{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1bd48ed3-0cb5-40d6-b3cb-a8515a3657cb",
          "code": "91-76-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=91-76-9",
          "code_system": "CAS",
          "references": [
            "0bc32c44-133d-4931-854b-61aa9575a38b",
            "a178a838-a732-405e-a74b-669fdccba53e"
          ]
        },
        {
          "uuid": "01b0e88c-68b2-45a5-bffc-63c00673faf4",
          "code": "C523939",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67523939",
          "code_system": "MESH",
          "references": [
            "0bc32c44-133d-4931-854b-61aa9575a38b"
          ]
        },
        {
          "uuid": "61953e10-733a-4740-9e00-d709badfb404",
          "code": "202-095-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.905",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0bc32c44-133d-4931-854b-61aa9575a38b"
          ]
        },
        {
          "uuid": "51e76cd3-c84a-4d6e-ab94-f7ec1470edab",
          "code": "m2361",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2361?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "0bc32c44-133d-4931-854b-61aa9575a38b"
          ]
        },
        {
          "uuid": "a34494b8-22af-49b4-9b62-ec899120c1de",
          "code": "7064",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7064",
          "code_system": "PUBCHEM",
          "references": [
            "0bc32c44-133d-4931-854b-61aa9575a38b"
          ]
        },
        {
          "uuid": "f5f7fd82-1e09-be70-44bc-721936f027dc",
          "code": "5275",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5275",
          "code_system": "HSDB",
          "references": [
            "5cf3bfca-c2f4-b975-69aa-4ea9c5501c67"
          ]
        },
        {
          "uuid": "a7ba5909-70d4-08bb-111e-6e665c9897db",
          "code": "DTXSID1020142",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1020142",
          "code_system": "EPA CompTox",
          "references": [
            "ebbc19e6-cfcb-a817-81d7-4706cc4b0f14"
          ]
        },
        {
          "uuid": "b860728b-f702-4498-a430-1d90ad632145",
          "code": "B9E2Q3VTUB",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c72dcdea-9fe7-cea4-751e-0532d9622e32",
          "code": "Benzoguanamine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Benzoguanamine",
          "code_system": "WIKIPEDIA",
          "references": [
            "3d21a727-3e3b-367c-fecb-6cd55cc82294"
          ]
        },
        {
          "uuid": "6fcf84f5-e13a-8049-c55b-f0c0da236219",
          "code": "3267",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=3267",
          "code_system": "NSC",
          "references": [
            "4bed8fa4-e586-30cc-c831-488145190262"
          ]
        },
        {
          "uuid": "9e77d116-8083-1553-ceb8-213d7942fcbd",
          "code": "300000053175",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b89e1cdd-7dca-fec1-9dff-5873d371223e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c7fb2614-090a-4f67-be07-c8632779e153",
          "name": "2,4-DIAMINO-6-PHENYL-1,3,5-TRIAZINE [HSDB]",
          "stdName": "2,4-DIAMINO-6-PHENYL-1,3,5-TRIAZINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "867007c8-ff9a-4089-9d02-3489de0e0078",
            "0b9a23e4-b484-4db0-9d2f-a66bc97f693b"
          ],
          "display_name": false
        },
        {
          "uuid": "cabee3ae-72dd-4d18-b962-39893375d1fb",
          "name": "6-PHENYL-1,3,5-TRIAZINE-2,4-DIAMINE",
          "stdName": "6-PHENYL-1,3,5-TRIAZINE-2,4-DIAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6922c142-87c7-49cd-8fd2-e0dc4ffde72c",
            "867007c8-ff9a-4089-9d02-3489de0e0078"
          ],
          "display_name": false
        },
        {
          "uuid": "90c16396-5d58-45ca-b9cb-2a7b0506b2d8",
          "name": "BENZOGUANAMINE",
          "stdName": "BENZOGUANAMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03ffcb5b-bc82-4c57-adff-f274e76af71f",
            "d568e7c7-a0fd-495c-95bd-3aabd75baae4",
            "6922c142-87c7-49cd-8fd2-e0dc4ffde72c",
            "867007c8-ff9a-4089-9d02-3489de0e0078",
            "9f41b261-a598-4379-b336-94a3fd0f2899",
            "7e71d61a-b25b-4207-90cb-0b40c48f6226"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "fc2e1b16-e032-43c1-85f9-17d551962d20",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "6dadba1a-8080-4b9b-bcb4-d681e4b052b1",
          "name": "BENZOGUANAMINE [MI]",
          "stdName": "BENZOGUANAMINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "867007c8-ff9a-4089-9d02-3489de0e0078",
            "9f41b261-a598-4379-b336-94a3fd0f2899"
          ],
          "display_name": false
        },
        {
          "uuid": "09b918f3-71d8-444c-bfe1-57f540587835",
          "name": "NSC-3267",
          "stdName": "NSC-3267",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a9cfbf3-3ae5-4d79-ad82-d4e26871ea54",
