c3f0ef",
            "445011e4-d0d1-4c79-8c33-f60adb8dc4bb"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "033307ec-c1a3-4907-9012-5774b75343b5",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "2b8e2938-adc4-4f39-95aa-75fddc9dc2fb",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ac64ef10-124d-4800-8f9e-d52057c3f0ef",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96c951c2-ea19-4d06-8505-ab6b3e5e260c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52aa1aa7-dc79-44af-a7aa-0f0a549cc36b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393334000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "da4f619c-7429-4bbb-a3be-07c785e13a49",
          "citation": "SRS import [B9M5HHR5V0]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=B9M5HHR5V0",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393334000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "445011e4-d0d1-4c79-8c33-f60adb8dc4bb",
          "citation": "ISOSTEARAMIDOPROPYL DIMETHYLAMINE GLUCONATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6a947946-8ee0-4d69-acc1-9177a4bfe1e6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bdc5448d-a2a7-48ce-878f-b5c8dc81a43b",
          "id": "bdc5448d-a2a7-48ce-878f-b5c8dc81a43b",
          "molfile": "\n  Marvin  01132109492D          \n\n 13 12  0  0  1  0            999 V2000\n   20.7867   -7.4006    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   20.7867   -6.5756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0722   -7.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3577   -7.4006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.5011   -7.8131    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   21.5011   -8.6380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.2156   -7.4006    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   22.2156   -6.5756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.9300   -7.8131    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   22.9300   -8.6380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.6445   -7.4006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.3589   -7.8131    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.6445   -6.5756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  6  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  6  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  6  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\nM  END",
          "smiles": "C([C@H]([C@H]([C@@H]([C@H](C(=O)O)O)O)O)O)O",
          "formula": "C6H12O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "57ec3104-c8ac-4c94-84e2-de7da780c6e5"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "196.1555",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        },
        {
          "uuid": "dbb8186e-3fb8-46f6-ba0b-5e3ea134bc1d",
          "id": "dbb8186e-3fb8-46f6-ba0b-5e3ea134bc1d",
          "molfile": "\n  Marvin  01132111242D          \n\n 26 25  0  0  1  0            999 V2000\n    0.8753   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5898   -7.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5898   -8.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3042   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0187   -7.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7331   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4476   -7.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1621   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8765   -7.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5910   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3054   -7.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0198   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7342   -7.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4487   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1632   -7.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8776   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5921   -7.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3065   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3065   -6.0341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0210   -7.2716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7354   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4499   -7.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1643   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8787   -7.2716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8787   -8.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5932   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CCCCCCCCCCCCCCC(=O)NCCCN(C)C",
          "formula": "C23H48N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a5daaa24-723c-441c-9c16-80c771675e3c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "368.6409",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "REPRESENTATIVE",
      "uuid": "167e694e-1c0b-42ad-b0c1-14a49f4c1106",
      "version": "4",
      "structure": {
        "id": "d4dd04eb-4887-410e-9483-9040d43aaf50",
        "molfile": "\n  Marvin  01132111022D          \n\n 39 37  0  0  1  0            999 V2000\n   23.6445   -7.4006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.3589   -7.8131    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.6445   -6.5756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.9300   -7.8131    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   22.2156   -7.4006    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   21.5011   -7.8131    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   20.7867   -7.4006    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   20.0722   -7.8131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3577   -7.4006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.7867   -6.5756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.5011   -8.6380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.2156   -6.5756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.9300   -8.6380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3065   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0210   -7.2716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7354   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4499   -7.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1643   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8787   -7.2716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8787   -8.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5932   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3065   -6.0341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5921   -7.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8776   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1632   -7.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4487   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7342   -7.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0198   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3054   -7.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5910   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8765   -7.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1621   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4476   -7.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7331   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0187   -7.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3042   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5898   -7.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8753   -6.8590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5898   -8.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  1  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  7 10  1  1  0  0  0\n  6 11  1  6  0  0  0\n  5 12  1  6  0  0  0\n  4 13  1  6  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 14 22  2  0  0  0  0\n 14 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  1  0  0  0  0\n 31 32  1  0  0  0  0\n 32 33  1  0  0  0  0\n 33 34  1  0  0  0  0\n 34 35  1  0  0  0  0\n 35 36  1  0  0  0  0\n 36 37  1  0  0  0  0\n 38 37  1  0  0  0  0\n 37 39  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CCCCCCCCCCCCCCC(=O)NCCCN(C)C.C([C@H]([C@H]([C@@H]([C@H](C(=O)O)O)O)O)O)O",
        "formula": "C23H48N2O.C6H12O7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "564.7964",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "da4f619c-7429-4bbb-a3be-07c785e13a49",
          "96c951c2-ea19-4d06-8505-ab6b3e5e260c"
        ],
        "stereo_centers": 4
      },
      "unii": "B9M5HHR5V0"
    }
  ]
}