            "867007c8-ff9a-4089-9d02-3489de0e0078"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6922c142-87c7-49cd-8fd2-e0dc4ffde72c",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "867007c8-ff9a-4089-9d02-3489de0e0078",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f41b261-a598-4379-b336-94a3fd0f2899",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e71d61a-b25b-4207-90cb-0b40c48f6226",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b9a23e4-b484-4db0-9d2f-a66bc97f693b",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a9cfbf3-3ae5-4d79-ad82-d4e26871ea54",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0bc32c44-133d-4931-854b-61aa9575a38b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389722000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59553619-fe73-40bf-866e-2baf3be4a318",
          "citation": "SRS import [B9E2Q3VTUB]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=B9E2Q3VTUB",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389722000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "120663a3-e428-499f-905f-64c01158b84c",
          "citation": "http://www.wegochem.com/en/products/plastics-resins-rubber/44/",
          "url": "http://www.wegochem.com/en/products/plastics-resins-rubber/44/",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "03ffcb5b-bc82-4c57-adff-f274e76af71f",
          "citation": "BENZOGUANAMINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d568e7c7-a0fd-495c-95bd-3aabd75baae4",
          "citation": "BENZOGUANAMINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5cf3bfca-c2f4-b975-69aa-4ea9c5501c67",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+91-76-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ebbc19e6-cfcb-a817-81d7-4706cc4b0f14",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=91-76-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3d21a727-3e3b-367c-fecb-6cd55cc82294",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "a178a838-a732-405e-a74b-669fdccba53e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4bed8fa4-e586-30cc-c831-488145190262",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b89e1cdd-7dca-fec1-9dff-5873d371223e",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3e9218c4-4e63-4c0d-8386-7b52fa4263fc",
          "id": "3e9218c4-4e63-4c0d-8386-7b52fa4263fc",
          "molfile": "\n  Marvin  01132103192D          \n\n 14 15  0  0  0  0            999 V2000\n    4.2727   -1.2718    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5481   -1.6829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5481   -2.5076    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8596   -2.9161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8596   -3.7178    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1607   -2.5076    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1607   -1.6829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8596   -1.2975    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4362   -1.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7194   -1.6443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.4085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7194    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4362   -0.4085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  8  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 14  9  2  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 13 14  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)-c2nc(N)nc(N)n2",
          "formula": "C9H9N5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6c619fbf-7b53-46fc-9f0a-fee3ff22f030"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "187.2016",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f8d96378-f72b-42a8-8713-30cfbbd74fb5",
      "version": "9",
      "structure": {
        "id": "089baecc-3933-468e-8537-6298c57dbf2b",
        "molfile": "\n  Marvin  01132100432D          \n\n 14 15  0  0  0  0            999 V2000\n    2.8596   -1.2975    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1607   -2.5076    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1607   -1.6829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5481   -2.5076    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5481   -1.6829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8596   -2.9161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4362   -1.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2727   -1.2718    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8596   -3.7178    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4362   -0.4085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7194   -1.6443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7194    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.4085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  4  2  0  0  0  0\n  7  3  1  0  0  0  0\n  8  5  1  0  0  0  0\n  9  6  1  0  0  0  0\n 10  7  2  0  0  0  0\n 11  7  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 10  1  0  0  0  0\n 14 12  1  0  0  0  0\n  2  6  1  0  0  0  0\n 13 14  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)-c2nc(N)nc(N)n2",
        "formula": "C9H9N5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "187.2016",
        "optical_activity": "NONE",
        "references": [
          "59553619-fe73-40bf-866e-2baf3be4a318",
          "120663a3-e428-499f-905f-64c01158b84c"
        ],
        "stereo_centers": 0
      },
      "unii": "B9E2Q3VTUB"
    }
  ]
}